Daunorubicin
(GUGHGUXZJWAIAS-QQYBVWGSSA-N)
Structure
- SMILES
- COc1cccc2c1C(=O)c1c(C2=O)c(O)c2c(c1O)[C@@H](O[C@H]1C[C@H](N)[C@@H]([C@@H](O1)C)O)C[C@](C2)(O)C(=O)C.Cl
- Molecular Formula:
- C27H30ClNO10
- Molecular Weight:
- 563.981
- Log P:
- 2.5312
- Hydrogen Bond Acceptor:
- 11
- Hydrogen Bond Donor:
- 6
- TPSA:
- 185.84
- CAS Number(s):
- 23541-50-6
Synonym(s)
1.
Daunorubicin
2.
Daunomycin
3.
Rubidomycin
4.
Rubomycin
5.
Cerubidine
6.
Dauno-Rubidomycine
7.
Daunoblastin
8.
Daunoblastine
9.
Daunorubicin Hydrochloride
10.
NSC-82151
11.
Dauno Rubidomycine
12.
Hydrochloride, Daunorubicin
13.
NSC 82151
14.
NSC82151
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Febrile Neutropenia | FAERS: 29 | US FAERS | |
| 2 | Hypotension | FAERS: 19 | US FAERS | |
| 3 | Infection | FAERS: 17 | US FAERS | |
| 4 | Dehydration | FAERS: 9 | US FAERS | |
| 5 | Sepsis | FAERS: 9 | US FAERS | |
| 6 | Stomatitis | FAERS: 9 | US FAERS | |
| 7 | Neutropenia | FAERS: 8 | US FAERS | |
| 8 | Abdominal Pain | FAERS: 7 | US FAERS | |
| 9 | Catheter related infection | FAERS: 7 | US FAERS | |
| 10 | Fatigue | FAERS: 7 | US FAERS | |
| 11 | Hypoxia | FAERS: 7 | US FAERS | |
| 12 | Nausea | FAERS: 7 | US FAERS | |
| 13 | Pneumonitis | FAERS: 7 | US FAERS | |
| 14 | Weight decreased | FAERS: 7 | US FAERS | |
| 15 | Anorexia | FAERS: 6 | US FAERS | |
| 16 | Thrombocytopenia | FAERS: 6 | US FAERS | |
| 17 | White blood cell count decreased | FAERS: 6 | US FAERS | |
| 18 | Colitis | FAERS: 5 | US FAERS | |
| 19 | Delirium | FAERS: 5 | US FAERS | |
| 20 | Ejection Fraction Decreased | FAERS: 5 | US FAERS | |
| 21 | Atrial Fibrillation | FAERS: 4 | US FAERS | |
| 22 | Respiratory Failure | FAERS: 4 | US FAERS | |
| 23 | Respiratory distress | FAERS: 4 | US FAERS | |
| 24 | Septic Shock | FAERS: 4 | US FAERS | |
| 25 | Asthenia | FAERS: 3 | US FAERS | |
| 26 | Ataxia | FAERS: 3 | US FAERS | |
| 27 | Cardiac Arrest | FAERS: 3 | US FAERS | |
| 28 | Chills | FAERS: 3 | US FAERS | |
| 29 | Enterococcal infection | FAERS: 3 | US FAERS | |
| 30 | Headache | FAERS: 3 | US FAERS | |
| 31 | Hypophagia | FAERS: 3 | US FAERS | |
| 32 | Medication Error | FAERS: 3 | US FAERS | |
| 33 | Neutropenic sepsis | FAERS: 3 | US FAERS | |
| 34 | Neutrophil count decreased | FAERS: 3 | US FAERS | |
| 35 | Pancytopenia | FAERS: 3 | US FAERS | |
| 36 | Pneumonia | FAERS: 3 | US FAERS | |
| 37 | Sinus bradycardia | FAERS: 3 | US FAERS | |
| 38 | Vomiting | FAERS: 3 | US FAERS | |
| 39 | Arthralgia | FAERS: 2 | US FAERS | |
| 40 | Back Pain | FAERS: 2 | US FAERS | |
| 41 | Catheter site phlebitis | FAERS: 2 | US FAERS | |
| 42 | Central nervous system lesion | FAERS: 2 | US FAERS | |
| 43 | Clostridium colitis | FAERS: 2 | US FAERS | |
| 44 | Depressed Level of Consciousness | FAERS: 2 | US FAERS | |
| 45 | Disease Progression | FAERS: 2 | US FAERS | |
| 46 | Dizziness | FAERS: 2 | US FAERS | |
| 47 | Dysuria | FAERS: 2 | US FAERS | |
| 48 | Epistaxis | FAERS: 2 | US FAERS | |
| 49 | Expired drug administered | FAERS: 2 | US FAERS | |
| 50 | Infarction | FAERS: 2 | US FAERS | |
| 51 | Leukaemic infiltration brain | FAERS: 2 | US FAERS | |
| 52 | Mental disorder due to a general medical condition | FAERS: 2 | US FAERS | |
| 53 | Mental status changes | FAERS: 2 | US FAERS | |
| 54 | Myocardial Infarction | FAERS: 2 | US FAERS | |
| 55 | Pain | FAERS: 2 | US FAERS | |
| 56 | Petechiae | FAERS: 2 | US FAERS | |
| 57 | Pruritus | FAERS: 2 | US FAERS | |
| 58 | Pulmonary Embolism | FAERS: 2 | US FAERS | |
| 59 | Staphylococcus test positive | FAERS: 2 | US FAERS | |
| 60 | Troponin increased | FAERS: 2 | US FAERS | |
| 61 | Urinary Incontinence | FAERS: 2 | US FAERS | |
| 62 | Acidosis | FAERS: 1 | US FAERS | |
| 63 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 64 | Alanine Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 65 | Alkalosis | FAERS: 1 | US FAERS | |
| 66 | Anaphylactoid Reaction | FAERS: 1 | US FAERS | |
| 67 | Anxiety | FAERS: 1 | US FAERS | |
| 68 | Appendicitis | FAERS: 1 | US FAERS | |
| 69 | Aspartate Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 70 | Aspergillosis | FAERS: 1 | US FAERS | |
| 71 | Blindness | FAERS: 1 | US FAERS | |
| 72 | Blood albumin decreased | FAERS: 1 | US FAERS | |
| 73 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 74 | Blood potassium increased | FAERS: 1 | US FAERS | |
| 75 | Cardiomegaly | FAERS: 1 | US FAERS | |
| 76 | Cardiovascular insufficiency | FAERS: 1 | US FAERS | |
| 77 | Cellulitis | FAERS: 1 | US FAERS | |
| 78 | Chest discomfort | FAERS: 1 | US FAERS | |
| 79 | Chest wall pain | FAERS: 1 | US FAERS | |
| 80 | Cholecystitis | FAERS: 1 | US FAERS | |
| 81 | Coma scale abnormal | FAERS: 1 | US FAERS | |
| 82 | Complications of transplant surgery | FAERS: 1 | US FAERS | |
| 83 | Cytolytic hepatitis | FAERS: 1 | US FAERS | |
| 84 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 85 | Duodenal ulcer perforation | FAERS: 1 | US FAERS | |
| 86 | Dysphasia | FAERS: 1 | US FAERS | |
| 87 | Enterocolitis | FAERS: 1 | US FAERS | |
| 88 | Epstein-Barr virus associated lymphoproliferative disorder | FAERS: 1 | US FAERS | |
| 89 | Extravasation | FAERS: 1 | US FAERS | |
| 90 | Facial Paresis | FAERS: 1 | US FAERS | |
| 91 | Feeling jittery | FAERS: 1 | US FAERS | |
| 92 | Gamma-Glutamyltransferase Increased | FAERS: 1 | US FAERS | |
| 93 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 94 | Ileus | FAERS: 1 | US FAERS | |
| 95 | Immunosuppression | FAERS: 1 | US FAERS | |
| 96 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 97 | Intervertebral disc disorder | FAERS: 1 | US FAERS | |
| 98 | Klebsiella test positive | FAERS: 1 | US FAERS | |
| 99 | Lethargy | FAERS: 1 | US FAERS | |
| 100 | Leukoencephalopathy | FAERS: 1 | US FAERS | |
| 101 | Malignant melanoma in situ | FAERS: 1 | US FAERS | |
| 102 | Meningeal disorder | FAERS: 1 | US FAERS | |
| 103 | Meningism | FAERS: 1 | US FAERS | |
| 104 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 105 | Moaning | FAERS: 1 | US FAERS | |
| 106 | Mucosal Infection | FAERS: 1 | US FAERS | |
| 107 | Mutism | FAERS: 1 | US FAERS | |
| 108 | Myalgia | FAERS: 1 | US FAERS | |
| 109 | Neuropathy | FAERS: 1 | US FAERS | |
| 110 | Neutropenic colitis | FAERS: 1 | US FAERS | |
| 111 | Palpitations | FAERS: 1 | US FAERS | |
| 112 | Pancreatitis | FAERS: 1 | US FAERS | |
| 113 | Peritonitis | FAERS: 1 | US FAERS | |
| 114 | Phlebitis | FAERS: 1 | US FAERS | |
| 115 | Presyncope | FAERS: 1 | US FAERS | |
| 116 | Renal tubular necrosis | FAERS: 1 | US FAERS | |
| 117 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 118 | Ruptured cerebral aneurysm | FAERS: 1 | US FAERS | |
| 119 | Sinusitis | FAERS: 1 | US FAERS | |
| 120 | Tardive Dyskinesia | FAERS: 1 | US FAERS | |
| 121 | Tremor | FAERS: 1 | US FAERS | |
| 122 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 123 | VIIth nerve paralysis | FAERS: 1 | US FAERS | |
| 124 | Vasculitis | FAERS: 1 | US FAERS | |
| 125 | Ventricular Dysfunction | FAERS: 1 | US FAERS | |
| 126 | Ventricular failure | FAERS: 1 | US FAERS | |
| 127 | Visual Impairment | FAERS: 1 | US FAERS | |
| 128 | Wound Infection | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.