Fluorescein
(GNBHRKFJIUUOQI-UHFFFAOYSA-N)
Structure
- SMILES
- Oc1ccc2c(c1)Oc1c(C32OC(=O)c2c3cccc2)ccc(c1)O
- Type(s)
- Approved
- ATC code(s)
- S01JA01; S01JA51
- Molecular Formula:
- C20H12O5
- Molecular Weight:
- 332.306
- Log P:
- 3.6658
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 2
- TPSA:
- 75.99
- CAS Number(s):
- 2321-07-5; 153954
Synonym(s)
1.
Fluorescein
2.
Fluorescein Sodium
3.
Sodium Fluorescein
4.
C.I. 45350
5.
Colircusi Fluoresceina
6.
D & C Yellow No. 7
7.
D & C Yellow No. 8
8.
D and C Yellow No. 7
9.
D and C Yellow No. 8
10.
D&C Yellow No. 7
11.
D&C Yellow No. 8
12.
Diofluor
13.
Disodium Fluorescein
14.
Fluor-I-Strip A.T.
15.
Fluorescein Dipotassium Salt
16.
Fluorescein Disodium Salt
17.
Fluorescein Monosodium Salt
18.
Fluorescite
19.
Fluorescéine sodique Faure
20.
Fluorets
21.
Ful-Glo
22.
Funduscein
23.
Minims Fluorescein Sodium
24.
Minims Fluoresceine
25.
Minims Stains
26.
Optifluor Diba
27.
Uranine
28.
Dipotassium Salt, Fluorescein
29.
Disodium Salt, Fluorescein
30.
Fluor I Strip A.T.
31.
Fluorescein Sodium, Minims
32.
Fluorescein, Disodium
33.
Fluorescein, Sodium
34.
Fluoresceina, Colircusi
35.
Fluoresceine, Minims
36.
Ful Glo
37.
Monosodium Salt, Fluorescein
38.
Sodium, Fluorescein
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Pruritus | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 2 | Urticaria | FAERS: 6 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 3 | Dizziness | FAERS: 5 Canada Vigilance: 3 | 2944349 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 4 | Nausea | FAERS: 4 Canada Vigilance: 6 | 2944349 16451256 20002025 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 5 | Anaphylactic shock | FAERS: 3 | SIDER US FAERS | |
| 6 | Chest discomfort | FAERS: 3 | US FAERS | |
| 7 | Hypotension | FAERS: 3 Canada Vigilance: 1 | 20002025 | CTD SIDER Canada Vigilance US FAERS |
| 8 | Malaise | FAERS: 3 | SIDER US FAERS | |
| 9 | Syncope | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 10 | Asthenia | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 11 | Burning sensation | FAERS: 2 | US FAERS | |
| 12 | Contrast media reaction | FAERS: 2 | US FAERS | |
| 13 | Throat irritation | FAERS: 2 | US FAERS | |
| 14 | Vomiting | FAERS: 2 Canada Vigilance: 1 | 2944349 16451256 20002025 | CTD SIDER Canada Vigilance US FAERS |
| 15 | Angina Pectoris | FAERS: 1 | SIDER US FAERS | |
| 16 | Angioedema | FAERS: 1 | US FAERS | |
| 17 | Anxiety | FAERS: 1 | US FAERS | |
| 18 | Back Pain | FAERS: 1 | US FAERS | |
| 19 | Blood creatinine increased | FAERS: 1 | US FAERS | |
| 20 | Cardiac Arrest | FAERS: 1 | SIDER US FAERS | |
| 21 | Chest Pain | FAERS: 1 | 2944349 | CTD OFFSIDES SIDER US FAERS |
| 22 | Chills | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 23 | Choking | FAERS: 1 | US FAERS | |
| 24 | Chromaturia | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 25 | Consciousness fluctuating | FAERS: 1 | US FAERS | |
| 26 | Discomfort | FAERS: 1 | SIDER US FAERS | |
| 27 | Headache | FAERS: 1 | 14755201 | CTD SIDER US FAERS |
| 28 | Hypersensitivity | FAERS: 1 | SIDER US FAERS | |
| 29 | Immediate post-injection reaction | FAERS: 1 | OFFSIDES US FAERS | |
| 30 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 31 | Lethargy | FAERS: 1 | OFFSIDES US FAERS | |
| 32 | Lymphocytic infiltration | FAERS: 1 | US FAERS | |
| 33 | Mental status changes | FAERS: 1 | US FAERS | |
| 34 | Nystagmus | FAERS: 1 | US FAERS | |
| 35 | Overdose | FAERS: 1 | US FAERS | |
| 36 | Post procedural complication | FAERS: 1 | US FAERS | |
| 37 | Presyncope | FAERS: 1 | US FAERS | |
| 38 | Renal tubular disorder | FAERS: 1 | US FAERS | |
| 39 | Respiratory Depression | FAERS: 1 | US FAERS | |
| 40 | Respiratory arrest | FAERS: 1 | SIDER US FAERS | |
| 41 | Retching | FAERS: 1 | SIDER US FAERS | |
| 42 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 43 | Unresponsive to stimuli | FAERS: 1 | OFFSIDES US FAERS | |
| 44 | Wheezing | FAERS: 1 | US FAERS | |
| 45 | Abdominal Pain | SIDER | ||
| 46 | Abdominal discomfort | SIDER | ||
| 47 | Abnormal vision | OFFSIDES | ||
| 48 | Ache | SIDER | ||
| 49 | Acute myocardial infarction | OFFSIDES SIDER | ||
| 50 | Amnesia | 16055987 | CTD | |
| 51 | Anaphylactoid Reaction | SIDER | ||
| 52 | Anemia, Hemolytic | 8342239 | CTD | |
| 53 | Anisometropia | OFFSIDES | ||
| 54 | Anorexia | OFFSIDES | ||
| 55 | Aphasia | SIDER | ||
| 56 | Asthma | SIDER | ||
| 57 | Automatism | OFFSIDES | ||
| 58 | Blood Glucose | OFFSIDES | ||
| 59 | Blood cholesterol | OFFSIDES | ||
| 60 | Blood glucose decreased | OFFSIDES | ||
| 61 | Blurred vision | OFFSIDES | ||
| 62 | Bradycardia | OFFSIDES SIDER | ||
| 63 | Bronchospasm | SIDER | ||
| 64 | Bulbar palsy | OFFSIDES | ||
| 65 | Cataract | OFFSIDES | ||
| 66 | Central nervous system lesion | OFFSIDES | ||
| 67 | Cerebellar infarction | OFFSIDES | ||
| 68 | Cerebrovascular accident | SIDER | ||
| 69 | Choking sensation | OFFSIDES | ||
| 70 | Cholangiolitis | OFFSIDES | ||
| 71 | Cold sweat | OFFSIDES SIDER | ||
| 72 | Crying | OFFSIDES | ||
| 73 | Dermatitis, Phototoxic | 9152079 | CTD | |
| 74 | Dermatitis | SIDER | ||
| 75 | Diabetic Retinopathy | SIDER | ||
| 76 | Diplopia | OFFSIDES | ||
| 77 | Distress gastrointestinal | SIDER | ||
| 78 | Drowsiness | OFFSIDES | ||
| 79 | Dysgeusia | SIDER | ||
| 80 | Dysphasia | SIDER | ||
| 81 | Dyspnea | 2944349 | CTD | |
| 82 | Eczema | SIDER | ||
| 83 | Erythema | 20002025 | CTD SIDER | |
| 84 | Exanthema | 20002025 | CTD | |
| 85 | Extravasation | SIDER | ||
| 86 | Fatigue | OFFSIDES | ||
| 87 | Feeling abnormal | SIDER | ||
| 88 | Flushing | Canada Vigilance: 1 | Canada Vigilance | |
| 89 | Gastrointestinal Pain | SIDER | ||
| 90 | Hypoventilation | SIDER | ||
| 91 | Hypoxia | SIDER | ||
| 92 | Incontinence | OFFSIDES | ||
| 93 | Increased bronchial secretion | OFFSIDES | ||
| 94 | Infusion site pain | OFFSIDES | ||
| 95 | Injection site thrombosis | SIDER | ||
| 96 | Intention tremor | OFFSIDES | ||
| 97 | Intermittent Claudication | SIDER | ||
| 98 | Intracranial Hypotension | OFFSIDES | ||
| 99 | Keratitis sicca | OFFSIDES | ||
| 100 | Macular degeneration | SIDER | ||
| 101 | Metamorphopsia | OFFSIDES | ||
| 102 | Musculoskeletal stiffness | Canada Vigilance: 1 | Canada Vigilance | |
| 103 | Myocardial Infarction | CTD | ||
| 104 | Neurological examination abnormal | OFFSIDES | ||
| 105 | Neurotoxicity Syndromes | 265392 | CTD | |
| 106 | Obstruction | SIDER | ||
| 107 | Pain | 20002025 | CTD SIDER | |
| 108 | Pallor | Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER | |
| 109 | Phlebitis | 843017 | CTD | |
| 110 | Pleocytosis | OFFSIDES | ||
| 111 | Raynaud Disease | 17608774 | CTD | |
| 112 | Rectal tenesmus | OFFSIDES | ||
| 113 | Respiratory Failure | SIDER | ||
| 114 | Retinal exudates | OFFSIDES | ||
| 115 | Retinal pigment epithelial tear | OFFSIDES | ||
| 116 | Retinal pigment epitheliopathy | OFFSIDES | ||
| 117 | Ruptured cerebral aneurysm | OFFSIDES | ||
| 118 | Seizures | CTD | ||
| 119 | Shock | SIDER | ||
| 120 | Skeletal injury | OFFSIDES | ||
| 121 | Skin Abnormalities | 2944349 | CTD | |
| 122 | Skin test positive | Canada Vigilance: 1 | Canada Vigilance | |
| 123 | Sneezing | SIDER | ||
| 124 | Status Epilepticus | 18635493 | CTD OFFSIDES | |
| 125 | Stevens-Johnson Syndrome | OFFSIDES | ||
| 126 | Subretinal fibrosis | OFFSIDES | ||
| 127 | Tachycardia | Canada Vigilance: 1 | Canada Vigilance SIDER | |
| 128 | Thrombophlebitis injection site | SIDER | ||
| 129 | Thrombophlebitis | Canada Vigilance: 1 | Canada Vigilance SIDER | |
| 130 | Tremor | Canada Vigilance: 2 | Canada Vigilance SIDER | |
| 131 | Vasculitis | Canada Vigilance: 1 | Canada Vigilance | |
| 132 | Vasodilation procedure | SIDER | ||
| 133 | Vasodilation | SIDER | ||
| 134 | Vasospasm | SIDER | ||
| 135 | Venous Injury | OFFSIDES | ||
| 136 | Venous Thrombosis | 15860310 | CTD | |
| 137 | Vertebrobasilar Insufficiency | SIDER | ||
| 138 | jaundice | Canada Vigilance: 1 | Canada Vigilance | |
| 139 | nervous system disorder | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.