QVA149
(GCUZFFAPBPDIFM-IKXQUJFKSA-M)
Structure
- SMILES
- O=C(C(c1ccccc1)(C1CCCC1)O)OC1CC[N+](C1)(C)C.CCc1cc2CC(Cc2cc1CC)NC[C@@H](c1ccc(c2c1ccc(=O)[nH]2)O)O.[Br-]
- Molecular Formula:
- C43H56BrN3O6
- Molecular Weight:
- 790.825
- Log P:
- 2.9589
- Hydrogen Bond Acceptor:
- 7
- Hydrogen Bond Donor:
- 5
- TPSA:
- 131.88
- CAS Number(s):
- 1262431-94-6
Synonym(s)
1.
QVA149
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Product use issue | FAERS: 29 | US FAERS | |
| 2 | Malaise | FAERS: 21 | US FAERS | |
| 3 | Pneumonia | FAERS: 20 | US FAERS | |
| 4 | Drug ineffective | FAERS: 17 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 5 | Headache | FAERS: 12 | US FAERS | |
| 6 | Chest Pain | FAERS: 11 | US FAERS | |
| 7 | Asthenia | FAERS: 10 | US FAERS | |
| 8 | Choking | FAERS: 9 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 9 | Feeling abnormal | FAERS: 9 | US FAERS | |
| 10 | Myocardial Infarction | FAERS: 9 | US FAERS | |
| 11 | Bronchospasm | FAERS: 8 | US FAERS | |
| 12 | Dizziness | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 13 | Fatigue | FAERS: 8 | US FAERS | |
| 14 | Respiratory Failure | FAERS: 8 | US FAERS | |
| 15 | Agitation | FAERS: 7 | US FAERS | |
| 16 | Chest discomfort | FAERS: 7 | US FAERS | |
| 17 | Glaucoma | FAERS: 7 | US FAERS | |
| 18 | Myalgia | FAERS: 7 | US FAERS | |
| 19 | Oropharyngeal pain | FAERS: 7 | US FAERS | |
| 20 | Pain | FAERS: 7 | US FAERS | |
| 21 | Urinary Retention | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 22 | Acute respiratory failure | FAERS: 6 | US FAERS | |
| 23 | Angioedema | FAERS: 6 | US FAERS | |
| 24 | Lower respiratory tract infection | FAERS: 6 | US FAERS | |
| 25 | Palpitations | FAERS: 6 | US FAERS | |
| 26 | Tachycardia | FAERS: 6 | US FAERS | |
| 27 | Urticaria | FAERS: 6 | US FAERS | |
| 28 | Arthralgia | FAERS: 5 | US FAERS | |
| 29 | Asphyxia | FAERS: 5 | US FAERS | |
| 30 | Bronchitis | FAERS: 5 | US FAERS | |
| 31 | Drug prescribing error | FAERS: 5 | US FAERS | |
| 32 | Dysgeusia | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 33 | Inappropriate schedule of drug administration | FAERS: 5 | US FAERS | |
| 34 | Infection | FAERS: 5 | US FAERS | |
| 35 | Memory impairment | FAERS: 5 | US FAERS | |
| 36 | Throat irritation | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 37 | Visual Impairment | FAERS: 5 | US FAERS | |
| 38 | Weight decreased | FAERS: 5 | US FAERS | |
| 39 | Asthma | FAERS: 4 | US FAERS | |
| 40 | Hypersensitivity | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 41 | Infarction | FAERS: 4 | US FAERS | |
| 42 | Syncope | FAERS: 4 | US FAERS | |
| 43 | Acute kidney injury | FAERS: 3 | US FAERS | |
| 44 | Ageusia | FAERS: 3 | US FAERS | |
| 45 | Anxiety | FAERS: 3 | US FAERS | |
| 46 | Atrial Fibrillation | FAERS: 3 | US FAERS | |
| 47 | Blood glucose increased | FAERS: 3 | US FAERS | |
| 48 | Bone pain | FAERS: 3 | US FAERS | |
| 49 | Concomitant disease aggravated | FAERS: 3 | US FAERS | |
| 50 | Cystitis | FAERS: 3 | US FAERS | |
| 51 | Disease Progression | FAERS: 3 | US FAERS | |
| 52 | Dysuria | FAERS: 3 | US FAERS | |
| 53 | General physical health deterioration | FAERS: 3 | US FAERS | |
| 54 | Intestinal Obstruction | FAERS: 3 | US FAERS | |
| 55 | Joint swelling | FAERS: 3 | US FAERS | |
| 56 | Nasopharyngitis | FAERS: 3 | US FAERS | |
| 57 | Overdose | FAERS: 3 | US FAERS | |
| 58 | Pulmonary function test decreased | FAERS: 3 | US FAERS | |
| 59 | Urinary tract infection | FAERS: 3 | US FAERS | |
| 60 | Wheezing | FAERS: 3 | US FAERS | |
| 61 | Acute Coronary Syndrome | FAERS: 2 | US FAERS | |
| 62 | Angina Pectoris | FAERS: 2 | US FAERS | |
| 63 | Cardiac Arrest | FAERS: 2 | US FAERS | |
| 64 | Cataract | FAERS: 2 | US FAERS | |
| 65 | Cerebral Infarction | FAERS: 2 | US FAERS | |
| 66 | Cerebrovascular accident | FAERS: 2 | US FAERS | |
| 67 | Chronic respiratory failure | FAERS: 2 | US FAERS | |
| 68 | Constipation | FAERS: 2 | US FAERS | |
| 69 | Cyanosis | FAERS: 2 | US FAERS | |
| 70 | Device malfunction | FAERS: 2 | US FAERS | |
| 71 | Epistaxis | FAERS: 2 | US FAERS | |
| 72 | Erythema | FAERS: 2 | US FAERS | |
| 73 | Flushing | FAERS: 2 | US FAERS | |
| 74 | Hypoxia | FAERS: 2 | US FAERS | |
| 75 | Influenza | FAERS: 2 | US FAERS | |
| 76 | Lip swelling | FAERS: 2 | US FAERS | |
| 77 | Mouth swelling | FAERS: 2 | US FAERS | |
| 78 | Musculoskeletal Pain | FAERS: 2 | US FAERS | |
| 79 | Musculoskeletal discomfort | FAERS: 2 | US FAERS | |
| 80 | Nervousness | FAERS: 2 | US FAERS | |
| 81 | Ocular discomfort | FAERS: 2 | US FAERS | |
| 82 | Peripheral swelling | FAERS: 2 | US FAERS | |
| 83 | Pleurisy | FAERS: 2 | US FAERS | |
| 84 | Pneumothorax | FAERS: 2 | US FAERS | |
| 85 | Product dose omission | FAERS: 2 | US FAERS | |
| 86 | Productive Cough | FAERS: 2 | US FAERS | |
| 87 | Pruritus | FAERS: 2 | US FAERS | |
| 88 | Pulmonary Hypertension | FAERS: 2 | US FAERS | |
| 89 | Respiratory arrest | FAERS: 2 | US FAERS | |
| 90 | Respiratory distress | FAERS: 2 | US FAERS | |
| 91 | Sensitivity to weather change | FAERS: 2 | US FAERS | |
| 92 | Thrombosis | FAERS: 2 | US FAERS | |
| 93 | Tremor | FAERS: 2 | US FAERS | |
| 94 | Abasia | FAERS: 1 | US FAERS | |
| 95 | Abdominal Pain | FAERS: 1 | US FAERS | |
| 96 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 97 | Adenosquamous cell lung cancer stage IV | FAERS: 1 | US FAERS | |
| 98 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 99 | Anaphylactoid Reaction | FAERS: 1 | US FAERS | |
| 100 | Aneurysm | FAERS: 1 | US FAERS | |
| 101 | Anger | FAERS: 1 | US FAERS | |
| 102 | Anosmia | FAERS: 1 | US FAERS | |
| 103 | Aortic Aneurysm | FAERS: 1 | US FAERS | |
| 104 | Aphasia | FAERS: 1 | US FAERS | |
| 105 | Aphonia | FAERS: 1 | US FAERS | |
| 106 | Apparent death | FAERS: 1 | US FAERS | |
| 107 | Arthropathy | FAERS: 1 | US FAERS | |
| 108 | Aspartate Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 109 | Back Pain | FAERS: 1 | US FAERS | |
| 110 | Bipolar Disorder | FAERS: 1 | US FAERS | |
| 111 | Blindness | FAERS: 1 | US FAERS | |
| 112 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 113 | Blood glucose abnormal | FAERS: 1 | US FAERS | |
| 114 | Blood lactate dehydrogenase increased | FAERS: 1 | US FAERS | |
| 115 | Brain natriuretic peptide increased | FAERS: 1 | US FAERS | |
| 116 | Bronchiectasis | FAERS: 1 | US FAERS | |
| 117 | Bronchopneumonia | FAERS: 1 | US FAERS | |
| 118 | Bronchopulmonary Aspergillosis | FAERS: 1 | US FAERS | |
| 119 | Burning sensation | FAERS: 1 | US FAERS | |
| 120 | Cardiomegaly | FAERS: 1 | US FAERS | |
| 121 | Chills | FAERS: 1 | US FAERS | |
| 122 | Choking sensation | FAERS: 1 | US FAERS | |
| 123 | Coronary Artery Disease | FAERS: 1 | US FAERS | |
| 124 | Deafness | FAERS: 1 | US FAERS | |
| 125 | Dementia | FAERS: 1 | US FAERS | |
| 126 | Device related infection | FAERS: 1 | US FAERS | |
| 127 | Diplopia | FAERS: 1 | US FAERS | |
| 128 | Discomfort | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 129 | Disease complication | FAERS: 1 | US FAERS | |
| 130 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 131 | Drug resistance | FAERS: 1 | US FAERS | |
| 132 | Dyspepsia | FAERS: 1 | US FAERS | |
| 133 | Dysphonia | FAERS: 1 | US FAERS | |
| 134 | Eczema | FAERS: 1 | US FAERS | |
| 135 | Embolism | FAERS: 1 | US FAERS | |
| 136 | Epilepsy | FAERS: 1 | US FAERS | |
| 137 | Erectile dysfunction | FAERS: 1 | US FAERS | |
| 138 | Escherichia infection | FAERS: 1 | US FAERS | |
| 139 | Expired product administered | FAERS: 1 | US FAERS | |
| 140 | Eye Infection | FAERS: 1 | US FAERS | |
| 141 | Eye pain | FAERS: 1 | US FAERS | |
| 142 | Fibromyalgia | FAERS: 1 | US FAERS | |
| 143 | Gastric ulcer | FAERS: 1 | US FAERS | |
| 144 | Gastroenteritis | FAERS: 1 | US FAERS | |
| 145 | Hepatitis A | FAERS: 1 | US FAERS | |
| 146 | Hernial eventration | FAERS: 1 | US FAERS | |
| 147 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 148 | Hyperthyroidism | FAERS: 1 | US FAERS | |
| 149 | Hypokinesia | FAERS: 1 | US FAERS | |
| 150 | Hypotension | FAERS: 1 | US FAERS | |
| 151 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 152 | Ileus | FAERS: 1 | US FAERS | |
| 153 | Immunosuppression | FAERS: 1 | US FAERS | |
| 154 | Incorrect dose administered | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 155 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 156 | Increased bronchial secretion | FAERS: 1 | US FAERS | |
| 157 | Increased tendency to bruise | FAERS: 1 | US FAERS | |
| 158 | Infectious disease carrier | FAERS: 1 | US FAERS | |
| 159 | Intracranial Aneurysm | FAERS: 1 | US FAERS | |
| 160 | Laceration | FAERS: 1 | US FAERS | |
| 161 | Limb discomfort | FAERS: 1 | US FAERS | |
| 162 | Lymphadenitis | FAERS: 1 | US FAERS | |
| 163 | Lymphocyte count decreased | FAERS: 1 | US FAERS | |
| 164 | Lymphoma | FAERS: 1 | US FAERS | |
| 165 | Macular degeneration | FAERS: 1 | US FAERS | |
| 166 | Malignant neoplasm progression | FAERS: 1 | US FAERS | |
| 167 | Marasmus | FAERS: 1 | US FAERS | |
| 168 | Metastasis | FAERS: 1 | US FAERS | |
| 169 | Middle insomnia | FAERS: 1 | US FAERS | |
| 170 | Musculoskeletal chest pain | FAERS: 1 | US FAERS | |
| 171 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 172 | Neuralgia | FAERS: 1 | US FAERS | |
| 173 | Occult blood positive | FAERS: 1 | US FAERS | |
| 174 | Oropharyngeal candidiasis | FAERS: 1 | US FAERS | |
| 175 | Oropharyngeal spasm | FAERS: 1 | US FAERS | |
| 176 | Oropharyngeal swelling | FAERS: 1 | US FAERS | |
| 177 | Osteoporosis | FAERS: 1 | US FAERS | |
| 178 | Overweight | FAERS: 1 | US FAERS | |
| 179 | Pancreatitis | FAERS: 1 | US FAERS | |
| 180 | Papule | FAERS: 1 | US FAERS | |
| 181 | Periarthritis | FAERS: 1 | US FAERS | |
| 182 | Periodontitis | FAERS: 1 | US FAERS | |
| 183 | Peritonitis | FAERS: 1 | US FAERS | |
| 184 | Personality Change | FAERS: 1 | US FAERS | |
| 185 | Poisoning | FAERS: 1 | US FAERS | |
| 186 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 187 | Product blister packaging issue | FAERS: 1 | US FAERS | |
| 188 | Product packaging issue | FAERS: 1 | US FAERS | |
| 189 | Product physical consistency issue | FAERS: 1 | US FAERS | |
| 190 | Prostatic Adenoma | FAERS: 1 | US FAERS | |
| 191 | Protein urine present | FAERS: 1 | US FAERS | |
| 192 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 193 | Pyelonephritis | FAERS: 1 | US FAERS | |
| 194 | Rales | FAERS: 1 | US FAERS | |
| 195 | Renal cyst | FAERS: 1 | US FAERS | |
| 196 | Renal pain | FAERS: 1 | US FAERS | |
| 197 | Respiratory Depression | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 198 | Respiratory tract congestion | FAERS: 1 | US FAERS | |
| 199 | Respiratory tract inflammation | FAERS: 1 | US FAERS | |
| 200 | Respiratory tract irritation | FAERS: 1 | US FAERS | |
| 201 | Retinal vascular thrombosis | FAERS: 1 | US FAERS | |
| 202 | Right ventricular failure | FAERS: 1 | US FAERS | |
| 203 | Senile dementia | FAERS: 1 | US FAERS | |
| 204 | Spirometry abnormal | FAERS: 1 | US FAERS | |
| 205 | Squamous cell carcinoma of pharynx | FAERS: 1 | US FAERS | |
| 206 | Squamous cell carcinoma | FAERS: 1 | US FAERS | |
| 207 | Stomatitis | FAERS: 1 | US FAERS | |
| 208 | Streptococcus test positive | FAERS: 1 | US FAERS | |
| 209 | Stress | FAERS: 1 | US FAERS | |
| 210 | Stridor | FAERS: 1 | US FAERS | |
| 211 | Sudden death | FAERS: 1 | US FAERS | |
| 212 | Suicide attempt | FAERS: 1 | US FAERS | |
| 213 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 214 | Swelling | FAERS: 1 | US FAERS | |
| 215 | Tachyarrhythmia | FAERS: 1 | US FAERS | |
| 216 | Tongue discomfort | FAERS: 1 | US FAERS | |
| 217 | Tongue spasm | FAERS: 1 | US FAERS | |
| 218 | Tonsillitis | FAERS: 1 | US FAERS | |
| 219 | Troponin increased | FAERS: 1 | US FAERS | |
| 220 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 221 | Upper airway obstruction | FAERS: 1 | US FAERS | |
| 222 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 223 | White blood cell count decreased | FAERS: 1 | US FAERS | |
| 224 | pseudomembranous colitis | FAERS: 1 | US FAERS | |
| 225 | treatment failure | FAERS: 1 | US FAERS | |
| 226 | Inappropriate schedule of product administration | Canada Vigilance: 1 | Canada Vigilance | |
| 227 | Product use in unapproved indication | Canada Vigilance: 5 | Canada Vigilance | |
| 228 | Therapy non-responder | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.