Atacand hct
(GBMIVDMAHNBPIH-UHFFFAOYSA-N)
Structure
- SMILES
- Clc1cc2NCNS(=O)(=O)c2cc1S(=O)(=O)N.CCOc1nc2c(n1Cc1ccc(cc1)c1ccccc1c1n[nH]nn1)c(ccc2)C(=O)OC(OC(=O)OC1CCCCC1)C
- Molecular Formula:
- C40H42ClN9O10S2
- Molecular Weight:
- 908.399
- Log P:
- 9.2965
- Hydrogen Bond Acceptor:
- 18
- Hydrogen Bond Donor:
- 4
- TPSA:
- 278.46
- CAS Number(s):
- 1145777-98-5
Synonym(s)
1.
Atacand hct
External Link(s)
| PubChem Compound | 9811533 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 64 | US FAERS | |
| 2 | Drug dose omission | FAERS: 26 | US FAERS | |
| 3 | Dizziness | FAERS: 22 | US FAERS | |
| 4 | Cerebrovascular accident | FAERS: 18 | US FAERS | |
| 5 | Blood pressure inadequately controlled | FAERS: 16 | US FAERS | |
| 6 | Diabetes Mellitus | FAERS: 16 | US FAERS | |
| 7 | Headache | FAERS: 13 | US FAERS | |
| 8 | Blood pressure fluctuation | FAERS: 10 | US FAERS | |
| 9 | Malaise | FAERS: 10 | US FAERS | |
| 10 | Fatigue | FAERS: 9 | US FAERS | |
| 11 | Weight decreased | FAERS: 9 | US FAERS | |
| 12 | Myocardial Infarction | FAERS: 8 | US FAERS | |
| 13 | Pain | FAERS: 8 | US FAERS | |
| 14 | Infarction | FAERS: 7 | US FAERS | |
| 15 | Blood cholesterol increased | FAERS: 6 | US FAERS | |
| 16 | Chest Pain | FAERS: 6 | US FAERS | |
| 17 | Hypotension | FAERS: 6 | US FAERS | |
| 18 | Syncope | FAERS: 6 | US FAERS | |
| 19 | Vomiting | FAERS: 6 | US FAERS | |
| 20 | Burning sensation | FAERS: 5 | US FAERS | |
| 21 | Dehydration | FAERS: 5 | US FAERS | |
| 22 | Dysphonia | FAERS: 5 | US FAERS | |
| 23 | Incorrect dose administered | FAERS: 5 | US FAERS | |
| 24 | Intentional drug misuse | FAERS: 5 | US FAERS | |
| 25 | Memory impairment | FAERS: 5 | US FAERS | |
| 26 | Nausea | FAERS: 5 | US FAERS | |
| 27 | Visual Impairment | FAERS: 5 | US FAERS | |
| 28 | Anxiety | FAERS: 4 | US FAERS | |
| 29 | Asthenia | FAERS: 4 | US FAERS | |
| 30 | Gout | FAERS: 4 | US FAERS | |
| 31 | Hepatitis C | FAERS: 4 | US FAERS | |
| 32 | Palpitations | FAERS: 4 | US FAERS | |
| 33 | Thrombosis | FAERS: 4 | US FAERS | |
| 34 | Abdominal Pain | FAERS: 3 | US FAERS | |
| 35 | Amnesia | FAERS: 3 | US FAERS | |
| 36 | Angioedema | FAERS: 3 | US FAERS | |
| 37 | Arthritis | FAERS: 3 | US FAERS | |
| 38 | Back Pain | FAERS: 3 | US FAERS | |
| 39 | Cardiac Arrest | FAERS: 3 | US FAERS | |
| 40 | Glaucoma | FAERS: 3 | US FAERS | |
| 41 | Hypersensitivity | FAERS: 3 | US FAERS | |
| 42 | Hypertensive crisis | FAERS: 3 | US FAERS | |
| 43 | Medication Error | FAERS: 3 | US FAERS | |
| 44 | Musculoskeletal Pain | FAERS: 3 | US FAERS | |
| 45 | Pancreatitis | FAERS: 3 | US FAERS | |
| 46 | Pneumonia | FAERS: 3 | US FAERS | |
| 47 | Pruritus | FAERS: 3 | US FAERS | |
| 48 | Somnolence | FAERS: 3 | US FAERS | |
| 49 | Swelling | FAERS: 3 | US FAERS | |
| 50 | Tachycardia | FAERS: 3 | US FAERS | |
| 51 | Urticaria | FAERS: 3 | US FAERS | |
| 52 | Aortic Aneurysm | FAERS: 2 | US FAERS | |
| 53 | Appendicitis | FAERS: 2 | US FAERS | |
| 54 | Arthralgia | FAERS: 2 | US FAERS | |
| 55 | Asthma | FAERS: 2 | US FAERS | |
| 56 | Benign Prostatic Hyperplasia | FAERS: 2 | US FAERS | |
| 57 | Blood glucose increased | FAERS: 2 | US FAERS | |
| 58 | Blood triglycerides increased | FAERS: 2 | US FAERS | |
| 59 | Cataract | FAERS: 2 | US FAERS | |
| 60 | Cholestasis | FAERS: 2 | US FAERS | |
| 61 | Circumstance or information capable of leading to medication error | FAERS: 2 | US FAERS | |
| 62 | Dengue Fever | FAERS: 2 | US FAERS | |
| 63 | Drug dispensing error | FAERS: 2 | US FAERS | |
| 64 | Dysgeusia | FAERS: 2 | US FAERS | |
| 65 | Electrocardiogram abnormal | FAERS: 2 | US FAERS | |
| 66 | Erectile dysfunction | FAERS: 2 | US FAERS | |
| 67 | Feeling abnormal | FAERS: 2 | US FAERS | |
| 68 | Hypothyroidism | FAERS: 2 | US FAERS | |
| 69 | Intentional product misuse | FAERS: 2 | US FAERS | |
| 70 | Lip and/or oral cavity cancer | FAERS: 2 | US FAERS | |
| 71 | Lymphadenitis | FAERS: 2 | US FAERS | |
| 72 | Macular degeneration | FAERS: 2 | US FAERS | |
| 73 | Nasopharyngitis | FAERS: 2 | US FAERS | |
| 74 | Neck Pain | FAERS: 2 | US FAERS | |
| 75 | Nervousness | FAERS: 2 | US FAERS | |
| 76 | Pallor | FAERS: 2 | US FAERS | |
| 77 | Pathological fracture | FAERS: 2 | US FAERS | |
| 78 | Pericardial effusion | FAERS: 2 | US FAERS | |
| 79 | Polyuria | FAERS: 2 | US FAERS | |
| 80 | Renal cyst | FAERS: 2 | US FAERS | |
| 81 | Suicide attempt | FAERS: 2 | US FAERS | |
| 82 | Therapy cessation | FAERS: 2 | US FAERS | |
| 83 | Vertigo | FAERS: 2 | US FAERS | |
| 84 | Visual disturbance | FAERS: 2 | US FAERS | |
| 85 | Vitreous opacities | FAERS: 2 | US FAERS | |
| 86 | nervous system disorder | FAERS: 2 | US FAERS | |
| 87 | Abasia | FAERS: 1 | US FAERS | |
| 88 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 89 | Abnormal weight gain | FAERS: 1 | US FAERS | |
| 90 | Adverse event | FAERS: 1 | US FAERS | |
| 91 | Alopecia | FAERS: 1 | US FAERS | |
| 92 | Amniotic fluid volume decreased | FAERS: 1 | US FAERS | |
| 93 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 94 | Angioplasty | FAERS: 1 | US FAERS | |
| 95 | Benign neoplasm of thyroid gland | FAERS: 1 | US FAERS | |
| 96 | Blindness | FAERS: 1 | US FAERS | |
| 97 | Blood amylase increased | FAERS: 1 | US FAERS | |
| 98 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 99 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 100 | Blood potassium increased | FAERS: 1 | US FAERS | |
| 101 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 102 | Bone pain | FAERS: 1 | US FAERS | |
| 103 | Brain Hypoxia | FAERS: 1 | US FAERS | |
| 104 | Bronchiectasis | FAERS: 1 | US FAERS | |
| 105 | Bursitis | FAERS: 1 | US FAERS | |
| 106 | Carpal Tunnel Syndrome | FAERS: 1 | US FAERS | |
| 107 | Cataract operation | FAERS: 1 | US FAERS | |
| 108 | Cervix carcinoma | FAERS: 1 | US FAERS | |
| 109 | Chemotherapy | FAERS: 1 | US FAERS | |
| 110 | Chest discomfort | FAERS: 1 | US FAERS | |
| 111 | Constipation | FAERS: 1 | US FAERS | |
| 112 | Device dislocation | FAERS: 1 | US FAERS | |
| 113 | Disability | FAERS: 1 | US FAERS | |
| 114 | Disorientation | FAERS: 1 | US FAERS | |
| 115 | Diverticulitis | FAERS: 1 | US FAERS | |
| 116 | Drug therapy changed | FAERS: 1 | US FAERS | |
| 117 | Dyspepsia | FAERS: 1 | US FAERS | |
| 118 | Embolism | FAERS: 1 | US FAERS | |
| 119 | Endometriosis | FAERS: 1 | US FAERS | |
| 120 | Erythema | FAERS: 1 | US FAERS | |
| 121 | Expired drug administered | FAERS: 1 | US FAERS | |
| 122 | Eye pain | FAERS: 1 | US FAERS | |
| 123 | Food Poisoning | FAERS: 1 | US FAERS | |
| 124 | Gastritis | FAERS: 1 | US FAERS | |
| 125 | Hepatitis | FAERS: 1 | US FAERS | |
| 126 | Hepatomegaly | FAERS: 1 | US FAERS | |
| 127 | Hepatotoxicity | FAERS: 1 | US FAERS | |
| 128 | Hyperplasia | FAERS: 1 | US FAERS | |
| 129 | Hypoxia | FAERS: 1 | US FAERS | |
| 130 | Infection | FAERS: 1 | US FAERS | |
| 131 | Inflammation | FAERS: 1 | US FAERS | |
| 132 | Joint Range of Motion Decreased | FAERS: 1 | US FAERS | |
| 133 | Joint sprain | FAERS: 1 | US FAERS | |
| 134 | Laryngitis | FAERS: 1 | US FAERS | |
| 135 | Larynx irritation | FAERS: 1 | US FAERS | |
| 136 | Ligament rupture | FAERS: 1 | US FAERS | |
| 137 | Limb discomfort | FAERS: 1 | US FAERS | |
| 138 | Lipase increased | FAERS: 1 | US FAERS | |
| 139 | Lupus-like syndrome | FAERS: 1 | US FAERS | |
| 140 | Malignant Hypertension | FAERS: 1 | US FAERS | |
| 141 | Malignant tumour excision | FAERS: 1 | US FAERS | |
| 142 | Mastectomy | FAERS: 1 | US FAERS | |
| 143 | Menorrhagia | FAERS: 1 | US FAERS | |
| 144 | Micturition frequency decreased | FAERS: 1 | US FAERS | |
| 145 | Multiple allergies | FAERS: 1 | US FAERS | |
| 146 | Musculoskeletal discomfort | FAERS: 1 | US FAERS | |
| 147 | Myalgia | FAERS: 1 | US FAERS | |
| 148 | Myopia | FAERS: 1 | US FAERS | |
| 149 | Nerve injury | FAERS: 1 | US FAERS | |
| 150 | Night sweats | FAERS: 1 | US FAERS | |
| 151 | Nocturia | FAERS: 1 | US FAERS | |
| 152 | Obesity surgery | FAERS: 1 | US FAERS | |
| 153 | Ocular icterus | FAERS: 1 | US FAERS | |
| 154 | Oropharyngeal cancer stage unspecified | FAERS: 1 | US FAERS | |
| 155 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 156 | Osteoporosis | FAERS: 1 | US FAERS | |
| 157 | Pharyngolaryngeal Pain | FAERS: 1 | US FAERS | |
| 158 | Product use issue | FAERS: 1 | US FAERS | |
| 159 | Psoriasis | FAERS: 1 | US FAERS | |
| 160 | Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 161 | Purpura | FAERS: 1 | US FAERS | |
| 162 | Renin increased | FAERS: 1 | US FAERS | |
| 163 | Restlessness | FAERS: 1 | US FAERS | |
| 164 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 165 | Rotator cuff syndrome | FAERS: 1 | US FAERS | |
| 166 | Sinusitis | FAERS: 1 | US FAERS | |
| 167 | Skin tightness | FAERS: 1 | US FAERS | |
| 168 | Splenomegaly | FAERS: 1 | US FAERS | |
| 169 | Stress | FAERS: 1 | US FAERS | |
| 170 | Systolic dysfunction | FAERS: 1 | US FAERS | |
| 171 | Therapeutic product ineffective | FAERS: 1 | US FAERS | |
| 172 | Throat irritation | FAERS: 1 | US FAERS | |
| 173 | Thyroid Neoplasm | FAERS: 1 | US FAERS | |
| 174 | Thyroiditis | FAERS: 1 | US FAERS | |
| 175 | Transaminases increased | FAERS: 1 | US FAERS | |
| 176 | Traumatic Brain Injury | FAERS: 1 | US FAERS | |
| 177 | Tremor | FAERS: 1 | US FAERS | |
| 178 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 179 | Urine potassium abnormal | FAERS: 1 | US FAERS | |
| 180 | Venous occlusion | FAERS: 1 | US FAERS | |
| 181 | Vitreous Detachment | FAERS: 1 | US FAERS | |
| 182 | furuncle | FAERS: 1 | US FAERS | |
| 183 | jaundice | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120329
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.