Panobinostat
(FPOHNWQLNRZRFC-ZHACJKMWSA-N)
Structure
- SMILES
- ONC(=O)/C=C/c1ccc(cc1)CNCCc1c(C)[nH]c2c1cccc2
- Type(s)
- Approved; Investigational
- ATC code(s)
- L01XX42
- Molecular Formula:
- C21H23N3O2
- Molecular Weight:
- 349.426
- Log P:
- 4.1090
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 4
- TPSA:
- 77.15
- CAS Number(s):
- 404950-80-7
Synonym(s)
1.
Panobinostat
2.
Farydak
3.
LBH 589
4.
LBH589
5.
NVP-LBH589
6.
NVP LBH589
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Fatigue | FAERS: 39 | US FAERS | |
| 2 | Malignant neoplasm progression | FAERS: 30 | US FAERS | |
| 3 | Drug ineffective | FAERS: 26 | US FAERS | |
| 4 | Nausea | FAERS: 23 | US FAERS | |
| 5 | Thrombocytopenia | FAERS: 21 | US FAERS | |
| 6 | Disease Progression | FAERS: 18 | US FAERS | |
| 7 | Vomiting | FAERS: 14 | US FAERS | |
| 8 | Pneumonia | FAERS: 10 | US FAERS | |
| 9 | Asthenia | FAERS: 9 | US FAERS | |
| 10 | Infection | FAERS: 9 | US FAERS | |
| 11 | Malaise | FAERS: 8 | US FAERS | |
| 12 | Constipation | FAERS: 6 | US FAERS | |
| 13 | Cytopenia | FAERS: 6 | US FAERS | |
| 14 | General physical health deterioration | FAERS: 6 | US FAERS | |
| 15 | Headache | FAERS: 5 | US FAERS | |
| 16 | Pancytopenia | FAERS: 5 | US FAERS | |
| 17 | Dizziness | FAERS: 4 | US FAERS | |
| 18 | Inappropriate schedule of drug administration | FAERS: 4 | US FAERS | |
| 19 | Product use in unapproved indication | FAERS: 4 | US FAERS | |
| 20 | Weight decreased | FAERS: 4 | US FAERS | |
| 21 | Back Pain | FAERS: 3 | US FAERS | |
| 22 | Cerebrovascular accident | FAERS: 3 | US FAERS | |
| 23 | Disease recurrence | FAERS: 3 | US FAERS | |
| 24 | Electrocardiogram abnormal | FAERS: 3 | US FAERS | |
| 25 | Enterocolitis | FAERS: 3 | US FAERS | |
| 26 | Febrile Neutropenia | FAERS: 3 | US FAERS | |
| 27 | Feeling abnormal | FAERS: 3 | US FAERS | |
| 28 | Intestinal Obstruction | FAERS: 3 | US FAERS | |
| 29 | Neutrophil count decreased | FAERS: 3 | US FAERS | |
| 30 | Somnolence | FAERS: 3 | US FAERS | |
| 31 | Therapy cessation | FAERS: 3 | US FAERS | |
| 32 | Abdominal Pain | FAERS: 2 | US FAERS | |
| 33 | Atrial Fibrillation | FAERS: 2 | US FAERS | |
| 34 | Blood creatinine increased | FAERS: 2 | US FAERS | |
| 35 | Blood glucose increased | FAERS: 2 | US FAERS | |
| 36 | Bone lesion | FAERS: 2 | US FAERS | |
| 37 | Cardiotoxicity | FAERS: 2 | US FAERS | |
| 38 | Chest discomfort | FAERS: 2 | US FAERS | |
| 39 | Chills | FAERS: 2 | US FAERS | |
| 40 | Cold sweat | FAERS: 2 | US FAERS | |
| 41 | Dehydration | FAERS: 2 | US FAERS | |
| 42 | Drug resistance | FAERS: 2 | US FAERS | |
| 43 | Eructation | FAERS: 2 | US FAERS | |
| 44 | Hypotension | FAERS: 2 | US FAERS | |
| 45 | Ileus | FAERS: 2 | US FAERS | |
| 46 | Lethargy | FAERS: 2 | US FAERS | |
| 47 | Lymphadenopathy | FAERS: 2 | US FAERS | |
| 48 | Musculoskeletal Pain | FAERS: 2 | US FAERS | |
| 49 | Myocardial Infarction | FAERS: 2 | US FAERS | |
| 50 | N-terminal prohormone brain natriuretic peptide increased | FAERS: 2 | US FAERS | |
| 51 | Nasopharyngitis | FAERS: 2 | US FAERS | |
| 52 | Neutropenia | FAERS: 2 | US FAERS | |
| 53 | Palpitations | FAERS: 2 | US FAERS | |
| 54 | Peripheral swelling | FAERS: 2 | US FAERS | |
| 55 | Product use issue | FAERS: 2 | US FAERS | |
| 56 | Pruritus | FAERS: 2 | US FAERS | |
| 57 | Respiratory distress | FAERS: 2 | US FAERS | |
| 58 | Sepsis | FAERS: 2 | US FAERS | |
| 59 | Staring | FAERS: 2 | US FAERS | |
| 60 | Syncope | FAERS: 2 | US FAERS | |
| 61 | Tachycardia | FAERS: 2 | US FAERS | |
| 62 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 63 | Actinic keratosis | FAERS: 1 | US FAERS | |
| 64 | Adenocarcinoma | FAERS: 1 | US FAERS | |
| 65 | Alanine Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 66 | Albumin globulin ratio decreased | FAERS: 1 | US FAERS | |
| 67 | Altered state of consciousness | FAERS: 1 | US FAERS | |
| 68 | Arthralgia | FAERS: 1 | US FAERS | |
| 69 | Aspartate Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 70 | Asthma | FAERS: 1 | US FAERS | |
| 71 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 72 | Autonomic neuropathy | FAERS: 1 | US FAERS | |
| 73 | Bacterial test positive | FAERS: 1 | US FAERS | |
| 74 | Bifascicular block | FAERS: 1 | US FAERS | |
| 75 | Blood count abnormal | FAERS: 1 | US FAERS | |
| 76 | Blood immunoglobulin A decreased | FAERS: 1 | US FAERS | |
| 77 | Blood immunoglobulin G increased | FAERS: 1 | US FAERS | |
| 78 | Blood immunoglobulin M decreased | FAERS: 1 | US FAERS | |
| 79 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 80 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 81 | Blood triglycerides increased | FAERS: 1 | US FAERS | |
| 82 | Bone pain | FAERS: 1 | US FAERS | |
| 83 | Bone swelling | FAERS: 1 | US FAERS | |
| 84 | Brain Stem Glioma | FAERS: 1 | US FAERS | |
| 85 | Carbon dioxide decreased | FAERS: 1 | US FAERS | |
| 86 | Cellulitis | FAERS: 1 | US FAERS | |
| 87 | Chest Pain | FAERS: 1 | US FAERS | |
| 88 | Choking | FAERS: 1 | US FAERS | |
| 89 | Clostridium difficile colitis | FAERS: 1 | US FAERS | |
| 90 | Complications of bone marrow transplant | FAERS: 1 | US FAERS | |
| 91 | Concomitant disease aggravated | FAERS: 1 | US FAERS | |
| 92 | Device related infection | FAERS: 1 | US FAERS | |
| 93 | Disease complication | FAERS: 1 | US FAERS | |
| 94 | Disorientation | FAERS: 1 | US FAERS | |
| 95 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 96 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 97 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 98 | Epistaxis | FAERS: 1 | US FAERS | |
| 99 | Erythema | FAERS: 1 | US FAERS | |
| 100 | Failure to Thrive | FAERS: 1 | US FAERS | |
| 101 | Gastritis | FAERS: 1 | US FAERS | |
| 102 | Gastroenteritis | FAERS: 1 | US FAERS | |
| 103 | Gastrointestinal Pain | FAERS: 1 | US FAERS | |
| 104 | Gastrointestinal toxicity | FAERS: 1 | US FAERS | |
| 105 | Gastrointestinal viral infection | FAERS: 1 | US FAERS | |
| 106 | Hemiparesis | FAERS: 1 | US FAERS | |
| 107 | Hepatotoxicity | FAERS: 1 | US FAERS | |
| 108 | Human rhinovirus test positive | FAERS: 1 | US FAERS | |
| 109 | Hydronephrosis | FAERS: 1 | US FAERS | |
| 110 | Hypoxia | FAERS: 1 | US FAERS | |
| 111 | Immunosuppression | FAERS: 1 | US FAERS | |
| 112 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 113 | Intervertebral disc disorder | FAERS: 1 | US FAERS | |
| 114 | Joint swelling | FAERS: 1 | US FAERS | |
| 115 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 116 | Lymphocyte count increased | FAERS: 1 | US FAERS | |
| 117 | Lymphopenia | FAERS: 1 | US FAERS | |
| 118 | Meniscus injury | FAERS: 1 | US FAERS | |
| 119 | Moaning | FAERS: 1 | US FAERS | |
| 120 | Monocytosis | FAERS: 1 | US FAERS | |
| 121 | Myalgia | FAERS: 1 | US FAERS | |
| 122 | Myoclonus | FAERS: 1 | US FAERS | |
| 123 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 124 | Pain | FAERS: 1 | US FAERS | |
| 125 | Pelvic mass | FAERS: 1 | US FAERS | |
| 126 | Performance status decreased | FAERS: 1 | US FAERS | |
| 127 | Pericardial effusion | FAERS: 1 | US FAERS | |
| 128 | Pharyngitis | FAERS: 1 | US FAERS | |
| 129 | Plasma cell myeloma recurrent | FAERS: 1 | US FAERS | |
| 130 | Plasmacytoma | FAERS: 1 | US FAERS | |
| 131 | Pneumonitis | FAERS: 1 | US FAERS | |
| 132 | Posterior reversible encephalopathy syndrome | FAERS: 1 | US FAERS | |
| 133 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 134 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 135 | Respiratory tract congestion | FAERS: 1 | US FAERS | |
| 136 | Secretion discharge | FAERS: 1 | US FAERS | |
| 137 | Skin hypertrophy | FAERS: 1 | US FAERS | |
| 138 | Splenomegaly | FAERS: 1 | US FAERS | |
| 139 | Stomatitis | FAERS: 1 | US FAERS | |
| 140 | Terminal state | FAERS: 1 | US FAERS | |
| 141 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 142 | Thirst | FAERS: 1 | US FAERS | |
| 143 | Thrombocytosis | FAERS: 1 | US FAERS | |
| 144 | Thrombosis | FAERS: 1 | US FAERS | |
| 145 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 146 | Tremor | FAERS: 1 | US FAERS | |
| 147 | Unevaluable event | FAERS: 1 | US FAERS | |
| 148 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 149 | White blood cell count decreased | FAERS: 1 | US FAERS | |
| 150 | Idiopathic Pulmonary Fibrosis | 30481203 | CTD | |
| 151 | Neoplasms, Experimental | 24157872 | CTD | |
| 152 | Prostatic Neoplasms | 24157872 | CTD |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.