Chlorpromazine
(FBSMERQALIEGJT-UHFFFAOYSA-N)
Structure
- SMILES
- CN(CCCN1c2ccccc2Sc2c1cc(Cl)cc2)C.Cl
- Molecular Formula:
- C17H20Cl2N2S
- Molecular Weight:
- 355.325
- Log P:
- 5.7614
- Hydrogen Bond Acceptor:
- 2
- Hydrogen Bond Donor:
- 1
- TPSA:
- 31.78
- CAS Number(s):
- 69-09-0
Synonym(s)
1.
Chlorpromazine
2.
Aminazine
3.
Chlorazine
4.
Chlordelazine
5.
Chlorpromazine Hydrochloride
6.
Contomin
7.
Fenactil
8.
Largactil
9.
Propaphenin
10.
Thorazine
11.
Hydrochloride, Chlorpromazine
External Link(s)
| MeSH | D002746 |
| PubChem Compound | 522335 657361 6240 25010312 |
| BindingDB | 50318908 |
| ChEBI | 3649 |
| CHEMBL | CHEMBL1713 |
| KEGG | cpd:C07952 dr:D00789 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Neuroleptic Malignant Syndrome | FAERS: 4 | US FAERS | |
| 2 | Pneumonia | FAERS: 4 | US FAERS | |
| 3 | Tachycardia | FAERS: 4 | US FAERS | |
| 4 | Atelectasis | FAERS: 3 | US FAERS | |
| 5 | Altered state of consciousness | FAERS: 2 | US FAERS | |
| 6 | Autonomic nervous system imbalance | FAERS: 2 | US FAERS | |
| 7 | Glossitis | FAERS: 2 | US FAERS | |
| 8 | Hypotension | FAERS: 2 | US FAERS | |
| 9 | Lethargy | FAERS: 2 | US FAERS | |
| 10 | Overdose | FAERS: 2 | US FAERS | |
| 11 | Rhabdomyolysis | FAERS: 2 | US FAERS | |
| 12 | Somnolence | FAERS: 2 | US FAERS | |
| 13 | Agitation | FAERS: 1 | US FAERS | |
| 14 | Alanine Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 15 | Antinuclear antibody increased | FAERS: 1 | US FAERS | |
| 16 | Aspartate Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 17 | Blood alkaline phosphatase increased | FAERS: 1 | US FAERS | |
| 18 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 19 | Cataract | FAERS: 1 | US FAERS | |
| 20 | Chemical burn of gastrointestinal tract | FAERS: 1 | US FAERS | |
| 21 | Cholestasis | FAERS: 1 | US FAERS | |
| 22 | Cogwheel Rigidity | FAERS: 1 | US FAERS | |
| 23 | Completed Suicide | FAERS: 1 | US FAERS | |
| 24 | Corneal epithelium defect | FAERS: 1 | US FAERS | |
| 25 | Corneal pigmentation | FAERS: 1 | US FAERS | |
| 26 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 27 | Drug exposure during pregnancy | FAERS: 1 | US FAERS | |
| 28 | Eye pain | FAERS: 1 | US FAERS | |
| 29 | Fatigue | FAERS: 1 | US FAERS | |
| 30 | Feeding disorder neonatal | FAERS: 1 | US FAERS | |
| 31 | Feeling abnormal | FAERS: 1 | US FAERS | |
| 32 | Headache | FAERS: 1 | US FAERS | |
| 33 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 34 | Keratoconus | FAERS: 1 | US FAERS | |
| 35 | Lagophthalmos | FAERS: 1 | US FAERS | |
| 36 | Memory impairment | FAERS: 1 | US FAERS | |
| 37 | Mental status changes | FAERS: 1 | US FAERS | |
| 38 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 39 | Multiple drug overdose | FAERS: 1 | US FAERS | |
| 40 | Muscle Rigidity | FAERS: 1 | US FAERS | |
| 41 | Myocardial Infarction | FAERS: 1 | US FAERS | |
| 42 | Nausea | FAERS: 1 | US FAERS | |
| 43 | Ocular Toxicity | FAERS: 1 | US FAERS | |
| 44 | Oral mucosal eruption | FAERS: 1 | US FAERS | |
| 45 | Personality Change | FAERS: 1 | US FAERS | |
| 46 | Pregnancy | FAERS: 1 | US FAERS | |
| 47 | Priapism | FAERS: 1 | US FAERS | |
| 48 | Prosopagnosia | FAERS: 1 | US FAERS | |
| 49 | Shock | FAERS: 1 | US FAERS | |
| 50 | Slit-lamp tests abnormal | FAERS: 1 | US FAERS | |
| 51 | Status Epilepticus | FAERS: 1 | US FAERS | |
| 52 | Suicide attempt | FAERS: 1 | US FAERS | |
| 53 | Swelling | FAERS: 1 | US FAERS | |
| 54 | Syncope | FAERS: 1 | US FAERS | |
| 55 | Tardive Dyskinesia | FAERS: 1 | US FAERS | |
| 56 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 57 | Tongue discomfort | FAERS: 1 | US FAERS | |
| 58 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 59 | Tremor | FAERS: 1 | US FAERS | |
| 60 | Wrong technique in product usage process | FAERS: 1 | US FAERS | |
| 61 | nervous system disorder | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120295
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.