ixabepilone
(FABUFPQFXZVHFB-PVYNADRNSA-N)
Structure
- SMILES
- O=C1N[C@@H](C[C@@H]2O[C@]2(C)CCC[C@@H]([C@@H]([C@H](C(=O)C([C@H](C1)O)(C)C)C)O)C)/C(=C/c1csc(n1)C)/C
- Type(s)
- Approved; Investigational
- ATC code(s)
- L01DC04
- Molecular Formula:
- C27H42N2O5S
- Molecular Weight:
- 506.698
- Log P:
- 4.3793
- Hydrogen Bond Acceptor:
- 8
- Hydrogen Bond Donor:
- 3
- TPSA:
- 140.29
- CAS Number(s):
- 219989-84-1
Synonym(s)
1.
ixabepilone
2.
BMS 247550
3.
BMS-247550
4.
BMS247550
5.
azaepothilone B
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Fatigue | FAERS: 51 | OFFSIDES SIDER US FAERS | |
| 2 | Nausea | FAERS: 41 | OFFSIDES SIDER US FAERS | |
| 3 | Malignant neoplasm progression | FAERS: 36 | US FAERS | |
| 4 | Vomiting | FAERS: 33 | SIDER US FAERS | |
| 5 | Neutropenia | FAERS: 29 | SIDER US FAERS | |
| 6 | Myalgia | FAERS: 25 | SIDER US FAERS | |
| 7 | Circumstance or information capable of leading to medication error | FAERS: 24 | US FAERS | |
| 8 | Extravasation | FAERS: 24 | US FAERS | |
| 9 | Pain | FAERS: 20 | SIDER US FAERS | |
| 10 | Drug administration error | FAERS: 19 | US FAERS | |
| 11 | Arthralgia | FAERS: 18 | SIDER US FAERS | |
| 12 | Asthenia | FAERS: 18 | OFFSIDES SIDER US FAERS | |
| 13 | Dehydration | FAERS: 16 | OFFSIDES SIDER US FAERS | |
| 14 | Febrile Neutropenia | FAERS: 16 | OFFSIDES SIDER US FAERS | |
| 15 | Hypersensitivity | FAERS: 16 | SIDER US FAERS | |
| 16 | Dizziness | FAERS: 14 | OFFSIDES SIDER US FAERS | |
| 17 | Headache | FAERS: 14 | SIDER US FAERS | |
| 18 | Adverse event | FAERS: 13 | US FAERS | |
| 19 | Bone pain | FAERS: 13 | US FAERS | |
| 20 | Incorrect storage of drug | FAERS: 13 | US FAERS | |
| 21 | Stomatitis | FAERS: 13 | SIDER US FAERS | |
| 22 | Erythema | FAERS: 12 | US FAERS | |
| 23 | Abdominal Pain | FAERS: 11 | OFFSIDES SIDER US FAERS | |
| 24 | No adverse event | FAERS: 11 | US FAERS | |
| 25 | Alopecia | FAERS: 10 | SIDER US FAERS | |
| 26 | Flushing | FAERS: 10 | US FAERS | |
| 27 | Hypotension | FAERS: 10 | SIDER US FAERS | |
| 28 | Medication Error | FAERS: 10 | US FAERS | |
| 29 | Burning sensation | FAERS: 9 | SIDER US FAERS | |
| 30 | Full blood count decreased | FAERS: 9 | US FAERS | |
| 31 | Sepsis | FAERS: 9 | SIDER US FAERS | |
| 32 | White blood cell count decreased | FAERS: 9 | US FAERS | |
| 33 | Back Pain | FAERS: 8 | US FAERS | |
| 34 | Injection site extravasation | FAERS: 8 | US FAERS | |
| 35 | Pancytopenia | FAERS: 8 | SIDER US FAERS | |
| 36 | Recall phenomenon | FAERS: 8 | US FAERS | |
| 37 | Thrombocytopenia | FAERS: 8 | SIDER US FAERS | |
| 38 | Accidental exposure | FAERS: 7 | US FAERS | |
| 39 | Wrong technique in drug usage process | FAERS: 7 | US FAERS | |
| 40 | Chest Pain | FAERS: 6 | SIDER US FAERS | |
| 41 | Malaise | FAERS: 6 | US FAERS | |
| 42 | Weight decreased | FAERS: 6 | SIDER US FAERS | |
| 43 | Chest discomfort | FAERS: 5 | US FAERS | |
| 44 | Dysphonia | FAERS: 5 | OFFSIDES SIDER US FAERS | |
| 45 | Incorrect product storage | FAERS: 5 | US FAERS | |
| 46 | Infusion Site Extravasation | FAERS: 5 | US FAERS | |
| 47 | Neutrophil count decreased | FAERS: 5 | OFFSIDES US FAERS | |
| 48 | Pruritus | FAERS: 5 | SIDER US FAERS | |
| 49 | Respiratory arrest | FAERS: 5 | US FAERS | |
| 50 | Septic Shock | FAERS: 5 | OFFSIDES US FAERS | |
| 51 | Blood creatinine increased | FAERS: 4 | OFFSIDES US FAERS | |
| 52 | Cardiac Arrest | FAERS: 4 | US FAERS | |
| 53 | Dysuria | FAERS: 4 | OFFSIDES US FAERS | |
| 54 | Musculoskeletal Pain | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 55 | Pancreatitis | FAERS: 4 | US FAERS | |
| 56 | Purpura | FAERS: 4 | US FAERS | |
| 57 | Ataxia | FAERS: 3 | US FAERS | |
| 58 | Cerebrovascular accident | FAERS: 3 | US FAERS | |
| 59 | Chills | FAERS: 3 | SIDER US FAERS | |
| 60 | Constipation | FAERS: 3 | SIDER US FAERS | |
| 61 | Disease Progression | FAERS: 3 | US FAERS | |
| 62 | Dyspepsia | FAERS: 3 | US FAERS | |
| 63 | Dysphasia | FAERS: 3 | US FAERS | |
| 64 | General physical health deterioration | FAERS: 3 | OFFSIDES US FAERS | |
| 65 | Incorrect drug administration duration | FAERS: 3 | US FAERS | |
| 66 | Lymphocyte count decreased | FAERS: 3 | US FAERS | |
| 67 | Mental status changes | FAERS: 3 | US FAERS | |
| 68 | Metastasis | FAERS: 3 | US FAERS | |
| 69 | Polyneuropathy | FAERS: 3 | SIDER US FAERS | |
| 70 | Pulmonary Embolism | FAERS: 3 | US FAERS | |
| 71 | Respiratory Failure | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 72 | Restless Legs Syndrome | FAERS: 3 | US FAERS | |
| 73 | Somnolence | FAERS: 3 | US FAERS | |
| 74 | Swelling | FAERS: 3 | US FAERS | |
| 75 | Tremor | FAERS: 3 | US FAERS | |
| 76 | Urinary tract infection | FAERS: 3 | SIDER US FAERS | |
| 77 | Vocal Cord Paralysis | FAERS: 3 | US FAERS | |
| 78 | Abasia | FAERS: 2 | US FAERS | |
| 79 | Alanine Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 80 | Anorexia | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 81 | Anxiety | FAERS: 2 | US FAERS | |
| 82 | Depressed Level of Consciousness | FAERS: 2 | OFFSIDES US FAERS | |
| 83 | Drug dose omission | FAERS: 2 | US FAERS | |
| 84 | Dysgeusia | FAERS: 2 | US FAERS | |
| 85 | Electrolyte imbalance | FAERS: 2 | US FAERS | |
| 86 | Feeling abnormal | FAERS: 2 | US FAERS | |
| 87 | Hemiparesis | FAERS: 2 | US FAERS | |
| 88 | Hypoxia | FAERS: 2 | OFFSIDES US FAERS | |
| 89 | Ileus | FAERS: 2 | SIDER US FAERS | |
| 90 | Incorrect drug administration rate | FAERS: 2 | US FAERS | |
| 91 | Infection | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 92 | Inflammation | FAERS: 2 | US FAERS | |
| 93 | Injection site erythema | FAERS: 2 | US FAERS | |
| 94 | Intestinal Perforation | FAERS: 2 | OFFSIDES US FAERS | |
| 95 | Lethargy | FAERS: 2 | SIDER US FAERS | |
| 96 | Lymphopenia | FAERS: 2 | SIDER US FAERS | |
| 97 | Myocardial Infarction | FAERS: 2 | SIDER US FAERS | |
| 98 | Neutropenic sepsis | FAERS: 2 | US FAERS | |
| 99 | Oropharyngeal pain | FAERS: 2 | US FAERS | |
| 100 | Pericardial effusion | FAERS: 2 | OFFSIDES US FAERS | |
| 101 | Peripheral motor neuropathy | FAERS: 2 | SIDER US FAERS | |
| 102 | Pneumonia | FAERS: 2 | SIDER US FAERS | |
| 103 | Pneumothorax | FAERS: 2 | OFFSIDES US FAERS | |
| 104 | Pulmonary toxicity | FAERS: 2 | US FAERS | |
| 105 | Rash erythematous | FAERS: 2 | US FAERS | |
| 106 | Sudden death | FAERS: 2 | US FAERS | |
| 107 | Syncope | FAERS: 2 | SIDER US FAERS | |
| 108 | Tachycardia | FAERS: 2 | US FAERS | |
| 109 | Urticaria | FAERS: 2 | US FAERS | |
| 110 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 111 | Amnesia | FAERS: 1 | US FAERS | |
| 112 | Anuria | FAERS: 1 | US FAERS | |
| 113 | Arthritis | FAERS: 1 | US FAERS | |
| 114 | Aspartate Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 115 | Atrophic vulvovaginitis | FAERS: 1 | US FAERS | |
| 116 | Bedridden | FAERS: 1 | US FAERS | |
| 117 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 118 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 119 | Blood phosphorus decreased | FAERS: 1 | US FAERS | |
| 120 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 121 | Bronchitis | FAERS: 1 | US FAERS | |
| 122 | Bronchospasm | FAERS: 1 | US FAERS | |
| 123 | Capillary Leak Syndrome | FAERS: 1 | US FAERS | |
| 124 | Cardiac Tamponade | FAERS: 1 | OFFSIDES US FAERS | |
| 125 | Cholestasis | FAERS: 1 | US FAERS | |
| 126 | Chromaturia | FAERS: 1 | US FAERS | |
| 127 | Colitis | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 128 | Complication associated with device | FAERS: 1 | US FAERS | |
| 129 | Device related infection | FAERS: 1 | US FAERS | |
| 130 | Diabetes Insipidus | FAERS: 1 | US FAERS | |
| 131 | Diplopia | FAERS: 1 | US FAERS | |
| 132 | Discomfort | FAERS: 1 | US FAERS | |
| 133 | Drug ineffective | FAERS: 1 | US FAERS | |
| 134 | Drug toxicity | FAERS: 1 | US FAERS | |
| 135 | Dyslexia | FAERS: 1 | US FAERS | |
| 136 | Embolism | FAERS: 1 | SIDER US FAERS | |
| 137 | Epilepsy | FAERS: 1 | US FAERS | |
| 138 | Epistaxis | FAERS: 1 | US FAERS | |
| 139 | Erythema Multiforme | FAERS: 1 | SIDER US FAERS | |
| 140 | Excoriation | FAERS: 1 | US FAERS | |
| 141 | Flatulence | FAERS: 1 | US FAERS | |
| 142 | Gallbladder pain | FAERS: 1 | US FAERS | |
| 143 | Gastrointestinal Pain | FAERS: 1 | SIDER US FAERS | |
| 144 | Guillain-Barre Syndrome | FAERS: 1 | US FAERS | |
| 145 | Hepatitis | FAERS: 1 | US FAERS | |
| 146 | Hepatotoxicity | FAERS: 1 | US FAERS | |
| 147 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 148 | Hyperventilation | FAERS: 1 | US FAERS | |
| 149 | Hypoaesthesia facial | FAERS: 1 | US FAERS | |
| 150 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 151 | Infusion site pain | FAERS: 1 | US FAERS | |
| 152 | Infusion site reaction | FAERS: 1 | US FAERS | |
| 153 | Infusion site warmth | FAERS: 1 | US FAERS | |
| 154 | Intestinal infarction | FAERS: 1 | US FAERS | |
| 155 | Laryngospasm | FAERS: 1 | OFFSIDES US FAERS | |
| 156 | Metrorrhagia | FAERS: 1 | US FAERS | |
| 157 | Nail bed infection | FAERS: 1 | US FAERS | |
| 158 | Nerve injury | FAERS: 1 | US FAERS | |
| 159 | Neuralgia | FAERS: 1 | SIDER US FAERS | |
| 160 | Neuritis | FAERS: 1 | SIDER US FAERS | |
| 161 | Nodule | FAERS: 1 | US FAERS | |
| 162 | Non-cardiac chest pain | FAERS: 1 | US FAERS | |
| 163 | Oropharyngeal blistering | FAERS: 1 | US FAERS | |
| 164 | Pain of skin | FAERS: 1 | US FAERS | |
| 165 | Palpitations | FAERS: 1 | US FAERS | |
| 166 | Pericarditis | FAERS: 1 | US FAERS | |
| 167 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 168 | Phlebitis | FAERS: 1 | US FAERS | |
| 169 | Pneumonitis | FAERS: 1 | US FAERS | |
| 170 | Product packaging issue | FAERS: 1 | US FAERS | |
| 171 | Product quality issue | FAERS: 1 | US FAERS | |
| 172 | Psychiatric symptom | FAERS: 1 | US FAERS | |
| 173 | Respiratory Depression | FAERS: 1 | US FAERS | |
| 174 | Respiratory distress | FAERS: 1 | US FAERS | |
| 175 | Respiratory tract congestion | FAERS: 1 | US FAERS | |
| 176 | Retching | FAERS: 1 | US FAERS | |
| 177 | Retroperitoneal fibrosis | FAERS: 1 | US FAERS | |
| 178 | Sinus Tachycardia | FAERS: 1 | US FAERS | |
| 179 | Skin irritation | FAERS: 1 | US FAERS | |
| 180 | Skin necrosis | FAERS: 1 | US FAERS | |
| 181 | Skin toxicity | FAERS: 1 | US FAERS | |
| 182 | Subcutaneous Emphysema | FAERS: 1 | US FAERS | |
| 183 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 184 | Thrombosis | FAERS: 1 | SIDER US FAERS | |
| 185 | Transaminases increased | FAERS: 1 | SIDER US FAERS | |
| 186 | Urinary Retention | FAERS: 1 | US FAERS | |
| 187 | Vulvovaginal dryness | FAERS: 1 | US FAERS | |
| 188 | Wound Infection | FAERS: 1 | US FAERS | |
| 189 | jaundice | FAERS: 1 | SIDER US FAERS | |
| 190 | Abdominal Abscess | OFFSIDES | ||
| 191 | Abdominal mass | OFFSIDES | ||
| 192 | Acid reflux | OFFSIDES | ||
| 193 | Acute Coronary Syndrome | SIDER | ||
| 194 | Allodynia | SIDER | ||
| 195 | Anal abscess | OFFSIDES | ||
| 196 | Angina Pectoris | SIDER | ||
| 197 | Anhedonia | OFFSIDES | ||
| 198 | Aphagia | OFFSIDES | ||
| 199 | Atelectasis | OFFSIDES | ||
| 200 | Atrial Flutter | SIDER | ||
| 201 | Atrial tachycardia | OFFSIDES | ||
| 202 | Autonomic neuropathy | OFFSIDES | ||
| 203 | Bacteria urine identified | OFFSIDES | ||
| 204 | Blood albumin increased | OFFSIDES | ||
| 205 | Blood and lymphatic system disorders | SIDER | ||
| 206 | Blood sodium | OFFSIDES | ||
| 207 | Blood uric acid | OFFSIDES | ||
| 208 | Bone marrow toxicity | OFFSIDES | ||
| 209 | Bronchiectasis | OFFSIDES | ||
| 210 | Cancer Pain | OFFSIDES | ||
| 211 | Choking sensation | OFFSIDES | ||
| 212 | Cholecystitis | OFFSIDES | ||
| 213 | Clostridium colitis | OFFSIDES | ||
| 214 | Decreased vibratory sense | SIDER | ||
| 215 | Demyelination | OFFSIDES | ||
| 216 | Dental caries | OFFSIDES | ||
| 217 | Dermatitis | SIDER | ||
| 218 | Device Failure | OFFSIDES | ||
| 219 | Diarrhea | OFFSIDES | ||
| 220 | Disseminated Intravascular Coagulation | OFFSIDES | ||
| 221 | Drowsiness | OFFSIDES | ||
| 222 | Drug withdrawal headache | OFFSIDES | ||
| 223 | Enterococcal infection | OFFSIDES | ||
| 224 | Enterocolitis | SIDER | ||
| 225 | Erosive gastritis | OFFSIDES | ||
| 226 | Febrile bone marrow aplasia | OFFSIDES | ||
| 227 | Feeding tube complication | OFFSIDES | ||
| 228 | Fluid overload | OFFSIDES | ||
| 229 | Gastritis | SIDER | ||
| 230 | Granulocytosis | OFFSIDES | ||
| 231 | Hyporeflexia | SIDER | ||
| 232 | Hysterectomy | OFFSIDES | ||
| 233 | Impaired gastric emptying | SIDER | ||
| 234 | Incontinence | OFFSIDES | ||
| 235 | Infestation | SIDER | ||
| 236 | Kidney Failure | OFFSIDES | ||
| 237 | Large intestine perforation | OFFSIDES | ||
| 238 | Laryngitis | SIDER | ||
| 239 | Leukopenia neonatal | OFFSIDES | ||
| 240 | Leukopenia | SIDER | ||
| 241 | Lower respiratory tract infection | SIDER | ||
| 242 | Lymphocele | OFFSIDES | ||
| 243 | Malnutrition | SIDER | ||
| 244 | Metabolic acidosis | OFFSIDES SIDER | ||
| 245 | Metaplasia | OFFSIDES | ||
| 246 | Multifocal motor neuropathy | SIDER | ||
| 247 | Musculoskeletal chest pain | OFFSIDES | ||
| 248 | Musculoskeletal discomfort | SIDER | ||
| 249 | Myelosuppression | SIDER | ||
| 250 | Neoplasm Metastasis | 18304905 | CTD | |
| 251 | Nephrolithiasis | OFFSIDES SIDER | ||
| 252 | Nervous tension | OFFSIDES | ||
| 253 | Neuromuscular toxicity | SIDER | ||
| 254 | Neuropathy | SIDER | ||
| 255 | Neutropenic infection | SIDER | ||
| 256 | Oliguria | OFFSIDES | ||
| 257 | Osteopenia | OFFSIDES | ||
| 258 | Painful response to normal stimuli | SIDER | ||
| 259 | Peripheral Nervous System Diseases | 26883566 | CTD | |
| 260 | Pharyngolaryngeal Pain | SIDER | ||
| 261 | Pneumoperitoneum | OFFSIDES | ||
| 262 | Productive Cough | OFFSIDES | ||
| 263 | Risus sardonicus | OFFSIDES | ||
| 264 | Sensorimotor disorder | SIDER | ||
| 265 | Shock | SIDER | ||
| 266 | Stevens-Johnson Syndrome | OFFSIDES | ||
| 267 | Taste Disorders | SIDER | ||
| 268 | Thoracotomy | OFFSIDES | ||
| 269 | Tooth Infection | OFFSIDES | ||
| 270 | Trismus | SIDER | ||
| 271 | Unresponsive to stimuli | OFFSIDES | ||
| 272 | Urinary tract infection enterococcal | OFFSIDES | ||
| 273 | Vasculitis | SIDER | ||
| 274 | Ventricular Fibrillation | OFFSIDES | ||
| 275 | Vulvar erosion | OFFSIDES | ||
| 276 | nervous system disorder | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120141
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.