Guanfacine
(DGFYECXYGUIODH-UHFFFAOYSA-N)
Structure
- SMILES
- O=C(Cc1c(Cl)cccc1Cl)N=C(N)N.Cl
- Molecular Formula:
- C9H10Cl3N3O
- Molecular Weight:
- 282.554
- Log P:
- 3.5385
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 3
- TPSA:
- 81.47
- CAS Number(s):
- 29110-48-3; 29520-14-7
Synonym(s)
1.
Guanfacine
2.
BS-100-141
3.
Estulic
4.
Guanfacine Hydrochloride
5.
Guanfacine Monohydrochloride
6.
Lon798
7.
Tenex
8.
BS 100 141
9.
BS100141
10.
Hydrochloride, Guanfacine
11.
Monohydrochloride, Guanfacine
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Syncope | FAERS: 84 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 2 | Somnolence | FAERS: 60 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 3 | Drug ineffective | FAERS: 45 Canada Vigilance: 13 | Canada Vigilance US FAERS | |
| 4 | Hypotension | FAERS: 38 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 5 | Fatigue | FAERS: 37 | US FAERS | |
| 6 | Bradycardia | FAERS: 33 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 7 | Product substitution issue | FAERS: 33 | US FAERS | |
| 8 | No adverse event | FAERS: 29 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 9 | Dizziness | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 10 | Product use issue | FAERS: 27 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 11 | Inappropriate schedule of drug administration | FAERS: 24 | US FAERS | |
| 12 | Headache | FAERS: 23 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 13 | Lethargy | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 14 | Drug dose omission | FAERS: 16 | US FAERS | |
| 15 | Vomiting | FAERS: 16 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 16 | Accidental overdose | FAERS: 13 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 17 | Agitation | FAERS: 13 | US FAERS | |
| 18 | Incorrect dose administered | FAERS: 12 | US FAERS | |
| 19 | Pallor | FAERS: 12 | US FAERS | |
| 20 | Abdominal Pain | FAERS: 11 | US FAERS | |
| 21 | Drug administered to patient of inappropriate age | FAERS: 11 | US FAERS | |
| 22 | Drug dose titration not performed | FAERS: 11 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 23 | Wrong technique in drug usage process | FAERS: 11 | US FAERS | |
| 24 | Wrong technique in product usage process | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 25 | Anger | FAERS: 10 | US FAERS | |
| 26 | Dehydration | FAERS: 10 | US FAERS | |
| 27 | Feeling abnormal | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 28 | Constipation | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 29 | Crying | FAERS: 9 | US FAERS | |
| 30 | Depressed mood | FAERS: 9 | US FAERS | |
| 31 | Product quality issue | FAERS: 9 | US FAERS | |
| 32 | Adverse event | FAERS: 8 | US FAERS | |
| 33 | Anxiety | FAERS: 8 | US FAERS | |
| 34 | Chest Pain | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 35 | Educational problem | FAERS: 8 | US FAERS | |
| 36 | Enuresis | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 37 | Hypersomnia | FAERS: 8 | US FAERS | |
| 38 | Pharmaceutical product complaint | FAERS: 8 | US FAERS | |
| 39 | Accidental exposure to product by child | FAERS: 7 | US FAERS | |
| 40 | Asthenia | FAERS: 7 | US FAERS | |
| 41 | Atrioventricular Block | FAERS: 7 | US FAERS | |
| 42 | Intentional self-injury | FAERS: 7 | US FAERS | |
| 43 | Middle insomnia | FAERS: 7 | US FAERS | |
| 44 | Negativism | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 45 | Palpitations | FAERS: 7 | US FAERS | |
| 46 | Pancreatitis | FAERS: 7 | US FAERS | |
| 47 | Depressed Level of Consciousness | FAERS: 6 | US FAERS | |
| 48 | Initial insomnia | FAERS: 6 | US FAERS | |
| 49 | Malaise | FAERS: 6 | US FAERS | |
| 50 | Mental impairment | FAERS: 6 | US FAERS | |
| 51 | Mood swings | FAERS: 6 | US FAERS | |
| 52 | Nausea | FAERS: 6 | US FAERS | |
| 53 | Overdose | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 54 | Presyncope | FAERS: 6 | US FAERS | |
| 55 | Sinus bradycardia | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 56 | Unresponsive to stimuli | FAERS: 6 | US FAERS | |
| 57 | Emotional disorder | FAERS: 5 | US FAERS | |
| 58 | Epilepsy | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 59 | Restlessness | FAERS: 5 | US FAERS | |
| 60 | Tremor | FAERS: 5 | US FAERS | |
| 61 | Abdominal discomfort | FAERS: 4 | US FAERS | |
| 62 | Drug dispensing error | FAERS: 4 | US FAERS | |
| 63 | Epistaxis | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 64 | Hypersensitivity | FAERS: 4 | US FAERS | |
| 65 | Therapeutic response unexpected | FAERS: 4 | US FAERS | |
| 66 | Urinary Incontinence | FAERS: 4 | US FAERS | |
| 67 | Visual Impairment | FAERS: 4 | US FAERS | |
| 68 | Abasia | FAERS: 3 | US FAERS | |
| 69 | Altered state of consciousness | FAERS: 3 | US FAERS | |
| 70 | Amnesia | FAERS: 3 | US FAERS | |
| 71 | Angina Pectoris | FAERS: 3 | US FAERS | |
| 72 | Arthralgia | FAERS: 3 | US FAERS | |
| 73 | Drug toxicity | FAERS: 3 | US FAERS | |
| 74 | Dysarthria | FAERS: 3 | US FAERS | |
| 75 | Dysgeusia | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 76 | Facial paralysis | FAERS: 3 | US FAERS | |
| 77 | Hallucinations, mixed | FAERS: 3 | US FAERS | |
| 78 | Hyperventilation | FAERS: 3 | US FAERS | |
| 79 | Inappropriate schedule of product administration | FAERS: 3 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 80 | Oppositional Defiant Disorder | FAERS: 3 | US FAERS | |
| 81 | Orthostatic intolerance | FAERS: 3 | US FAERS | |
| 82 | Poor quality sleep | FAERS: 3 | US FAERS | |
| 83 | Screaming | FAERS: 3 | US FAERS | |
| 84 | Somnambulism | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 85 | Suicide attempt | FAERS: 3 | US FAERS | |
| 86 | Unevaluable event | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 87 | Abnormal weight gain | FAERS: 2 | US FAERS | |
| 88 | Abulia | FAERS: 2 | US FAERS | |
| 89 | Alopecia | FAERS: 2 | US FAERS | |
| 90 | Bipolar Disorder | FAERS: 2 | US FAERS | |
| 91 | Blood pressure fluctuation | FAERS: 2 | US FAERS | |
| 92 | Choking | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 93 | Cold sweat | FAERS: 2 | US FAERS | |
| 94 | Deafness | FAERS: 2 | US FAERS | |
| 95 | Diabetes Mellitus | FAERS: 2 | US FAERS | |
| 96 | Disorientation | FAERS: 2 | US FAERS | |
| 97 | Drooling | FAERS: 2 | US FAERS | |
| 98 | Drug prescribing error | FAERS: 2 | US FAERS | |
| 99 | Drug withdrawal syndrome | FAERS: 2 | US FAERS | |
| 100 | Dysuria | FAERS: 2 | US FAERS | |
| 101 | Electroencephalogram abnormal | FAERS: 2 | US FAERS | |
| 102 | Excessive eye blinking | FAERS: 2 | US FAERS | |
| 103 | Feeling jittery | FAERS: 2 | US FAERS | |
| 104 | Flushing | FAERS: 2 | US FAERS | |
| 105 | Gastritis | FAERS: 2 | US FAERS | |
| 106 | Head Banging | FAERS: 2 | US FAERS | |
| 107 | Hostility | FAERS: 2 | US FAERS | |
| 108 | Incoherent | FAERS: 2 | US FAERS | |
| 109 | Incontinence | FAERS: 2 | US FAERS | |
| 110 | Intentional product misuse | FAERS: 2 | US FAERS | |
| 111 | Lower respiratory tract infection | FAERS: 2 | US FAERS | |
| 112 | Nervousness | FAERS: 2 | US FAERS | |
| 113 | Oral administration complication | FAERS: 2 | US FAERS | |
| 114 | Oropharyngeal pain | FAERS: 2 | US FAERS | |
| 115 | Pain | FAERS: 2 | US FAERS | |
| 116 | Paranoia | FAERS: 2 | US FAERS | |
| 117 | Physical assault | FAERS: 2 | US FAERS | |
| 118 | Retching | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 119 | Shock | FAERS: 2 | US FAERS | |
| 120 | Tachycardia | FAERS: 2 | US FAERS | |
| 121 | Tardive Dyskinesia | FAERS: 2 | US FAERS | |
| 122 | Therapy cessation | FAERS: 2 | US FAERS | |
| 123 | Thirst | FAERS: 2 | US FAERS | |
| 124 | Toxicity to various agents | FAERS: 2 | US FAERS | |
| 125 | Urinary Retention | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 126 | Wheezing | FAERS: 2 | US FAERS | |
| 127 | treatment failure | FAERS: 2 | US FAERS | |
| 128 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 129 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 130 | Acute psychosis | FAERS: 1 | US FAERS | |
| 131 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 132 | Blepharospasm | FAERS: 1 | US FAERS | |
| 133 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 134 | Blood urine present | FAERS: 1 | US FAERS | |
| 135 | Bradyphrenia | FAERS: 1 | US FAERS | |
| 136 | Bronchopneumonia | FAERS: 1 | US FAERS | |
| 137 | Carbon dioxide increased | FAERS: 1 | US FAERS | |
| 138 | Cardiac Arrest | FAERS: 1 | US FAERS | |
| 139 | Cardioactive drug level | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 140 | Cardioactive drug level increased | FAERS: 1 | US FAERS | |
| 141 | Cataract | FAERS: 1 | US FAERS | |
| 142 | Chills | FAERS: 1 | US FAERS | |
| 143 | Chromaturia | FAERS: 1 | US FAERS | |
| 144 | Circumstance or information capable of leading to medication error | FAERS: 1 | US FAERS | |
| 145 | Completed Suicide | FAERS: 1 | US FAERS | |
| 146 | Cyanosis | FAERS: 1 | US FAERS | |
| 147 | Cytopenia | FAERS: 1 | US FAERS | |
| 148 | Death of relative | FAERS: 1 | US FAERS | |
| 149 | Delirium | FAERS: 1 | US FAERS | |
| 150 | Dependence | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 151 | Diabetes mellitus inadequate control | FAERS: 1 | US FAERS | |
| 152 | Diplegia | FAERS: 1 | US FAERS | |
| 153 | Dissociation | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 154 | Dissociative disorder | FAERS: 1 | US FAERS | |
| 155 | Drug effect variable | FAERS: 1 | US FAERS | |
| 156 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 157 | Drug titration error | FAERS: 1 | US FAERS | |
| 158 | Dysphonia | FAERS: 1 | US FAERS | |
| 159 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 160 | Emotional distress | FAERS: 1 | US FAERS | |
| 161 | Erectile dysfunction | FAERS: 1 | US FAERS | |
| 162 | Erythema Nodosum | FAERS: 1 | US FAERS | |
| 163 | Expired product administered | FAERS: 1 | US FAERS | |
| 164 | Exposure via inhalation | FAERS: 1 | US FAERS | |
| 165 | Eye pain | FAERS: 1 | US FAERS | |
| 166 | Feelings of worthlessness | FAERS: 1 | US FAERS | |
| 167 | Female sexual dysfunction | FAERS: 1 | US FAERS | |
| 168 | Flat affect | FAERS: 1 | US FAERS | |
| 169 | Formication | FAERS: 1 | US FAERS | |
| 170 | Gastrointestinal infection | FAERS: 1 | US FAERS | |
| 171 | Gastrointestinal inflammation | FAERS: 1 | US FAERS | |
| 172 | Glaucoma | FAERS: 1 | US FAERS | |
| 173 | Grief reaction | FAERS: 1 | US FAERS | |
| 174 | Head discomfort | FAERS: 1 | US FAERS | |
| 175 | Hepatitis | FAERS: 1 | US FAERS | |
| 176 | Hyperacusis | FAERS: 1 | US FAERS | |
| 177 | Hyperphagia | FAERS: 1 | US FAERS | |
| 178 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 179 | Hypertensive emergency | FAERS: 1 | US FAERS | |
| 180 | Hypokinesia | FAERS: 1 | US FAERS | |
| 181 | Hypomania | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 182 | Immune thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 183 | Impatience | FAERS: 1 | US FAERS | |
| 184 | Infection | FAERS: 1 | US FAERS | |
| 185 | Intellectual Disability | FAERS: 1 | US FAERS | |
| 186 | Intentional drug misuse | FAERS: 1 | US FAERS | |
| 187 | Intentional product use issue | FAERS: 1 | US FAERS | |
| 188 | Irritable Bowel Syndrome | FAERS: 1 | US FAERS | |
| 189 | Ketoacidosis | FAERS: 1 | US FAERS | |
| 190 | Labile blood pressure | FAERS: 1 | US FAERS | |
| 191 | Lip swelling | FAERS: 1 | US FAERS | |
| 192 | Malignant Hypertension | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 193 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 194 | Medication Error | FAERS: 1 | US FAERS | |
| 195 | Memory impairment | FAERS: 1 | US FAERS | |
| 196 | Mental status changes | FAERS: 1 | US FAERS | |
| 197 | Morose | FAERS: 1 | US FAERS | |
| 198 | Narcolepsy | FAERS: 1 | US FAERS | |
| 199 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 200 | Near Drowning | FAERS: 1 | US FAERS | |
| 201 | Neck Pain | FAERS: 1 | US FAERS | |
| 202 | Negative thoughts | FAERS: 1 | US FAERS | |
| 203 | Neutrophil count decreased | FAERS: 1 | US FAERS | |
| 204 | Nystagmus | FAERS: 1 | US FAERS | |
| 205 | Obsessive-Compulsive Disorder | FAERS: 1 | US FAERS | |
| 206 | Oculogyric crisis | FAERS: 1 | US FAERS | |
| 207 | Overweight | FAERS: 1 | US FAERS | |
| 208 | Parkinsonian rest tremor | FAERS: 1 | US FAERS | |
| 209 | Personality Change | FAERS: 1 | US FAERS | |
| 210 | Posturing | FAERS: 1 | US FAERS | |
| 211 | Prescribed overdose | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 212 | Product administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 213 | Product contamination | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 214 | Product use complaint | FAERS: 1 | US FAERS | |
| 215 | Protein urine present | FAERS: 1 | US FAERS | |
| 216 | Pruritus | FAERS: 1 | US FAERS | |
| 217 | Psychiatric symptom | FAERS: 1 | US FAERS | |
| 218 | Psychomotor skills impaired | FAERS: 1 | US FAERS | |
| 219 | Psychotic symptom | FAERS: 1 | US FAERS | |
| 220 | Pulmonary congestion | FAERS: 1 | US FAERS | |
| 221 | Rash erythematous | FAERS: 1 | US FAERS | |
| 222 | Reaction to drug excipients | FAERS: 1 | US FAERS | |
| 223 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 224 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 225 | Scab | FAERS: 1 | US FAERS | |
| 226 | Sinus Arrhythmia | FAERS: 1 | US FAERS | |
| 227 | Skin reaction | FAERS: 1 | US FAERS | |
| 228 | Sleep Talking | FAERS: 1 | US FAERS | |
| 229 | Sluggishness | FAERS: 1 | US FAERS | |
| 230 | Sneezing | FAERS: 1 | US FAERS | |
| 231 | Streptococcus test positive | FAERS: 1 | US FAERS | |
| 232 | Suspected product contamination | FAERS: 1 | US FAERS | |
| 233 | Thrombocytosis | FAERS: 1 | US FAERS | |
| 234 | Tinnitus | FAERS: 1 | US FAERS | |
| 235 | Tongue pruritus | FAERS: 1 | US FAERS | |
| 236 | Tongue spasm | FAERS: 1 | US FAERS | |
| 237 | Tonsillitis | FAERS: 1 | US FAERS | |
| 238 | Toothache | FAERS: 1 | US FAERS | |
| 239 | Trismus | FAERS: 1 | US FAERS | |
| 240 | Urticaria | FAERS: 1 | US FAERS | |
| 241 | Vasculitis | FAERS: 1 | US FAERS | |
| 242 | Vertigo | FAERS: 1 | US FAERS | |
| 243 | White blood cell count decreased | FAERS: 1 | US FAERS | |
| 244 | Withdrawal hypertension | FAERS: 1 | US FAERS | |
| 245 | Wolff-Parkinson-White Syndrome | FAERS: 1 | US FAERS | |
| 246 | ovarian neoplasm | FAERS: 1 | US FAERS | |
| 247 | Therapeutic product effect decreased | Canada Vigilance: 1 | Canada Vigilance | |
| 248 | Therapeutic product effect increased | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.