diclofenac hydroxyethylpyrrolidine
(DCERVXIINVUMKU-UHFFFAOYSA-N)
Structure
- SMILES
- OC(=O)Cc1ccccc1Nc1c(Cl)cccc1Cl.OCCN1CCCC1
- Molecular Formula:
- C20H24Cl2N2O3
- Molecular Weight:
- 411.322
- Log P:
- 4.4495
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 3
- TPSA:
- 72.8
- CAS Number(s):
- 119623-66-4
Synonym(s)
1.
diclofenac hydroxyethylpyrrolidine
2.
DHEP
3.
DIEP
4.
Flector
5.
N-(2-hydroxyethyl)pyrrolidinium (2-((2,6-dichlorophenyl)amino)phenyl)acetate
6.
diclofenac 1-(2-hydroxyethyl)pyrrolidinium salt
7.
diclofenac-N-(2-hydroxyethyl) pyrrolidine
8.
diclofenac-epolamine
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 341 | US FAERS | |
| 2 | Nausea | FAERS: 82 | US FAERS | |
| 3 | Pain | FAERS: 68 | US FAERS | |
| 4 | Dizziness | FAERS: 61 | US FAERS | |
| 5 | Headache | FAERS: 54 | US FAERS | |
| 6 | Product adhesion issue | FAERS: 49 | US FAERS | |
| 7 | Malaise | FAERS: 46 | US FAERS | |
| 8 | Pruritus | FAERS: 44 | US FAERS | |
| 9 | Application site pain | FAERS: 42 | US FAERS | |
| 10 | Application site rash | FAERS: 36 | US FAERS | |
| 11 | Abdominal discomfort | FAERS: 31 | US FAERS | |
| 12 | Feeling abnormal | FAERS: 30 | US FAERS | |
| 13 | Drug effect incomplete | FAERS: 27 | US FAERS | |
| 14 | Product quality issue | FAERS: 26 | US FAERS | |
| 15 | Product use in unapproved indication | FAERS: 25 | US FAERS | |
| 16 | Vomiting | FAERS: 25 | US FAERS | |
| 17 | Application site erythema | FAERS: 24 | US FAERS | |
| 18 | Hypersensitivity | FAERS: 24 | US FAERS | |
| 19 | Chest Pain | FAERS: 23 | US FAERS | |
| 20 | Erythema | FAERS: 23 | US FAERS | |
| 21 | Intentional product misuse | FAERS: 23 | US FAERS | |
| 22 | Product use issue | FAERS: 23 | US FAERS | |
| 23 | Skin irritation | FAERS: 21 | US FAERS | |
| 24 | Application site irritation | FAERS: 19 | US FAERS | |
| 25 | Drug ineffective for unapproved indication | FAERS: 19 | US FAERS | |
| 26 | Abdominal Pain | FAERS: 17 | US FAERS | |
| 27 | Fatigue | FAERS: 17 | US FAERS | |
| 28 | Application site pruritus | FAERS: 16 | US FAERS | |
| 29 | Somnolence | FAERS: 16 | US FAERS | |
| 30 | Arthralgia | FAERS: 15 | US FAERS | |
| 31 | No adverse event | FAERS: 15 | US FAERS | |
| 32 | Palpitations | FAERS: 15 | US FAERS | |
| 33 | Poor quality drug administered | FAERS: 14 | US FAERS | |
| 34 | Asthenia | FAERS: 13 | US FAERS | |
| 35 | Burning sensation | FAERS: 13 | US FAERS | |
| 36 | Drug effective for unapproved indication | FAERS: 13 | US FAERS | |
| 37 | Urticaria | FAERS: 13 | US FAERS | |
| 38 | Joint swelling | FAERS: 11 | US FAERS | |
| 39 | Tinnitus | FAERS: 11 | US FAERS | |
| 40 | Wrong technique in drug usage process | FAERS: 11 | US FAERS | |
| 41 | Application site reaction | FAERS: 10 | US FAERS | |
| 42 | Back Pain | FAERS: 10 | US FAERS | |
| 43 | Dysuria | FAERS: 9 | US FAERS | |
| 44 | Product size issue | FAERS: 9 | US FAERS | |
| 45 | Swelling | FAERS: 9 | US FAERS | |
| 46 | Application site burn | FAERS: 8 | US FAERS | |
| 47 | Application site vesicles | FAERS: 8 | US FAERS | |
| 48 | Cold sweat | FAERS: 8 | US FAERS | |
| 49 | Drug diversion | FAERS: 8 | US FAERS | |
| 50 | Neck Pain | FAERS: 8 | US FAERS | |
| 51 | Ulcer | FAERS: 8 | US FAERS | |
| 52 | Anxiety | FAERS: 7 | US FAERS | |
| 53 | Blood glucose increased | FAERS: 7 | US FAERS | |
| 54 | Cerebrovascular accident | FAERS: 7 | US FAERS | |
| 55 | Chills | FAERS: 7 | US FAERS | |
| 56 | Dyspepsia | FAERS: 7 | US FAERS | |
| 57 | Flushing | FAERS: 7 | US FAERS | |
| 58 | Musculoskeletal Pain | FAERS: 7 | US FAERS | |
| 59 | Peripheral swelling | FAERS: 7 | US FAERS | |
| 60 | Tremor | FAERS: 7 | US FAERS | |
| 61 | Wrong technique in product usage process | FAERS: 7 | US FAERS | |
| 62 | Accidental exposure | FAERS: 6 | US FAERS | |
| 63 | Alopecia | FAERS: 6 | US FAERS | |
| 64 | Application site hypersensitivity | FAERS: 6 | US FAERS | |
| 65 | Application site warmth | FAERS: 6 | US FAERS | |
| 66 | Arthritis | FAERS: 6 | US FAERS | |
| 67 | Disorientation | FAERS: 6 | US FAERS | |
| 68 | Dysgeusia | FAERS: 6 | US FAERS | |
| 69 | Expired product administered | FAERS: 6 | US FAERS | |
| 70 | Incorrect dose administered | FAERS: 6 | US FAERS | |
| 71 | Incorrect drug administration duration | FAERS: 6 | US FAERS | |
| 72 | Product physical issue | FAERS: 6 | US FAERS | |
| 73 | Rash erythematous | FAERS: 6 | US FAERS | |
| 74 | Skin reaction | FAERS: 6 | US FAERS | |
| 75 | Vertigo | FAERS: 6 | US FAERS | |
| 76 | Weight decreased | FAERS: 6 | US FAERS | |
| 77 | Application site swelling | FAERS: 5 | US FAERS | |
| 78 | Back disorder | FAERS: 5 | US FAERS | |
| 79 | Constipation | FAERS: 5 | US FAERS | |
| 80 | Epistaxis | FAERS: 5 | US FAERS | |
| 81 | Feeling jittery | FAERS: 5 | US FAERS | |
| 82 | Influenza | FAERS: 5 | US FAERS | |
| 83 | Myocardial Infarction | FAERS: 5 | US FAERS | |
| 84 | Poor quality product administered | FAERS: 5 | US FAERS | |
| 85 | Therapeutic response unexpected | FAERS: 5 | US FAERS | |
| 86 | Thrombosis | FAERS: 5 | US FAERS | |
| 87 | Visual Impairment | FAERS: 5 | US FAERS | |
| 88 | Application site discomfort | FAERS: 4 | US FAERS | |
| 89 | Application site exfoliation | FAERS: 4 | US FAERS | |
| 90 | Asthma | FAERS: 4 | US FAERS | |
| 91 | Deafness | FAERS: 4 | US FAERS | |
| 92 | Dementia | FAERS: 4 | US FAERS | |
| 93 | Drug administration error | FAERS: 4 | US FAERS | |
| 94 | Drug prescribing error | FAERS: 4 | US FAERS | |
| 95 | Gastritis | FAERS: 4 | US FAERS | |
| 96 | Intentional drug misuse | FAERS: 4 | US FAERS | |
| 97 | Lethargy | FAERS: 4 | US FAERS | |
| 98 | Myalgia | FAERS: 4 | US FAERS | |
| 99 | Nasopharyngitis | FAERS: 4 | US FAERS | |
| 100 | Nervousness | FAERS: 4 | US FAERS | |
| 101 | Neuralgia | FAERS: 4 | US FAERS | |
| 102 | Overdose | FAERS: 4 | US FAERS | |
| 103 | Pre-existing condition improved | FAERS: 4 | US FAERS | |
| 104 | Purpura | FAERS: 4 | US FAERS | |
| 105 | Therapeutic product effect incomplete | FAERS: 4 | US FAERS | |
| 106 | Anaphylactic shock | FAERS: 3 | US FAERS | |
| 107 | Application site ulcer | FAERS: 3 | US FAERS | |
| 108 | Application site urticaria | FAERS: 3 | US FAERS | |
| 109 | Chromaturia | FAERS: 3 | US FAERS | |
| 110 | Drug screen false positive | FAERS: 3 | US FAERS | |
| 111 | Expired drug administered | FAERS: 3 | US FAERS | |
| 112 | Feeling Cold | FAERS: 3 | US FAERS | |
| 113 | Gastrointestinal Pain | FAERS: 3 | US FAERS | |
| 114 | Hypotension | FAERS: 3 | US FAERS | |
| 115 | Inappropriate schedule of drug administration | FAERS: 3 | US FAERS | |
| 116 | Presyncope | FAERS: 3 | US FAERS | |
| 117 | Sneezing | FAERS: 3 | US FAERS | |
| 118 | Urinary Retention | FAERS: 3 | US FAERS | |
| 119 | Vulvovaginal mycotic infection | FAERS: 3 | US FAERS | |
| 120 | Adverse event | FAERS: 2 | US FAERS | |
| 121 | Agitation | FAERS: 2 | US FAERS | |
| 122 | Amnesia | FAERS: 2 | US FAERS | |
| 123 | Application site dryness | FAERS: 2 | US FAERS | |
| 124 | Application site erosion | FAERS: 2 | US FAERS | |
| 125 | Application site perspiration | FAERS: 2 | US FAERS | |
| 126 | Arthropathy | FAERS: 2 | US FAERS | |
| 127 | Asthenopia | FAERS: 2 | US FAERS | |
| 128 | Atrial Fibrillation | FAERS: 2 | US FAERS | |
| 129 | Blood blister | FAERS: 2 | US FAERS | |
| 130 | Blood urine present | FAERS: 2 | US FAERS | |
| 131 | Chest discomfort | FAERS: 2 | US FAERS | |
| 132 | Circumstance or information capable of leading to medication error | FAERS: 2 | US FAERS | |
| 133 | Conjunctivitis | FAERS: 2 | US FAERS | |
| 134 | Crystalluria | FAERS: 2 | US FAERS | |
| 135 | Dermatitis | FAERS: 2 | US FAERS | |
| 136 | Drug administered at inappropriate site | FAERS: 2 | US FAERS | |
| 137 | Drug dispensing error | FAERS: 2 | US FAERS | |
| 138 | Drug screen positive | FAERS: 2 | US FAERS | |
| 139 | Excoriation | FAERS: 2 | US FAERS | |
| 140 | Eye pain | FAERS: 2 | US FAERS | |
| 141 | Fibromyalgia | FAERS: 2 | US FAERS | |
| 142 | Formication | FAERS: 2 | US FAERS | |
| 143 | Gait inability | FAERS: 2 | US FAERS | |
| 144 | Gallbladder pain | FAERS: 2 | US FAERS | |
| 145 | Implant site irritation | FAERS: 2 | US FAERS | |
| 146 | Infection | FAERS: 2 | US FAERS | |
| 147 | Inflammation | FAERS: 2 | US FAERS | |
| 148 | Limb discomfort | FAERS: 2 | US FAERS | |
| 149 | Lip swelling | FAERS: 2 | US FAERS | |
| 150 | Memory impairment | FAERS: 2 | US FAERS | |
| 151 | Musculoskeletal stiffness | FAERS: 2 | US FAERS | |
| 152 | Nuchal Rigidity | FAERS: 2 | US FAERS | |
| 153 | Onychoclasis | FAERS: 2 | US FAERS | |
| 154 | Oropharyngeal discomfort | FAERS: 2 | US FAERS | |
| 155 | Oropharyngeal pain | FAERS: 2 | US FAERS | |
| 156 | Photophobia | FAERS: 2 | US FAERS | |
| 157 | Pneumonia | FAERS: 2 | US FAERS | |
| 158 | Prescribed overdose | FAERS: 2 | US FAERS | |
| 159 | Product dispensing error | FAERS: 2 | US FAERS | |
| 160 | Product dose omission | FAERS: 2 | US FAERS | |
| 161 | Sciatica | FAERS: 2 | US FAERS | |
| 162 | Skin lesion | FAERS: 2 | US FAERS | |
| 163 | Tachycardia | FAERS: 2 | US FAERS | |
| 164 | Vaginal Discharge | FAERS: 2 | US FAERS | |
| 165 | Wheelchair user | FAERS: 2 | US FAERS | |
| 166 | treatment failure | FAERS: 2 | US FAERS | |
| 167 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 168 | Adiposis Dolorosa | FAERS: 1 | US FAERS | |
| 169 | Administration site rash | FAERS: 1 | US FAERS | |
| 170 | Administration site warmth | FAERS: 1 | US FAERS | |
| 171 | Ageusia | FAERS: 1 | US FAERS | |
| 172 | Alanine Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 173 | Alcohol problem | FAERS: 1 | US FAERS | |
| 174 | Allergic reaction to excipient | FAERS: 1 | US FAERS | |
| 175 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 176 | Angiolipoma | FAERS: 1 | US FAERS | |
| 177 | Ankle Fracture | FAERS: 1 | US FAERS | |
| 178 | Application site cellulitis | FAERS: 1 | US FAERS | |
| 179 | Application site discharge | FAERS: 1 | US FAERS | |
| 180 | Application site eczema | FAERS: 1 | US FAERS | |
| 181 | Application site inflammation | FAERS: 1 | US FAERS | |
| 182 | Aspartate Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 183 | Blood triglycerides increased | FAERS: 1 | US FAERS | |
| 184 | Bone pain | FAERS: 1 | US FAERS | |
| 185 | Breath alcohol test positive | FAERS: 1 | US FAERS | |
| 186 | Bursitis | FAERS: 1 | US FAERS | |
| 187 | Cardiac Arrest | FAERS: 1 | US FAERS | |
| 188 | Cataract | FAERS: 1 | US FAERS | |
| 189 | Cellulitis | FAERS: 1 | US FAERS | |
| 190 | Cerebellar infarction | FAERS: 1 | US FAERS | |
| 191 | Cerebral disorder | FAERS: 1 | US FAERS | |
| 192 | Dehydration | FAERS: 1 | US FAERS | |
| 193 | Device Failure | FAERS: 1 | US FAERS | |
| 194 | Device breakage | FAERS: 1 | US FAERS | |
| 195 | Device related infection | FAERS: 1 | US FAERS | |
| 196 | Discomfort | FAERS: 1 | US FAERS | |
| 197 | Disease recurrence | FAERS: 1 | US FAERS | |
| 198 | Dysphemia | FAERS: 1 | US FAERS | |
| 199 | Economic problem | FAERS: 1 | US FAERS | |
| 200 | Euphoric mood | FAERS: 1 | US FAERS | |
| 201 | Eye irritation | FAERS: 1 | US FAERS | |
| 202 | Facial Pain | FAERS: 1 | US FAERS | |
| 203 | Factor V deficiency | FAERS: 1 | US FAERS | |
| 204 | False positive investigation result | FAERS: 1 | US FAERS | |
| 205 | Fear of falling | FAERS: 1 | US FAERS | |
| 206 | Flatulence | FAERS: 1 | US FAERS | |
| 207 | Glaucoma | FAERS: 1 | US FAERS | |
| 208 | Head discomfort | FAERS: 1 | US FAERS | |
| 209 | Hip swelling | FAERS: 1 | US FAERS | |
| 210 | Hypersomnia | FAERS: 1 | US FAERS | |
| 211 | Hyperventilation | FAERS: 1 | US FAERS | |
| 212 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 213 | Incoherent | FAERS: 1 | US FAERS | |
| 214 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 215 | Increased tendency to bruise | FAERS: 1 | US FAERS | |
| 216 | Initial insomnia | FAERS: 1 | US FAERS | |
| 217 | Intestinal Obstruction | FAERS: 1 | US FAERS | |
| 218 | Irritable Bowel Syndrome | FAERS: 1 | US FAERS | |
| 219 | Joint injury | FAERS: 1 | US FAERS | |
| 220 | Joint warmth | FAERS: 1 | US FAERS | |
| 221 | Limb injury | FAERS: 1 | US FAERS | |
| 222 | Lipoatrophy | FAERS: 1 | US FAERS | |
| 223 | Lipoma | FAERS: 1 | US FAERS | |
| 224 | Malnutrition | FAERS: 1 | US FAERS | |
| 225 | Medical device complication | FAERS: 1 | US FAERS | |
| 226 | Meniscus injury | FAERS: 1 | US FAERS | |
| 227 | Menorrhagia | FAERS: 1 | US FAERS | |
| 228 | Mental status changes | FAERS: 1 | US FAERS | |
| 229 | Mood swings | FAERS: 1 | US FAERS | |
| 230 | Muscle strain | FAERS: 1 | US FAERS | |
| 231 | Muscle tightness | FAERS: 1 | US FAERS | |
| 232 | Musculoskeletal discomfort | FAERS: 1 | US FAERS | |
| 233 | Opiates positive | FAERS: 1 | US FAERS | |
| 234 | Oral pain | FAERS: 1 | US FAERS | |
| 235 | Oropharyngeal blistering | FAERS: 1 | US FAERS | |
| 236 | Peripheral artery occlusion | FAERS: 1 | US FAERS | |
| 237 | Petechiae | FAERS: 1 | US FAERS | |
| 238 | Pharmaceutical product complaint | FAERS: 1 | US FAERS | |
| 239 | Product complaint | FAERS: 1 | US FAERS | |
| 240 | Psoriasis | FAERS: 1 | US FAERS | |
| 241 | Reaction to excipient | FAERS: 1 | US FAERS | |
| 242 | Rheumatoid Nodule | FAERS: 1 | US FAERS | |
| 243 | Sensitivity to weather change | FAERS: 1 | US FAERS | |
| 244 | Sinusitis | FAERS: 1 | US FAERS | |
| 245 | Sunburn | FAERS: 1 | US FAERS | |
| 246 | Syncope | FAERS: 1 | US FAERS | |
| 247 | Therapeutic product effect decreased | FAERS: 1 | US FAERS | |
| 248 | Therapeutic response changed | FAERS: 1 | US FAERS | |
| 249 | Therapeutic response delayed | FAERS: 1 | US FAERS | |
| 250 | Thermal burn | FAERS: 1 | US FAERS | |
| 251 | Throat cancer | FAERS: 1 | US FAERS | |
| 252 | Throat irritation | FAERS: 1 | US FAERS | |
| 253 | Toxic Epidermal Necrolysis | FAERS: 1 | US FAERS | |
| 254 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 255 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 256 | Urinary hesitation | FAERS: 1 | US FAERS | |
| 257 | Urine alcohol test positive | FAERS: 1 | US FAERS | |
| 258 | Urine flow decreased | FAERS: 1 | US FAERS | |
| 259 | Vascular rupture | FAERS: 1 | US FAERS | |
| 260 | Vulvovaginal discomfort | FAERS: 1 | US FAERS | |
| 261 | Vulvovaginal rash | FAERS: 1 | US FAERS | |
| 262 | White blood cell count abnormal | FAERS: 1 | US FAERS | |
| 263 | Wound dehiscence | FAERS: 1 | US FAERS | |
| 264 | jaundice | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.