Prezcobix
(CXORHDVSJFELCV-HWDLLDTBSA-N)
Structure
- SMILES
- O=C(N[C@@H](Cc1ccccc1)CC[C@H](Cc1ccccc1)NC(=O)[C@@H](NC(=O)N(Cc1csc(n1)C(C)C)C)CCN1CCOCC1)OCc1cncs1.CC(CN(S(=O)(=O)c1ccc(cc1)N)C[C@H]([C@H](Cc1ccccc1)NC(=O)O[C@H]1CO[C@@H]2[C@H]1CCO2)O)C
- Molecular Formula:
- C67H90N10O12S3
- Molecular Weight:
- 1323.690
- Log P:
- 11.5395
- Hydrogen Bond Acceptor:
- 24
- Hydrogen Bond Donor:
- 6
- TPSA:
- 343.3
- CAS Number(s):
- N/A
Synonym(s)
1.
Prezcobix
External Link(s)
| PubChem Compound | 57327017 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Nausea | FAERS: 21 | US FAERS | |
| 2 | Headache | FAERS: 15 | US FAERS | |
| 3 | Drug dose omission | FAERS: 11 | US FAERS | |
| 4 | Vomiting | FAERS: 9 | US FAERS | |
| 5 | Arthralgia | FAERS: 7 | US FAERS | |
| 6 | Blood creatinine increased | FAERS: 7 | US FAERS | |
| 7 | Adverse event | FAERS: 6 | US FAERS | |
| 8 | Fatigue | FAERS: 6 | US FAERS | |
| 9 | Pruritus | FAERS: 6 | US FAERS | |
| 10 | Abdominal discomfort | FAERS: 5 | US FAERS | |
| 11 | Drug ineffective | FAERS: 5 | US FAERS | |
| 12 | Dizziness | FAERS: 4 | US FAERS | |
| 13 | Feeling abnormal | FAERS: 4 | US FAERS | |
| 14 | Product size issue | FAERS: 4 | US FAERS | |
| 15 | Product use complaint | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 16 | Inappropriate schedule of drug administration | FAERS: 3 | US FAERS | |
| 17 | Malaise | FAERS: 3 | US FAERS | |
| 18 | Myalgia | FAERS: 3 | US FAERS | |
| 19 | Myocardial Infarction | FAERS: 3 | US FAERS | |
| 20 | Therapy cessation | FAERS: 3 | US FAERS | |
| 21 | Urticaria | FAERS: 3 | US FAERS | |
| 22 | Viral load increased | FAERS: 3 | US FAERS | |
| 23 | Wrong technique in product usage process | FAERS: 3 | US FAERS | |
| 24 | Abdominal Pain | FAERS: 2 | US FAERS | |
| 25 | Asthenia | FAERS: 2 | US FAERS | |
| 26 | Blood HIV RNA increased | FAERS: 2 | US FAERS | |
| 27 | Diabetes Mellitus | FAERS: 2 | US FAERS | |
| 28 | Drug dispensing error | FAERS: 2 | US FAERS | |
| 29 | Drug prescribing error | FAERS: 2 | US FAERS | |
| 30 | Drug screen positive | FAERS: 2 | US FAERS | |
| 31 | Flatulence | FAERS: 2 | US FAERS | |
| 32 | Incorrect product storage | FAERS: 2 | US FAERS | |
| 33 | Medication residue present | FAERS: 2 | US FAERS | |
| 34 | Middle insomnia | FAERS: 2 | US FAERS | |
| 35 | Pain | FAERS: 2 | US FAERS | |
| 36 | Poor quality drug administered | FAERS: 2 | US FAERS | |
| 37 | Product physical issue | FAERS: 2 | US FAERS | |
| 38 | Product storage error | FAERS: 2 | US FAERS | |
| 39 | Somnolence | FAERS: 2 | US FAERS | |
| 40 | Visual Impairment | FAERS: 2 | US FAERS | |
| 41 | Weight decreased | FAERS: 2 | US FAERS | |
| 42 | Abdominal rigidity | FAERS: 1 | US FAERS | |
| 43 | Accidental overdose | FAERS: 1 | US FAERS | |
| 44 | Acne | FAERS: 1 | US FAERS | |
| 45 | Acute hepatitis C | FAERS: 1 | US FAERS | |
| 46 | Agitation | FAERS: 1 | US FAERS | |
| 47 | Anxiety | FAERS: 1 | US FAERS | |
| 48 | Back Pain | FAERS: 1 | US FAERS | |
| 49 | Blood HIV RNA | FAERS: 1 | US FAERS | |
| 50 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 51 | Blood creatine increased | FAERS: 1 | US FAERS | |
| 52 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 53 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 54 | Blood triglycerides increased | FAERS: 1 | US FAERS | |
| 55 | Bone pain | FAERS: 1 | US FAERS | |
| 56 | CD4 Lymphocytes Decreased | FAERS: 1 | US FAERS | |
| 57 | Cerebral Infarction | FAERS: 1 | US FAERS | |
| 58 | Cerebral artery occlusion | FAERS: 1 | US FAERS | |
| 59 | Cerebral artery stenosis | FAERS: 1 | US FAERS | |
| 60 | Chest Pain | FAERS: 1 | US FAERS | |
| 61 | Chills | FAERS: 1 | US FAERS | |
| 62 | Choking | FAERS: 1 | US FAERS | |
| 63 | Chromaturia | FAERS: 1 | US FAERS | |
| 64 | Clostridium difficile infection | FAERS: 1 | US FAERS | |
| 65 | Conjunctivitis | FAERS: 1 | US FAERS | |
| 66 | Constipation | FAERS: 1 | US FAERS | |
| 67 | Crying | FAERS: 1 | US FAERS | |
| 68 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 69 | Drowning | FAERS: 1 | US FAERS | |
| 70 | Drug administered at inappropriate site | FAERS: 1 | US FAERS | |
| 71 | Drug resistance | FAERS: 1 | US FAERS | |
| 72 | Dry skin | FAERS: 1 | US FAERS | |
| 73 | Economic problem | FAERS: 1 | US FAERS | |
| 74 | Eczema | FAERS: 1 | US FAERS | |
| 75 | Erectile dysfunction | FAERS: 1 | US FAERS | |
| 76 | Erythema | FAERS: 1 | US FAERS | |
| 77 | Gangrene | FAERS: 1 | US FAERS | |
| 78 | Gastrostomy | FAERS: 1 | US FAERS | |
| 79 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 80 | Genitourinary operation | FAERS: 1 | US FAERS | |
| 81 | Immune Reconstitution Inflammatory Syndrome | FAERS: 1 | US FAERS | |
| 82 | Impaired work ability | FAERS: 1 | US FAERS | |
| 83 | Inability to afford medication | FAERS: 1 | US FAERS | |
| 84 | Inflammation | FAERS: 1 | US FAERS | |
| 85 | Lip swelling | FAERS: 1 | US FAERS | |
| 86 | Lipodystrophy acquired | FAERS: 1 | US FAERS | |
| 87 | Medication Error | FAERS: 1 | US FAERS | |
| 88 | Nephrolithiasis | FAERS: 1 | US FAERS | |
| 89 | Night sweats | FAERS: 1 | US FAERS | |
| 90 | Oral candidiasis | FAERS: 1 | US FAERS | |
| 91 | Ototoxicity | FAERS: 1 | US FAERS | |
| 92 | Pancreatitis | FAERS: 1 | US FAERS | |
| 93 | Pathogen resistance | FAERS: 1 | US FAERS | |
| 94 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 95 | Product difficult to swallow | FAERS: 1 | US FAERS | |
| 96 | Product dose omission | FAERS: 1 | US FAERS | |
| 97 | Product packaging quantity issue | FAERS: 1 | US FAERS | |
| 98 | Productive Cough | FAERS: 1 | US FAERS | |
| 99 | Pulmonary Hypertension | FAERS: 1 | US FAERS | |
| 100 | Rhabdomyolysis | FAERS: 1 | US FAERS | |
| 101 | Serotonin Syndrome | FAERS: 1 | US FAERS | |
| 102 | Skin Erosion | FAERS: 1 | US FAERS | |
| 103 | Skin reaction | FAERS: 1 | US FAERS | |
| 104 | Sluggishness | FAERS: 1 | US FAERS | |
| 105 | Sperm concentration decreased | FAERS: 1 | US FAERS | |
| 106 | Stress | FAERS: 1 | US FAERS | |
| 107 | Symptom recurrence | FAERS: 1 | US FAERS | |
| 108 | Tremor | FAERS: 1 | US FAERS | |
| 109 | Urinary Retention | FAERS: 1 | US FAERS | |
| 110 | Urinary tract infection | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120238
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.