tegaserod
(CPDDZSSEAVLMRY-QUZUWDHUSA-N)
Structure
- SMILES
- OC(=O)/C=C/C(=O)O.CCCCCN=C(N/N=C/c1c[nH]c2c1cc(OC)cc2)N
- Molecular Formula:
- C20H27N5O5
- Molecular Weight:
- 417.459
- Log P:
- 3.4079
- Hydrogen Bond Acceptor:
- 9
- Hydrogen Bond Donor:
- 5
- TPSA:
- 162.39
- CAS Number(s):
- 145158-71-0; 189188-57-6; 1184963-48-1
Synonym(s)
1.
tegaserod
2.
5-methoxyindol-3-carboxaldehyde amino(pentylamino)methylenehydrazone hydrogen maleate
3.
HTF 919
4.
SDZ HTF 919
5.
SDZ HTF-919
6.
Zelmac
7.
Zelnorm
8.
tegaserod maleate
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Abdominal Pain | FAERS: 26 | US FAERS | |
| 2 | Dizziness | FAERS: 17 | US FAERS | |
| 3 | Headache | FAERS: 14 | US FAERS | |
| 4 | Hypotension | FAERS: 12 | US FAERS | |
| 5 | Malaise | FAERS: 12 | US FAERS | |
| 6 | Constipation | FAERS: 11 | US FAERS | |
| 7 | Intestinal Obstruction | FAERS: 11 | US FAERS | |
| 8 | Asthenia | FAERS: 10 | US FAERS | |
| 9 | Drug exposure during pregnancy | FAERS: 10 | US FAERS | |
| 10 | Drug ineffective | FAERS: 9 | US FAERS | |
| 11 | Tachycardia | FAERS: 9 | US FAERS | |
| 12 | Gastritis | FAERS: 8 | US FAERS | |
| 13 | Hypersensitivity | FAERS: 8 | US FAERS | |
| 14 | Vomiting | FAERS: 8 | US FAERS | |
| 15 | Feeling abnormal | FAERS: 7 | US FAERS | |
| 16 | Tremor | FAERS: 7 | US FAERS | |
| 17 | Colitis | FAERS: 6 | US FAERS | |
| 18 | Dehydration | FAERS: 6 | US FAERS | |
| 19 | Flatulence | FAERS: 6 | US FAERS | |
| 20 | Thrombosis | FAERS: 6 | US FAERS | |
| 21 | Erythema | FAERS: 5 | US FAERS | |
| 22 | Medication Error | FAERS: 5 | US FAERS | |
| 23 | Pain | FAERS: 5 | US FAERS | |
| 24 | Palpitations | FAERS: 5 | US FAERS | |
| 25 | Alanine Aminotransferase Increased | FAERS: 4 | US FAERS | |
| 26 | Anxiety | FAERS: 4 | US FAERS | |
| 27 | Diverticulitis | FAERS: 4 | US FAERS | |
| 28 | Gamma-Glutamyltransferase Increased | FAERS: 4 | US FAERS | |
| 29 | Nervousness | FAERS: 4 | US FAERS | |
| 30 | Peritonitis | FAERS: 4 | US FAERS | |
| 31 | Abasia | FAERS: 3 | US FAERS | |
| 32 | Angina Pectoris | FAERS: 3 | US FAERS | |
| 33 | Back Pain | FAERS: 3 | US FAERS | |
| 34 | Blood creatinine increased | FAERS: 3 | US FAERS | |
| 35 | Blood glucose increased | FAERS: 3 | US FAERS | |
| 36 | Blood urea increased | FAERS: 3 | US FAERS | |
| 37 | Bronchitis | FAERS: 3 | US FAERS | |
| 38 | Cerebrovascular accident | FAERS: 3 | US FAERS | |
| 39 | Cholelithiasis | FAERS: 3 | US FAERS | |
| 40 | Diverticulum | FAERS: 3 | US FAERS | |
| 41 | Eye irritation | FAERS: 3 | US FAERS | |
| 42 | Gastrointestinal Pain | FAERS: 3 | US FAERS | |
| 43 | Gastrointestinal motility disorder | FAERS: 3 | US FAERS | |
| 44 | Hysterectomy | FAERS: 3 | US FAERS | |
| 45 | Infarction | FAERS: 3 | US FAERS | |
| 46 | Infrequent bowel movements | FAERS: 3 | US FAERS | |
| 47 | Myocardial Infarction | FAERS: 3 | US FAERS | |
| 48 | Pneumonia | FAERS: 3 | US FAERS | |
| 49 | Vertigo | FAERS: 3 | US FAERS | |
| 50 | Weight decreased | FAERS: 3 | US FAERS | |
| 51 | colonoscopy | FAERS: 3 | US FAERS | |
| 52 | Appendicitis | FAERS: 2 | US FAERS | |
| 53 | Arthralgia | FAERS: 2 | US FAERS | |
| 54 | Bladder Neoplasm | FAERS: 2 | US FAERS | |
| 55 | Blood glucose fluctuation | FAERS: 2 | US FAERS | |
| 56 | Bowel movement irregularity | FAERS: 2 | US FAERS | |
| 57 | Chest Pain | FAERS: 2 | US FAERS | |
| 58 | Coagulation time abnormal | FAERS: 2 | US FAERS | |
| 59 | Concomitant disease aggravated | FAERS: 2 | US FAERS | |
| 60 | Concomitant disease progression | FAERS: 2 | US FAERS | |
| 61 | Coronary Artery Disease | FAERS: 2 | US FAERS | |
| 62 | Discomfort | FAERS: 2 | US FAERS | |
| 63 | Disease Progression | FAERS: 2 | US FAERS | |
| 64 | Drug dose omission | FAERS: 2 | US FAERS | |
| 65 | Drug exposure via breast milk | FAERS: 2 | US FAERS | |
| 66 | Electrocardiogram abnormal | FAERS: 2 | US FAERS | |
| 67 | Emotional distress | FAERS: 2 | US FAERS | |
| 68 | Feeling Cold | FAERS: 2 | US FAERS | |
| 69 | Gastric ulcer | FAERS: 2 | US FAERS | |
| 70 | Inflammation | FAERS: 2 | US FAERS | |
| 71 | Nausea | FAERS: 2 | US FAERS | |
| 72 | Nephrolithiasis | FAERS: 2 | US FAERS | |
| 73 | Oropharyngeal swelling | FAERS: 2 | US FAERS | |
| 74 | Pacemaker complication | FAERS: 2 | US FAERS | |
| 75 | Pharmaceutical product complaint | FAERS: 2 | US FAERS | |
| 76 | Poisoning | FAERS: 2 | US FAERS | |
| 77 | Pyelonephritis | FAERS: 2 | US FAERS | |
| 78 | Renal cyst | FAERS: 2 | US FAERS | |
| 79 | Respiratory arrest | FAERS: 2 | US FAERS | |
| 80 | Spinal column injury | FAERS: 2 | US FAERS | |
| 81 | Syncope | FAERS: 2 | US FAERS | |
| 82 | Tooth Extraction | FAERS: 2 | US FAERS | |
| 83 | White blood cell count decreased | FAERS: 2 | US FAERS | |
| 84 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 85 | Accidental death | FAERS: 1 | US FAERS | |
| 86 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 87 | Anaphylactoid Reaction | FAERS: 1 | US FAERS | |
| 88 | Angioedema | FAERS: 1 | US FAERS | |
| 89 | Ankle Fracture | FAERS: 1 | US FAERS | |
| 90 | Anorexia | FAERS: 1 | US FAERS | |
| 91 | Aortic Aneurysm | FAERS: 1 | US FAERS | |
| 92 | Asthma | FAERS: 1 | US FAERS | |
| 93 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 94 | Bedridden | FAERS: 1 | US FAERS | |
| 95 | Bladder pain | FAERS: 1 | US FAERS | |
| 96 | Blood glucose abnormal | FAERS: 1 | US FAERS | |
| 97 | Blood urine present | FAERS: 1 | US FAERS | |
| 98 | Bone decalcification | FAERS: 1 | US FAERS | |
| 99 | Bone pain | FAERS: 1 | US FAERS | |
| 100 | Bradycardia | FAERS: 1 | US FAERS | |
| 101 | Bronchospasm | FAERS: 1 | US FAERS | |
| 102 | Cardiac Arrest | FAERS: 1 | US FAERS | |
| 103 | Cardiac discomfort | FAERS: 1 | US FAERS | |
| 104 | Cardiomegaly | FAERS: 1 | US FAERS | |
| 105 | Central nervous system lesion | FAERS: 1 | US FAERS | |
| 106 | Chest discomfort | FAERS: 1 | US FAERS | |
| 107 | Completed Suicide | FAERS: 1 | US FAERS | |
| 108 | Cyanosis | FAERS: 1 | US FAERS | |
| 109 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 110 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 111 | Dyspepsia | FAERS: 1 | US FAERS | |
| 112 | Dysphasia | FAERS: 1 | US FAERS | |
| 113 | Ejection Fraction Decreased | FAERS: 1 | US FAERS | |
| 114 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 115 | Emotional disorder | FAERS: 1 | US FAERS | |
| 116 | Endometriosis | FAERS: 1 | US FAERS | |
| 117 | Fatigue | FAERS: 1 | US FAERS | |
| 118 | Food Poisoning | FAERS: 1 | US FAERS | |
| 119 | Gastric Lavage | FAERS: 1 | US FAERS | |
| 120 | Gastrointestinal obstruction | FAERS: 1 | US FAERS | |
| 121 | Helicobacter pylori identification test positive | FAERS: 1 | US FAERS | |
| 122 | Hemiparesis | FAERS: 1 | US FAERS | |
| 123 | Hemiplegia | FAERS: 1 | US FAERS | |
| 124 | Incubator therapy | FAERS: 1 | US FAERS | |
| 125 | Influenza | FAERS: 1 | US FAERS | |
| 126 | Limb discomfort | FAERS: 1 | US FAERS | |
| 127 | Lip swelling | FAERS: 1 | US FAERS | |
| 128 | Memory impairment | FAERS: 1 | US FAERS | |
| 129 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 130 | Mutism | FAERS: 1 | US FAERS | |
| 131 | Myalgia | FAERS: 1 | US FAERS | |
| 132 | Myocarditis | FAERS: 1 | US FAERS | |
| 133 | Myopathy | FAERS: 1 | US FAERS | |
| 134 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 135 | Nephrectomy | FAERS: 1 | US FAERS | |
| 136 | Oligohydramnios | FAERS: 1 | US FAERS | |
| 137 | Oncologic complication | FAERS: 1 | US FAERS | |
| 138 | Osteoporosis | FAERS: 1 | US FAERS | |
| 139 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 140 | Peritoneal lavage | FAERS: 1 | US FAERS | |
| 141 | Placenta Accreta | FAERS: 1 | US FAERS | |
| 142 | Pneumonitis | FAERS: 1 | US FAERS | |
| 143 | Polyuria | FAERS: 1 | US FAERS | |
| 144 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 145 | Prostatectomy | FAERS: 1 | US FAERS | |
| 146 | Pruritus | FAERS: 1 | US FAERS | |
| 147 | Rectal tenesmus | FAERS: 1 | US FAERS | |
| 148 | Renal pain | FAERS: 1 | US FAERS | |
| 149 | Retching | FAERS: 1 | US FAERS | |
| 150 | Sinus Tachycardia | FAERS: 1 | US FAERS | |
| 151 | Skin reaction | FAERS: 1 | US FAERS | |
| 152 | Swelling | FAERS: 1 | US FAERS | |
| 153 | Ulcer | FAERS: 1 | US FAERS | |
| 154 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 155 | Urticaria | FAERS: 1 | US FAERS | |
| 156 | Vasculitis | FAERS: 1 | US FAERS | |
| 157 | fibroma | FAERS: 1 | US FAERS | |
| 158 | nervous system disorder | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.