ziconotide
(BPKIMPVREBSLAJ-QTBYCLKRSA-N)
Structure
- SMILES
- NCCCC[C@@H]1NC(=O)[C@H](C)NC(=O)CNC(=O)[C@H](CCCCN)NC(=O)CNC(=O)[C@H](CCCCN)NC(=O)[C@@H](N)CSSC[C@H]2C(=O)N[C@H](C(=O)NCC(=O)N[C@H](C(=O)N[C@H]3CSSC[C@H](NC1=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](Cc1ccc(cc1)O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C(=O)N2)CSSC[C@H](NC(=O)[C@@H](NC(=O)CNC(=O)[C@@H](NC(=O)[C@@H](NC3=O)CCCNC(=N)N)CO)CCCCN)C(=O)N)CO)[C@H](O)C
- Molecular Formula:
- C102H172N36O32S7
- Molecular Weight:
- 2639.130
- Log P:
- -1.7380
- Hydrogen Bond Acceptor:
- 75
- Hydrogen Bond Donor:
- 42
- TPSA:
- 1310.94
- CAS Number(s):
- 107452-89-1
Synonym(s)
1.
ziconotide
2.
CYS-LYS-GLY-LYS-GLY-ALA-LYS-CYS-SER-ARG-LEU-MET-TYR-ASP-CYS-CYS-THR-GLY-SER-CYS-ARG-SER-GLY-LYS-CYS-NH2
3.
Prialt
4.
SNX 111
5.
SNX-111
6.
leconotide
7.
omega-conopeptide MVIIA
8.
omega-conotoxin M VIIA
9.
omega-conotoxin MVIIA
10.
omega-conotoxin MVIIA, Conus magus
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Pain | FAERS: 69 | 19530373 22084632 | CTD SIDER US FAERS |
| 2 | Drug ineffective | FAERS: 62 | US FAERS | |
| 3 | Nausea | FAERS: 53 | 19530373 | CTD SIDER US FAERS |
| 4 | Dizziness | FAERS: 50 | 19530373 | CTD SIDER US FAERS |
| 5 | Headache | FAERS: 42 | SIDER US FAERS | |
| 6 | Vomiting | FAERS: 25 | 19530373 | CTD SIDER US FAERS |
| 7 | Mental status changes | FAERS: 24 | SIDER US FAERS | |
| 8 | Amnesia | FAERS: 20 | SIDER US FAERS | |
| 9 | Memory impairment | FAERS: 20 | SIDER US FAERS | |
| 10 | Burning sensation | FAERS: 18 | SIDER US FAERS | |
| 11 | Anxiety | FAERS: 17 | SIDER US FAERS | |
| 12 | Asthenia | FAERS: 17 | SIDER US FAERS | |
| 13 | Malaise | FAERS: 17 | US FAERS | |
| 14 | Agitation | FAERS: 15 | SIDER US FAERS | |
| 15 | Feeling abnormal | FAERS: 14 | SIDER US FAERS | |
| 16 | Urinary Retention | FAERS: 14 | 19530373 | CTD SIDER US FAERS |
| 17 | Weight decreased | FAERS: 14 | SIDER US FAERS | |
| 18 | Back Pain | FAERS: 13 | SIDER US FAERS | |
| 19 | Infection | FAERS: 13 | SIDER US FAERS | |
| 20 | Seroma | FAERS: 13 | US FAERS | |
| 21 | Aphasia | FAERS: 12 | SIDER US FAERS | |
| 22 | Fatigue | FAERS: 12 | SIDER US FAERS | |
| 23 | Tinnitus | FAERS: 12 | SIDER US FAERS | |
| 24 | Disorientation | FAERS: 10 | SIDER US FAERS | |
| 25 | Dysgeusia | FAERS: 10 | SIDER US FAERS | |
| 26 | Hypersensitivity | FAERS: 10 | SIDER US FAERS | |
| 27 | Paranoia | FAERS: 10 | SIDER US FAERS | |
| 28 | Pneumonia | FAERS: 10 | US FAERS | |
| 29 | Somnolence | FAERS: 10 | SIDER US FAERS | |
| 30 | Tremor | FAERS: 10 | SIDER US FAERS | |
| 31 | Blood creatine phosphokinase increased | FAERS: 9 | SIDER US FAERS | |
| 32 | Constipation | FAERS: 9 | SIDER US FAERS | |
| 33 | Dysarthria | FAERS: 9 | SIDER US FAERS | |
| 34 | Meningitis | FAERS: 9 | SIDER US FAERS | |
| 35 | Swelling | FAERS: 9 | US FAERS | |
| 36 | Unevaluable event | FAERS: 9 | US FAERS | |
| 37 | Unresponsive to stimuli | FAERS: 9 | US FAERS | |
| 38 | Dehydration | FAERS: 8 | US FAERS | |
| 39 | Peripheral swelling | FAERS: 8 | SIDER US FAERS | |
| 40 | Pruritus | FAERS: 8 | SIDER US FAERS | |
| 41 | Vertigo | FAERS: 8 | SIDER US FAERS | |
| 42 | Crying | FAERS: 7 | US FAERS | |
| 43 | Mental impairment | FAERS: 7 | US FAERS | |
| 44 | Myalgia | FAERS: 7 | SIDER US FAERS | |
| 45 | No adverse event | FAERS: 7 | US FAERS | |
| 46 | Urinary tract infection | FAERS: 7 | US FAERS | |
| 47 | Chest Pain | FAERS: 6 | SIDER US FAERS | |
| 48 | Delirium | FAERS: 6 | SIDER US FAERS | |
| 49 | Musculoskeletal stiffness | FAERS: 6 | US FAERS | |
| 50 | Neck Pain | FAERS: 6 | SIDER US FAERS | |
| 51 | Nervousness | FAERS: 6 | SIDER US FAERS | |
| 52 | Overdose | FAERS: 6 | US FAERS | |
| 53 | Psychiatric symptom | FAERS: 6 | US FAERS | |
| 54 | Abdominal Pain | FAERS: 5 | SIDER US FAERS | |
| 55 | Chills | FAERS: 5 | SIDER US FAERS | |
| 56 | Completed Suicide | FAERS: 5 | US FAERS | |
| 57 | Drug withdrawal syndrome | FAERS: 5 | US FAERS | |
| 58 | Feeling Cold | FAERS: 5 | US FAERS | |
| 59 | Implant site infection | FAERS: 5 | US FAERS | |
| 60 | Visual Impairment | FAERS: 5 | SIDER US FAERS | |
| 61 | Abasia | FAERS: 4 | US FAERS | |
| 62 | Acute psychosis | FAERS: 4 | US FAERS | |
| 63 | Alopecia | FAERS: 4 | US FAERS | |
| 64 | Anger | FAERS: 4 | US FAERS | |
| 65 | Bedridden | FAERS: 4 | US FAERS | |
| 66 | Catheter related complication | FAERS: 4 | US FAERS | |
| 67 | Cold sweat | FAERS: 4 | US FAERS | |
| 68 | Diplopia | FAERS: 4 | SIDER US FAERS | |
| 69 | Dysuria | FAERS: 4 | SIDER US FAERS | |
| 70 | Formication | FAERS: 4 | US FAERS | |
| 71 | Incorrect dose administered | FAERS: 4 | US FAERS | |
| 72 | Lethargy | FAERS: 4 | SIDER US FAERS | |
| 73 | Maternal exposure during pregnancy | FAERS: 4 | US FAERS | |
| 74 | Perineal pain | FAERS: 4 | US FAERS | |
| 75 | Abdominal discomfort | FAERS: 3 | US FAERS | |
| 76 | Activities of daily living impaired | FAERS: 3 | US FAERS | |
| 77 | Acute kidney injury | FAERS: 3 | US FAERS | |
| 78 | Adverse event | FAERS: 3 | US FAERS | |
| 79 | Ageusia | FAERS: 3 | SIDER US FAERS | |
| 80 | Arthralgia | FAERS: 3 | SIDER US FAERS | |
| 81 | Ataxia | FAERS: 3 | 19530373 | CTD SIDER US FAERS |
| 82 | Blindness | FAERS: 3 | US FAERS | |
| 83 | Cellulitis | FAERS: 3 | US FAERS | |
| 84 | Cerebrovascular accident | FAERS: 3 | SIDER US FAERS | |
| 85 | Chest discomfort | FAERS: 3 | US FAERS | |
| 86 | Clostridium difficile infection | FAERS: 3 | US FAERS | |
| 87 | Conversion disorder | FAERS: 3 | US FAERS | |
| 88 | Dementia | FAERS: 3 | US FAERS | |
| 89 | Depressed mood | FAERS: 3 | US FAERS | |
| 90 | Device breakage | FAERS: 3 | US FAERS | |
| 91 | Device dislocation | FAERS: 3 | US FAERS | |
| 92 | Erythema | FAERS: 3 | US FAERS | |
| 93 | Flank Pain | FAERS: 3 | US FAERS | |
| 94 | Implant site extravasation | FAERS: 3 | US FAERS | |
| 95 | Incision site complication | FAERS: 3 | US FAERS | |
| 96 | Incoherent | FAERS: 3 | US FAERS | |
| 97 | Medication Error | FAERS: 3 | US FAERS | |
| 98 | Mood swings | FAERS: 3 | US FAERS | |
| 99 | Pulmonary Embolism | FAERS: 3 | US FAERS | |
| 100 | Restless Legs Syndrome | FAERS: 3 | US FAERS | |
| 101 | Rhabdomyolysis | FAERS: 3 | SIDER US FAERS | |
| 102 | Screaming | FAERS: 3 | US FAERS | |
| 103 | Sepsis | FAERS: 3 | SIDER US FAERS | |
| 104 | Sinusitis | FAERS: 3 | SIDER US FAERS | |
| 105 | Suicide attempt | FAERS: 3 | SIDER US FAERS | |
| 106 | Therapy change | FAERS: 3 | US FAERS | |
| 107 | Trismus | FAERS: 3 | US FAERS | |
| 108 | Urinary Incontinence | FAERS: 3 | SIDER US FAERS | |
| 109 | nervous system disorder | FAERS: 3 | SIDER US FAERS | |
| 110 | Accidental overdose | FAERS: 2 | US FAERS | |
| 111 | Altered state of consciousness | FAERS: 2 | SIDER US FAERS | |
| 112 | Angioedema | FAERS: 2 | SIDER US FAERS | |
| 113 | Anorexia | FAERS: 2 | SIDER US FAERS | |
| 114 | Aphagia | FAERS: 2 | US FAERS | |
| 115 | Arthropathy | FAERS: 2 | US FAERS | |
| 116 | Blood glucose increased | FAERS: 2 | US FAERS | |
| 117 | Blood sodium decreased | FAERS: 2 | US FAERS | |
| 118 | Bone pain | FAERS: 2 | US FAERS | |
| 119 | Bradycardia | FAERS: 2 | US FAERS | |
| 120 | Breakthrough Pain | FAERS: 2 | US FAERS | |
| 121 | Cardiac Arrest | FAERS: 2 | US FAERS | |
| 122 | Catheter related infection | FAERS: 2 | US FAERS | |
| 123 | Cholecystitis | FAERS: 2 | US FAERS | |
| 124 | Concomitant disease progression | FAERS: 2 | US FAERS | |
| 125 | Discomfort | FAERS: 2 | US FAERS | |
| 126 | Disease Progression | FAERS: 2 | US FAERS | |
| 127 | Dysphemia | FAERS: 2 | US FAERS | |
| 128 | Dysphonia | FAERS: 2 | US FAERS | |
| 129 | Emotional distress | FAERS: 2 | US FAERS | |
| 130 | Hallucinations, mixed | FAERS: 2 | US FAERS | |
| 131 | Head discomfort | FAERS: 2 | US FAERS | |
| 132 | Hostility | FAERS: 2 | SIDER US FAERS | |
| 133 | Hypersomnia | FAERS: 2 | US FAERS | |
| 134 | Hypophagia | FAERS: 2 | US FAERS | |
| 135 | Hypotension | FAERS: 2 | SIDER US FAERS | |
| 136 | Impaired driving ability | FAERS: 2 | US FAERS | |
| 137 | Implant site pain | FAERS: 2 | US FAERS | |
| 138 | Incorrect route of drug administration | FAERS: 2 | US FAERS | |
| 139 | Leukocytosis | FAERS: 2 | US FAERS | |
| 140 | Limb discomfort | FAERS: 2 | US FAERS | |
| 141 | Medical device complication | FAERS: 2 | US FAERS | |
| 142 | Monoparesis | FAERS: 2 | US FAERS | |
| 143 | Myocardial Infarction | FAERS: 2 | US FAERS | |
| 144 | Myoclonus | FAERS: 2 | US FAERS | |
| 145 | Myositis | FAERS: 2 | SIDER US FAERS | |
| 146 | Nasopharyngitis | FAERS: 2 | US FAERS | |
| 147 | Nephrectomy | FAERS: 2 | US FAERS | |
| 148 | Neuralgia | FAERS: 2 | US FAERS | |
| 149 | Personality Change | FAERS: 2 | US FAERS | |
| 150 | Poisoning | FAERS: 2 | US FAERS | |
| 151 | Post procedural complication | FAERS: 2 | US FAERS | |
| 152 | Post procedural infection | FAERS: 2 | US FAERS | |
| 153 | Respiratory arrest | FAERS: 2 | US FAERS | |
| 154 | Restlessness | FAERS: 2 | US FAERS | |
| 155 | Retching | FAERS: 2 | US FAERS | |
| 156 | Rheumatoid Arthritis | FAERS: 2 | US FAERS | |
| 157 | Skin Ulcer | FAERS: 2 | SIDER US FAERS | |
| 158 | Stomatitis | FAERS: 2 | US FAERS | |
| 159 | Stress | FAERS: 2 | US FAERS | |
| 160 | Therapeutic response unexpected | FAERS: 2 | US FAERS | |
| 161 | Toxicity to various agents | FAERS: 2 | US FAERS | |
| 162 | Urticaria | FAERS: 2 | US FAERS | |
| 163 | Wrong technique in product usage process | FAERS: 2 | US FAERS | |
| 164 | prostatitis | FAERS: 2 | US FAERS | |
| 165 | Abdominal Abscess | FAERS: 1 | US FAERS | |
| 166 | Acarodermatitis | FAERS: 1 | US FAERS | |
| 167 | Accidental death | FAERS: 1 | US FAERS | |
| 168 | Accidental exposure | FAERS: 1 | US FAERS | |
| 169 | Adjustment disorder with depressed mood | FAERS: 1 | US FAERS | |
| 170 | Administration related reaction | FAERS: 1 | US FAERS | |
| 171 | Alcohol abuse | FAERS: 1 | US FAERS | |
| 172 | Allergy to chemicals | FAERS: 1 | US FAERS | |
| 173 | Anal spasm | FAERS: 1 | US FAERS | |
| 174 | Anorgasmia | FAERS: 1 | US FAERS | |
| 175 | Anosmia | FAERS: 1 | US FAERS | |
| 176 | Aphonia | FAERS: 1 | US FAERS | |
| 177 | Arachnoiditis | FAERS: 1 | US FAERS | |
| 178 | Arteriosclerosis | FAERS: 1 | US FAERS | |
| 179 | Autonomic nervous system imbalance | FAERS: 1 | US FAERS | |
| 180 | Bacteria urine identified | FAERS: 1 | US FAERS | |
| 181 | Bladder dysfunction | FAERS: 1 | US FAERS | |
| 182 | Blood pressure inadequately controlled | FAERS: 1 | US FAERS | |
| 183 | Bradyphrenia | FAERS: 1 | US FAERS | |
| 184 | Brain natriuretic peptide increased | FAERS: 1 | US FAERS | |
| 185 | Bunion operation | FAERS: 1 | US FAERS | |
| 186 | Burning feet syndrome | FAERS: 1 | US FAERS | |
| 187 | Chest wall pain | FAERS: 1 | US FAERS | |
| 188 | Clumsiness | FAERS: 1 | US FAERS | |
| 189 | Coronary artery embolism | FAERS: 1 | US FAERS | |
| 190 | Cystitis | FAERS: 1 | US FAERS | |
| 191 | Cyst | FAERS: 1 | US FAERS | |
| 192 | Depressed Level of Consciousness | FAERS: 1 | SIDER US FAERS | |
| 193 | Device Failure | FAERS: 1 | US FAERS | |
| 194 | Device alarm issue | FAERS: 1 | US FAERS | |
| 195 | Device leakage | FAERS: 1 | US FAERS | |
| 196 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 197 | Disability | FAERS: 1 | US FAERS | |
| 198 | Drooling | FAERS: 1 | US FAERS | |
| 199 | Drowning | FAERS: 1 | US FAERS | |
| 200 | Drug Dependence | FAERS: 1 | US FAERS | |
| 201 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 202 | Dysgraphia | FAERS: 1 | US FAERS | |
| 203 | Dyspepsia | FAERS: 1 | SIDER US FAERS | |
| 204 | Dysphasia | FAERS: 1 | US FAERS | |
| 205 | Emotional disorder | FAERS: 1 | US FAERS | |
| 206 | Erectile dysfunction | FAERS: 1 | US FAERS | |
| 207 | Exposure during breast feeding | FAERS: 1 | US FAERS | |
| 208 | Eye irritation | FAERS: 1 | US FAERS | |
| 209 | Eye pain | FAERS: 1 | US FAERS | |
| 210 | Feeling jittery | FAERS: 1 | SIDER US FAERS | |
| 211 | Fibrin D dimer increased | FAERS: 1 | US FAERS | |
| 212 | Flushing | FAERS: 1 | US FAERS | |
| 213 | Gambling | FAERS: 1 | US FAERS | |
| 214 | Gastric Bypass | FAERS: 1 | US FAERS | |
| 215 | Gastrointestinal motility disorder | FAERS: 1 | US FAERS | |
| 216 | Gingival Atrophy | FAERS: 1 | US FAERS | |
| 217 | Gingival blister | FAERS: 1 | US FAERS | |
| 218 | Hemiparesis | FAERS: 1 | US FAERS | |
| 219 | Hemiplegia | FAERS: 1 | US FAERS | |
| 220 | Hernia | FAERS: 1 | US FAERS | |
| 221 | Hospice Care | FAERS: 1 | US FAERS | |
| 222 | Hydrocephalus | FAERS: 1 | US FAERS | |
| 223 | Hyperacusis | FAERS: 1 | US FAERS | |
| 224 | Hyperchlorhydria | FAERS: 1 | US FAERS | |
| 225 | Hypokinesia | FAERS: 1 | US FAERS | |
| 226 | Implant site cellulitis | FAERS: 1 | US FAERS | |
| 227 | Implant site discharge | FAERS: 1 | US FAERS | |
| 228 | Implant site effusion | FAERS: 1 | US FAERS | |
| 229 | Implant site erosion | FAERS: 1 | US FAERS | |
| 230 | Implant site reaction | FAERS: 1 | US FAERS | |
| 231 | Implant site swelling | FAERS: 1 | US FAERS | |
| 232 | Implant site warmth | FAERS: 1 | US FAERS | |
| 233 | Inappropriate affect | FAERS: 1 | US FAERS | |
| 234 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 235 | Incision site infection | FAERS: 1 | US FAERS | |
| 236 | Incision site swelling | FAERS: 1 | US FAERS | |
| 237 | Inflammation | FAERS: 1 | US FAERS | |
| 238 | Injection Site Reaction | FAERS: 1 | US FAERS | |
| 239 | Intervertebral Disc Degeneration | FAERS: 1 | US FAERS | |
| 240 | Intervertebral disc disorder | FAERS: 1 | US FAERS | |
| 241 | Intracranial Hypotension | FAERS: 1 | US FAERS | |
| 242 | Joint injury | FAERS: 1 | US FAERS | |
| 243 | Joint swelling | FAERS: 1 | US FAERS | |
| 244 | Limb injury | FAERS: 1 | US FAERS | |
| 245 | Malignant neoplasm progression | FAERS: 1 | US FAERS | |
| 246 | Medical device implantation | FAERS: 1 | US FAERS | |
| 247 | Medical device site swelling | FAERS: 1 | US FAERS | |
| 248 | Mental status changes postoperative | FAERS: 1 | US FAERS | |
| 249 | Micturition frequency decreased | FAERS: 1 | US FAERS | |
| 250 | Middle insomnia | FAERS: 1 | US FAERS | |
| 251 | Moaning | FAERS: 1 | US FAERS | |
| 252 | Multi-organ disorder | FAERS: 1 | US FAERS | |
| 253 | Multiple drug therapy | FAERS: 1 | US FAERS | |
| 254 | Muscle Spasticity | FAERS: 1 | US FAERS | |
| 255 | Muscle tightness | FAERS: 1 | US FAERS | |
| 256 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 257 | Musculoskeletal discomfort | FAERS: 1 | SIDER US FAERS | |
| 258 | Myocarditis | FAERS: 1 | US FAERS | |
| 259 | Nephrolithiasis | FAERS: 1 | US FAERS | |
| 260 | Nerve injury | FAERS: 1 | US FAERS | |
| 261 | Neuroleptic Malignant Syndrome | FAERS: 1 | US FAERS | |
| 262 | Neuroma | FAERS: 1 | US FAERS | |
| 263 | Obesity | FAERS: 1 | US FAERS | |
| 264 | Onychoclasis | FAERS: 1 | US FAERS | |
| 265 | Oral mucosal exfoliation | FAERS: 1 | US FAERS | |
| 266 | Oral pain | FAERS: 1 | US FAERS | |
| 267 | Oropharyngeal plaque | FAERS: 1 | US FAERS | |
| 268 | Osteoporosis | FAERS: 1 | US FAERS | |
| 269 | Paranasal sinus discomfort | FAERS: 1 | US FAERS | |
| 270 | Paraparesis | FAERS: 1 | US FAERS | |
| 271 | Paraplegia | FAERS: 1 | US FAERS | |
| 272 | Pelvic Pain | FAERS: 1 | US FAERS | |
| 273 | Peripheral arterial occlusive disease | FAERS: 1 | US FAERS | |
| 274 | Petechiae | FAERS: 1 | US FAERS | |
| 275 | Pharmaceutical product complaint | FAERS: 1 | US FAERS | |
| 276 | Physical assault | FAERS: 1 | US FAERS | |
| 277 | Pre-existing condition improved | FAERS: 1 | US FAERS | |
| 278 | Pseudomeningocele | FAERS: 1 | US FAERS | |
| 279 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 280 | Radicular pain | FAERS: 1 | US FAERS | |
| 281 | Rash erythematous | FAERS: 1 | US FAERS | |
| 282 | Renal pain | FAERS: 1 | US FAERS | |
| 283 | Respiratory distress | FAERS: 1 | SIDER US FAERS | |
| 284 | Sciatica | FAERS: 1 | US FAERS | |
| 285 | Septic Shock | FAERS: 1 | US FAERS | |
| 286 | Serum Sickness | FAERS: 1 | US FAERS | |
| 287 | Sexual Dysfunction | FAERS: 1 | US FAERS | |
| 288 | Sick Sinus Syndrome | FAERS: 1 | US FAERS | |
| 289 | Sinus Tachycardia | FAERS: 1 | US FAERS | |
| 290 | Skin discomfort | FAERS: 1 | US FAERS | |
| 291 | Sluggishness | FAERS: 1 | US FAERS | |
| 292 | Sneezing | FAERS: 1 | US FAERS | |
| 293 | Somatic symptom disorder | FAERS: 1 | US FAERS | |
| 294 | Spinal column stenosis | FAERS: 1 | US FAERS | |
| 295 | Spinal cord infection | FAERS: 1 | US FAERS | |
| 296 | Spondylolisthesis | FAERS: 1 | US FAERS | |
| 297 | Staring | FAERS: 1 | US FAERS | |
| 298 | Stenosis | FAERS: 1 | US FAERS | |
| 299 | Syncope | FAERS: 1 | US FAERS | |
| 300 | Tension | FAERS: 1 | SIDER US FAERS | |
| 301 | Therapeutic response changed | FAERS: 1 | US FAERS | |
| 302 | Thermal burn | FAERS: 1 | US FAERS | |
| 303 | Thirst | FAERS: 1 | US FAERS | |
| 304 | Thrombosis | FAERS: 1 | US FAERS | |
| 305 | Tooth Loss | FAERS: 1 | US FAERS | |
| 306 | Toothache | FAERS: 1 | US FAERS | |
| 307 | Tracheobronchitis | FAERS: 1 | US FAERS | |
| 308 | Transaminases increased | FAERS: 1 | US FAERS | |
| 309 | Urinary hesitation | FAERS: 1 | SIDER US FAERS | |
| 310 | Vibratory sense increased | FAERS: 1 | US FAERS | |
| 311 | Vulvovaginal burning sensation | FAERS: 1 | US FAERS | |
| 312 | White blood cell count decreased | FAERS: 1 | US FAERS | |
| 313 | Wound Infection | FAERS: 1 | US FAERS | |
| 314 | Wound infection staphylococcal | FAERS: 1 | US FAERS | |
| 315 | Anxiety aggravated | SIDER | ||
| 316 | Aspartate Aminotransferase Increased | SIDER | ||
| 317 | Atrial Fibrillation | SIDER | ||
| 318 | Blood creatine phosphokinase MM increased | SIDER | ||
| 319 | Confusion aggravated | SIDER | ||
| 320 | Confusion | 19530373 | CTD | |
| 321 | Depression aggravated | SIDER | ||
| 322 | Dermatitis | SIDER | ||
| 323 | Drug Overdose | 19530373 | CTD | |
| 324 | Ear and labyrinth disorders | SIDER | ||
| 325 | Electrocardiogram abnormal | SIDER | ||
| 326 | Gait Disorders, Neurologic | 19530373 | CTD | |
| 327 | Gastrointestinal Pain | SIDER | ||
| 328 | Hallucinations | 19530373 | CTD | |
| 329 | Hyporeflexia | SIDER | ||
| 330 | Hypotension, Orthostatic | 19530373 | CTD | |
| 331 | Infestation | SIDER | ||
| 332 | Malnutrition | SIDER | ||
| 333 | Mental Retardation | SIDER | ||
| 334 | Myopathy | SIDER | ||
| 335 | Nausea aggravated | SIDER | ||
| 336 | Nystagmus | SIDER | ||
| 337 | Pain worsened | SIDER | ||
| 338 | Pain, Intractable | 20439438 | CTD | |
| 339 | Photophobia | SIDER | ||
| 340 | Poor quality sleep | SIDER | ||
| 341 | Stupor | SIDER | ||
| 342 | Visual disturbance | SIDER | ||
| 343 | Wakefulness | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120235
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.