Tropicamide
(BGDKAVGWHJFAGW-UHFFFAOYSA-N)
Structure
- SMILES
- CCN(C(=O)C(c1ccccc1)CO)Cc1ccncc1
- Type(s)
- Approved; Investigational
- ATC code(s)
- S01FA06; S01FA56
- Molecular Formula:
- C17H20N2O2
- Molecular Weight:
- 284.353
- Log P:
- 2.2062
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 1
- TPSA:
- 53.43
- CAS Number(s):
- 1508-75-4
Synonym(s)
1.
Tropicamide
2.
Colircusi Tropicamida
3.
Minims Tropicamide
4.
Mydral
5.
Mydriafair
6.
Mydriaticum
7.
Mydrum
8.
N-Ethyl-N-(4-pyridylmethyl)tropamide
9.
N-Ethyl-alpha-(hydroxymethyl)-N-(4-pyridinylmethyl)benzeneacetamide
10.
Ocu-Tropic
11.
Tropicacyl
12.
Tropicamide Faure
13.
Tropicamide Minims
14.
Tropicamide Monofree
15.
Tropicamide Monohydrochloride, (R)-Isomer
16.
Tropicamide Monohydrochloride, (S)-Isomer
17.
Tropicamide, (+-)-Isomer
18.
Tropicamide, (R)-Isomer
19.
Tropicamide, (S)-Isomer
20.
Ocu Tropic
21.
OcuTropic
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Dizziness | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 2 | Nausea | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 3 | Eye pain | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 4 | Headache | FAERS: 12 | SIDER US FAERS | |
| 5 | Mydriasis | FAERS: 11 | CTD US FAERS | |
| 6 | Drug ineffective | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 7 | Angle Closure Glaucoma | FAERS: 8 | OFFSIDES US FAERS | |
| 8 | Eye irritation | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 9 | Photophobia | FAERS: 7 | SIDER US FAERS | |
| 10 | Product quality issue | FAERS: 7 | US FAERS | |
| 11 | Syncope | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 12 | Vomiting | FAERS: 6 | SIDER US FAERS | |
| 13 | Hypersensitivity | FAERS: 5 | SIDER US FAERS | |
| 14 | Hypotension | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 15 | Erythema | FAERS: 4 | US FAERS | |
| 16 | Malaise | FAERS: 4 | US FAERS | |
| 17 | Feeling abnormal | FAERS: 3 | US FAERS | |
| 18 | Pallor | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 19 | Agitation | FAERS: 2 | US FAERS | |
| 20 | Asthenia | FAERS: 2 | SIDER US FAERS | |
| 21 | Blepharospasm | FAERS: 2 | US FAERS | |
| 22 | Choking | FAERS: 2 | US FAERS | |
| 23 | Conjunctivitis | FAERS: 2 | US FAERS | |
| 24 | Diplopia | FAERS: 2 | OFFSIDES US FAERS | |
| 25 | Drug abuse | FAERS: 2 | US FAERS | |
| 26 | Dry skin | FAERS: 2 | US FAERS | |
| 27 | Endophthalmitis | FAERS: 2 | OFFSIDES US FAERS | |
| 28 | Extra dose administered | FAERS: 2 | US FAERS | |
| 29 | Incorrect route of drug administration | FAERS: 2 | US FAERS | |
| 30 | Lip swelling | FAERS: 2 | US FAERS | |
| 31 | Medication Error | FAERS: 2 | US FAERS | |
| 32 | Myocardial Infarction | FAERS: 2 | US FAERS | |
| 33 | Palpitations | FAERS: 2 | SIDER US FAERS | |
| 34 | Respiratory arrest | FAERS: 2 | US FAERS | |
| 35 | Thirst | FAERS: 2 | SIDER US FAERS | |
| 36 | Toxicity to various agents | FAERS: 2 | US FAERS | |
| 37 | Tremor | FAERS: 2 | 17594079 19467297 | CTD US FAERS |
| 38 | Unresponsive to stimuli | FAERS: 2 | US FAERS | |
| 39 | Vertigo | FAERS: 2 | US FAERS | |
| 40 | Acute respiratory failure | FAERS: 1 | US FAERS | |
| 41 | Anaphylactic shock | FAERS: 1 | SIDER US FAERS | |
| 42 | Aneurysm | FAERS: 1 | US FAERS | |
| 43 | Aphasia | FAERS: 1 | US FAERS | |
| 44 | Blepharitis | FAERS: 1 | US FAERS | |
| 45 | Blood creatine increased | FAERS: 1 | US FAERS | |
| 46 | Bradycardia | FAERS: 1 | OFFSIDES US FAERS | |
| 47 | Consciousness fluctuating | FAERS: 1 | US FAERS | |
| 48 | Cycloplegia | FAERS: 1 | US FAERS | |
| 49 | Delirium | FAERS: 1 | US FAERS | |
| 50 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 51 | Disorientation | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 52 | Documented hypersensitivity to administered product | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 53 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 54 | Drug withdrawal syndrome | FAERS: 1 | US FAERS | |
| 55 | Dysarthria | FAERS: 1 | US FAERS | |
| 56 | Dysgeusia | FAERS: 1 | US FAERS | |
| 57 | Eye Infection | FAERS: 1 | US FAERS | |
| 58 | Fatigue | FAERS: 1 | SIDER US FAERS | |
| 59 | Head discomfort | FAERS: 1 | US FAERS | |
| 60 | Hypersomnia | FAERS: 1 | US FAERS | |
| 61 | Iatrogenic injury | FAERS: 1 | US FAERS | |
| 62 | Influenza | FAERS: 1 | US FAERS | |
| 63 | Intracranial Aneurysm | FAERS: 1 | US FAERS | |
| 64 | Keratitis | FAERS: 1 | SIDER US FAERS | |
| 65 | Nystagmus | FAERS: 1 | US FAERS | |
| 66 | Ocular discomfort | FAERS: 1 | US FAERS | |
| 67 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 68 | Oropharyngeal swelling | FAERS: 1 | OFFSIDES US FAERS | |
| 69 | Pain | FAERS: 1 Canada Vigilance: 2 | 15089787 | CTD SIDER Canada Vigilance US FAERS |
| 70 | Pharmaceutical product complaint | FAERS: 1 | US FAERS | |
| 71 | Pinguecula | FAERS: 1 | US FAERS | |
| 72 | Post procedural complication | FAERS: 1 | OFFSIDES US FAERS | |
| 73 | Presyncope | FAERS: 1 | US FAERS | |
| 74 | Product packaging confusion | FAERS: 1 | US FAERS | |
| 75 | Reaction to preservatives | FAERS: 1 | US FAERS | |
| 76 | Skin Wrinkling | FAERS: 1 | US FAERS | |
| 77 | Somnolence | FAERS: 1 | SIDER US FAERS | |
| 78 | Sudden death | FAERS: 1 | US FAERS | |
| 79 | Tachycardia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 80 | Tinnitus | FAERS: 1 | US FAERS | |
| 81 | Visual Impairment | FAERS: 1 | US FAERS | |
| 82 | Visual acuity tests abnormal | FAERS: 1 | US FAERS | |
| 83 | Visual disturbance | FAERS: 1 | US FAERS | |
| 84 | Vitreous floaters | FAERS: 1 | US FAERS | |
| 85 | Antiphospholipid Syndrome | OFFSIDES | ||
| 86 | Asthenopia | Canada Vigilance: 1 | Canada Vigilance | |
| 87 | Bacterial Infections | 12669766 | CTD | |
| 88 | Blood pressure immeasurable | OFFSIDES | ||
| 89 | Blurred vision | OFFSIDES | ||
| 90 | Bronchospasm | SIDER | ||
| 91 | Cataract operation complication | OFFSIDES | ||
| 92 | Cataract | OFFSIDES | ||
| 93 | Chest Pain | Canada Vigilance: 1 | Canada Vigilance | |
| 94 | Circumstance or information capable of leading to medication error | OFFSIDES | ||
| 95 | Citrobacter infection | OFFSIDES | ||
| 96 | Confabulation | OFFSIDES | ||
| 97 | Conjunctival deposit | OFFSIDES | ||
| 98 | Constipation | SIDER | ||
| 99 | Corneal erosion | OFFSIDES | ||
| 100 | Corneal exfoliation | OFFSIDES | ||
| 101 | Corneal irritation | SIDER | ||
| 102 | Cytolytic hepatitis | OFFSIDES | ||
| 103 | Depressed mood | OFFSIDES | ||
| 104 | Diarrhea | OFFSIDES | ||
| 105 | Discomfort | Canada Vigilance: 1 | Canada Vigilance | |
| 106 | Drowsiness | SIDER | ||
| 107 | Drug withdrawal headache | OFFSIDES | ||
| 108 | Dysuria | SIDER | ||
| 109 | Erythema Multiforme | OFFSIDES | ||
| 110 | Eye infection intraocular | OFFSIDES | ||
| 111 | Floppy iris syndrome | OFFSIDES | ||
| 112 | Flushing | Canada Vigilance: 1 | Canada Vigilance SIDER | |
| 113 | Glaucoma, Open-Angle | 3833883 | CTD | |
| 114 | Hypokinesia | Canada Vigilance: 1 | Canada Vigilance | |
| 115 | Hypopyon | OFFSIDES | ||
| 116 | Infection in an immunocompromised host | OFFSIDES | ||
| 117 | Intercepted medication error | OFFSIDES | ||
| 118 | Intestinal Obstruction | OFFSIDES | ||
| 119 | Intraocular inflammation | OFFSIDES | ||
| 120 | Iridocele | OFFSIDES | ||
| 121 | Leukopenia neonatal | OFFSIDES | ||
| 122 | Macular vasospasm | OFFSIDES | ||
| 123 | Mental impairment | Canada Vigilance: 1 | Canada Vigilance | |
| 124 | Muscle Rigidity | SIDER | ||
| 125 | Nasal discomfort | Canada Vigilance: 1 | Canada Vigilance | |
| 126 | Ocular Hypertension | 3833883 19295368 | CTD | |
| 127 | Parkinsonian Disorders | 17594079 | CTD | |
| 128 | Procedural complication | OFFSIDES | ||
| 129 | Productive Cough | Canada Vigilance: 1 | Canada Vigilance | |
| 130 | Pruritus | SIDER | ||
| 131 | Punctate keratitis | SIDER | ||
| 132 | Rash erythematous | SIDER | ||
| 133 | Retinal Artery Occlusion | OFFSIDES | ||
| 134 | Rhinitis | SIDER | ||
| 135 | Sinusitis | Canada Vigilance: 1 | Canada Vigilance | |
| 136 | Swelling | Canada Vigilance: 1 | Canada Vigilance | |
| 137 | Vision Disorders | 22247005 | CTD | |
| 138 | Vital dye staining cornea present | SIDER | ||
| 139 | Vitritis | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.