Brimonidine Tartrate, Timolol Maleate Drug Combination
(ZUIFJYRNWWNOPB-PPHPATTJSA-N)
Structure
- SMILES
- Brc1c(ccc2c1nccn2)NC1=NCCN1.O[C@H](COc1nsnc1N1CCOCC1)CNC(C)(C)C
- Molecular Formula:
- C24H34BrN9O3S
- Molecular Weight:
- 608.554
- Log P:
- 2.5592
- Hydrogen Bond Acceptor:
- 13
- Hydrogen Bond Donor:
- 4
- TPSA:
- 170.18
- CAS Number(s):
- 952743-07-6
Synonym(s)
1.
Brimonidine Tartrate, Timolol Maleate Drug Combination
2.
Brimonidine Tartrate-Timolol Maleate
3.
Brimonidine Tartrate-Timolol Maleate Drug Combination
4.
Combigan
5.
Brimonidine Tartrate Timolol Maleate
6.
Brimonidine Tartrate Timolol Maleate Drug Combination
7.
Maleate, Brimonidine Tartrate-Timolol
8.
Tartrate-Timolol Maleate, Brimonidine
External Link(s)
| MeSH | D000068599 |
| PubChem Compound | 11387895 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Eye irritation | FAERS: 118 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 2 | Eye pain | FAERS: 75 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 3 | Dizziness | FAERS: 55 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 4 | Hypersensitivity | FAERS: 38 | US FAERS | |
| 5 | Fatigue | FAERS: 36 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 6 | Drug ineffective | FAERS: 29 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 7 | Asthenia | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 8 | Accidental exposure to product | FAERS: 22 | US FAERS | |
| 9 | Product dose omission | FAERS: 21 | US FAERS | |
| 10 | Visual Impairment | FAERS: 20 | US FAERS | |
| 11 | Headache | FAERS: 19 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 12 | Somnolence | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 13 | Foreign body sensation in eyes | FAERS: 18 | US FAERS | |
| 14 | Inappropriate schedule of drug administration | FAERS: 18 | US FAERS | |
| 15 | Erythema | FAERS: 15 | US FAERS | |
| 16 | Product container issue | FAERS: 15 | US FAERS | |
| 17 | Glaucoma | FAERS: 14 | US FAERS | |
| 18 | Incorrect dose administered | FAERS: 14 | US FAERS | |
| 19 | Product storage error | FAERS: 14 | US FAERS | |
| 20 | Blepharitis | FAERS: 13 | US FAERS | |
| 21 | Hypotension | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 22 | Pruritus | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 23 | Drug dose omission | FAERS: 12 | US FAERS | |
| 24 | Inappropriate schedule of product administration | FAERS: 11 | US FAERS | |
| 25 | Malaise | FAERS: 11 | US FAERS | |
| 26 | Eye Infection | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 27 | Feeling abnormal | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 28 | Bradycardia | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 29 | Cataract | FAERS: 9 | US FAERS | |
| 30 | Chest discomfort | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 31 | Photophobia | FAERS: 9 | US FAERS | |
| 32 | Eye inflammation | FAERS: 8 | US FAERS | |
| 33 | Palpitations | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 34 | Product packaging quantity issue | FAERS: 8 | US FAERS | |
| 35 | Product quality issue | FAERS: 8 | US FAERS | |
| 36 | Alopecia | FAERS: 7 | US FAERS | |
| 37 | Arthralgia | FAERS: 7 | US FAERS | |
| 38 | Burning sensation | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 39 | Cerebrovascular accident | FAERS: 7 | US FAERS | |
| 40 | Chest Pain | FAERS: 7 | US FAERS | |
| 41 | Eyelid exfoliation | FAERS: 7 | US FAERS | |
| 42 | Eyelid irritation | FAERS: 7 | US FAERS | |
| 43 | Iritis | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 44 | Product dropper issue | FAERS: 7 | US FAERS | |
| 45 | Conjunctivitis | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 46 | Dysgeusia | FAERS: 6 | US FAERS | |
| 47 | Eyelid margin crusting | FAERS: 6 | US FAERS | |
| 48 | Eyelids pruritus | FAERS: 6 | US FAERS | |
| 49 | Iridocyclitis | FAERS: 6 | US FAERS | |
| 50 | Memory impairment | FAERS: 6 | US FAERS | |
| 51 | Pain | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 52 | Urticaria | FAERS: 6 | US FAERS | |
| 53 | Wrong technique in product usage process | FAERS: 6 | US FAERS | |
| 54 | Abdominal discomfort | FAERS: 5 | US FAERS | |
| 55 | Asthma | FAERS: 5 | US FAERS | |
| 56 | Dry skin | FAERS: 5 | US FAERS | |
| 57 | Epistaxis | FAERS: 5 | US FAERS | |
| 58 | Joint swelling | FAERS: 5 | US FAERS | |
| 59 | Ocular discomfort | FAERS: 5 | US FAERS | |
| 60 | Counterfeit drug administered | FAERS: 4 | US FAERS | |
| 61 | Dermatitis | FAERS: 4 | US FAERS | |
| 62 | Flushing | FAERS: 4 | US FAERS | |
| 63 | Lip swelling | FAERS: 4 | US FAERS | |
| 64 | Macular degeneration | FAERS: 4 | US FAERS | |
| 65 | Myocardial Infarction | FAERS: 4 | US FAERS | |
| 66 | Oropharyngeal pain | FAERS: 4 | US FAERS | |
| 67 | Poor quality drug administered | FAERS: 4 | US FAERS | |
| 68 | Retinal Detachment | FAERS: 4 | US FAERS | |
| 69 | Sinus bradycardia | FAERS: 4 | US FAERS | |
| 70 | Skin irritation | FAERS: 4 | US FAERS | |
| 71 | Sneezing | FAERS: 4 | US FAERS | |
| 72 | Uveitis | FAERS: 4 | US FAERS | |
| 73 | Vomiting | FAERS: 4 | US FAERS | |
| 74 | Adverse event | FAERS: 3 | US FAERS | |
| 75 | Asthenopia | FAERS: 3 | US FAERS | |
| 76 | Atrial Fibrillation | FAERS: 3 | US FAERS | |
| 77 | Diabetes Mellitus | FAERS: 3 | US FAERS | |
| 78 | Diplopia | FAERS: 3 | US FAERS | |
| 79 | Disorientation | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 80 | Eye allergy | FAERS: 3 | US FAERS | |
| 81 | Eyelid pain | FAERS: 3 | US FAERS | |
| 82 | Instillation site pain | FAERS: 3 | US FAERS | |
| 83 | Nasal discomfort | FAERS: 3 | US FAERS | |
| 84 | Nausea | FAERS: 3 | US FAERS | |
| 85 | Nervousness | FAERS: 3 | US FAERS | |
| 86 | Peripheral swelling | FAERS: 3 | US FAERS | |
| 87 | Scab | FAERS: 3 | US FAERS | |
| 88 | Syncope | FAERS: 3 | US FAERS | |
| 89 | Tinnitus | FAERS: 3 | US FAERS | |
| 90 | Activities of daily living impaired | FAERS: 2 | US FAERS | |
| 91 | Allergic bronchitis | FAERS: 2 | US FAERS | |
| 92 | Amnesia | FAERS: 2 | US FAERS | |
| 93 | Back Pain | FAERS: 2 | US FAERS | |
| 94 | Blindness | FAERS: 2 | US FAERS | |
| 95 | Bronchitis | FAERS: 2 | US FAERS | |
| 96 | Cataract operation | FAERS: 2 | US FAERS | |
| 97 | Choking | FAERS: 2 | US FAERS | |
| 98 | Dark circles under eyes | FAERS: 2 | US FAERS | |
| 99 | Discomfort | FAERS: 2 | US FAERS | |
| 100 | Drug administration error | FAERS: 2 | US FAERS | |
| 101 | Drug toxicity | FAERS: 2 | US FAERS | |
| 102 | Erectile dysfunction | FAERS: 2 | US FAERS | |
| 103 | Excessive eye blinking | FAERS: 2 | US FAERS | |
| 104 | Eyelid rash | FAERS: 2 | US FAERS | |
| 105 | Growth of eyelashes | FAERS: 2 | US FAERS | |
| 106 | Intraocular pressure fluctuation | FAERS: 2 | US FAERS | |
| 107 | Intraocular pressure test abnormal | FAERS: 2 | US FAERS | |
| 108 | Joint stiffness | FAERS: 2 | US FAERS | |
| 109 | Laceration | FAERS: 2 | US FAERS | |
| 110 | Lethargy | FAERS: 2 | US FAERS | |
| 111 | Muscle strain | FAERS: 2 | US FAERS | |
| 112 | Mydriasis | FAERS: 2 | US FAERS | |
| 113 | Nasopharyngitis | FAERS: 2 | US FAERS | |
| 114 | No adverse event | FAERS: 2 | US FAERS | |
| 115 | Pallor | FAERS: 2 | US FAERS | |
| 116 | Poor quality product administered | FAERS: 2 | US FAERS | |
| 117 | Product complaint | FAERS: 2 | US FAERS | |
| 118 | Product contamination | FAERS: 2 | US FAERS | |
| 119 | Product dispensing error | FAERS: 2 | US FAERS | |
| 120 | Product size issue | FAERS: 2 | US FAERS | |
| 121 | Rash erythematous | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 122 | Skin Ulcer | FAERS: 2 | US FAERS | |
| 123 | Skin lesion | FAERS: 2 | US FAERS | |
| 124 | Somnambulism | FAERS: 2 | US FAERS | |
| 125 | Vertigo | FAERS: 2 | US FAERS | |
| 126 | Weight decreased | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 127 | Wrong drug administered | FAERS: 2 | US FAERS | |
| 128 | Abdominal Pain | FAERS: 1 | US FAERS | |
| 129 | Accidental overdose | FAERS: 1 | US FAERS | |
| 130 | Acne | FAERS: 1 | US FAERS | |
| 131 | Ankle Fracture | FAERS: 1 | US FAERS | |
| 132 | Anosmia | FAERS: 1 | US FAERS | |
| 133 | Anxiety | FAERS: 1 | US FAERS | |
| 134 | Arthritis | FAERS: 1 | US FAERS | |
| 135 | Blepharopachynsis | FAERS: 1 | US FAERS | |
| 136 | Blepharospasm | FAERS: 1 | US FAERS | |
| 137 | Blood glucose abnormal | FAERS: 1 | US FAERS | |
| 138 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 139 | Bone pain | FAERS: 1 | US FAERS | |
| 140 | Bradyphrenia | FAERS: 1 | US FAERS | |
| 141 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 142 | Chromaturia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 143 | Deafness | FAERS: 1 | US FAERS | |
| 144 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 145 | Dehydration | FAERS: 1 | US FAERS | |
| 146 | Depressed mood | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 147 | Device malfunction | FAERS: 1 | US FAERS | |
| 148 | Documented hypersensitivity to administered drug | FAERS: 1 | US FAERS | |
| 149 | Drug administered at inappropriate site | FAERS: 1 | US FAERS | |
| 150 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 151 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 152 | Dysarthria | FAERS: 1 | US FAERS | |
| 153 | Ear discomfort | FAERS: 1 | US FAERS | |
| 154 | Ecchymosis | FAERS: 1 | US FAERS | |
| 155 | Eczema | FAERS: 1 | US FAERS | |
| 156 | Eosinophilia | FAERS: 1 | US FAERS | |
| 157 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 158 | Excessive skin | FAERS: 1 | US FAERS | |
| 159 | Excoriation | FAERS: 1 | US FAERS | |
| 160 | Exfoliative rash | FAERS: 1 | US FAERS | |
| 161 | Expired drug administered | FAERS: 1 | US FAERS | |
| 162 | Expired product administered | FAERS: 1 | US FAERS | |
| 163 | Extremity necrosis | FAERS: 1 | US FAERS | |
| 164 | Eye Burns | FAERS: 1 | US FAERS | |
| 165 | Eye laser surgery | FAERS: 1 | US FAERS | |
| 166 | Eye operation complication | FAERS: 1 | US FAERS | |
| 167 | Eyelid Function Disorder | FAERS: 1 | US FAERS | |
| 168 | Facial Pain | FAERS: 1 | US FAERS | |
| 169 | Folliculitis | FAERS: 1 | US FAERS | |
| 170 | Frostbite | FAERS: 1 | US FAERS | |
| 171 | Gout | FAERS: 1 | US FAERS | |
| 172 | Head discomfort | FAERS: 1 | US FAERS | |
| 173 | Hordeolum | FAERS: 1 | US FAERS | |
| 174 | Hydrocephalus | FAERS: 1 | US FAERS | |
| 175 | Hypersomnia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 176 | Hypogeusia | FAERS: 1 | US FAERS | |
| 177 | Incontinence | FAERS: 1 | US FAERS | |
| 178 | Incorrect dose administered by product | FAERS: 1 | US FAERS | |
| 179 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 180 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 181 | Incorrect storage of drug | FAERS: 1 | US FAERS | |
| 182 | Infection | FAERS: 1 | US FAERS | |
| 183 | Inflammation | FAERS: 1 | US FAERS | |
| 184 | Influenza | FAERS: 1 | US FAERS | |
| 185 | Intentional dose omission | FAERS: 1 | US FAERS | |
| 186 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 187 | Joint injury | FAERS: 1 | US FAERS | |
| 188 | Keratitis | FAERS: 1 | US FAERS | |
| 189 | Lens dislocation | FAERS: 1 | US FAERS | |
| 190 | Limb injury | FAERS: 1 | US FAERS | |
| 191 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 192 | Medical device removal | FAERS: 1 | US FAERS | |
| 193 | Medication residue present | FAERS: 1 | US FAERS | |
| 194 | Metamorphopsia | FAERS: 1 | US FAERS | |
| 195 | Mood swings | FAERS: 1 | US FAERS | |
| 196 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 197 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 198 | Myopia | FAERS: 1 | US FAERS | |
| 199 | Neck Pain | FAERS: 1 | US FAERS | |
| 200 | Ocular vascular disorder | FAERS: 1 | US FAERS | |
| 201 | Pain of skin | FAERS: 1 | US FAERS | |
| 202 | Pneumonia | FAERS: 1 | US FAERS | |
| 203 | Product label issue | FAERS: 1 | US FAERS | |
| 204 | Product physical issue | FAERS: 1 | US FAERS | |
| 205 | Product use complaint | FAERS: 1 | US FAERS | |
| 206 | Product use issue | FAERS: 1 | US FAERS | |
| 207 | Productive Cough | FAERS: 1 | US FAERS | |
| 208 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 209 | Renal mass | FAERS: 1 | US FAERS | |
| 210 | Respiratory tract congestion | FAERS: 1 | US FAERS | |
| 211 | Retinal Vascular Disorder | FAERS: 1 | US FAERS | |
| 212 | Rheumatoid Arthritis | FAERS: 1 | US FAERS | |
| 213 | Skin Erosion | FAERS: 1 | US FAERS | |
| 214 | Skin necrosis | FAERS: 1 | US FAERS | |
| 215 | Skin reaction | FAERS: 1 | US FAERS | |
| 216 | Swelling | FAERS: 1 | US FAERS | |
| 217 | Tachycardia | FAERS: 1 | US FAERS | |
| 218 | Therapeutic product effect decreased | FAERS: 1 | US FAERS | |
| 219 | Thirst | FAERS: 1 | US FAERS | |
| 220 | Throat irritation | FAERS: 1 | US FAERS | |
| 221 | Tongue blistering | FAERS: 1 | US FAERS | |
| 222 | Traumatic fracture | FAERS: 1 | US FAERS | |
| 223 | Tremor | FAERS: 1 | US FAERS | |
| 224 | Unevaluable event | FAERS: 1 | US FAERS | |
| 225 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 226 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 227 | Visual disturbance | FAERS: 1 | US FAERS | |
| 228 | Vitreous floaters | FAERS: 1 | US FAERS | |
| 229 | Vulvovaginal mycotic infection | FAERS: 1 | US FAERS | |
| 230 | Wheezing | FAERS: 1 | US FAERS | |
| 231 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 232 | Abnormal sleep-related event | Canada Vigilance: 1 | Canada Vigilance | |
| 233 | Feeling Cold | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120329
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.