Olanzapine pamoate
(ZIMCQJVMPKQQPB-UHFFFAOYSA-N)
Structure
- SMILES
- OC(=O)c1cc2ccccc2c(c1O)Cc1c(O)c(cc2c1cccc2)C(=O)O.CN1CCN(CC1)C1=Nc2ccccc2Nc2c1cc(s2)C.O
- Molecular Formula:
- C40H38N4O7S
- Molecular Weight:
- 718.817
- Log P:
- 7.2157
- Hydrogen Bond Acceptor:
- 11
- Hydrogen Bond Donor:
- 6
- TPSA:
- 183.4
- CAS Number(s):
- 221373-18-8
Synonym(s)
1.
Olanzapine pamoate
External Link(s)
| PubChem Compound | 135566032 |
| CHEMBL | CHEMBL3989694 |
| KEGG | dr:D06623 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Dysarthria | FAERS: 43 | US FAERS | |
| 2 | Somnolence | FAERS: 42 | US FAERS | |
| 3 | Agitation | FAERS: 31 | US FAERS | |
| 4 | Drug dose omission | FAERS: 27 | US FAERS | |
| 5 | Dizziness | FAERS: 24 | US FAERS | |
| 6 | Post-injection delirium sedation syndrome | FAERS: 22 | US FAERS | |
| 7 | Drug ineffective | FAERS: 20 | US FAERS | |
| 8 | Disorientation | FAERS: 16 | US FAERS | |
| 9 | Fatigue | FAERS: 16 | US FAERS | |
| 10 | Anxiety | FAERS: 15 | US FAERS | |
| 11 | Delirium | FAERS: 13 | US FAERS | |
| 12 | Prescribed overdose | FAERS: 13 | US FAERS | |
| 13 | Psychiatric decompensation | FAERS: 13 | US FAERS | |
| 14 | Ataxia | FAERS: 12 | US FAERS | |
| 15 | Restlessness | FAERS: 12 | US FAERS | |
| 16 | Schizophrenia | FAERS: 11 | US FAERS | |
| 17 | Feeling abnormal | FAERS: 10 | US FAERS | |
| 18 | Overdose | FAERS: 10 | US FAERS | |
| 19 | Asthenia | FAERS: 9 | US FAERS | |
| 20 | Inappropriate schedule of drug administration | FAERS: 9 | US FAERS | |
| 21 | Malaise | FAERS: 9 | US FAERS | |
| 22 | Unresponsive to stimuli | FAERS: 9 | US FAERS | |
| 23 | Weight decreased | FAERS: 8 | US FAERS | |
| 24 | Influenza | FAERS: 7 | US FAERS | |
| 25 | Pallor | FAERS: 7 | US FAERS | |
| 26 | Accidental exposure to product | FAERS: 6 | US FAERS | |
| 27 | Blood glucose increased | FAERS: 6 | US FAERS | |
| 28 | Hypotension | FAERS: 6 | US FAERS | |
| 29 | Tachycardia | FAERS: 6 | US FAERS | |
| 30 | Hypersomnia | FAERS: 5 | US FAERS | |
| 31 | Injection site pain | FAERS: 5 | US FAERS | |
| 32 | Pain | FAERS: 5 | US FAERS | |
| 33 | Pneumonia | FAERS: 5 | US FAERS | |
| 34 | Drug abuse | FAERS: 4 | US FAERS | |
| 35 | Injection site abscess | FAERS: 4 | US FAERS | |
| 36 | Injection site infection | FAERS: 4 | US FAERS | |
| 37 | Neutrophil count decreased | FAERS: 4 | US FAERS | |
| 38 | Paranoia | FAERS: 4 | US FAERS | |
| 39 | Tremor | FAERS: 4 | US FAERS | |
| 40 | Urinary tract infection | FAERS: 4 | US FAERS | |
| 41 | Adverse event | FAERS: 3 | US FAERS | |
| 42 | Akathisia | FAERS: 3 | US FAERS | |
| 43 | Completed Suicide | FAERS: 3 | US FAERS | |
| 44 | Dehydration | FAERS: 3 | US FAERS | |
| 45 | Drooling | FAERS: 3 | US FAERS | |
| 46 | Drug effect incomplete | FAERS: 3 | US FAERS | |
| 47 | Feeling of body temperature change | FAERS: 3 | US FAERS | |
| 48 | Injection site erythema | FAERS: 3 | US FAERS | |
| 49 | Memory impairment | FAERS: 3 | US FAERS | |
| 50 | Mental impairment | FAERS: 3 | US FAERS | |
| 51 | Myocardial Infarction | FAERS: 3 | US FAERS | |
| 52 | Syncope | FAERS: 3 | US FAERS | |
| 53 | Toxicity to various agents | FAERS: 3 | US FAERS | |
| 54 | Urinary Incontinence | FAERS: 3 | US FAERS | |
| 55 | Vomiting | FAERS: 3 | US FAERS | |
| 56 | Alopecia | FAERS: 2 | US FAERS | |
| 57 | Aphasia | FAERS: 2 | US FAERS | |
| 58 | Arthralgia | FAERS: 2 | US FAERS | |
| 59 | Atrial Fibrillation | FAERS: 2 | US FAERS | |
| 60 | Blood creatine phosphokinase increased | FAERS: 2 | US FAERS | |
| 61 | Cerebrovascular accident | FAERS: 2 | US FAERS | |
| 62 | Chills | FAERS: 2 | US FAERS | |
| 63 | Cholelithiasis | FAERS: 2 | US FAERS | |
| 64 | Coma scale abnormal | FAERS: 2 | US FAERS | |
| 65 | Cyanosis | FAERS: 2 | US FAERS | |
| 66 | Depressed mood | FAERS: 2 | US FAERS | |
| 67 | Diabetes Mellitus | FAERS: 2 | US FAERS | |
| 68 | Drug administered at inappropriate site | FAERS: 2 | US FAERS | |
| 69 | Erythema | FAERS: 2 | US FAERS | |
| 70 | Escherichia sepsis | FAERS: 2 | US FAERS | |
| 71 | Facial paralysis | FAERS: 2 | US FAERS | |
| 72 | Feeling Cold | FAERS: 2 | US FAERS | |
| 73 | Headache | FAERS: 2 | US FAERS | |
| 74 | Injection site cyst | FAERS: 2 | US FAERS | |
| 75 | Injection site discomfort | FAERS: 2 | US FAERS | |
| 76 | Injection site extravasation | FAERS: 2 | US FAERS | |
| 77 | Injection site pruritus | FAERS: 2 | US FAERS | |
| 78 | Lethargy | FAERS: 2 | US FAERS | |
| 79 | Limb discomfort | FAERS: 2 | US FAERS | |
| 80 | Limb injury | FAERS: 2 | US FAERS | |
| 81 | Medication Error | FAERS: 2 | US FAERS | |
| 82 | Musculoskeletal stiffness | FAERS: 2 | US FAERS | |
| 83 | Myalgia | FAERS: 2 | US FAERS | |
| 84 | Nasopharyngitis | FAERS: 2 | US FAERS | |
| 85 | Nausea | FAERS: 2 | US FAERS | |
| 86 | No adverse event | FAERS: 2 | US FAERS | |
| 87 | Orthostatic intolerance | FAERS: 2 | US FAERS | |
| 88 | Palpitations | FAERS: 2 | US FAERS | |
| 89 | Poor quality sleep | FAERS: 2 | US FAERS | |
| 90 | Post procedural complication | FAERS: 2 | US FAERS | |
| 91 | Presyncope | FAERS: 2 | US FAERS | |
| 92 | Restless Legs Syndrome | FAERS: 2 | US FAERS | |
| 93 | Stress | FAERS: 2 | US FAERS | |
| 94 | White blood cell count decreased | FAERS: 2 | US FAERS | |
| 95 | Abasia | FAERS: 1 | US FAERS | |
| 96 | Abdominal Pain | FAERS: 1 | US FAERS | |
| 97 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 98 | Abscess | FAERS: 1 | US FAERS | |
| 99 | Alanine Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 100 | Alcohol abuse | FAERS: 1 | US FAERS | |
| 101 | Alcohol poisoning | FAERS: 1 | US FAERS | |
| 102 | Amnesia | FAERS: 1 | US FAERS | |
| 103 | Anger | FAERS: 1 | US FAERS | |
| 104 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 105 | Animal bite | FAERS: 1 | US FAERS | |
| 106 | Aortic Aneurysm | FAERS: 1 | US FAERS | |
| 107 | Apathy | FAERS: 1 | US FAERS | |
| 108 | Appendicitis | FAERS: 1 | US FAERS | |
| 109 | Aspartate Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 110 | Back Pain | FAERS: 1 | US FAERS | |
| 111 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 112 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 113 | Blood triglycerides increased | FAERS: 1 | US FAERS | |
| 114 | Blood triglycerides | FAERS: 1 | US FAERS | |
| 115 | Boredom | FAERS: 1 | US FAERS | |
| 116 | Bradykinesia | FAERS: 1 | US FAERS | |
| 117 | Bradyphrenia | FAERS: 1 | US FAERS | |
| 118 | Bronchopneumonia | FAERS: 1 | US FAERS | |
| 119 | Cardiac Death | FAERS: 1 | US FAERS | |
| 120 | Cardiac infection | FAERS: 1 | US FAERS | |
| 121 | Cardiomegaly | FAERS: 1 | US FAERS | |
| 122 | Cellulitis | FAERS: 1 | US FAERS | |
| 123 | Chest Pain | FAERS: 1 | US FAERS | |
| 124 | Choking | FAERS: 1 | US FAERS | |
| 125 | Cold sweat | FAERS: 1 | US FAERS | |
| 126 | Consciousness fluctuating | FAERS: 1 | US FAERS | |
| 127 | Constipation | FAERS: 1 | US FAERS | |
| 128 | Delusional disorder, unspecified type | FAERS: 1 | US FAERS | |
| 129 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 130 | Depression suicidal | FAERS: 1 | US FAERS | |
| 131 | Diet refusal | FAERS: 1 | US FAERS | |
| 132 | Diplopia | FAERS: 1 | US FAERS | |
| 133 | Discomfort | FAERS: 1 | US FAERS | |
| 134 | Drowning | FAERS: 1 | US FAERS | |
| 135 | Drug administration error | FAERS: 1 | US FAERS | |
| 136 | Drug level above therapeutic | FAERS: 1 | US FAERS | |
| 137 | Dysgeusia | FAERS: 1 | US FAERS | |
| 138 | Dysphonia | FAERS: 1 | US FAERS | |
| 139 | Epistaxis | FAERS: 1 | US FAERS | |
| 140 | Expired product administered | FAERS: 1 | US FAERS | |
| 141 | Flushing | FAERS: 1 | US FAERS | |
| 142 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 143 | Hepatitis C | FAERS: 1 | US FAERS | |
| 144 | Hyperreflexia | FAERS: 1 | US FAERS | |
| 145 | Hypersensitivity | FAERS: 1 | US FAERS | |
| 146 | Hypokinesia | FAERS: 1 | US FAERS | |
| 147 | Hypophagia | FAERS: 1 | US FAERS | |
| 148 | Inappropriate affect | FAERS: 1 | US FAERS | |
| 149 | Inappropriate schedule of product administration | FAERS: 1 | US FAERS | |
| 150 | Incoherent | FAERS: 1 | US FAERS | |
| 151 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 152 | Infarction | FAERS: 1 | US FAERS | |
| 153 | Injection Site Reaction | FAERS: 1 | US FAERS | |
| 154 | Injection site bruising | FAERS: 1 | US FAERS | |
| 155 | Injection site inflammation | FAERS: 1 | US FAERS | |
| 156 | Injection site irritation | FAERS: 1 | US FAERS | |
| 157 | Injection site mass | FAERS: 1 | US FAERS | |
| 158 | Injection site urticaria | FAERS: 1 | US FAERS | |
| 159 | Injection site vesicles | FAERS: 1 | US FAERS | |
| 160 | Injection site warmth | FAERS: 1 | US FAERS | |
| 161 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 162 | Intentional self-injury | FAERS: 1 | US FAERS | |
| 163 | Intercepted product selection error | FAERS: 1 | US FAERS | |
| 164 | Intestinal Obstruction | FAERS: 1 | US FAERS | |
| 165 | Intestinal Perforation | FAERS: 1 | US FAERS | |
| 166 | Joint injury | FAERS: 1 | US FAERS | |
| 167 | Joint stiffness | FAERS: 1 | US FAERS | |
| 168 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 169 | Mental status changes | FAERS: 1 | US FAERS | |
| 170 | Myoclonus | FAERS: 1 | US FAERS | |
| 171 | Needle issue | FAERS: 1 | US FAERS | |
| 172 | Nervousness | FAERS: 1 | US FAERS | |
| 173 | Neuroleptic Malignant Syndrome | FAERS: 1 | US FAERS | |
| 174 | Neurological infection | FAERS: 1 | US FAERS | |
| 175 | Obesity | FAERS: 1 | US FAERS | |
| 176 | Obsessive-Compulsive Disorder | FAERS: 1 | US FAERS | |
| 177 | Oromandibular dystonia | FAERS: 1 | US FAERS | |
| 178 | Paraparesis | FAERS: 1 | US FAERS | |
| 179 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 180 | Physical assault | FAERS: 1 | US FAERS | |
| 181 | Poor personal hygiene | FAERS: 1 | US FAERS | |
| 182 | Priapism | FAERS: 1 | US FAERS | |
| 183 | Procedural complication | FAERS: 1 | US FAERS | |
| 184 | Product preparation error | FAERS: 1 | US FAERS | |
| 185 | Pruritus | FAERS: 1 | US FAERS | |
| 186 | Psoriasis | FAERS: 1 | US FAERS | |
| 187 | Psychiatric symptom | FAERS: 1 | US FAERS | |
| 188 | Respiratory Depression | FAERS: 1 | US FAERS | |
| 189 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 190 | Respiratory distress | FAERS: 1 | US FAERS | |
| 191 | Schizoaffective Disorder | FAERS: 1 | US FAERS | |
| 192 | Screaming | FAERS: 1 | US FAERS | |
| 193 | Sedation complication | FAERS: 1 | US FAERS | |
| 194 | Seizure like phenomena | FAERS: 1 | US FAERS | |
| 195 | Sepsis | FAERS: 1 | US FAERS | |
| 196 | Sinus Tachycardia | FAERS: 1 | US FAERS | |
| 197 | Skin Wrinkling | FAERS: 1 | US FAERS | |
| 198 | Snoring | FAERS: 1 | US FAERS | |
| 199 | Staring | FAERS: 1 | US FAERS | |
| 200 | Subcutaneous Abscess | FAERS: 1 | US FAERS | |
| 201 | Thirst | FAERS: 1 | US FAERS | |
| 202 | Trismus | FAERS: 1 | US FAERS | |
| 203 | Troponin T increased | FAERS: 1 | US FAERS | |
| 204 | Ventricular arrhythmia | FAERS: 1 | US FAERS | |
| 205 | Wheezing | FAERS: 1 | US FAERS | |
| 206 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 207 | Wrong technique in product usage process | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120295
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.