bromfenac
(ZBPLOVFIXSTCRZ-UHFFFAOYSA-N)
Structure
- SMILES
- OC(=O)Cc1cccc(c1N)C(=O)c1ccc(cc1)Br
- Type(s)
- Approved
- ATC code(s)
- S01BC11
- Molecular Formula:
- C15H12BrNO3
- Molecular Weight:
- 334.165
- Log P:
- 3.4706
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 2
- TPSA:
- 80.39
- CAS Number(s):
- 91714-94-2; 120638-55-3
Synonym(s)
1.
bromfenac
2.
AHR-10282
3.
Duract
4.
ISV-303
5.
Xibrom
6.
bromfenac sodium
7.
sodium bromfenac
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Eye irritation | FAERS: 22 | SIDER US FAERS | |
| 2 | Eye pain | FAERS: 15 | SIDER US FAERS | |
| 3 | No adverse event | FAERS: 8 | US FAERS | |
| 4 | Foreign body sensation in eyes | FAERS: 6 | US FAERS | |
| 5 | Dizziness | FAERS: 5 | US FAERS | |
| 6 | Pruritus | FAERS: 5 | US FAERS | |
| 7 | Blepharitis | FAERS: 4 | US FAERS | |
| 8 | Cataract operation | FAERS: 4 | US FAERS | |
| 9 | Headache | FAERS: 4 | SIDER US FAERS | |
| 10 | Swelling of eyelid | FAERS: 4 | US FAERS | |
| 11 | Visual Impairment | FAERS: 4 | US FAERS | |
| 12 | Drug ineffective | FAERS: 3 | US FAERS | |
| 13 | Expired product administered | FAERS: 3 | US FAERS | |
| 14 | Feeling abnormal | FAERS: 3 | US FAERS | |
| 15 | Drug administration error | FAERS: 2 | US FAERS | |
| 16 | Eye Infection | FAERS: 2 | US FAERS | |
| 17 | Incorrect drug administration duration | FAERS: 2 | US FAERS | |
| 18 | Keratitis | FAERS: 2 | US FAERS | |
| 19 | Medication residue present | FAERS: 2 | US FAERS | |
| 20 | Nausea | FAERS: 2 | US FAERS | |
| 21 | Oropharyngeal pain | FAERS: 2 | US FAERS | |
| 22 | Photophobia | FAERS: 2 | SIDER US FAERS | |
| 23 | Tinnitus | FAERS: 2 | US FAERS | |
| 24 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 25 | Agitation | FAERS: 1 | US FAERS | |
| 26 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 27 | Anterior chamber inflammation | FAERS: 1 | SIDER US FAERS | |
| 28 | Asthenopia | FAERS: 1 | US FAERS | |
| 29 | Blindness | FAERS: 1 | US FAERS | |
| 30 | Blood iron decreased | FAERS: 1 | US FAERS | |
| 31 | Burning sensation | FAERS: 1 | US FAERS | |
| 32 | Caustic injury | FAERS: 1 | US FAERS | |
| 33 | Chromaturia | FAERS: 1 | US FAERS | |
| 34 | Conjunctivitis | FAERS: 1 | US FAERS | |
| 35 | Corneal erosion | FAERS: 1 | SIDER US FAERS | |
| 36 | Deposit eye | FAERS: 1 | US FAERS | |
| 37 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 38 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 39 | Extra dose administered | FAERS: 1 | US FAERS | |
| 40 | Eye inflammation | FAERS: 1 | US FAERS | |
| 41 | Eyelid margin crusting | FAERS: 1 | US FAERS | |
| 42 | Eyelid pain | FAERS: 1 | US FAERS | |
| 43 | Facial Pain | FAERS: 1 | US FAERS | |
| 44 | Fatigue | FAERS: 1 | US FAERS | |
| 45 | Hypersensitivity | FAERS: 1 | US FAERS | |
| 46 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 47 | Inappropriate schedule of product administration | FAERS: 1 | US FAERS | |
| 48 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 49 | Instillation site erythema | FAERS: 1 | US FAERS | |
| 50 | Instillation site pain | FAERS: 1 | US FAERS | |
| 51 | Joint swelling | FAERS: 1 | US FAERS | |
| 52 | Limb operation | FAERS: 1 | US FAERS | |
| 53 | Macular degeneration | FAERS: 1 | US FAERS | |
| 54 | Mydriasis | FAERS: 1 | US FAERS | |
| 55 | Ocular discomfort | FAERS: 1 | SIDER US FAERS | |
| 56 | Overdose | FAERS: 1 | US FAERS | |
| 57 | Pallor | FAERS: 1 | US FAERS | |
| 58 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 59 | Product dropper issue | FAERS: 1 | US FAERS | |
| 60 | Product physical consistency issue | FAERS: 1 | US FAERS | |
| 61 | Product quality issue | FAERS: 1 | US FAERS | |
| 62 | Reaction to preservatives | FAERS: 1 | US FAERS | |
| 63 | Retinal Vein Occlusion | FAERS: 1 | US FAERS | |
| 64 | Scleral thinning | FAERS: 1 | US FAERS | |
| 65 | Sneezing | FAERS: 1 | US FAERS | |
| 66 | Somnolence | FAERS: 1 | US FAERS | |
| 67 | Throat irritation | FAERS: 1 | US FAERS | |
| 68 | Tremor | FAERS: 1 | US FAERS | |
| 69 | Ulcer | FAERS: 1 | US FAERS | |
| 70 | Urticaria | FAERS: 1 | US FAERS | |
| 71 | Wheezing | FAERS: 1 | US FAERS | |
| 72 | Asthma | SIDER | ||
| 73 | Chemical and Drug Induced Liver Injury | CTD | ||
| 74 | Corneal Perforation | SIDER | ||
| 75 | Corneal Scar | SIDER | ||
| 76 | Corneal epithelium defect | SIDER | ||
| 77 | Corneal epithelium disorder | SIDER | ||
| 78 | Corneal thinning | SIDER | ||
| 79 | Epistaxis | SIDER | ||
| 80 | Eye Redness | SIDER | ||
| 81 | Iritis | SIDER | ||
| 82 | Liver Failure, Acute | 10445569 | CTD | |
| 83 | Nasal sinus drainage | SIDER | ||
| 84 | Pain | SIDER | ||
| 85 | Retinal exudates | SIDER | ||
| 86 | Scleromalacia | SIDER | ||
| 87 | Sinus operation | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.