Propafenone
(XWIHRGFIPXWGEF-UHFFFAOYSA-N)
Structure
- SMILES
- CCCNCC(COc1ccccc1C(=O)CCc1ccccc1)O.Cl
- Molecular Formula:
- C21H28ClNO3
- Molecular Weight:
- 377.905
- Log P:
- 4.4343
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 3
- TPSA:
- 58.56
- CAS Number(s):
- 34183-22-7
Synonym(s)
1.
Propafenone
2.
Apo-Propafenone
3.
Arythmol
4.
Baxarytmon
5.
Cuxafenon
6.
Fenoprain
7.
Jutanorm
8.
Nistaken
9.
Norfenon
10.
Pintoform
11.
Prolecofen
12.
Propafenon AL
13.
Propafenon Hexal
14.
Propafenon Minden
15.
Propafenone Hydrochloride
16.
Propafenone Hydrochloride, (R)-Isomer
17.
Propafenone Hydrochloride, (S)-Isomer
18.
Propafenone, (+-)-Isomer
19.
Propafenone, (R)-Isomer
20.
Propafenone, (S)-Isomer
21.
Propamerck
22.
Rythmol
23.
Rytmo-Puren
24.
Rytmogenat
25.
Rytmonorm
26.
SA-79
27.
Hydrochloride, Propafenone
28.
SA 79
29.
SA79
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Atrial Fibrillation | FAERS: 42 | US FAERS | |
| 2 | Product quality issue | FAERS: 31 | US FAERS | |
| 3 | Hypotension | FAERS: 30 | US FAERS | |
| 4 | Drug ineffective | FAERS: 28 | US FAERS | |
| 5 | Dizziness | FAERS: 23 | US FAERS | |
| 6 | Overdose | FAERS: 23 | US FAERS | |
| 7 | Asthenia | FAERS: 15 | US FAERS | |
| 8 | Cardiac Arrest | FAERS: 15 | US FAERS | |
| 9 | Headache | FAERS: 15 | US FAERS | |
| 10 | Malaise | FAERS: 15 | US FAERS | |
| 11 | Bradycardia | FAERS: 14 | US FAERS | |
| 12 | Chest Pain | FAERS: 14 | US FAERS | |
| 13 | Fatigue | FAERS: 14 | US FAERS | |
| 14 | Nausea | FAERS: 14 | US FAERS | |
| 15 | Palpitations | FAERS: 14 | US FAERS | |
| 16 | Completed Suicide | FAERS: 13 | US FAERS | |
| 17 | Product substitution issue | FAERS: 11 | US FAERS | |
| 18 | Syncope | FAERS: 11 | US FAERS | |
| 19 | Tremor | FAERS: 11 | US FAERS | |
| 20 | Myocardial Infarction | FAERS: 9 | US FAERS | |
| 21 | Suicide attempt | FAERS: 9 | US FAERS | |
| 22 | Vomiting | FAERS: 9 | US FAERS | |
| 23 | Abdominal Pain | FAERS: 8 | US FAERS | |
| 24 | Respiratory distress | FAERS: 8 | US FAERS | |
| 25 | Toxicity to various agents | FAERS: 8 | US FAERS | |
| 26 | Anxiety | FAERS: 7 | US FAERS | |
| 27 | Incorrect dose administered | FAERS: 7 | US FAERS | |
| 28 | Pain | FAERS: 7 | US FAERS | |
| 29 | Ventricular arrhythmia | FAERS: 7 | US FAERS | |
| 30 | Vertigo | FAERS: 7 | US FAERS | |
| 31 | Accidental exposure | FAERS: 6 | US FAERS | |
| 32 | Adverse event | FAERS: 6 | US FAERS | |
| 33 | Amnesia | FAERS: 6 | US FAERS | |
| 34 | Atrial Flutter | FAERS: 6 | US FAERS | |
| 35 | Cholestasis | FAERS: 6 | US FAERS | |
| 36 | Depressed Level of Consciousness | FAERS: 6 | US FAERS | |
| 37 | Drug toxicity | FAERS: 6 | US FAERS | |
| 38 | Dyspepsia | FAERS: 6 | US FAERS | |
| 39 | Atrioventricular Block | FAERS: 5 | US FAERS | |
| 40 | Dysgeusia | FAERS: 5 | US FAERS | |
| 41 | Sinus bradycardia | FAERS: 5 | US FAERS | |
| 42 | Tachycardia | FAERS: 5 | US FAERS | |
| 43 | Ventricular Fibrillation | FAERS: 5 | US FAERS | |
| 44 | Visual Impairment | FAERS: 5 | US FAERS | |
| 45 | Cerebrovascular accident | FAERS: 4 | US FAERS | |
| 46 | Chest discomfort | FAERS: 4 | US FAERS | |
| 47 | Constipation | FAERS: 4 | US FAERS | |
| 48 | Disease recurrence | FAERS: 4 | US FAERS | |
| 49 | Drug dose omission | FAERS: 4 | US FAERS | |
| 50 | Hepatotoxicity | FAERS: 4 | US FAERS | |
| 51 | Hypersensitivity | FAERS: 4 | US FAERS | |
| 52 | Intentional self-injury | FAERS: 4 | US FAERS | |
| 53 | Metabolic acidosis | FAERS: 4 | US FAERS | |
| 54 | Sinus Tachycardia | FAERS: 4 | US FAERS | |
| 55 | Therapeutic response unexpected with drug substitution | FAERS: 4 | US FAERS | |
| 56 | Abdominal discomfort | FAERS: 3 | US FAERS | |
| 57 | Accidental overdose | FAERS: 3 | US FAERS | |
| 58 | Arthralgia | FAERS: 3 | US FAERS | |
| 59 | Cold sweat | FAERS: 3 | US FAERS | |
| 60 | Economic problem | FAERS: 3 | US FAERS | |
| 61 | Feeling abnormal | FAERS: 3 | US FAERS | |
| 62 | Macular degeneration | FAERS: 3 | US FAERS | |
| 63 | Medication Error | FAERS: 3 | US FAERS | |
| 64 | Nasopharyngitis | FAERS: 3 | US FAERS | |
| 65 | No adverse event | FAERS: 3 | US FAERS | |
| 66 | Pallor | FAERS: 3 | US FAERS | |
| 67 | Pancytopenia | FAERS: 3 | US FAERS | |
| 68 | Pharmaceutical product complaint | FAERS: 3 | US FAERS | |
| 69 | Pneumonia | FAERS: 3 | US FAERS | |
| 70 | Product measured potency issue | FAERS: 3 | US FAERS | |
| 71 | Product taste abnormal | FAERS: 3 | US FAERS | |
| 72 | Psoriasis | FAERS: 3 | US FAERS | |
| 73 | Pulmonary congestion | FAERS: 3 | US FAERS | |
| 74 | Rehabilitation therapy | FAERS: 3 | US FAERS | |
| 75 | Somnolence | FAERS: 3 | US FAERS | |
| 76 | Weight decreased | FAERS: 3 | US FAERS | |
| 77 | cancer surgery | FAERS: 3 | US FAERS | |
| 78 | Accidental exposure to product by child | FAERS: 2 | US FAERS | |
| 79 | Acidosis | FAERS: 2 | US FAERS | |
| 80 | Activities of daily living impaired | FAERS: 2 | US FAERS | |
| 81 | Agitation | FAERS: 2 | US FAERS | |
| 82 | Blood potassium decreased | FAERS: 2 | US FAERS | |
| 83 | Circumstance or information capable of leading to medication error | FAERS: 2 | US FAERS | |
| 84 | Cyanosis | FAERS: 2 | US FAERS | |
| 85 | Drug dispensing error | FAERS: 2 | US FAERS | |
| 86 | Dysphonia | FAERS: 2 | US FAERS | |
| 87 | Electrocardiogram abnormal | FAERS: 2 | US FAERS | |
| 88 | Electrocardiogram change | FAERS: 2 | US FAERS | |
| 89 | Erythema | FAERS: 2 | US FAERS | |
| 90 | Excoriation | FAERS: 2 | US FAERS | |
| 91 | Iatrogenic injury | FAERS: 2 | US FAERS | |
| 92 | Incontinence | FAERS: 2 | US FAERS | |
| 93 | Intestinal Obstruction | FAERS: 2 | US FAERS | |
| 94 | Myoclonus | FAERS: 2 | US FAERS | |
| 95 | Neutropenia | FAERS: 2 | US FAERS | |
| 96 | Ophthalmoplegia | FAERS: 2 | US FAERS | |
| 97 | Oxygen saturation immeasurable | FAERS: 2 | US FAERS | |
| 98 | Presyncope | FAERS: 2 | US FAERS | |
| 99 | Pruritus | FAERS: 2 | US FAERS | |
| 100 | Pulmonary Fibrosis | FAERS: 2 | US FAERS | |
| 101 | Renal Cell Carcinoma | FAERS: 2 | US FAERS | |
| 102 | Sinoatrial Block | FAERS: 2 | US FAERS | |
| 103 | Sinus Arrhythmia | FAERS: 2 | US FAERS | |
| 104 | Supraventricular tachycardia | FAERS: 2 | US FAERS | |
| 105 | Thyroid Neoplasm | FAERS: 2 | US FAERS | |
| 106 | Unresponsive to stimuli | FAERS: 2 | US FAERS | |
| 107 | Urinary Incontinence | FAERS: 2 | US FAERS | |
| 108 | Urticaria | FAERS: 2 | US FAERS | |
| 109 | Accidental drug intake by child | FAERS: 1 | US FAERS | |
| 110 | Acquired porphyria | FAERS: 1 | US FAERS | |
| 111 | Acute Coronary Syndrome | FAERS: 1 | US FAERS | |
| 112 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 113 | Akinesia | FAERS: 1 | US FAERS | |
| 114 | Anorexia | FAERS: 1 | US FAERS | |
| 115 | Apallic syndrome | FAERS: 1 | US FAERS | |
| 116 | Apparent death | FAERS: 1 | US FAERS | |
| 117 | Apparent life threatening event | FAERS: 1 | US FAERS | |
| 118 | Atrial tachycardia | FAERS: 1 | US FAERS | |
| 119 | Back Pain | FAERS: 1 | US FAERS | |
| 120 | Bedridden | FAERS: 1 | US FAERS | |
| 121 | Blindness | FAERS: 1 | US FAERS | |
| 122 | Blood alkaline phosphatase increased | FAERS: 1 | US FAERS | |
| 123 | Blood pH decreased | FAERS: 1 | US FAERS | |
| 124 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 125 | Breast cancer recurrent | FAERS: 1 | US FAERS | |
| 126 | Bronchopneumonia | FAERS: 1 | US FAERS | |
| 127 | Burning sensation | FAERS: 1 | US FAERS | |
| 128 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 129 | Cardiac ablation | FAERS: 1 | US FAERS | |
| 130 | Cardiac enzymes increased | FAERS: 1 | US FAERS | |
| 131 | Cardiac ventricular disorder | FAERS: 1 | US FAERS | |
| 132 | Cardiomegaly | FAERS: 1 | US FAERS | |
| 133 | Cardiovascular insufficiency | FAERS: 1 | US FAERS | |
| 134 | Catecholamines urine normal | FAERS: 1 | US FAERS | |
| 135 | Chills | FAERS: 1 | US FAERS | |
| 136 | Cholelithiasis | FAERS: 1 | US FAERS | |
| 137 | Chromaturia | FAERS: 1 | US FAERS | |
| 138 | Crying | FAERS: 1 | US FAERS | |
| 139 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 140 | Dehydration | FAERS: 1 | US FAERS | |
| 141 | Dementia | FAERS: 1 | US FAERS | |
| 142 | Dermatitis Herpetiformis | FAERS: 1 | US FAERS | |
| 143 | Diplopia | FAERS: 1 | US FAERS | |
| 144 | Discomfort | FAERS: 1 | US FAERS | |
| 145 | Disorientation | FAERS: 1 | US FAERS | |
| 146 | Diverticulitis | FAERS: 1 | US FAERS | |
| 147 | Drug abuse | FAERS: 1 | US FAERS | |
| 148 | Drug administration error | FAERS: 1 | US FAERS | |
| 149 | Drug screen positive | FAERS: 1 | US FAERS | |
| 150 | Dry skin | FAERS: 1 | US FAERS | |
| 151 | Dysentery | FAERS: 1 | US FAERS | |
| 152 | Eczema | FAERS: 1 | US FAERS | |
| 153 | Ejection Fraction Decreased | FAERS: 1 | US FAERS | |
| 154 | Electrocardiogram repolarisation abnormality | FAERS: 1 | US FAERS | |
| 155 | Emotional disorder | FAERS: 1 | US FAERS | |
| 156 | Eosinophilia | FAERS: 1 | US FAERS | |
| 157 | Epistaxis | FAERS: 1 | US FAERS | |
| 158 | Erectile dysfunction | FAERS: 1 | US FAERS | |
| 159 | Eructation | FAERS: 1 | US FAERS | |
| 160 | Expired product administered | FAERS: 1 | US FAERS | |
| 161 | Eye irritation | FAERS: 1 | US FAERS | |
| 162 | Flatulence | FAERS: 1 | US FAERS | |
| 163 | Flushing | FAERS: 1 | US FAERS | |
| 164 | Frustration | FAERS: 1 | US FAERS | |
| 165 | Gastritis | FAERS: 1 | US FAERS | |
| 166 | Genital Herpes | FAERS: 1 | US FAERS | |
| 167 | Hepatitis | FAERS: 1 | US FAERS | |
| 168 | Hip surgery | FAERS: 1 | US FAERS | |
| 169 | Hypertransaminasaemia | FAERS: 1 | US FAERS | |
| 170 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 171 | Hypoxia | FAERS: 1 | US FAERS | |
| 172 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 173 | Impaired work ability | FAERS: 1 | US FAERS | |
| 174 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 175 | Incoherent | FAERS: 1 | US FAERS | |
| 176 | Infarction | FAERS: 1 | US FAERS | |
| 177 | Joint swelling | FAERS: 1 | US FAERS | |
| 178 | Laboratory test interference | FAERS: 1 | US FAERS | |
| 179 | Laryngitis | FAERS: 1 | US FAERS | |
| 180 | Malignant neoplasm progression | FAERS: 1 | US FAERS | |
| 181 | Memory impairment | FAERS: 1 | US FAERS | |
| 182 | Mental status changes | FAERS: 1 | US FAERS | |
| 183 | Metanephrine urine normal | FAERS: 1 | US FAERS | |
| 184 | Middle insomnia | FAERS: 1 | US FAERS | |
| 185 | Mixed liver injury | FAERS: 1 | US FAERS | |
| 186 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 187 | Myalgia | FAERS: 1 | US FAERS | |
| 188 | Mydriasis | FAERS: 1 | US FAERS | |
| 189 | Nervousness | FAERS: 1 | US FAERS | |
| 190 | Nocturia | FAERS: 1 | US FAERS | |
| 191 | Nuchal Rigidity | FAERS: 1 | US FAERS | |
| 192 | Opisthotonus | FAERS: 1 | US FAERS | |
| 193 | Petechiae | FAERS: 1 | US FAERS | |
| 194 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 195 | Procedural complication | FAERS: 1 | US FAERS | |
| 196 | Product commingling | FAERS: 1 | US FAERS | |
| 197 | Product label issue | FAERS: 1 | US FAERS | |
| 198 | Purpura | FAERS: 1 | US FAERS | |
| 199 | Rotator cuff syndrome | FAERS: 1 | US FAERS | |
| 200 | Shock | FAERS: 1 | US FAERS | |
| 201 | Sinobronchitis | FAERS: 1 | US FAERS | |
| 202 | Suture insertion | FAERS: 1 | US FAERS | |
| 203 | Swelling | FAERS: 1 | US FAERS | |
| 204 | Systolic dysfunction | FAERS: 1 | US FAERS | |
| 205 | Temperature intolerance | FAERS: 1 | US FAERS | |
| 206 | Tinnitus | FAERS: 1 | US FAERS | |
| 207 | Tonic clonic movements | FAERS: 1 | US FAERS | |
| 208 | Transaminases increased | FAERS: 1 | US FAERS | |
| 209 | Transplant | FAERS: 1 | US FAERS | |
| 210 | Unevaluable event | FAERS: 1 | US FAERS | |
| 211 | Vanillyl mandelic acid urine | FAERS: 1 | US FAERS | |
| 212 | Ventricular hyperkinesia | FAERS: 1 | US FAERS | |
| 213 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 214 | Wrong technique in product usage process | FAERS: 1 | US FAERS | |
| 215 | jaundice | FAERS: 1 | US FAERS | |
| 216 | liposarcoma | FAERS: 1 | US FAERS | |
| 217 | nervous system disorder | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.