Probenecid and colchicine
(WFUGJIWKCBYGJL-NTISSMGPSA-N)
Structure
- SMILES
- COc1c(OC)cc2c(c1OC)c1ccc(c(=O)cc1[C@H](CC2)NC(=O)C)OC.CCCN(S(=O)(=O)c1ccc(cc1)C(=O)O)CCC
- Molecular Formula:
- C35H44N2O10S
- Molecular Weight:
- 684.796
- Log P:
- 6.5388
- Hydrogen Bond Acceptor:
- 12
- Hydrogen Bond Donor:
- 2
- TPSA:
- 166.15
- CAS Number(s):
- 8055-45-6
Synonym(s)
1.
Probenecid and colchicine
External Link(s)
| PubChem Compound | 44149770 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Toxicity to various agents | FAERS: 24 | US FAERS | |
| 2 | Vomiting | FAERS: 12 | US FAERS | |
| 3 | Myopathy | FAERS: 9 | US FAERS | |
| 4 | Nausea | FAERS: 8 | US FAERS | |
| 5 | Disseminated Intravascular Coagulation | FAERS: 7 | US FAERS | |
| 6 | Leukocytosis | FAERS: 6 | US FAERS | |
| 7 | Product use in unapproved indication | FAERS: 6 | US FAERS | |
| 8 | Thrombocytopenia | FAERS: 6 | US FAERS | |
| 9 | Alopecia | FAERS: 5 | US FAERS | |
| 10 | Hypotension | FAERS: 5 | US FAERS | |
| 11 | Overdose | FAERS: 5 | US FAERS | |
| 12 | Product use issue | FAERS: 5 | US FAERS | |
| 13 | Rhabdomyolysis | FAERS: 5 | US FAERS | |
| 14 | Shock | FAERS: 5 | US FAERS | |
| 15 | Accidental exposure to product | FAERS: 4 | US FAERS | |
| 16 | Completed Suicide | FAERS: 4 | US FAERS | |
| 17 | Pancytopenia | FAERS: 4 | US FAERS | |
| 18 | Abdominal Pain | FAERS: 3 | US FAERS | |
| 19 | Acute kidney injury | FAERS: 3 | US FAERS | |
| 20 | Infertility | FAERS: 3 | US FAERS | |
| 21 | Abdominal tenderness | FAERS: 2 | US FAERS | |
| 22 | Blood creatine phosphokinase increased | FAERS: 2 | US FAERS | |
| 23 | Bradycardia | FAERS: 2 | US FAERS | |
| 24 | Cyanosis | FAERS: 2 | US FAERS | |
| 25 | Dehydration | FAERS: 2 | US FAERS | |
| 26 | Myalgia | FAERS: 2 | US FAERS | |
| 27 | Neuromuscular toxicity | FAERS: 2 | US FAERS | |
| 28 | Oliguria | FAERS: 2 | US FAERS | |
| 29 | Septic Shock | FAERS: 2 | US FAERS | |
| 30 | Transaminases increased | FAERS: 2 | US FAERS | |
| 31 | Abasia | FAERS: 1 | US FAERS | |
| 32 | Abdominal Compartment Syndrome | FAERS: 1 | US FAERS | |
| 33 | Accidental overdose | FAERS: 1 | US FAERS | |
| 34 | Agitation | FAERS: 1 | US FAERS | |
| 35 | Alanine Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 36 | Altered state of consciousness | FAERS: 1 | US FAERS | |
| 37 | Arthralgia | FAERS: 1 | US FAERS | |
| 38 | Aspartate Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 39 | Asthenia | FAERS: 1 | US FAERS | |
| 40 | Back Pain | FAERS: 1 | US FAERS | |
| 41 | Bicytopenia | FAERS: 1 | US FAERS | |
| 42 | Blood lactate dehydrogenase increased | FAERS: 1 | US FAERS | |
| 43 | Bone marrow depression | FAERS: 1 | US FAERS | |
| 44 | Cardiac Arrest | FAERS: 1 | US FAERS | |
| 45 | Deafness | FAERS: 1 | US FAERS | |
| 46 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 47 | Ecchymosis | FAERS: 1 | US FAERS | |
| 48 | Febrile Neutropenia | FAERS: 1 | US FAERS | |
| 49 | Fluid overload | FAERS: 1 | US FAERS | |
| 50 | Gangrene | FAERS: 1 | US FAERS | |
| 51 | Gastric ulcer | FAERS: 1 | US FAERS | |
| 52 | Hemiparesis | FAERS: 1 | US FAERS | |
| 53 | Histiocytosis haematophagic | FAERS: 1 | US FAERS | |
| 54 | Ileus | FAERS: 1 | US FAERS | |
| 55 | Joint swelling | FAERS: 1 | US FAERS | |
| 56 | Lethargy | FAERS: 1 | US FAERS | |
| 57 | Leukopenia | FAERS: 1 | US FAERS | |
| 58 | Mental status changes | FAERS: 1 | US FAERS | |
| 59 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 60 | Myocardial Infarction | FAERS: 1 | US FAERS | |
| 61 | Neurological decompensation | FAERS: 1 | US FAERS | |
| 62 | Neutropenia | FAERS: 1 | US FAERS | |
| 63 | Neutrophil morphology abnormal | FAERS: 1 | US FAERS | |
| 64 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 65 | Pain | FAERS: 1 | US FAERS | |
| 66 | Pallor | FAERS: 1 | US FAERS | |
| 67 | Poisoning | FAERS: 1 | US FAERS | |
| 68 | Purpura | FAERS: 1 | US FAERS | |
| 69 | Respiratory distress | FAERS: 1 | US FAERS | |
| 70 | Restlessness | FAERS: 1 | US FAERS | |
| 71 | Sinus bradycardia | FAERS: 1 | US FAERS | |
| 72 | Tachycardia | FAERS: 1 | US FAERS | |
| 73 | Thrombocytosis | FAERS: 1 | US FAERS | |
| 74 | Toxic Epidermal Necrolysis | FAERS: 1 | US FAERS | |
| 75 | Weight decreased | FAERS: 1 | US FAERS | |
| 76 | White blood cell count decreased | FAERS: 1 | US FAERS | |
| 77 | jaundice | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.