Meperidine
(WCNLCIJMFAJCPX-UHFFFAOYSA-N)
Structure
- SMILES
- CCOC(=O)C1(CCN(CC1)C)c1ccccc1.Cl
- Molecular Formula:
- C15H22ClNO2
- Molecular Weight:
- 283.794
- Log P:
- 2.9530
- Hydrogen Bond Acceptor:
- 3
- Hydrogen Bond Donor:
- 1
- TPSA:
- 29.54
- CAS Number(s):
- 50-13-5; 2793-00-2; 55989-09-8
Synonym(s)
1.
Meperidine
2.
Isonipecain
3.
Pethidine
4.
Demerol
5.
Dolantin
6.
Dolargan
7.
Dolcontral
8.
Dolin
9.
Dolosal
10.
Dolsin
11.
Lidol
12.
Lydol
13.
Meperidine Hydrochloride
14.
Operidine EPJ-I
15.
Operidine EPJ I
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Urticaria | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 2 | Nausea | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 3 | Pruritus | FAERS: 12 | US FAERS | |
| 4 | Drug ineffective | FAERS: 9 | US FAERS | |
| 5 | Vomiting | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 6 | Hypotension | FAERS: 7 | US FAERS | |
| 7 | Overdose | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 8 | Anxiety | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 9 | Pain | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 10 | Respiratory Depression | FAERS: 6 | US FAERS | |
| 11 | Erythema | FAERS: 5 | US FAERS | |
| 12 | Hypersensitivity | FAERS: 5 | US FAERS | |
| 13 | Disorientation | FAERS: 4 | US FAERS | |
| 14 | Infusion site erythema | FAERS: 4 | US FAERS | |
| 15 | Product quality issue | FAERS: 4 | US FAERS | |
| 16 | Abdominal discomfort | FAERS: 3 | US FAERS | |
| 17 | Drug Dependence | FAERS: 3 | US FAERS | |
| 18 | Drug toxicity | FAERS: 3 | US FAERS | |
| 19 | Incorrect dose administered | FAERS: 3 | US FAERS | |
| 20 | Malaise | FAERS: 3 | US FAERS | |
| 21 | Medication Error | FAERS: 3 | US FAERS | |
| 22 | Multiple drug overdose | FAERS: 3 | US FAERS | |
| 23 | No adverse event | FAERS: 3 | US FAERS | |
| 24 | Swelling | FAERS: 3 | US FAERS | |
| 25 | nervous system disorder | FAERS: 3 | US FAERS | |
| 26 | Agitation | FAERS: 2 | US FAERS | |
| 27 | Cardiac Arrest | FAERS: 2 | US FAERS | |
| 28 | Circumstance or information capable of leading to medication error | FAERS: 2 | US FAERS | |
| 29 | Drug abuse | FAERS: 2 | US FAERS | |
| 30 | Drug dispensing error | FAERS: 2 | US FAERS | |
| 31 | Drug screen negative | FAERS: 2 | US FAERS | |
| 32 | Inadequate analgesia | FAERS: 2 | US FAERS | |
| 33 | Injection site urticaria | FAERS: 2 | US FAERS | |
| 34 | Intentional product use issue | FAERS: 2 | US FAERS | |
| 35 | Myocardial Infarction | FAERS: 2 | US FAERS | |
| 36 | Pneumonia | FAERS: 2 | US FAERS | |
| 37 | Poor quality drug administered | FAERS: 2 | US FAERS | |
| 38 | Retrograde amnesia | FAERS: 2 | US FAERS | |
| 39 | Sepsis | FAERS: 2 | US FAERS | |
| 40 | Serotonin Syndrome | FAERS: 2 | US FAERS | |
| 41 | Unresponsive to stimuli | FAERS: 2 | US FAERS | |
| 42 | Abdominal Pain | FAERS: 1 | US FAERS | |
| 43 | Accidental overdose | FAERS: 1 | US FAERS | |
| 44 | Analgesic drug level decreased | FAERS: 1 | US FAERS | |
| 45 | Analgesic drug level increased | FAERS: 1 | US FAERS | |
| 46 | Anaphylactoid Reaction | FAERS: 1 | US FAERS | |
| 47 | Back Pain | FAERS: 1 | US FAERS | |
| 48 | Blindness | FAERS: 1 | US FAERS | |
| 49 | Blood creatine phosphokinase MB increased | FAERS: 1 | US FAERS | |
| 50 | Blood creatinine increased | FAERS: 1 | US FAERS | |
| 51 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 52 | Breakthrough Pain | FAERS: 1 | US FAERS | |
| 53 | Breast cancer stage III | FAERS: 1 | US FAERS | |
| 54 | Cachexia | FAERS: 1 | US FAERS | |
| 55 | Cerebral Palsy | FAERS: 1 | US FAERS | |
| 56 | Chest Pain | FAERS: 1 | US FAERS | |
| 57 | Chest discomfort | FAERS: 1 | US FAERS | |
| 58 | Chills | FAERS: 1 | US FAERS | |
| 59 | Completed Suicide | FAERS: 1 | US FAERS | |
| 60 | Contrast media reaction | FAERS: 1 | US FAERS | |
| 61 | Creatinine renal clearance decreased | FAERS: 1 | US FAERS | |
| 62 | Crying | FAERS: 1 | US FAERS | |
| 63 | Culture wound positive | FAERS: 1 | US FAERS | |
| 64 | Deafness | FAERS: 1 | US FAERS | |
| 65 | Delirium | FAERS: 1 | US FAERS | |
| 66 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 67 | Disseminated Intravascular Coagulation | FAERS: 1 | US FAERS | |
| 68 | Dizziness | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 69 | Drug exposure during pregnancy | FAERS: 1 | US FAERS | |
| 70 | Drug withdrawal convulsions | FAERS: 1 | US FAERS | |
| 71 | Dry skin | FAERS: 1 | US FAERS | |
| 72 | Dysgeusia | FAERS: 1 | US FAERS | |
| 73 | Dyspepsia | FAERS: 1 | US FAERS | |
| 74 | Emotional disorder | FAERS: 1 | US FAERS | |
| 75 | Expired product administered | FAERS: 1 | US FAERS | |
| 76 | Exposure via inhalation | FAERS: 1 | US FAERS | |
| 77 | Feeling Cold | FAERS: 1 | US FAERS | |
| 78 | Feeling jittery | FAERS: 1 | US FAERS | |
| 79 | Fibrodysplasia Ossificans Progressiva | FAERS: 1 | US FAERS | |
| 80 | Foaming at mouth | FAERS: 1 | US FAERS | |
| 81 | Formication | FAERS: 1 | US FAERS | |
| 82 | Hypoventilation | FAERS: 1 | US FAERS | |
| 83 | Immobile | FAERS: 1 | US FAERS | |
| 84 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 85 | Incorrect drug administration rate | FAERS: 1 | US FAERS | |
| 86 | Infusion site pain | FAERS: 1 | US FAERS | |
| 87 | Injection site abscess | FAERS: 1 | US FAERS | |
| 88 | Injection site erythema | FAERS: 1 | US FAERS | |
| 89 | Injection site pruritus | FAERS: 1 | US FAERS | |
| 90 | Lethargy | FAERS: 1 | US FAERS | |
| 91 | Mental status changes | FAERS: 1 | US FAERS | |
| 92 | Muscle Rigidity | FAERS: 1 | US FAERS | |
| 93 | Myoclonus | FAERS: 1 | US FAERS | |
| 94 | Myoglobin blood increased | FAERS: 1 | US FAERS | |
| 95 | Myopathy | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 96 | Nasal discomfort | FAERS: 1 | US FAERS | |
| 97 | Necrosis | FAERS: 1 | US FAERS | |
| 98 | Nervousness | FAERS: 1 | US FAERS | |
| 99 | Occupational exposure to product | FAERS: 1 | US FAERS | |
| 100 | Pallor | FAERS: 1 | US FAERS | |
| 101 | Pancreatitis | FAERS: 1 | US FAERS | |
| 102 | Pharmaceutical product complaint | FAERS: 1 | US FAERS | |
| 103 | Postoperative ileus | FAERS: 1 | US FAERS | |
| 104 | Procedural complication | FAERS: 1 | US FAERS | |
| 105 | Product deposit | FAERS: 1 | US FAERS | |
| 106 | Product dosage form issue | FAERS: 1 | US FAERS | |
| 107 | Product expiration date issue | FAERS: 1 | US FAERS | |
| 108 | Product friable | FAERS: 1 | US FAERS | |
| 109 | Product taste abnormal | FAERS: 1 | US FAERS | |
| 110 | Product use issue | FAERS: 1 | US FAERS | |
| 111 | Purpura | FAERS: 1 | US FAERS | |
| 112 | Rash erythematous | FAERS: 1 | US FAERS | |
| 113 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 114 | Respiratory distress | FAERS: 1 | US FAERS | |
| 115 | Restlessness | FAERS: 1 | US FAERS | |
| 116 | Rhabdomyolysis | FAERS: 1 | US FAERS | |
| 117 | Sinus Tachycardia | FAERS: 1 | US FAERS | |
| 118 | Tachycardia | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 119 | Tension | FAERS: 1 | US FAERS | |
| 120 | Tongue biting | FAERS: 1 | US FAERS | |
| 121 | Traumatic Brain Injury | FAERS: 1 | US FAERS | |
| 122 | Troponin T increased | FAERS: 1 | US FAERS | |
| 123 | Wrong technique in product usage process | FAERS: 1 | US FAERS | |
| 124 | Asthenia | Canada Vigilance: 1 | Canada Vigilance | |
| 125 | Consciousness fluctuating | Canada Vigilance: 1 | Canada Vigilance | |
| 126 | Cyanosis | Canada Vigilance: 1 | Canada Vigilance | |
| 127 | Flushing | Canada Vigilance: 1 | Canada Vigilance | |
| 128 | Hyperventilation | Canada Vigilance: 1 | Canada Vigilance | |
| 129 | Hypoxia | Canada Vigilance: 1 | Canada Vigilance | |
| 130 | Injection Site Reaction | Canada Vigilance: 1 | Canada Vigilance | |
| 131 | Injection site inflammation | Canada Vigilance: 1 | Canada Vigilance | |
| 132 | Injection site pain | Canada Vigilance: 1 | Canada Vigilance | |
| 133 | Livedo Reticularis | Canada Vigilance: 1 | Canada Vigilance | |
| 134 | Metabolic acidosis | Canada Vigilance: 1 | Canada Vigilance | |
| 135 | Shock | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.