Cromolyn Sodium
(VLARUOGDXDTHEH-UHFFFAOYSA-L)
Structure
- SMILES
- OC(COc1cccc2c1c(=O)cc(o2)C(=O)[O-])COc1cccc2c1c(=O)cc(o2)C(=O)[O-].[Na+].[Na+]
- Molecular Formula:
- C23H14Na2O11
- Molecular Weight:
- 512.330
- Log P:
- -0.5549
- Hydrogen Bond Acceptor:
- 11
- Hydrogen Bond Donor:
- 1
- TPSA:
- 179.37
- CAS Number(s):
- 15826-37-6
Synonym(s)
1.
Cromolyn Sodium
2.
Disodium Cromoglycate
3.
Sodium Cromoglycate
4.
Aarane
5.
Bicromat Spray
6.
Cromoglicic Acid
7.
Cromoglycate
8.
Cromoglycic Acid
9.
Cromolyn
10.
FPL-670
11.
Intal
12.
Lomudal
13.
Nalcrom
14.
Nasalcrom
15.
Opticrom
16.
Vicrom
17.
Acid, Cromoglicic
18.
Acid, Cromoglycic
19.
Cromoglycate, Disodium
20.
Cromoglycate, Sodium
21.
FPL 670
22.
FPL670
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 38 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 2 | Epistaxis | FAERS: 14 | OFFSIDES US FAERS | |
| 3 | Headache | FAERS: 13 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 4 | Dizziness | FAERS: 11 | OFFSIDES US FAERS | |
| 5 | Nausea | FAERS: 11 | OFFSIDES US FAERS | |
| 6 | Eye irritation | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 7 | Hypersensitivity | FAERS: 9 Canada Vigilance: 1 | 15033348 | CTD Canada Vigilance US FAERS |
| 8 | Asthma | FAERS: 7 | 7437783 | CTD OFFSIDES US FAERS |
| 9 | Fatigue | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 10 | Malaise | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 11 | Nasal discomfort | FAERS: 7 | OFFSIDES US FAERS | |
| 12 | Burning sensation | FAERS: 6 | US FAERS | |
| 13 | Incorrect route of drug administration | FAERS: 6 | US FAERS | |
| 14 | Wheezing | FAERS: 6 | US FAERS | |
| 15 | Abdominal discomfort | FAERS: 5 | US FAERS | |
| 16 | Asthenia | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 17 | Chest discomfort | FAERS: 5 | US FAERS | |
| 18 | Eye pain | FAERS: 5 | US FAERS | |
| 19 | No adverse event | FAERS: 5 | US FAERS | |
| 20 | Vomiting | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 21 | Anxiety | FAERS: 4 | US FAERS | |
| 22 | Expired drug administered | FAERS: 4 | OFFSIDES US FAERS | |
| 23 | Infection | FAERS: 4 | OFFSIDES US FAERS | |
| 24 | Product substitution issue | FAERS: 4 | US FAERS | |
| 25 | Sinusitis | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 26 | Drug administration error | FAERS: 3 | US FAERS | |
| 27 | Drug dispensing error | FAERS: 3 | US FAERS | |
| 28 | Dysphonia | FAERS: 3 | OFFSIDES US FAERS | |
| 29 | Erythema | FAERS: 3 | US FAERS | |
| 30 | Feeling jittery | FAERS: 3 | US FAERS | |
| 31 | Flushing | FAERS: 3 | US FAERS | |
| 32 | Incorrect dose administered | FAERS: 3 | US FAERS | |
| 33 | Medication Error | FAERS: 3 | US FAERS | |
| 34 | Myalgia | FAERS: 3 | US FAERS | |
| 35 | Pain | FAERS: 3 | US FAERS | |
| 36 | Pneumonia | FAERS: 3 | US FAERS | |
| 37 | Product quality issue | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 38 | Pruritus | FAERS: 3 | US FAERS | |
| 39 | Throat irritation | FAERS: 3 | US FAERS | |
| 40 | Vertigo | FAERS: 3 | US FAERS | |
| 41 | Accidental exposure to product | FAERS: 2 | US FAERS | |
| 42 | Adverse event | FAERS: 2 | OFFSIDES US FAERS | |
| 43 | Ageusia | FAERS: 2 | US FAERS | |
| 44 | Anosmia | FAERS: 2 | US FAERS | |
| 45 | Arthralgia | FAERS: 2 | US FAERS | |
| 46 | Chest Pain | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 47 | Drug exposure during pregnancy | FAERS: 2 | US FAERS | |
| 48 | Drug prescribing error | FAERS: 2 | US FAERS | |
| 49 | Dysgeusia | FAERS: 2 | US FAERS | |
| 50 | Feeling abnormal | FAERS: 2 | US FAERS | |
| 51 | Gastritis | FAERS: 2 | US FAERS | |
| 52 | Gastroenteritis | FAERS: 2 | US FAERS | |
| 53 | Product packaging issue | FAERS: 2 | US FAERS | |
| 54 | Product storage error | FAERS: 2 | US FAERS | |
| 55 | Product use issue | FAERS: 2 | US FAERS | |
| 56 | Sneezing | FAERS: 2 | US FAERS | |
| 57 | Unevaluable event | FAERS: 2 | US FAERS | |
| 58 | Urticaria | FAERS: 2 | US FAERS | |
| 59 | Wrong technique in product usage process | FAERS: 2 | US FAERS | |
| 60 | Abdominal Pain | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 61 | Alanine Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 62 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 63 | Aphonia | FAERS: 1 | US FAERS | |
| 64 | Aspartate Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 65 | Asphyxia | FAERS: 1 | OFFSIDES US FAERS | |
| 66 | Back Pain | FAERS: 1 | US FAERS | |
| 67 | Bronchospasm | FAERS: 1 | US FAERS | |
| 68 | Catheter site pain | FAERS: 1 | US FAERS | |
| 69 | Catheter site swelling | FAERS: 1 | US FAERS | |
| 70 | Cellulitis | FAERS: 1 | OFFSIDES US FAERS | |
| 71 | Choking sensation | FAERS: 1 | OFFSIDES US FAERS | |
| 72 | Crying | FAERS: 1 | US FAERS | |
| 73 | Deafness Neurosensory | FAERS: 1 | US FAERS | |
| 74 | Deafness | FAERS: 1 | US FAERS | |
| 75 | Dependence | FAERS: 1 | US FAERS | |
| 76 | Disease recurrence | FAERS: 1 | US FAERS | |
| 77 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 78 | Drug label confusion | FAERS: 1 | US FAERS | |
| 79 | Ear discomfort | FAERS: 1 | OFFSIDES US FAERS | |
| 80 | Ecchymosis | FAERS: 1 | US FAERS | |
| 81 | Emotional distress | FAERS: 1 | US FAERS | |
| 82 | Empyema | FAERS: 1 | US FAERS | |
| 83 | Eosinophilia | FAERS: 1 | US FAERS | |
| 84 | Expired product administered | FAERS: 1 | US FAERS | |
| 85 | Eye inflammation | FAERS: 1 | US FAERS | |
| 86 | Eyelids pruritus | FAERS: 1 | US FAERS | |
| 87 | Facial Pain | FAERS: 1 | US FAERS | |
| 88 | Failure to Thrive | FAERS: 1 | US FAERS | |
| 89 | Food Allergy | FAERS: 1 | US FAERS | |
| 90 | Gangrene | FAERS: 1 | US FAERS | |
| 91 | Gastrointestinal motility disorder | FAERS: 1 | US FAERS | |
| 92 | Genital erythema | FAERS: 1 | US FAERS | |
| 93 | Genital rash | FAERS: 1 | US FAERS | |
| 94 | Hepatitis C RNA positive | FAERS: 1 | US FAERS | |
| 95 | Hepatitis C | FAERS: 1 | OFFSIDES US FAERS | |
| 96 | Hunger | FAERS: 1 | US FAERS | |
| 97 | Impaired work ability | FAERS: 1 | US FAERS | |
| 98 | Incoherent | FAERS: 1 | US FAERS | |
| 99 | Incorrect route of product administration | FAERS: 1 | US FAERS | |
| 100 | Incorrect storage of drug | FAERS: 1 | US FAERS | |
| 101 | Inflammation | FAERS: 1 | US FAERS | |
| 102 | Influenza | FAERS: 1 | US FAERS | |
| 103 | Instillation site pain | FAERS: 1 | US FAERS | |
| 104 | Intentional dose omission | FAERS: 1 | US FAERS | |
| 105 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 106 | Joint Range of Motion Decreased | FAERS: 1 | US FAERS | |
| 107 | Lethargy | FAERS: 1 | US FAERS | |
| 108 | Loss of personal independence in daily activities | FAERS: 1 | US FAERS | |
| 109 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 110 | Lupus-like syndrome | FAERS: 1 | US FAERS | |
| 111 | Medical device complication | FAERS: 1 | US FAERS | |
| 112 | Medication residue present | FAERS: 1 | US FAERS | |
| 113 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 114 | Nasal inflammation | FAERS: 1 | OFFSIDES US FAERS | |
| 115 | Neck Pain | FAERS: 1 | US FAERS | |
| 116 | Nephrolithiasis | FAERS: 1 | US FAERS | |
| 117 | Nodule | FAERS: 1 | US FAERS | |
| 118 | Ocular discomfort | FAERS: 1 | US FAERS | |
| 119 | Oral pain | FAERS: 1 | US FAERS | |
| 120 | Oropharyngeal pain | FAERS: 1 | OFFSIDES US FAERS | |
| 121 | Overdose | FAERS: 1 | OFFSIDES US FAERS | |
| 122 | Palpitations | FAERS: 1 | US FAERS | |
| 123 | Parotitis | FAERS: 1 | US FAERS | |
| 124 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 125 | Pleurisy | FAERS: 1 | US FAERS | |
| 126 | Product coating issue | FAERS: 1 | US FAERS | |
| 127 | Product counterfeit | FAERS: 1 | US FAERS | |
| 128 | Product packaging confusion | FAERS: 1 | US FAERS | |
| 129 | Product tampering | FAERS: 1 | OFFSIDES US FAERS | |
| 130 | Productive Cough | FAERS: 1 | US FAERS | |
| 131 | Pulmonary congestion | FAERS: 1 | US FAERS | |
| 132 | Rash erythematous | FAERS: 1 | US FAERS | |
| 133 | Reaction to excipient | FAERS: 1 | US FAERS | |
| 134 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 135 | Rhinalgia | FAERS: 1 | US FAERS | |
| 136 | Secretion discharge | FAERS: 1 | US FAERS | |
| 137 | Somnolence | FAERS: 1 | US FAERS | |
| 138 | Suspected product contamination | FAERS: 1 | US FAERS | |
| 139 | Tension Headache | FAERS: 1 | OFFSIDES US FAERS | |
| 140 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 141 | Upper-airway cough syndrome | FAERS: 1 | US FAERS | |
| 142 | Vasculitis | FAERS: 1 | US FAERS | |
| 143 | Venous Injury | FAERS: 1 | US FAERS | |
| 144 | Venous Thrombosis | FAERS: 1 | US FAERS | |
| 145 | Viral upper respiratory tract infection | FAERS: 1 | US FAERS | |
| 146 | Visual Impairment | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 147 | Weight decreased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 148 | White blood cell count abnormal | FAERS: 1 | US FAERS | |
| 149 | nervous system disorder | FAERS: 1 | US FAERS | |
| 150 | treatment failure | FAERS: 1 | US FAERS | |
| 151 | Abasia | OFFSIDES | ||
| 152 | Abscess | OFFSIDES | ||
| 153 | Alopecia | OFFSIDES | ||
| 154 | Alveolitis | OFFSIDES | ||
| 155 | Amnesia | OFFSIDES | ||
| 156 | Amniotic cavity disorder | OFFSIDES | ||
| 157 | Amphetamines | OFFSIDES | ||
| 158 | Angioedema | 6814739 | CTD | |
| 159 | Anorexia | OFFSIDES | ||
| 160 | Apathy | OFFSIDES | ||
| 161 | Arteriosclerosis | OFFSIDES | ||
| 162 | Arthritis | Canada Vigilance: 1 | Canada Vigilance OFFSIDES | |
| 163 | Blepharoptosis | OFFSIDES | ||
| 164 | Blood Glucose | OFFSIDES | ||
| 165 | Blood corticotrophin | OFFSIDES | ||
| 166 | Blood immunoglobulin E | OFFSIDES | ||
| 167 | Blood immunoglobulin G abnormal | OFFSIDES | ||
| 168 | Blood lactate dehydrogenase increased | OFFSIDES | ||
| 169 | Blood potassium increased | OFFSIDES | ||
| 170 | Blood uric acid | OFFSIDES | ||
| 171 | Bone marrow depression | OFFSIDES | ||
| 172 | Bradycardia | OFFSIDES | ||
| 173 | Bronchiectasis | OFFSIDES | ||
| 174 | Bronchitis | OFFSIDES | ||
| 175 | Bursitis | OFFSIDES | ||
| 176 | Calcinosis | OFFSIDES | ||
| 177 | Cardiomegaly | 18520950 | CTD | |
| 178 | Cardiomyopathies | 2432914 2467809 | CTD | |
| 179 | Cataract | OFFSIDES | ||
| 180 | Catheter related complication | OFFSIDES | ||
| 181 | Chills | Canada Vigilance: 1 | Canada Vigilance | |
| 182 | Chronic Obstructive Airway Disease | OFFSIDES | ||
| 183 | Cognitive deterioration | OFFSIDES | ||
| 184 | Colonic Neoplasms | 28732690 | CTD | |
| 185 | Conjunctivitis | Canada Vigilance: 2 | Canada Vigilance | |
| 186 | Dental caries | OFFSIDES | ||
| 187 | Deposit eye | OFFSIDES | ||
| 188 | Diabetes Mellitus, Experimental | 23784744 | CTD | |
| 189 | Diarrhea | OFFSIDES | ||
| 190 | Diplopia | OFFSIDES | ||
| 191 | Disorientation | Canada Vigilance: 1 | Canada Vigilance | |
| 192 | Drowsiness | OFFSIDES | ||
| 193 | Drug addict | OFFSIDES | ||
| 194 | Dysmorphism | OFFSIDES | ||
| 195 | Dyspepsia | OFFSIDES | ||
| 196 | Early satiety | OFFSIDES | ||
| 197 | Economic problem | OFFSIDES | ||
| 198 | Edema | 19703484 | CTD | |
| 199 | Eosinophilic Pneumonia | OFFSIDES | ||
| 200 | Epstein-Barr virus antibody positive | OFFSIDES | ||
| 201 | Eye Infection | OFFSIDES | ||
| 202 | Facial wasting | OFFSIDES | ||
| 203 | Febrile infection | OFFSIDES | ||
| 204 | Glaucoma | OFFSIDES | ||
| 205 | Globulinuria | OFFSIDES | ||
| 206 | Gout | OFFSIDES | ||
| 207 | Granuloma | Canada Vigilance: 1 | Canada Vigilance | |
| 208 | Heart Diseases | 6196562 | CTD | |
| 209 | Hepatitis B surface antigen positive | OFFSIDES | ||
| 210 | Hepatitis E | OFFSIDES | ||
| 211 | High density lipoprotein increased | OFFSIDES | ||
| 212 | Hoarseness | OFFSIDES | ||
| 213 | Hyperkeratosis | OFFSIDES | ||
| 214 | Hysterectomy | OFFSIDES | ||
| 215 | Immune complex level increased | OFFSIDES | ||
| 216 | Incision site complication | OFFSIDES | ||
| 217 | Inhalation Therapy | OFFSIDES | ||
| 218 | Keratitis | Canada Vigilance: 1 | Canada Vigilance | |
| 219 | Left atrial dilatation | OFFSIDES | ||
| 220 | Lymphocyte stimulation test positive | OFFSIDES | ||
| 221 | Malignant neoplasm of spinal cord | OFFSIDES | ||
| 222 | Morphea | OFFSIDES | ||
| 223 | Musculoskeletal discomfort | OFFSIDES | ||
| 224 | Myasthenia Gravis | OFFSIDES | ||
| 225 | Nasopharyngitis | OFFSIDES | ||
| 226 | Necrosis | 16798005 | CTD | |
| 227 | Nephrotic Syndrome | OFFSIDES | ||
| 228 | Nervous tension | OFFSIDES | ||
| 229 | Obesity | 23784744 | CTD | |
| 230 | Obsessive thoughts | OFFSIDES | ||
| 231 | Oliguria | OFFSIDES | ||
| 232 | Osteopenia | OFFSIDES | ||
| 233 | Pancreatic enzymes abnormal | OFFSIDES | ||
| 234 | Pelvic prolapse | OFFSIDES | ||
| 235 | Pemphigus | OFFSIDES | ||
| 236 | Photophobia | Canada Vigilance: 1 | Canada Vigilance | |
| 237 | Pneumothorax | OFFSIDES | ||
| 238 | Procedural complication | OFFSIDES | ||
| 239 | Product contamination | Canada Vigilance: 1 | Canada Vigilance | |
| 240 | Psychomotor skills impaired | OFFSIDES | ||
| 241 | Radicular pain | OFFSIDES | ||
| 242 | Reaction to preservatives | OFFSIDES | ||
| 243 | Regurgitation | OFFSIDES | ||
| 244 | Renal cyst | OFFSIDES | ||
| 245 | Rhinitis | OFFSIDES | ||
| 246 | Scotoma | OFFSIDES | ||
| 247 | Seizures | 20012267 | CTD | |
| 248 | Self Mutilation | OFFSIDES | ||
| 249 | Shoulder Pain | OFFSIDES | ||
| 250 | Sinus headache | OFFSIDES | ||
| 251 | Spinal column stenosis | OFFSIDES | ||
| 252 | Sudden Cardiac Death | OFFSIDES | ||
| 253 | Superficial Thrombophlebitis | OFFSIDES | ||
| 254 | Swelling | Canada Vigilance: 1 | Canada Vigilance | |
| 255 | Talipes | OFFSIDES | ||
| 256 | Upper respiratory tract inflammation | OFFSIDES | ||
| 257 | Venoocclusive disease | OFFSIDES | ||
| 258 | Vitreous Detachment | OFFSIDES | ||
| 259 | Vulvovaginal mycotic infection | OFFSIDES | ||
| 260 | anaphylaxis | 9597688 16536907 24361550 | CTD | |
| 261 | pH body fluid abnormal | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120238
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.