(3S,4R)-3-(1,3-Benzodioxol-5-yloxymethyl)-4-(4-fluorophenyl)piperidin-1-ium;methanesulfonate
(SHIJTGJXUHTGGZ-RVXRQPKJSA-N)
Structure
- SMILES
- CS(=O)(=O)O.Fc1ccc(cc1)[C@@H]1CCNC[C@H]1COc1ccc2c(c1)OCO2
- Molecular Formula:
- C20H24FNO6S
- Molecular Weight:
- 425.471
- Log P:
- 4.2401
- Hydrogen Bond Acceptor:
- 7
- Hydrogen Bond Donor:
- 2
- TPSA:
- 102.47
- CAS Number(s):
- 217797-14-3
Synonym(s)
1.
(3S,4R)-3-(1,3-Benzodioxol-5-yloxymethyl)-4-(4-fluorophenyl)piperidin-1-ium;methanesulfonate
2.
Paroxetine Mesylate
External Link(s)
| PubChem Compound | 11407639 9845306 |
| CHEMBL | CHEMBL1200609 |
| KEGG | dr:D05375 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 85 | US FAERS | |
| 2 | Nausea | FAERS: 39 | US FAERS | |
| 3 | Headache | FAERS: 37 | US FAERS | |
| 4 | Drug dose omission | FAERS: 27 | US FAERS | |
| 5 | Fatigue | FAERS: 25 | US FAERS | |
| 6 | No adverse event | FAERS: 25 | US FAERS | |
| 7 | Dizziness | FAERS: 24 | US FAERS | |
| 8 | Feeling abnormal | FAERS: 21 | US FAERS | |
| 9 | Vomiting | FAERS: 16 | US FAERS | |
| 10 | Somnolence | FAERS: 13 | US FAERS | |
| 11 | Product quality issue | FAERS: 11 | US FAERS | |
| 12 | Drug administration error | FAERS: 10 | US FAERS | |
| 13 | Anxiety | FAERS: 9 | US FAERS | |
| 14 | Drug prescribing error | FAERS: 9 | US FAERS | |
| 15 | Therapy cessation | FAERS: 9 | US FAERS | |
| 16 | Malaise | FAERS: 7 | US FAERS | |
| 17 | Night sweats | FAERS: 7 | US FAERS | |
| 18 | Palpitations | FAERS: 7 | US FAERS | |
| 19 | Restlessness | FAERS: 6 | US FAERS | |
| 20 | Anger | FAERS: 5 | US FAERS | |
| 21 | Wrong technique in drug usage process | FAERS: 5 | US FAERS | |
| 22 | Asthenia | FAERS: 4 | US FAERS | |
| 23 | Lethargy | FAERS: 4 | US FAERS | |
| 24 | Myalgia | FAERS: 4 | US FAERS | |
| 25 | Nervousness | FAERS: 4 | US FAERS | |
| 26 | Pruritus | FAERS: 4 | US FAERS | |
| 27 | Abdominal discomfort | FAERS: 3 | US FAERS | |
| 28 | Anorgasmia | FAERS: 3 | US FAERS | |
| 29 | Drug effect incomplete | FAERS: 3 | US FAERS | |
| 30 | Hypersensitivity | FAERS: 3 | US FAERS | |
| 31 | Inappropriate schedule of drug administration | FAERS: 3 | US FAERS | |
| 32 | Bruxism | FAERS: 2 | US FAERS | |
| 33 | Crying | FAERS: 2 | US FAERS | |
| 34 | Depressed mood | FAERS: 2 | US FAERS | |
| 35 | Dyspepsia | FAERS: 2 | US FAERS | |
| 36 | Flatulence | FAERS: 2 | US FAERS | |
| 37 | Incorrect dose administered | FAERS: 2 | US FAERS | |
| 38 | Middle insomnia | FAERS: 2 | US FAERS | |
| 39 | Nasopharyngitis | FAERS: 2 | US FAERS | |
| 40 | Neck Pain | FAERS: 2 | US FAERS | |
| 41 | Pain | FAERS: 2 | US FAERS | |
| 42 | Photophobia | FAERS: 2 | US FAERS | |
| 43 | Poor quality sleep | FAERS: 2 | US FAERS | |
| 44 | Serotonin Syndrome | FAERS: 2 | US FAERS | |
| 45 | Tremor | FAERS: 2 | US FAERS | |
| 46 | Vertigo | FAERS: 2 | US FAERS | |
| 47 | Adverse event | FAERS: 1 | US FAERS | |
| 48 | Agitation | FAERS: 1 | US FAERS | |
| 49 | Alopecia | FAERS: 1 | US FAERS | |
| 50 | Arthralgia | FAERS: 1 | US FAERS | |
| 51 | Arthritis | FAERS: 1 | US FAERS | |
| 52 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 53 | Bladder spasm | FAERS: 1 | US FAERS | |
| 54 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 55 | Breast tenderness | FAERS: 1 | US FAERS | |
| 56 | Chest Pain | FAERS: 1 | US FAERS | |
| 57 | Chills | FAERS: 1 | US FAERS | |
| 58 | Constipation | FAERS: 1 | US FAERS | |
| 59 | Dehydration | FAERS: 1 | US FAERS | |
| 60 | Discomfort | FAERS: 1 | US FAERS | |
| 61 | Disorientation | FAERS: 1 | US FAERS | |
| 62 | Drug withdrawal syndrome | FAERS: 1 | US FAERS | |
| 63 | Dysarthria | FAERS: 1 | US FAERS | |
| 64 | Dysphonia | FAERS: 1 | US FAERS | |
| 65 | Dysuria | FAERS: 1 | US FAERS | |
| 66 | Emotional disorder | FAERS: 1 | US FAERS | |
| 67 | Endometriosis | FAERS: 1 | US FAERS | |
| 68 | Erythema | FAERS: 1 | US FAERS | |
| 69 | Expired product administered | FAERS: 1 | US FAERS | |
| 70 | Feeling Cold | FAERS: 1 | US FAERS | |
| 71 | Fracture | FAERS: 1 | US FAERS | |
| 72 | Glaucoma | FAERS: 1 | US FAERS | |
| 73 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 74 | Inflammation | FAERS: 1 | US FAERS | |
| 75 | Intentional product use issue | FAERS: 1 | US FAERS | |
| 76 | Joint stiffness | FAERS: 1 | US FAERS | |
| 77 | Laceration | FAERS: 1 | US FAERS | |
| 78 | Limb discomfort | FAERS: 1 | US FAERS | |
| 79 | Menorrhagia | FAERS: 1 | US FAERS | |
| 80 | Metrorrhagia | FAERS: 1 | US FAERS | |
| 81 | Migraine with Aura | FAERS: 1 | US FAERS | |
| 82 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 83 | Oliguria | FAERS: 1 | US FAERS | |
| 84 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 85 | Overdose | FAERS: 1 | US FAERS | |
| 86 | Pancreatitis | FAERS: 1 | US FAERS | |
| 87 | Pathological fracture | FAERS: 1 | US FAERS | |
| 88 | Pelvic Pain | FAERS: 1 | US FAERS | |
| 89 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 90 | Product packaging issue | FAERS: 1 | US FAERS | |
| 91 | Rash erythematous | FAERS: 1 | US FAERS | |
| 92 | Restless Legs Syndrome | FAERS: 1 | US FAERS | |
| 93 | Stomatitis | FAERS: 1 | US FAERS | |
| 94 | Swelling | FAERS: 1 | US FAERS | |
| 95 | Tachycardia | FAERS: 1 | US FAERS | |
| 96 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 97 | Tinnitus | FAERS: 1 | US FAERS | |
| 98 | Tongue biting | FAERS: 1 | US FAERS | |
| 99 | Urticaria | FAERS: 1 | US FAERS | |
| 100 | Vitreous floaters | FAERS: 1 | US FAERS | |
| 101 | Vulvovaginal burning sensation | FAERS: 1 | US FAERS | |
| 102 | Vulvovaginal dryness | FAERS: 1 | US FAERS | |
| 103 | Wrong technique in product usage process | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.