Bisoprolol
(RZPZLFIUFMNCLY-WLHGVMLRSA-N)
Structure
- SMILES
- OC(COc1ccc(cc1)COCCOC(C)C)CNC(C)C.OC(=O)/C=C/C(=O)O
- Molecular Formula:
- C22H35NO8
- Molecular Weight:
- 441.515
- Log P:
- 2.4686
- Hydrogen Bond Acceptor:
- 9
- Hydrogen Bond Donor:
- 4
- TPSA:
- 134.55
- CAS Number(s):
- 66722-45-0; 104344-23-2; 105878-43-1
Synonym(s)
1.
Bisoprolol
2.
Bisoprolol Fumarate
3.
Bisoprolol Fumarate (1:1) Salt, (+-)-Isomer
4.
Bisoprolol Fumarate (2:1) Salt, (+-)-Isomer
5.
Bisoprolol Hydrochloride
6.
Bisoprolol Methanesulfonate Salt
7.
Bisoprolol, (+-)-Isomer
8.
Bisoprolol, (-)-Isomer
9.
Bisoprolol, Fumarate (1:1) Salt
10.
Bisoprolol, Fumarate (2:1) Salt
11.
CL-297939
12.
Concor
13.
EMD-33512
14.
CL 297939
15.
CL297939
16.
EMD 33512
17.
EMD33512
18.
Fumarate, Bisoprolol
19.
Hydrochloride, Bisoprolol
External Link(s)
| MeSH | D017298 |
| PubChem Compound | 6917733 |
| CHEMBL | CHEMBL1200708 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 16 | US FAERS | |
| 2 | Bradycardia | FAERS: 10 | US FAERS | |
| 3 | Fatigue | FAERS: 10 | US FAERS | |
| 4 | Malaise | FAERS: 9 | US FAERS | |
| 5 | Dizziness | FAERS: 8 | US FAERS | |
| 6 | Feeling abnormal | FAERS: 7 | US FAERS | |
| 7 | Nausea | FAERS: 6 | US FAERS | |
| 8 | Asthenia | FAERS: 5 | US FAERS | |
| 9 | Cardiac Arrest | FAERS: 5 | US FAERS | |
| 10 | Headache | FAERS: 5 | US FAERS | |
| 11 | Pruritus | FAERS: 5 | US FAERS | |
| 12 | Angina Pectoris | FAERS: 4 | US FAERS | |
| 13 | Deafness | FAERS: 4 | US FAERS | |
| 14 | Drug exposure during pregnancy | FAERS: 4 | US FAERS | |
| 15 | Erythema | FAERS: 4 | US FAERS | |
| 16 | Myalgia | FAERS: 4 | US FAERS | |
| 17 | Product substitution issue | FAERS: 4 | US FAERS | |
| 18 | Retroperitoneal fibrosis | FAERS: 4 | US FAERS | |
| 19 | Suicide attempt | FAERS: 4 | US FAERS | |
| 20 | Alopecia | FAERS: 3 | US FAERS | |
| 21 | Arthralgia | FAERS: 3 | US FAERS | |
| 22 | Atrioventricular Block | FAERS: 3 | US FAERS | |
| 23 | Blood pressure inadequately controlled | FAERS: 3 | US FAERS | |
| 24 | Cardiac Flutter | FAERS: 3 | US FAERS | |
| 25 | Chest Pain | FAERS: 3 | US FAERS | |
| 26 | Disorientation | FAERS: 3 | US FAERS | |
| 27 | Feeling Cold | FAERS: 3 | US FAERS | |
| 28 | Palpitations | FAERS: 3 | US FAERS | |
| 29 | Syncope | FAERS: 3 | US FAERS | |
| 30 | Activities of daily living impaired | FAERS: 2 | US FAERS | |
| 31 | Anxiety | FAERS: 2 | US FAERS | |
| 32 | Atrial Fibrillation | FAERS: 2 | US FAERS | |
| 33 | Bifascicular block | FAERS: 2 | US FAERS | |
| 34 | Catheter sepsis | FAERS: 2 | US FAERS | |
| 35 | Chest discomfort | FAERS: 2 | US FAERS | |
| 36 | Cholecystitis | FAERS: 2 | US FAERS | |
| 37 | Clonus | FAERS: 2 | US FAERS | |
| 38 | Dyspepsia | FAERS: 2 | US FAERS | |
| 39 | Erythema Nodosum | FAERS: 2 | US FAERS | |
| 40 | Eye pain | FAERS: 2 | US FAERS | |
| 41 | Hepatic artery thrombosis | FAERS: 2 | US FAERS | |
| 42 | Hypotension | FAERS: 2 | US FAERS | |
| 43 | Lethargy | FAERS: 2 | US FAERS | |
| 44 | Medication Error | FAERS: 2 | US FAERS | |
| 45 | Middle insomnia | FAERS: 2 | US FAERS | |
| 46 | Neonatal disorder | FAERS: 2 | US FAERS | |
| 47 | Pharmaceutical product complaint | FAERS: 2 | US FAERS | |
| 48 | Product quality issue | FAERS: 2 | US FAERS | |
| 49 | Sneezing | FAERS: 2 | US FAERS | |
| 50 | Somnolence | FAERS: 2 | US FAERS | |
| 51 | Tinnitus | FAERS: 2 | US FAERS | |
| 52 | Ventricular arrhythmia | FAERS: 2 | US FAERS | |
| 53 | Visual Impairment | FAERS: 2 | US FAERS | |
| 54 | Vomiting | FAERS: 2 | US FAERS | |
| 55 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 56 | Abdominal mass | FAERS: 1 | US FAERS | |
| 57 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 58 | Accidental overdose | FAERS: 1 | US FAERS | |
| 59 | Acute kidney injury | FAERS: 1 | US FAERS | |
| 60 | Agitation | FAERS: 1 | US FAERS | |
| 61 | Aortitis | FAERS: 1 | US FAERS | |
| 62 | Arthropathy | FAERS: 1 | US FAERS | |
| 63 | Aspartate Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 64 | Asphyxia | FAERS: 1 | US FAERS | |
| 65 | Back Pain | FAERS: 1 | US FAERS | |
| 66 | Bedridden | FAERS: 1 | US FAERS | |
| 67 | Blindness | FAERS: 1 | US FAERS | |
| 68 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 69 | Blood creatinine increased | FAERS: 1 | US FAERS | |
| 70 | Blood pH increased | FAERS: 1 | US FAERS | |
| 71 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 72 | Bronchospasm | FAERS: 1 | US FAERS | |
| 73 | Cardio-respiratory distress | FAERS: 1 | US FAERS | |
| 74 | Cardiomegaly | FAERS: 1 | US FAERS | |
| 75 | Catheter related complication | FAERS: 1 | US FAERS | |
| 76 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 77 | Coagulation factor VII level decreased | FAERS: 1 | US FAERS | |
| 78 | Coagulation factor X level decreased | FAERS: 1 | US FAERS | |
| 79 | Completed Suicide | FAERS: 1 | US FAERS | |
| 80 | Congenital brain damage | FAERS: 1 | US FAERS | |
| 81 | Congenital cytomegalovirus infection | FAERS: 1 | US FAERS | |
| 82 | Constipation | FAERS: 1 | US FAERS | |
| 83 | Dehydration | FAERS: 1 | US FAERS | |
| 84 | Delirium | FAERS: 1 | US FAERS | |
| 85 | Discomfort | FAERS: 1 | US FAERS | |
| 86 | Drug abuse | FAERS: 1 | US FAERS | |
| 87 | Drug exposure via breast milk | FAERS: 1 | US FAERS | |
| 88 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 89 | Drug toxicity | FAERS: 1 | US FAERS | |
| 90 | Ear discomfort | FAERS: 1 | US FAERS | |
| 91 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 92 | Epistaxis | FAERS: 1 | US FAERS | |
| 93 | Escherichia infection | FAERS: 1 | US FAERS | |
| 94 | Exposure to toxic agent | FAERS: 1 | US FAERS | |
| 95 | Eye Infection | FAERS: 1 | US FAERS | |
| 96 | Feeding disorder neonatal | FAERS: 1 | US FAERS | |
| 97 | Feeling jittery | FAERS: 1 | US FAERS | |
| 98 | Feeling of body temperature change | FAERS: 1 | US FAERS | |
| 99 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 100 | Growth retardation | FAERS: 1 | US FAERS | |
| 101 | Heart alternation | FAERS: 1 | US FAERS | |
| 102 | Impaired work ability | FAERS: 1 | US FAERS | |
| 103 | Incontinence | FAERS: 1 | US FAERS | |
| 104 | Infantile apnoeic attack | FAERS: 1 | US FAERS | |
| 105 | Infarction | FAERS: 1 | US FAERS | |
| 106 | Inflammation | FAERS: 1 | US FAERS | |
| 107 | Intentional self-injury | FAERS: 1 | US FAERS | |
| 108 | Intermittent Claudication | FAERS: 1 | US FAERS | |
| 109 | Intestinal Obstruction | FAERS: 1 | US FAERS | |
| 110 | Joint swelling | FAERS: 1 | US FAERS | |
| 111 | Klebsiella sepsis | FAERS: 1 | US FAERS | |
| 112 | Lip swelling | FAERS: 1 | US FAERS | |
| 113 | Memory impairment | FAERS: 1 | US FAERS | |
| 114 | Mitochondrial cytopathy | FAERS: 1 | US FAERS | |
| 115 | Muscle Fatigue | FAERS: 1 | US FAERS | |
| 116 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 117 | Myopathy | FAERS: 1 | US FAERS | |
| 118 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 119 | Neck Pain | FAERS: 1 | US FAERS | |
| 120 | Nodule | FAERS: 1 | US FAERS | |
| 121 | Oliguria | FAERS: 1 | US FAERS | |
| 122 | Overdose | FAERS: 1 | US FAERS | |
| 123 | Pain | FAERS: 1 | US FAERS | |
| 124 | Pancytopenia | FAERS: 1 | US FAERS | |
| 125 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 126 | Product use issue | FAERS: 1 | US FAERS | |
| 127 | Product used for unknown indication | FAERS: 1 | US FAERS | |
| 128 | Prothrombin level decreased | FAERS: 1 | US FAERS | |
| 129 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 130 | Retinal Artery Occlusion | FAERS: 1 | US FAERS | |
| 131 | Rhabdomyolysis | FAERS: 1 | US FAERS | |
| 132 | Sarcoidosis | FAERS: 1 | US FAERS | |
| 133 | Scleroderma | FAERS: 1 | US FAERS | |
| 134 | Sinus Tachycardia | FAERS: 1 | US FAERS | |
| 135 | Sinus bradycardia | FAERS: 1 | US FAERS | |
| 136 | Sluggishness | FAERS: 1 | US FAERS | |
| 137 | Swelling | FAERS: 1 | US FAERS | |
| 138 | Tachycardia | FAERS: 1 | US FAERS | |
| 139 | Therapeutic response unexpected with drug substitution | FAERS: 1 | US FAERS | |
| 140 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 141 | Thrombosis in device | FAERS: 1 | US FAERS | |
| 142 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 143 | Tremor | FAERS: 1 | US FAERS | |
| 144 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 145 | Urticaria | FAERS: 1 | US FAERS | |
| 146 | Vasculitis | FAERS: 1 | US FAERS | |
| 147 | Vasospasm | FAERS: 1 | US FAERS | |
| 148 | Ventricular Fibrillation | FAERS: 1 | US FAERS | |
| 149 | Vertigo | FAERS: 1 | US FAERS | |
| 150 | Weight decreased | FAERS: 1 | US FAERS | |
| 151 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 152 | nervous system disorder | FAERS: 1 | US FAERS | |
| 153 | treatment failure | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.