gadoterate meglumine
(RYHQMKVRYNEBNJ-BMWGJIJESA-K)
Structure
- SMILES
- [O-]C(=O)CN1CCN(CCN(CCN(CC1)CC(=O)[O-])CC(=O)O)CC(=O)[O-].CNC[C@@H]([C@H]([C@@H]([C@@H](CO)O)O)O)O.[Gd+3]
- Molecular Formula:
- C23H42GdN5O13
- Molecular Weight:
- 753.855
- Log P:
- -9.6735
- Hydrogen Bond Acceptor:
- 18
- Hydrogen Bond Donor:
- 7
- TPSA:
- 283.83
- CAS Number(s):
- N/A
Synonym(s)
1.
gadoterate meglumine
2.
Dotarem
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Urticaria | FAERS: 232 | US FAERS | |
| 2 | Nausea | FAERS: 181 | US FAERS | |
| 3 | Pruritus | FAERS: 143 | US FAERS | |
| 4 | Vomiting | FAERS: 142 | US FAERS | |
| 5 | Erythema | FAERS: 139 | US FAERS | |
| 6 | Product use in unapproved indication | FAERS: 59 | US FAERS | |
| 7 | Throat irritation | FAERS: 57 | US FAERS | |
| 8 | Sneezing | FAERS: 48 | US FAERS | |
| 9 | Dizziness | FAERS: 47 | US FAERS | |
| 10 | Chest discomfort | FAERS: 38 | US FAERS | |
| 11 | Headache | FAERS: 36 | US FAERS | |
| 12 | Malaise | FAERS: 32 | US FAERS | |
| 13 | Hypotension | FAERS: 30 | US FAERS | |
| 14 | Hypersensitivity | FAERS: 29 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 15 | Flushing | FAERS: 26 | US FAERS | |
| 16 | Tremor | FAERS: 26 | US FAERS | |
| 17 | Chills | FAERS: 23 | US FAERS | |
| 18 | Dysphonia | FAERS: 22 | US FAERS | |
| 19 | Burning sensation | FAERS: 19 | US FAERS | |
| 20 | Abdominal Pain | FAERS: 18 | US FAERS | |
| 21 | Bronchospasm | FAERS: 18 | US FAERS | |
| 22 | Angioedema | FAERS: 17 | US FAERS | |
| 23 | Tachycardia | FAERS: 17 | US FAERS | |
| 24 | Contrast media reaction | FAERS: 16 | US FAERS | |
| 25 | Chest Pain | FAERS: 15 | US FAERS | |
| 26 | Anaphylactic shock | FAERS: 14 | US FAERS | |
| 27 | Laryngeal discomfort | FAERS: 14 | US FAERS | |
| 28 | Syncope | FAERS: 12 | US FAERS | |
| 29 | Wheezing | FAERS: 12 | US FAERS | |
| 30 | Asthenia | FAERS: 11 | US FAERS | |
| 31 | Fatigue | FAERS: 11 | US FAERS | |
| 32 | Feeling abnormal | FAERS: 11 | US FAERS | |
| 33 | Pain | FAERS: 11 | US FAERS | |
| 34 | Retching | FAERS: 11 | US FAERS | |
| 35 | Skin reaction | FAERS: 10 | US FAERS | |
| 36 | Cold sweat | FAERS: 9 | US FAERS | |
| 37 | Lip swelling | FAERS: 9 | US FAERS | |
| 38 | Myalgia | FAERS: 9 | US FAERS | |
| 39 | Respiratory distress | FAERS: 9 | US FAERS | |
| 40 | Swelling | FAERS: 9 | US FAERS | |
| 41 | Unresponsive to stimuli | FAERS: 9 | US FAERS | |
| 42 | Anxiety | FAERS: 8 | US FAERS | |
| 43 | Arthralgia | FAERS: 8 | US FAERS | |
| 44 | Injection site pain | FAERS: 8 | US FAERS | |
| 45 | Pallor | FAERS: 7 | US FAERS | |
| 46 | Palpitations | FAERS: 7 | US FAERS | |
| 47 | Papule | FAERS: 7 | US FAERS | |
| 48 | Peripheral swelling | FAERS: 7 | US FAERS | |
| 49 | Cyanosis | FAERS: 6 | US FAERS | |
| 50 | Dysgeusia | FAERS: 6 | US FAERS | |
| 51 | Medication residue present | FAERS: 6 | US FAERS | |
| 52 | Presyncope | FAERS: 6 | US FAERS | |
| 53 | Rash erythematous | FAERS: 6 | US FAERS | |
| 54 | Vertigo | FAERS: 6 | US FAERS | |
| 55 | Extravasation | FAERS: 5 | US FAERS | |
| 56 | Eye irritation | FAERS: 5 | US FAERS | |
| 57 | Syringe issue | FAERS: 5 | US FAERS | |
| 58 | Tinnitus | FAERS: 5 | US FAERS | |
| 59 | Abdominal discomfort | FAERS: 4 | US FAERS | |
| 60 | Aphasia | FAERS: 4 | US FAERS | |
| 61 | Cardiac Arrest | FAERS: 4 | US FAERS | |
| 62 | Depressed Level of Consciousness | FAERS: 4 | US FAERS | |
| 63 | Feeling Cold | FAERS: 4 | US FAERS | |
| 64 | Gadolinium deposition disease | FAERS: 4 | US FAERS | |
| 65 | Head discomfort | FAERS: 4 | US FAERS | |
| 66 | Injection site pruritus | FAERS: 4 | US FAERS | |
| 67 | Lethargy | FAERS: 4 | US FAERS | |
| 68 | Memory impairment | FAERS: 4 | US FAERS | |
| 69 | Musculoskeletal stiffness | FAERS: 4 | US FAERS | |
| 70 | Oropharyngeal swelling | FAERS: 4 | US FAERS | |
| 71 | Shock | FAERS: 4 | US FAERS | |
| 72 | Visual Impairment | FAERS: 4 | US FAERS | |
| 73 | Bone pain | FAERS: 3 | US FAERS | |
| 74 | Choking sensation | FAERS: 3 | US FAERS | |
| 75 | Contrast media toxicity | FAERS: 3 | US FAERS | |
| 76 | Discomfort | FAERS: 3 | US FAERS | |
| 77 | Eye pain | FAERS: 3 | US FAERS | |
| 78 | Hyperventilation | FAERS: 3 | US FAERS | |
| 79 | Injection site erythema | FAERS: 3 | US FAERS | |
| 80 | Injection site extravasation | FAERS: 3 | US FAERS | |
| 81 | Larynx irritation | FAERS: 3 | US FAERS | |
| 82 | Limb injury | FAERS: 3 | US FAERS | |
| 83 | Oral pruritus | FAERS: 3 | US FAERS | |
| 84 | Oropharyngeal discomfort | FAERS: 3 | US FAERS | |
| 85 | Oropharyngeal pain | FAERS: 3 | US FAERS | |
| 86 | Respiratory arrest | FAERS: 3 | US FAERS | |
| 87 | Skin tightness | FAERS: 3 | US FAERS | |
| 88 | Somnolence | FAERS: 3 | US FAERS | |
| 89 | Stress | FAERS: 3 | US FAERS | |
| 90 | Urinary Incontinence | FAERS: 3 | US FAERS | |
| 91 | Accidental exposure to product | FAERS: 2 | US FAERS | |
| 92 | Agitation | FAERS: 2 | US FAERS | |
| 93 | Anaphylactoid Reaction | FAERS: 2 | US FAERS | |
| 94 | Anoxia | FAERS: 2 | US FAERS | |
| 95 | Arthritis | FAERS: 2 | US FAERS | |
| 96 | Asphyxia | FAERS: 2 | US FAERS | |
| 97 | Asthma | FAERS: 2 | US FAERS | |
| 98 | Blood pressure fluctuation | FAERS: 2 | US FAERS | |
| 99 | Bradycardia | FAERS: 2 | US FAERS | |
| 100 | Central nervous system lesion | FAERS: 2 | US FAERS | |
| 101 | Cerebrovascular accident | FAERS: 2 | US FAERS | |
| 102 | Choking | FAERS: 2 | US FAERS | |
| 103 | Conjunctivitis | FAERS: 2 | US FAERS | |
| 104 | Constipation | FAERS: 2 | US FAERS | |
| 105 | Contraindicated product administered | FAERS: 2 | US FAERS | |
| 106 | Deep Vein Thrombosis | FAERS: 2 | US FAERS | |
| 107 | Enuresis | FAERS: 2 | US FAERS | |
| 108 | Fibromyalgia | FAERS: 2 | US FAERS | |
| 109 | Incontinence | FAERS: 2 | US FAERS | |
| 110 | Induration | FAERS: 2 | US FAERS | |
| 111 | Joint stiffness | FAERS: 2 | US FAERS | |
| 112 | Laryngospasm | FAERS: 2 | US FAERS | |
| 113 | Limb discomfort | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 114 | Lip pruritus | FAERS: 2 | US FAERS | |
| 115 | Maternal exposure during pregnancy | FAERS: 2 | US FAERS | |
| 116 | Muscle tightness | FAERS: 2 | US FAERS | |
| 117 | Neck Pain | FAERS: 2 | US FAERS | |
| 118 | No adverse event | FAERS: 2 | US FAERS | |
| 119 | Overdose | FAERS: 2 | US FAERS | |
| 120 | Product use issue | FAERS: 2 | US FAERS | |
| 121 | Skin discomfort | FAERS: 2 | US FAERS | |
| 122 | Skin hypertrophy | FAERS: 2 | US FAERS | |
| 123 | Swelling of eyelid | FAERS: 2 | US FAERS | |
| 124 | Thirst | FAERS: 2 | US FAERS | |
| 125 | Toxicity to various agents | FAERS: 2 | US FAERS | |
| 126 | Weight decreased | FAERS: 2 | US FAERS | |
| 127 | Accidental underdose | FAERS: 1 | US FAERS | |
| 128 | Acne | FAERS: 1 | US FAERS | |
| 129 | Allergy to arthropod sting | FAERS: 1 | US FAERS | |
| 130 | Altered state of consciousness | FAERS: 1 | US FAERS | |
| 131 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 132 | Arteriovenous fistula thrombosis | FAERS: 1 | US FAERS | |
| 133 | Back Pain | FAERS: 1 | US FAERS | |
| 134 | Blindness | FAERS: 1 | US FAERS | |
| 135 | Cardiac discomfort | FAERS: 1 | US FAERS | |
| 136 | Chronic Fatigue Syndrome | FAERS: 1 | US FAERS | |
| 137 | Contrast media allergy | FAERS: 1 | US FAERS | |
| 138 | Deafness | FAERS: 1 | US FAERS | |
| 139 | Dehydration | FAERS: 1 | US FAERS | |
| 140 | Diaphragmatic spasm | FAERS: 1 | US FAERS | |
| 141 | Disorientation | FAERS: 1 | US FAERS | |
| 142 | Diverticulum | FAERS: 1 | US FAERS | |
| 143 | Drooling | FAERS: 1 | US FAERS | |
| 144 | Dry skin | FAERS: 1 | US FAERS | |
| 145 | Duodenal Ulcer | FAERS: 1 | US FAERS | |
| 146 | Dysphemia | FAERS: 1 | US FAERS | |
| 147 | Dysuria | FAERS: 1 | US FAERS | |
| 148 | Ear discomfort | FAERS: 1 | US FAERS | |
| 149 | Eczema | FAERS: 1 | US FAERS | |
| 150 | Emotional distress | FAERS: 1 | US FAERS | |
| 151 | End-tidal CO2 increased | FAERS: 1 | US FAERS | |
| 152 | Epilepsy | FAERS: 1 | US FAERS | |
| 153 | Eyelid irritation | FAERS: 1 | US FAERS | |
| 154 | Eyelids pruritus | FAERS: 1 | US FAERS | |
| 155 | Facial Pain | FAERS: 1 | US FAERS | |
| 156 | Foaming at mouth | FAERS: 1 | US FAERS | |
| 157 | Gastrointestinal Pain | FAERS: 1 | US FAERS | |
| 158 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 159 | Gingival Recession | FAERS: 1 | US FAERS | |
| 160 | Gingival discomfort | FAERS: 1 | US FAERS | |
| 161 | Hemiparesis | FAERS: 1 | US FAERS | |
| 162 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 163 | Hypokinesia | FAERS: 1 | US FAERS | |
| 164 | Hypoplastic nasal cartilage | FAERS: 1 | US FAERS | |
| 165 | Hypoventilation | FAERS: 1 | US FAERS | |
| 166 | Hypoxia | FAERS: 1 | US FAERS | |
| 167 | Impaired quality of life | FAERS: 1 | US FAERS | |
| 168 | Impaired work ability | FAERS: 1 | US FAERS | |
| 169 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 170 | Incorrect route of product administration | FAERS: 1 | US FAERS | |
| 171 | Inflammation | FAERS: 1 | US FAERS | |
| 172 | Injected limb mobility decreased | FAERS: 1 | US FAERS | |
| 173 | Injection Site Reaction | FAERS: 1 | US FAERS | |
| 174 | Injection related reaction | FAERS: 1 | US FAERS | |
| 175 | Injection site inflammation | FAERS: 1 | US FAERS | |
| 176 | Injection site mass | FAERS: 1 | US FAERS | |
| 177 | Injection site urticaria | FAERS: 1 | US FAERS | |
| 178 | Injection site vesicles | FAERS: 1 | US FAERS | |
| 179 | Injury associated with device | FAERS: 1 | US FAERS | |
| 180 | Joint swelling | FAERS: 1 | US FAERS | |
| 181 | Lupus-like syndrome | FAERS: 1 | US FAERS | |
| 182 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 183 | Macule | FAERS: 1 | US FAERS | |
| 184 | Mechanical urticaria | FAERS: 1 | US FAERS | |
| 185 | Mouth swelling | FAERS: 1 | US FAERS | |
| 186 | Muscle Fatigue | FAERS: 1 | US FAERS | |
| 187 | Nasal Flaring | FAERS: 1 | US FAERS | |
| 188 | Nasal discomfort | FAERS: 1 | US FAERS | |
| 189 | Nervousness | FAERS: 1 | US FAERS | |
| 190 | Neuritis | FAERS: 1 | US FAERS | |
| 191 | Non-cardiac chest pain | FAERS: 1 | US FAERS | |
| 192 | Noninfective encephalitis | FAERS: 1 | US FAERS | |
| 193 | Occupational exposure to product | FAERS: 1 | US FAERS | |
| 194 | Ocular discomfort | FAERS: 1 | US FAERS | |
| 195 | Onychoclasis | FAERS: 1 | US FAERS | |
| 196 | Pain of skin | FAERS: 1 | US FAERS | |
| 197 | Photophobia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 198 | Piloerection | FAERS: 1 | US FAERS | |
| 199 | Poor peripheral circulation | FAERS: 1 | US FAERS | |
| 200 | Post procedural complication | FAERS: 1 | US FAERS | |
| 201 | Prerenal failure | FAERS: 1 | US FAERS | |
| 202 | Product dispensing error | FAERS: 1 | US FAERS | |
| 203 | Product package associated injury | FAERS: 1 | US FAERS | |
| 204 | Product residue present | FAERS: 1 | US FAERS | |
| 205 | Productive Cough | FAERS: 1 | US FAERS | |
| 206 | Purpura | FAERS: 1 | US FAERS | |
| 207 | Quadriparesis | FAERS: 1 | US FAERS | |
| 208 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 209 | Respiratory fatigue | FAERS: 1 | US FAERS | |
| 210 | Respiratory tract congestion | FAERS: 1 | US FAERS | |
| 211 | Restlessness | FAERS: 1 | US FAERS | |
| 212 | Rhinitis | FAERS: 1 | US FAERS | |
| 213 | Seizure like phenomena | FAERS: 1 | US FAERS | |
| 214 | Sense of oppression | FAERS: 1 | US FAERS | |
| 215 | Sensitivity to weather change | FAERS: 1 | US FAERS | |
| 216 | Sinonasal obstruction | FAERS: 1 | US FAERS | |
| 217 | Sinus operation | FAERS: 1 | US FAERS | |
| 218 | Stridor | FAERS: 1 | US FAERS | |
| 219 | Tension Headache | FAERS: 1 | US FAERS | |
| 220 | Tetany | FAERS: 1 | US FAERS | |
| 221 | Tongue biting | FAERS: 1 | US FAERS | |
| 222 | Tongue discomfort | FAERS: 1 | US FAERS | |
| 223 | Tongue pruritus | FAERS: 1 | US FAERS | |
| 224 | Toothache | FAERS: 1 | US FAERS | |
| 225 | Unevaluable event | FAERS: 1 | US FAERS | |
| 226 | Uterine dilation and evacuation | FAERS: 1 | US FAERS | |
| 227 | Vascular stent stenosis | FAERS: 1 | US FAERS | |
| 228 | Vein collapse | FAERS: 1 | US FAERS | |
| 229 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 230 | nervous system disorder | FAERS: 1 | US FAERS | |
| 231 | Amnesia | Canada Vigilance: 1 | Canada Vigilance | |
| 232 | Miller Fisher Syndrome | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120235
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.