Flecainide
(RKXNZRPQSOPPRN-UHFFFAOYSA-N)
Structure
- SMILES
- O=C(c1cc(OCC(F)(F)F)ccc1OCC(F)(F)F)NCC1CCCCN1.CC(=O)O
- Molecular Formula:
- C19H24F6N2O5
- Molecular Weight:
- 474.395
- Log P:
- 4.2513
- Hydrogen Bond Acceptor:
- 7
- Hydrogen Bond Donor:
- 3
- TPSA:
- 96.89
- CAS Number(s):
- 54143-56-5
Synonym(s)
1.
Flecainide
2.
Flecainide Acetate
3.
Apocard
4.
Flecadura
5.
Flecainid-Isis
6.
Flecainide Monoacetate
7.
Flecainide Monoacetate, (+-)-Isomer
8.
Flecainide Monoacetate, (R)-Isomer
9.
Flecainide Monoacetate, (S)-Isomer
10.
Flecainide, (R)-Isomer
11.
Flecainide, (S)-Isomer
12.
Flecainide, 5-HO-N-(6-oxo)-Derivative
13.
Flecainide, 5-HO-N-(6-oxo)-Derivative, (+-)-Isomer
14.
Flecatab
15.
Flécaïne
16.
R818
17.
Tambocor
18.
Flecainid Isis
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Toxicity to various agents | FAERS: 39 | US FAERS | |
| 2 | Overdose | FAERS: 24 | US FAERS | |
| 3 | Accidental overdose | FAERS: 23 | US FAERS | |
| 4 | Cardiac Arrest | FAERS: 23 | US FAERS | |
| 5 | Hypotension | FAERS: 21 | US FAERS | |
| 6 | Tachycardia | FAERS: 19 | US FAERS | |
| 7 | Atrial Fibrillation | FAERS: 16 | US FAERS | |
| 8 | Dizziness | FAERS: 14 | US FAERS | |
| 9 | Drug ineffective | FAERS: 14 | US FAERS | |
| 10 | Electrocardiogram abnormal | FAERS: 14 | US FAERS | |
| 11 | Bradycardia | FAERS: 13 | US FAERS | |
| 12 | Suicide attempt | FAERS: 11 | US FAERS | |
| 13 | Asthenia | FAERS: 10 | US FAERS | |
| 14 | Atrial Flutter | FAERS: 10 | US FAERS | |
| 15 | Nausea | FAERS: 10 | US FAERS | |
| 16 | Medication Error | FAERS: 8 | US FAERS | |
| 17 | Syncope | FAERS: 8 | US FAERS | |
| 18 | Completed Suicide | FAERS: 7 | US FAERS | |
| 19 | Acute kidney injury | FAERS: 6 | US FAERS | |
| 20 | Headache | FAERS: 6 | US FAERS | |
| 21 | Incorrect dose administered | FAERS: 6 | US FAERS | |
| 22 | Malaise | FAERS: 6 | US FAERS | |
| 23 | Somnolence | FAERS: 6 | US FAERS | |
| 24 | Tachyarrhythmia | FAERS: 6 | US FAERS | |
| 25 | Chest discomfort | FAERS: 5 | US FAERS | |
| 26 | Drug dispensing error | FAERS: 5 | US FAERS | |
| 27 | Drug level above therapeutic | FAERS: 5 | US FAERS | |
| 28 | Drug level increased | FAERS: 5 | US FAERS | |
| 29 | Fatigue | FAERS: 5 | US FAERS | |
| 30 | Alkalosis | FAERS: 4 | US FAERS | |
| 31 | Ataxia | FAERS: 4 | US FAERS | |
| 32 | Blood potassium decreased | FAERS: 4 | US FAERS | |
| 33 | Chest Pain | FAERS: 4 | US FAERS | |
| 34 | Drug exposure during pregnancy | FAERS: 4 | US FAERS | |
| 35 | Drug toxicity | FAERS: 4 | US FAERS | |
| 36 | Electrocardiogram change | FAERS: 4 | US FAERS | |
| 37 | Lethargy | FAERS: 4 | US FAERS | |
| 38 | Metabolic acidosis | FAERS: 4 | US FAERS | |
| 39 | Palpitations | FAERS: 4 | US FAERS | |
| 40 | Pharmaceutical product complaint | FAERS: 4 | US FAERS | |
| 41 | Product taste abnormal | FAERS: 4 | US FAERS | |
| 42 | Supraventricular tachycardia | FAERS: 4 | US FAERS | |
| 43 | Accidental exposure to product | FAERS: 3 | US FAERS | |
| 44 | Acidosis | FAERS: 3 | US FAERS | |
| 45 | Dysarthria | FAERS: 3 | US FAERS | |
| 46 | Ejection Fraction Decreased | FAERS: 3 | US FAERS | |
| 47 | Hypoxia | FAERS: 3 | US FAERS | |
| 48 | Myocardial Infarction | FAERS: 3 | US FAERS | |
| 49 | Product substitution issue | FAERS: 3 | US FAERS | |
| 50 | Respiratory arrest | FAERS: 3 | US FAERS | |
| 51 | Respiratory distress | FAERS: 3 | US FAERS | |
| 52 | Unresponsive to stimuli | FAERS: 3 | US FAERS | |
| 53 | Ventricular Fibrillation | FAERS: 3 | US FAERS | |
| 54 | Wrong technique in drug usage process | FAERS: 3 | US FAERS | |
| 55 | Abdominal discomfort | FAERS: 2 | US FAERS | |
| 56 | Accidental drug intake by child | FAERS: 2 | US FAERS | |
| 57 | Atrioventricular Block | FAERS: 2 | US FAERS | |
| 58 | Blood potassium increased | FAERS: 2 | US FAERS | |
| 59 | Cyanosis | FAERS: 2 | US FAERS | |
| 60 | Flushing | FAERS: 2 | US FAERS | |
| 61 | General physical health deterioration | FAERS: 2 | US FAERS | |
| 62 | Hypophagia | FAERS: 2 | US FAERS | |
| 63 | Mental status changes | FAERS: 2 | US FAERS | |
| 64 | Multiple drug overdose | FAERS: 2 | US FAERS | |
| 65 | Pacing threshold increased | FAERS: 2 | US FAERS | |
| 66 | Product formulation issue | FAERS: 2 | US FAERS | |
| 67 | Product quality issue | FAERS: 2 | US FAERS | |
| 68 | Pruritus | FAERS: 2 | US FAERS | |
| 69 | Therapeutic response unexpected with drug substitution | FAERS: 2 | US FAERS | |
| 70 | Tonic clonic movements | FAERS: 2 | US FAERS | |
| 71 | Tremor | FAERS: 2 | US FAERS | |
| 72 | Vomiting | FAERS: 2 | US FAERS | |
| 73 | Wrong technique in product usage process | FAERS: 2 | US FAERS | |
| 74 | Abdominal Compartment Syndrome | FAERS: 1 | US FAERS | |
| 75 | Abdominal mass | FAERS: 1 | US FAERS | |
| 76 | Abnormal weight gain | FAERS: 1 | US FAERS | |
| 77 | Accidental exposure | FAERS: 1 | US FAERS | |
| 78 | Accidental underdose | FAERS: 1 | US FAERS | |
| 79 | Adverse event | FAERS: 1 | US FAERS | |
| 80 | Alopecia | FAERS: 1 | US FAERS | |
| 81 | Amnesia | FAERS: 1 | US FAERS | |
| 82 | Anxiety | FAERS: 1 | US FAERS | |
| 83 | Arteriosclerosis | FAERS: 1 | US FAERS | |
| 84 | Arthralgia | FAERS: 1 | US FAERS | |
| 85 | Ascites | FAERS: 1 | US FAERS | |
| 86 | Back Pain | FAERS: 1 | US FAERS | |
| 87 | Bifascicular block | FAERS: 1 | US FAERS | |
| 88 | Blindness | FAERS: 1 | US FAERS | |
| 89 | Blood pH decreased | FAERS: 1 | US FAERS | |
| 90 | Blood pH increased | FAERS: 1 | US FAERS | |
| 91 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 92 | Blood pressure immeasurable | FAERS: 1 | US FAERS | |
| 93 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 94 | Bronchoalveolar lavage abnormal | FAERS: 1 | US FAERS | |
| 95 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 96 | Cardiotoxicity | FAERS: 1 | US FAERS | |
| 97 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 98 | Chills | FAERS: 1 | US FAERS | |
| 99 | Choking sensation | FAERS: 1 | US FAERS | |
| 100 | Cold sweat | FAERS: 1 | US FAERS | |
| 101 | Coma scale abnormal | FAERS: 1 | US FAERS | |
| 102 | Constipation | FAERS: 1 | US FAERS | |
| 103 | Dehydration | FAERS: 1 | US FAERS | |
| 104 | Delusional disorder, persecutory type | FAERS: 1 | US FAERS | |
| 105 | Depressed mood | FAERS: 1 | US FAERS | |
| 106 | Disease recurrence | FAERS: 1 | US FAERS | |
| 107 | Drug administration error | FAERS: 1 | US FAERS | |
| 108 | Drug level changed | FAERS: 1 | US FAERS | |
| 109 | Dry skin | FAERS: 1 | US FAERS | |
| 110 | Electrocardiogram ST-T segment abnormal | FAERS: 1 | US FAERS | |
| 111 | Electrocardiogram T wave amplitude increased | FAERS: 1 | US FAERS | |
| 112 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 113 | Erythema | FAERS: 1 | US FAERS | |
| 114 | Eye pain | FAERS: 1 | US FAERS | |
| 115 | Facial paralysis | FAERS: 1 | US FAERS | |
| 116 | Failure to capture | FAERS: 1 | US FAERS | |
| 117 | Feeling abnormal | FAERS: 1 | US FAERS | |
| 118 | Gluten sensitivity | FAERS: 1 | US FAERS | |
| 119 | Hypersensitivity | FAERS: 1 | US FAERS | |
| 120 | Hypersomnia | FAERS: 1 | US FAERS | |
| 121 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 122 | Intentional dose omission | FAERS: 1 | US FAERS | |
| 123 | Intentional misuse | FAERS: 1 | US FAERS | |
| 124 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 125 | Joint swelling | FAERS: 1 | US FAERS | |
| 126 | Long QT Syndrome | FAERS: 1 | US FAERS | |
| 127 | Lymphocytosis | FAERS: 1 | US FAERS | |
| 128 | Lymphoma | FAERS: 1 | US FAERS | |
| 129 | Medical device complication | FAERS: 1 | US FAERS | |
| 130 | Memory impairment | FAERS: 1 | US FAERS | |
| 131 | Metabolic alkalosis | FAERS: 1 | US FAERS | |
| 132 | Multiple drug overdose intentional | FAERS: 1 | US FAERS | |
| 133 | Muscle strain | FAERS: 1 | US FAERS | |
| 134 | Myocardial necrosis | FAERS: 1 | US FAERS | |
| 135 | Neurological decompensation | FAERS: 1 | US FAERS | |
| 136 | Oxygen saturation immeasurable | FAERS: 1 | US FAERS | |
| 137 | Pacemaker complication | FAERS: 1 | US FAERS | |
| 138 | Palmar erythema | FAERS: 1 | US FAERS | |
| 139 | Pancreatitis | FAERS: 1 | US FAERS | |
| 140 | Perinatal brain damage | FAERS: 1 | US FAERS | |
| 141 | Plantar erythema | FAERS: 1 | US FAERS | |
| 142 | Polyneuropathy | FAERS: 1 | US FAERS | |
| 143 | Pre-Eclampsia | FAERS: 1 | US FAERS | |
| 144 | Presyncope | FAERS: 1 | US FAERS | |
| 145 | Product preparation error | FAERS: 1 | US FAERS | |
| 146 | Psoriasis | FAERS: 1 | US FAERS | |
| 147 | QRS axis abnormal | FAERS: 1 | US FAERS | |
| 148 | Resting Tremor | FAERS: 1 | US FAERS | |
| 149 | Retinal Vein Occlusion | FAERS: 1 | US FAERS | |
| 150 | Shock | FAERS: 1 | US FAERS | |
| 151 | Similar reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 152 | Sinus rhythm | FAERS: 1 | US FAERS | |
| 153 | Sudden Cardiac Death | FAERS: 1 | US FAERS | |
| 154 | Swelling | FAERS: 1 | US FAERS | |
| 155 | Thrombosis | FAERS: 1 | US FAERS | |
| 156 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 157 | Urticaria | FAERS: 1 | US FAERS | |
| 158 | Vasoplegia syndrome | FAERS: 1 | US FAERS | |
| 159 | Ventricular Dysfunction | FAERS: 1 | US FAERS | |
| 160 | Ventricular arrhythmia | FAERS: 1 | US FAERS | |
| 161 | Ventricular failure | FAERS: 1 | US FAERS | |
| 162 | Vulvovaginal pruritus | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120269
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.