Oxycodone and acetaminophen
(RJEIGSKSSKIIHG-RKXJKUSZSA-N)
Structure
- SMILES
- CC(=O)Nc1ccc(cc1)O.COc1ccc2c3c1O[C@@H]1[C@@]43CCN([C@H](C2)[C@]4(O)CCC1=O)C
- Molecular Formula:
- C26H30N2O6
- Molecular Weight:
- 466.526
- Log P:
- 2.4097
- Hydrogen Bond Acceptor:
- 8
- Hydrogen Bond Donor:
- 3
- TPSA:
- 108.33
- CAS Number(s):
- 330988-72-2
Synonym(s)
1.
Oxycodone and acetaminophen
External Link(s)
| PubChem Compound | 11993742 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 219 Canada Vigilance: 22 | Canada Vigilance US FAERS | |
| 2 | Nausea | FAERS: 72 Canada Vigilance: 16 | Canada Vigilance US FAERS | |
| 3 | Headache | FAERS: 49 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 4 | Malaise | FAERS: 33 | US FAERS | |
| 5 | Vomiting | FAERS: 32 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 6 | Product substitution issue | FAERS: 31 | US FAERS | |
| 7 | Abdominal discomfort | FAERS: 25 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 8 | Pruritus | FAERS: 21 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 9 | Completed Suicide | FAERS: 20 | US FAERS | |
| 10 | Dizziness | FAERS: 19 | US FAERS | |
| 11 | Pain | FAERS: 18 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 12 | Feeling abnormal | FAERS: 16 | US FAERS | |
| 13 | Product quality issue | FAERS: 15 | US FAERS | |
| 14 | Pharmaceutical product complaint | FAERS: 13 | US FAERS | |
| 15 | Somnolence | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 16 | Abdominal Pain | FAERS: 12 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 17 | Constipation | FAERS: 12 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 18 | Drug diversion | FAERS: 12 | US FAERS | |
| 19 | Anxiety | FAERS: 11 | US FAERS | |
| 20 | Fatigue | FAERS: 11 | US FAERS | |
| 21 | Chest Pain | FAERS: 10 | US FAERS | |
| 22 | Therapeutic response unexpected with drug substitution | FAERS: 10 | US FAERS | |
| 23 | Tremor | FAERS: 10 | US FAERS | |
| 24 | Drug abuse | FAERS: 9 | US FAERS | |
| 25 | Adverse event | FAERS: 8 | US FAERS | |
| 26 | Cardiac Arrest | FAERS: 8 | US FAERS | |
| 27 | Drug dispensing error | FAERS: 8 | US FAERS | |
| 28 | Overdose | FAERS: 7 | US FAERS | |
| 29 | Respiratory arrest | FAERS: 7 | US FAERS | |
| 30 | Drug screen negative | FAERS: 6 | US FAERS | |
| 31 | Drug withdrawal syndrome | FAERS: 6 | US FAERS | |
| 32 | Tinnitus | FAERS: 6 | US FAERS | |
| 33 | Asthenia | FAERS: 5 | US FAERS | |
| 34 | Depressed Level of Consciousness | FAERS: 5 | US FAERS | |
| 35 | Disorientation | FAERS: 5 | US FAERS | |
| 36 | Dysgeusia | FAERS: 5 | US FAERS | |
| 37 | Flatulence | FAERS: 5 | US FAERS | |
| 38 | Hypersensitivity | FAERS: 5 | US FAERS | |
| 39 | Inadequate analgesia | FAERS: 5 | US FAERS | |
| 40 | Incorrect dose administered | FAERS: 5 | US FAERS | |
| 41 | Intentional product misuse | FAERS: 5 | US FAERS | |
| 42 | Myalgia | FAERS: 5 | US FAERS | |
| 43 | Swelling | FAERS: 5 | US FAERS | |
| 44 | Arthralgia | FAERS: 4 | US FAERS | |
| 45 | Back Pain | FAERS: 4 | US FAERS | |
| 46 | Chills | FAERS: 4 | US FAERS | |
| 47 | Chromaturia | FAERS: 4 | US FAERS | |
| 48 | Drug Dependence | FAERS: 4 | US FAERS | |
| 49 | Drug screen positive | FAERS: 4 | US FAERS | |
| 50 | Dyspepsia | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 51 | Dysuria | FAERS: 4 | US FAERS | |
| 52 | Erythema | FAERS: 4 | US FAERS | |
| 53 | Flushing | FAERS: 4 | US FAERS | |
| 54 | Intentional drug misuse | FAERS: 4 | US FAERS | |
| 55 | Night sweats | FAERS: 4 | US FAERS | |
| 56 | Palpitations | FAERS: 4 | US FAERS | |
| 57 | Product formulation issue | FAERS: 4 | US FAERS | |
| 58 | Rash erythematous | FAERS: 4 | US FAERS | |
| 59 | Renal pain | FAERS: 4 | US FAERS | |
| 60 | Throat irritation | FAERS: 4 | US FAERS | |
| 61 | Unevaluable event | FAERS: 4 | US FAERS | |
| 62 | Urticaria | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 63 | Activities of daily living impaired | FAERS: 3 | US FAERS | |
| 64 | Agitation | FAERS: 3 | US FAERS | |
| 65 | Anger | FAERS: 3 | US FAERS | |
| 66 | Aspartate Aminotransferase Increased | FAERS: 3 | US FAERS | |
| 67 | Brain Death | FAERS: 3 | US FAERS | |
| 68 | Chest discomfort | FAERS: 3 | US FAERS | |
| 69 | Drug effect incomplete | FAERS: 3 | US FAERS | |
| 70 | Emergency Care | FAERS: 3 | US FAERS | |
| 71 | Hepatotoxicity | FAERS: 3 | US FAERS | |
| 72 | Inappropriate schedule of drug administration | FAERS: 3 | US FAERS | |
| 73 | Medication Error | FAERS: 3 | US FAERS | |
| 74 | Mood swings | FAERS: 3 | US FAERS | |
| 75 | Nasopharyngitis | FAERS: 3 | US FAERS | |
| 76 | Nervousness | FAERS: 3 | US FAERS | |
| 77 | Oropharyngeal pain | FAERS: 3 | US FAERS | |
| 78 | Product commingling | FAERS: 3 | US FAERS | |
| 79 | Product dispensing error | FAERS: 3 | US FAERS | |
| 80 | Reaction to excipient | FAERS: 3 | US FAERS | |
| 81 | Tongue discomfort | FAERS: 3 | US FAERS | |
| 82 | Vertigo | FAERS: 3 | US FAERS | |
| 83 | Visual Impairment | FAERS: 3 | US FAERS | |
| 84 | Atrial Fibrillation | FAERS: 2 | US FAERS | |
| 85 | Bedridden | FAERS: 2 | US FAERS | |
| 86 | Cellulitis | FAERS: 2 | US FAERS | |
| 87 | Crying | FAERS: 2 | US FAERS | |
| 88 | Drug abuser | FAERS: 2 | US FAERS | |
| 89 | Drug administration error | FAERS: 2 | US FAERS | |
| 90 | Drug ineffective for unapproved indication | FAERS: 2 | US FAERS | |
| 91 | Drug level decreased | FAERS: 2 | US FAERS | |
| 92 | Eructation | FAERS: 2 | US FAERS | |
| 93 | Feeling jittery | FAERS: 2 | US FAERS | |
| 94 | Formication | FAERS: 2 | US FAERS | |
| 95 | Gastritis | FAERS: 2 | US FAERS | |
| 96 | Gastrointestinal Pain | FAERS: 2 | US FAERS | |
| 97 | General physical health deterioration | FAERS: 2 | US FAERS | |
| 98 | Hepatomegaly | FAERS: 2 | US FAERS | |
| 99 | Hypersomnia | FAERS: 2 | US FAERS | |
| 100 | Hypotension | FAERS: 2 | US FAERS | |
| 101 | Impaired driving ability | FAERS: 2 | US FAERS | |
| 102 | Incoherent | FAERS: 2 | US FAERS | |
| 103 | Intentional product use issue | FAERS: 2 | US FAERS | |
| 104 | Intercepted product dispensing error | FAERS: 2 | US FAERS | |
| 105 | Joint swelling | FAERS: 2 | US FAERS | |
| 106 | Lip swelling | FAERS: 2 | US FAERS | |
| 107 | Mental status changes | FAERS: 2 | US FAERS | |
| 108 | Multiple drug overdose intentional | FAERS: 2 | US FAERS | |
| 109 | Myocardial Infarction | FAERS: 2 | US FAERS | |
| 110 | Neck Pain | FAERS: 2 | US FAERS | |
| 111 | Necrosis | FAERS: 2 | US FAERS | |
| 112 | Nephrolithiasis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 113 | No adverse event | FAERS: 2 | US FAERS | |
| 114 | Pallor | FAERS: 2 | US FAERS | |
| 115 | Pancreatitis | FAERS: 2 | US FAERS | |
| 116 | Pharmaceutical product counterfeit | FAERS: 2 | US FAERS | |
| 117 | Poisoning | FAERS: 2 | US FAERS | |
| 118 | Product shape issue | FAERS: 2 | US FAERS | |
| 119 | Reaction to drug excipients | FAERS: 2 | US FAERS | |
| 120 | Respiratory Failure | FAERS: 2 | US FAERS | |
| 121 | Retching | FAERS: 2 | US FAERS | |
| 122 | Soft Tissue Infection | FAERS: 2 | US FAERS | |
| 123 | Soft tissue necrosis | FAERS: 2 | US FAERS | |
| 124 | Tachycardia | FAERS: 2 | US FAERS | |
| 125 | Unresponsive to stimuli | FAERS: 2 | US FAERS | |
| 126 | Wrong technique in drug usage process | FAERS: 2 | US FAERS | |
| 127 | Wrong technique in product usage process | FAERS: 2 | US FAERS | |
| 128 | nervous system disorder | FAERS: 2 | US FAERS | |
| 129 | Acidosis | FAERS: 1 | US FAERS | |
| 130 | Acne | FAERS: 1 | US FAERS | |
| 131 | Alanine Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 132 | Amnesia | FAERS: 1 | US FAERS | |
| 133 | Anal sphincter atony | FAERS: 1 | US FAERS | |
| 134 | Analgesic drug level increased | FAERS: 1 | US FAERS | |
| 135 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 136 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 137 | Angioedema | FAERS: 1 | US FAERS | |
| 138 | Apathy | FAERS: 1 | US FAERS | |
| 139 | Aphagia | FAERS: 1 | US FAERS | |
| 140 | Aphthous Stomatitis | FAERS: 1 | US FAERS | |
| 141 | Bed rest | FAERS: 1 | US FAERS | |
| 142 | Blepharospasm | FAERS: 1 | US FAERS | |
| 143 | Bone pain | FAERS: 1 | US FAERS | |
| 144 | Bunion | FAERS: 1 | US FAERS | |
| 145 | Burning sensation | FAERS: 1 | US FAERS | |
| 146 | Cardiac Tamponade | FAERS: 1 | US FAERS | |
| 147 | Cerebral atrophy | FAERS: 1 | US FAERS | |
| 148 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 149 | Cervical myelopathy | FAERS: 1 | US FAERS | |
| 150 | Cold sweat | FAERS: 1 | US FAERS | |
| 151 | Coronary Artery Disease | FAERS: 1 | US FAERS | |
| 152 | Cortisol increased | FAERS: 1 | US FAERS | |
| 153 | Dark circles under eyes | FAERS: 1 | US FAERS | |
| 154 | Delirium | FAERS: 1 | US FAERS | |
| 155 | Dependence | FAERS: 1 | US FAERS | |
| 156 | Dermatomyositis | FAERS: 1 | US FAERS | |
| 157 | Diverticulitis | FAERS: 1 | US FAERS | |
| 158 | Drug Tolerance | FAERS: 1 | US FAERS | |
| 159 | Drug dispensed to wrong patient | FAERS: 1 | US FAERS | |
| 160 | Drug effect delayed | FAERS: 1 | US FAERS | |
| 161 | Drug effect variable | FAERS: 1 | US FAERS | |
| 162 | Drug level increased | FAERS: 1 | US FAERS | |
| 163 | Drug toxicity | FAERS: 1 | US FAERS | |
| 164 | Electromechanical dissociation | FAERS: 1 | US FAERS | |
| 165 | Emotional disorder | FAERS: 1 | US FAERS | |
| 166 | Emotional distress | FAERS: 1 | US FAERS | |
| 167 | Euphoric mood | FAERS: 1 | US FAERS | |
| 168 | Expired drug administered | FAERS: 1 | US FAERS | |
| 169 | Expired product administered | FAERS: 1 | US FAERS | |
| 170 | Facial Pain | FAERS: 1 | US FAERS | |
| 171 | Feeling Cold | FAERS: 1 | US FAERS | |
| 172 | Flank Pain | FAERS: 1 | US FAERS | |
| 173 | Foreign body in respiratory tract | FAERS: 1 | US FAERS | |
| 174 | Fungal rhinitis | FAERS: 1 | US FAERS | |
| 175 | Gait inability | FAERS: 1 | US FAERS | |
| 176 | Gastric ulcer | FAERS: 1 | US FAERS | |
| 177 | Gastrointestinal ulcer | FAERS: 1 | US FAERS | |
| 178 | Glossitis | FAERS: 1 | US FAERS | |
| 179 | Hemiplegia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 180 | Hepatosplenomegaly | FAERS: 1 | US FAERS | |
| 181 | Hypercapnia | FAERS: 1 | US FAERS | |
| 182 | Hyperchlorhydria | FAERS: 1 | US FAERS | |
| 183 | Hypoaesthesia facial | FAERS: 1 | US FAERS | |
| 184 | Incorrect drug dosage form administered | FAERS: 1 | US FAERS | |
| 185 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 186 | Increased bronchial secretion | FAERS: 1 | US FAERS | |
| 187 | Increased upper airway secretion | FAERS: 1 | US FAERS | |
| 188 | Influenza | FAERS: 1 | US FAERS | |
| 189 | Intentional misuse | FAERS: 1 | US FAERS | |
| 190 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 191 | Irritable Bowel Syndrome | FAERS: 1 | US FAERS | |
| 192 | Lack of spontaneous speech | FAERS: 1 | US FAERS | |
| 193 | Lethargy | FAERS: 1 | US FAERS | |
| 194 | Leukopenia | FAERS: 1 | US FAERS | |
| 195 | Loss of personal independence in daily activities | FAERS: 1 | US FAERS | |
| 196 | Medication residue present | FAERS: 1 | US FAERS | |
| 197 | Memory impairment | FAERS: 1 | US FAERS | |
| 198 | Mental impairment | FAERS: 1 | US FAERS | |
| 199 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 200 | Middle insomnia | FAERS: 1 | US FAERS | |
| 201 | Multi-organ disorder | FAERS: 1 | US FAERS | |
| 202 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 203 | Nasal mucosal erosion | FAERS: 1 | US FAERS | |
| 204 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 205 | Occupational exposure to product | FAERS: 1 | US FAERS | |
| 206 | Oral fungal infection | FAERS: 1 | US FAERS | |
| 207 | Oral pain | FAERS: 1 | US FAERS | |
| 208 | Partner stress | FAERS: 1 | US FAERS | |
| 209 | Pericardial effusion | FAERS: 1 | US FAERS | |
| 210 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 211 | Personality Change | FAERS: 1 | US FAERS | |
| 212 | Petechiae | FAERS: 1 | US FAERS | |
| 213 | Post-Traumatic Stress Disorder | FAERS: 1 | US FAERS | |
| 214 | Prescribed overdose | FAERS: 1 | US FAERS | |
| 215 | Prescription form tampering | FAERS: 1 | US FAERS | |
| 216 | Product packaging quantity issue | FAERS: 1 | US FAERS | |
| 217 | Product physical consistency issue | FAERS: 1 | US FAERS | |
| 218 | Product physical issue | FAERS: 1 | US FAERS | |
| 219 | Product size issue | FAERS: 1 | US FAERS | |
| 220 | Product solubility abnormal | FAERS: 1 | US FAERS | |
| 221 | Product taste abnormal | FAERS: 1 | US FAERS | |
| 222 | Product use in unapproved indication | FAERS: 1 | US FAERS | |
| 223 | Quadriparesis | FAERS: 1 | US FAERS | |
| 224 | Quadriplegia | FAERS: 1 | US FAERS | |
| 225 | Respiratory Depression | FAERS: 1 | US FAERS | |
| 226 | Respiratory distress | FAERS: 1 | US FAERS | |
| 227 | Restless Legs Syndrome | FAERS: 1 | US FAERS | |
| 228 | Restlessness | FAERS: 1 | US FAERS | |
| 229 | Rhabdomyolysis | FAERS: 1 | US FAERS | |
| 230 | Sepsis | FAERS: 1 | US FAERS | |
| 231 | Septic Shock | FAERS: 1 | US FAERS | |
| 232 | Similar reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 233 | Sinus Tachycardia | FAERS: 1 | US FAERS | |
| 234 | Sleep Talking | FAERS: 1 | US FAERS | |
| 235 | Sleep disorder due to a general medical condition | FAERS: 1 | US FAERS | |
| 236 | Snoring | FAERS: 1 | US FAERS | |
| 237 | Splenitis | FAERS: 1 | US FAERS | |
| 238 | Spontaneous penile erection | FAERS: 1 | US FAERS | |
| 239 | Stenosis | FAERS: 1 | US FAERS | |
| 240 | Stomatitis | FAERS: 1 | US FAERS | |
| 241 | Sudden onset of sleep | FAERS: 1 | US FAERS | |
| 242 | Suicide attempt | FAERS: 1 | US FAERS | |
| 243 | Syncope | FAERS: 1 | US FAERS | |
| 244 | Tachyphrenia | FAERS: 1 | US FAERS | |
| 245 | Therapeutic product ineffective | FAERS: 1 | US FAERS | |
| 246 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 247 | Thermal burn | FAERS: 1 | US FAERS | |
| 248 | Thirst | FAERS: 1 | US FAERS | |
| 249 | Thrombosis | FAERS: 1 | US FAERS | |
| 250 | Tongue exfoliation | FAERS: 1 | US FAERS | |
| 251 | Tooth Erosion | FAERS: 1 | US FAERS | |
| 252 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 253 | Transaminases increased | FAERS: 1 | US FAERS | |
| 254 | Transcription medication error | FAERS: 1 | US FAERS | |
| 255 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 256 | Weight decreased | FAERS: 1 | US FAERS | |
| 257 | furuncle | FAERS: 1 | US FAERS | |
| 258 | jaundice | FAERS: 1 | US FAERS | |
| 259 | Back disorder | Canada Vigilance: 1 | Canada Vigilance | |
| 260 | Rotator cuff syndrome | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120240
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.