torezolid phosphate
(QCGUSIANLFXSGE-GFCCVEGCSA-N)
Structure
- SMILES
- O=C1O[C@H](CN1c1ccc(c(c1)F)c1ccc(nc1)c1nnn(n1)C)COP(=O)(O)O
- Type(s)
- Approved
- Molecular Formula:
- C17H16FN6O6P
- Molecular Weight:
- 450.318
- Log P:
- 1.5777
- Hydrogen Bond Acceptor:
- 12
- Hydrogen Bond Donor:
- 2
- TPSA:
- 162.6
- CAS Number(s):
- 856867-55-5
Synonym(s)
1.
torezolid phosphate
2.
DA 7218
3.
DA-7218
4.
DA7218
5.
Sivextro
6.
TR 701
7.
TR-701
8.
TR701 cpd
9.
tedizolid phosphate
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Nausea | FAERS: 15 | US FAERS | |
| 2 | Drug ineffective | FAERS: 14 | US FAERS | |
| 3 | Vomiting | FAERS: 11 | US FAERS | |
| 4 | Headache | FAERS: 7 | US FAERS | |
| 5 | Urticaria | FAERS: 5 | US FAERS | |
| 6 | Drug effective for unapproved indication | FAERS: 4 | US FAERS | |
| 7 | Product use in unapproved indication | FAERS: 4 | US FAERS | |
| 8 | Thrombocytopenia | FAERS: 4 | US FAERS | |
| 9 | Adverse event | FAERS: 3 | US FAERS | |
| 10 | Cellulitis | FAERS: 3 | US FAERS | |
| 11 | Erythema | FAERS: 3 | US FAERS | |
| 12 | Malaise | FAERS: 3 | US FAERS | |
| 13 | Myocardial Infarction | FAERS: 3 | US FAERS | |
| 14 | No adverse event | FAERS: 3 | US FAERS | |
| 15 | Product prescribing issue | FAERS: 3 | US FAERS | |
| 16 | Product quality issue | FAERS: 3 | US FAERS | |
| 17 | Pruritus | FAERS: 3 | US FAERS | |
| 18 | Sepsis | FAERS: 3 | US FAERS | |
| 19 | Abdominal Pain | FAERS: 2 | US FAERS | |
| 20 | Abdominal discomfort | FAERS: 2 | US FAERS | |
| 21 | Asthenia | FAERS: 2 | US FAERS | |
| 22 | Bradycardia | FAERS: 2 | US FAERS | |
| 23 | Dizziness | FAERS: 2 | US FAERS | |
| 24 | Incorrect drug administration duration | FAERS: 2 | US FAERS | |
| 25 | Osteomyelitis | FAERS: 2 | US FAERS | |
| 26 | Tachycardia | FAERS: 2 | US FAERS | |
| 27 | Anxiety | FAERS: 1 | US FAERS | |
| 28 | Arthralgia | FAERS: 1 | US FAERS | |
| 29 | Blood glucose abnormal | FAERS: 1 | US FAERS | |
| 30 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 31 | Bone pain | FAERS: 1 | US FAERS | |
| 32 | Chest Pain | FAERS: 1 | US FAERS | |
| 33 | Chest discomfort | FAERS: 1 | US FAERS | |
| 34 | Chills | FAERS: 1 | US FAERS | |
| 35 | Clostridium difficile infection | FAERS: 1 | US FAERS | |
| 36 | Dehydration | FAERS: 1 | US FAERS | |
| 37 | Drug administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 38 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 39 | Endocarditis enterococcal | FAERS: 1 | US FAERS | |
| 40 | Genital rash | FAERS: 1 | US FAERS | |
| 41 | Hypersensitivity | FAERS: 1 | US FAERS | |
| 42 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 43 | Inappropriate schedule of product administration | FAERS: 1 | US FAERS | |
| 44 | Infection | FAERS: 1 | US FAERS | |
| 45 | Infusion Site Extravasation | FAERS: 1 | US FAERS | |
| 46 | Limb injury | FAERS: 1 | US FAERS | |
| 47 | Muscle Fatigue | FAERS: 1 | US FAERS | |
| 48 | Oropharyngeal candidiasis | FAERS: 1 | US FAERS | |
| 49 | Palpitations | FAERS: 1 | US FAERS | |
| 50 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 51 | Phlebitis | FAERS: 1 | US FAERS | |
| 52 | Product use issue | FAERS: 1 | US FAERS | |
| 53 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 54 | Purulent discharge | FAERS: 1 | US FAERS | |
| 55 | Soft Tissue Infection | FAERS: 1 | US FAERS | |
| 56 | Swelling | FAERS: 1 | US FAERS | |
| 57 | Throat irritation | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120262
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.