Midazolam
(PLYSCVSCYOQVRP-UHFFFAOYSA-N)
Structure
- SMILES
- Clc1ccc2c(c1)C(=NCc1n2c(C)nc1)c1ccccc1F.Cl
- Molecular Formula:
- C18H14Cl2FN3
- Molecular Weight:
- 362.228
- Log P:
- 4.5618
- Hydrogen Bond Acceptor:
- 3
- Hydrogen Bond Donor:
- 1
- TPSA:
- 30.18
- CAS Number(s):
- 59467-96-8
Synonym(s)
1.
Midazolam
2.
Dormicum
3.
Midazolam Hydrochloride
4.
Midazolam Maleate
5.
Ro 21-3981
6.
Versed
7.
Hydrochloride, Midazolam
8.
Maleate, Midazolam
9.
Ro 21 3981
10.
Ro 213981
External Link(s)
| MeSH | D008874 |
| PubChem Compound | 43032 |
| ChEBI | 6932 |
| CHEMBL | CHEMBL1200420 |
| KEGG | dr:D00696 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 86 | US FAERS | |
| 2 | Medication Error | FAERS: 20 | US FAERS | |
| 3 | Hypotension | FAERS: 13 | US FAERS | |
| 4 | Pharmaceutical product complaint | FAERS: 10 | US FAERS | |
| 5 | Agitation | FAERS: 9 | US FAERS | |
| 6 | Product quality issue | FAERS: 7 | US FAERS | |
| 7 | Cardiac Arrest | FAERS: 6 | US FAERS | |
| 8 | Screaming | FAERS: 6 | US FAERS | |
| 9 | Bradycardia | FAERS: 5 | US FAERS | |
| 10 | Post procedural complication | FAERS: 5 | US FAERS | |
| 11 | Drug effect delayed | FAERS: 4 | US FAERS | |
| 12 | Hypersensitivity | FAERS: 4 | US FAERS | |
| 13 | Paradoxical drug reaction | FAERS: 4 | US FAERS | |
| 14 | Procedural complication | FAERS: 4 | US FAERS | |
| 15 | Respiratory Failure | FAERS: 4 | US FAERS | |
| 16 | Unresponsive to stimuli | FAERS: 4 | US FAERS | |
| 17 | Urinary Retention | FAERS: 4 | US FAERS | |
| 18 | Urticaria | FAERS: 4 | US FAERS | |
| 19 | Amnesia | FAERS: 3 | US FAERS | |
| 20 | Anxiety | FAERS: 3 | US FAERS | |
| 21 | Crying | FAERS: 3 | US FAERS | |
| 22 | Depressed Level of Consciousness | FAERS: 3 | US FAERS | |
| 23 | Hypoxia | FAERS: 3 | US FAERS | |
| 24 | Incorrect dose administered | FAERS: 3 | US FAERS | |
| 25 | Nausea | FAERS: 3 | US FAERS | |
| 26 | Overdose | FAERS: 3 | US FAERS | |
| 27 | Pain | FAERS: 3 | US FAERS | |
| 28 | Somnolence | FAERS: 3 | US FAERS | |
| 29 | Tachycardia | FAERS: 3 | US FAERS | |
| 30 | Vomiting | FAERS: 3 | US FAERS | |
| 31 | Amnestic Disorder | FAERS: 2 | US FAERS | |
| 32 | Disorientation | FAERS: 2 | US FAERS | |
| 33 | Drug exposure during pregnancy | FAERS: 2 | US FAERS | |
| 34 | Drug ineffective for unapproved indication | FAERS: 2 | US FAERS | |
| 35 | Flushing | FAERS: 2 | US FAERS | |
| 36 | Headache | FAERS: 2 | US FAERS | |
| 37 | Impaired work ability | FAERS: 2 | US FAERS | |
| 38 | Incorrect drug administration rate | FAERS: 2 | US FAERS | |
| 39 | Mental status changes | FAERS: 2 | US FAERS | |
| 40 | Myoclonus | FAERS: 2 | US FAERS | |
| 41 | Neonatal hypotension | FAERS: 2 | US FAERS | |
| 42 | Product label confusion | FAERS: 2 | US FAERS | |
| 43 | Respiratory distress | FAERS: 2 | US FAERS | |
| 44 | Restlessness | FAERS: 2 | US FAERS | |
| 45 | Therapeutic response unexpected with drug substitution | FAERS: 2 | US FAERS | |
| 46 | Tremor | FAERS: 2 | US FAERS | |
| 47 | Abasia | FAERS: 1 | US FAERS | |
| 48 | Apallic syndrome | FAERS: 1 | US FAERS | |
| 49 | Aphasia | FAERS: 1 | US FAERS | |
| 50 | Ascites | FAERS: 1 | US FAERS | |
| 51 | Asphyxia | FAERS: 1 | US FAERS | |
| 52 | Asthenia | FAERS: 1 | US FAERS | |
| 53 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 54 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 55 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 56 | Bronchospasm | FAERS: 1 | US FAERS | |
| 57 | Catatonia | FAERS: 1 | US FAERS | |
| 58 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 59 | Chest Pain | FAERS: 1 | US FAERS | |
| 60 | Chest discomfort | FAERS: 1 | US FAERS | |
| 61 | Chills | FAERS: 1 | US FAERS | |
| 62 | Circumstance or information capable of leading to medication error | FAERS: 1 | US FAERS | |
| 63 | Cold sweat | FAERS: 1 | US FAERS | |
| 64 | Delirium | FAERS: 1 | US FAERS | |
| 65 | Device ineffective | FAERS: 1 | US FAERS | |
| 66 | Device malfunction | FAERS: 1 | US FAERS | |
| 67 | Dizziness | FAERS: 1 | US FAERS | |
| 68 | Drug administration error | FAERS: 1 | US FAERS | |
| 69 | Dystonia | FAERS: 1 | US FAERS | |
| 70 | Erythema | FAERS: 1 | US FAERS | |
| 71 | Excessive sexual fantasies | FAERS: 1 | US FAERS | |
| 72 | Expired drug administered | FAERS: 1 | US FAERS | |
| 73 | Feeling abnormal | FAERS: 1 | US FAERS | |
| 74 | Fluid overload | FAERS: 1 | US FAERS | |
| 75 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 76 | Hostility | FAERS: 1 | US FAERS | |
| 77 | Hyperkinesia | FAERS: 1 | US FAERS | |
| 78 | Hypoventilation | FAERS: 1 | US FAERS | |
| 79 | Inadequate analgesia | FAERS: 1 | US FAERS | |
| 80 | Inappropriate affect | FAERS: 1 | US FAERS | |
| 81 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 82 | Intercepted medication error | FAERS: 1 | US FAERS | |
| 83 | Kounis Syndrome | FAERS: 1 | US FAERS | |
| 84 | Laryngospasm | FAERS: 1 | US FAERS | |
| 85 | Lethargy | FAERS: 1 | US FAERS | |
| 86 | Medication tampering | FAERS: 1 | US FAERS | |
| 87 | Memory impairment | FAERS: 1 | US FAERS | |
| 88 | Muscle tightness | FAERS: 1 | US FAERS | |
| 89 | Nasal discomfort | FAERS: 1 | US FAERS | |
| 90 | Opisthotonus | FAERS: 1 | US FAERS | |
| 91 | Pallor | FAERS: 1 | US FAERS | |
| 92 | Phlebitis | FAERS: 1 | US FAERS | |
| 93 | Potentiating drug interaction | FAERS: 1 | US FAERS | |
| 94 | Product formulation issue | FAERS: 1 | US FAERS | |
| 95 | Product label issue | FAERS: 1 | US FAERS | |
| 96 | Product packaging issue | FAERS: 1 | US FAERS | |
| 97 | Product shape issue | FAERS: 1 | US FAERS | |
| 98 | Product storage error | FAERS: 1 | US FAERS | |
| 99 | Product substitution issue | FAERS: 1 | US FAERS | |
| 100 | Pruritus Ani | FAERS: 1 | US FAERS | |
| 101 | Pruritus | FAERS: 1 | US FAERS | |
| 102 | Respiratory Depression | FAERS: 1 | US FAERS | |
| 103 | Retrograde amnesia | FAERS: 1 | US FAERS | |
| 104 | Stress | FAERS: 1 | US FAERS | |
| 105 | Stridor | FAERS: 1 | US FAERS | |
| 106 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 107 | Swelling | FAERS: 1 | US FAERS | |
| 108 | Syncope | FAERS: 1 | US FAERS | |
| 109 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 110 | Throat irritation | FAERS: 1 | US FAERS | |
| 111 | Unevaluable event | FAERS: 1 | US FAERS | |
| 112 | Venous oxygen saturation decreased | FAERS: 1 | US FAERS | |
| 113 | nervous system disorder | FAERS: 1 | US FAERS | |
| 114 | treatment failure | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120240
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.