ALANINE, 3-(p-(BIS(2-CHLOROETHYL)AMINO)PHENYL)-, MONOHYDROCHLORIDE, L-
(OUUYBRCCFUEMLH-YDALLXLXSA-N)
Structure
- SMILES
- ClCCN(c1ccc(cc1)C[C@@H](C(=O)O)N)CCCl.Cl
- Molecular Formula:
- C13H19Cl3N2O2
- Molecular Weight:
- 341.661
- Log P:
- 3.4273
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 3
- TPSA:
- 66.56
- CAS Number(s):
- 3223-07-2
Synonym(s)
1.
ALANINE, 3-(p-(BIS(2-CHLOROETHYL)AMINO)PHENYL)-, MONOHYDROCHLORIDE, L-
2.
Melphalan hydrochloride
External Link(s)
| PubChem Compound | 24832839 9927978 |
| CHEMBL | CHEMBL1200863 |
| KEGG | dr:D08173 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Ocular vascular disorder | FAERS: 11 | US FAERS | |
| 2 | Chorioretinal atrophy | FAERS: 10 | US FAERS | |
| 3 | Febrile Neutropenia | FAERS: 9 | US FAERS | |
| 4 | Choroidal dystrophy | FAERS: 6 | US FAERS | |
| 5 | Haematotoxicity | FAERS: 6 | US FAERS | |
| 6 | Amputation | FAERS: 4 | US FAERS | |
| 7 | Retinal Artery Occlusion | FAERS: 4 | US FAERS | |
| 8 | Venoocclusive disease | FAERS: 4 | US FAERS | |
| 9 | Cholangitis | FAERS: 3 | US FAERS | |
| 10 | Local reaction | FAERS: 3 | US FAERS | |
| 11 | Neutropenia | FAERS: 3 | US FAERS | |
| 12 | Neutrophil count decreased | FAERS: 3 | US FAERS | |
| 13 | Sepsis | FAERS: 3 | US FAERS | |
| 14 | Toxicity to various agents | FAERS: 3 | US FAERS | |
| 15 | White blood cell count decreased | FAERS: 3 | US FAERS | |
| 16 | Atrial Fibrillation | FAERS: 2 | US FAERS | |
| 17 | Bone marrow toxicity | FAERS: 2 | US FAERS | |
| 18 | Neuralgic Amyotrophy | FAERS: 2 | US FAERS | |
| 19 | Pancytopenia | FAERS: 2 | US FAERS | |
| 20 | Respiratory Failure | FAERS: 2 | US FAERS | |
| 21 | Septic Shock | FAERS: 2 | US FAERS | |
| 22 | Vascular occlusion | FAERS: 2 | US FAERS | |
| 23 | Abdominal Pain | FAERS: 1 | US FAERS | |
| 24 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 25 | Alanine Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 26 | Angiogram peripheral abnormal | FAERS: 1 | US FAERS | |
| 27 | Asthenia | FAERS: 1 | US FAERS | |
| 28 | Back Pain | FAERS: 1 | US FAERS | |
| 29 | Bone Sarcoma | FAERS: 1 | US FAERS | |
| 30 | Cataract | FAERS: 1 | US FAERS | |
| 31 | Chest Pain | FAERS: 1 | US FAERS | |
| 32 | Chills | FAERS: 1 | US FAERS | |
| 33 | Colitis | FAERS: 1 | US FAERS | |
| 34 | Deafness | FAERS: 1 | US FAERS | |
| 35 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 36 | Disseminated Intravascular Coagulation | FAERS: 1 | US FAERS | |
| 37 | Drug toxicity | FAERS: 1 | US FAERS | |
| 38 | Eye excision | FAERS: 1 | US FAERS | |
| 39 | Eye inflammation | FAERS: 1 | US FAERS | |
| 40 | Gastric ulcer | FAERS: 1 | US FAERS | |
| 41 | Hypotension | FAERS: 1 | US FAERS | |
| 42 | Infection | FAERS: 1 | US FAERS | |
| 43 | Influenza | FAERS: 1 | US FAERS | |
| 44 | Leukocytoclastic vasculitis | FAERS: 1 | US FAERS | |
| 45 | Malaise | FAERS: 1 | US FAERS | |
| 46 | Mental status changes | FAERS: 1 | US FAERS | |
| 47 | Multiple Myeloma | FAERS: 1 | US FAERS | |
| 48 | Nausea | FAERS: 1 | US FAERS | |
| 49 | Nephrotic Syndrome | FAERS: 1 | US FAERS | |
| 50 | Pneumonia | FAERS: 1 | US FAERS | |
| 51 | Pneumonitis | FAERS: 1 | US FAERS | |
| 52 | Polypoidal choroidal vasculopathy | FAERS: 1 | US FAERS | |
| 53 | Proteinuria | FAERS: 1 | US FAERS | |
| 54 | Respiratory distress | FAERS: 1 | US FAERS | |
| 55 | Retinal Vascular Disorder | FAERS: 1 | US FAERS | |
| 56 | Stem cell transplant | FAERS: 1 | US FAERS | |
| 57 | Syncope | FAERS: 1 | US FAERS | |
| 58 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 59 | Unevaluable event | FAERS: 1 | US FAERS | |
| 60 | Ventricular arrhythmia | FAERS: 1 | US FAERS | |
| 61 | Vomiting | FAERS: 1 | US FAERS | |
| 62 | jaundice | FAERS: 1 | US FAERS | |
| 63 | nervous system disorder | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.