AR-13324
(OURRXQUGYQRVML-AREMUKBSSA-N)
Structure
- SMILES
- NC[C@@H](C(=O)Nc1ccc2c(c1)ccnc2)c1ccc(cc1)COC(=O)c1ccc(cc1C)C
- Type(s)
- Approved
- ATC code(s)
- S01EX05
- Molecular Formula:
- C28H27N3O3
- Molecular Weight:
- 453.532
- Log P:
- 5.6629
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 2
- TPSA:
- 94.31
- CAS Number(s):
- 1254032-66-0
Synonym(s)
1.
AR-13324
2.
netarsudil
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Eye allergy | FAERS: 16 | US FAERS | |
| 2 | Cornea verticillata | FAERS: 12 | US FAERS | |
| 3 | Eye pain | FAERS: 9 | US FAERS | |
| 4 | Blepharitis | FAERS: 8 | US FAERS | |
| 5 | Corneal Opacity | FAERS: 6 | US FAERS | |
| 6 | Eye irritation | FAERS: 6 | US FAERS | |
| 7 | Uveitis | FAERS: 6 | US FAERS | |
| 8 | Drug ineffective | FAERS: 5 | US FAERS | |
| 9 | Headache | FAERS: 5 | US FAERS | |
| 10 | Visual Impairment | FAERS: 5 | US FAERS | |
| 11 | Eyelids pruritus | FAERS: 4 | US FAERS | |
| 12 | Hypersensitivity | FAERS: 4 | US FAERS | |
| 13 | Discomfort | FAERS: 3 | US FAERS | |
| 14 | Myopia | FAERS: 3 | US FAERS | |
| 15 | Abdominal discomfort | FAERS: 2 | US FAERS | |
| 16 | Chest Pain | FAERS: 2 | US FAERS | |
| 17 | Conjunctivitis | FAERS: 2 | US FAERS | |
| 18 | Corneal cyst | FAERS: 2 | US FAERS | |
| 19 | Ectropion | FAERS: 2 | US FAERS | |
| 20 | Eye inflammation | FAERS: 2 | US FAERS | |
| 21 | Instillation site pain | FAERS: 2 | US FAERS | |
| 22 | Iritis | FAERS: 2 | US FAERS | |
| 23 | Keratitis | FAERS: 2 | US FAERS | |
| 24 | Photophobia | FAERS: 2 | US FAERS | |
| 25 | Punctate keratitis | FAERS: 2 | US FAERS | |
| 26 | Vitreous floaters | FAERS: 2 | US FAERS | |
| 27 | Alopecia | FAERS: 1 | US FAERS | |
| 28 | Asthenopia | FAERS: 1 | US FAERS | |
| 29 | Blepharospasm | FAERS: 1 | US FAERS | |
| 30 | Blood urine present | FAERS: 1 | US FAERS | |
| 31 | Corneal degeneration | FAERS: 1 | US FAERS | |
| 32 | Device damage | FAERS: 1 | US FAERS | |
| 33 | Diplopia | FAERS: 1 | US FAERS | |
| 34 | Dizziness | FAERS: 1 | US FAERS | |
| 35 | Epistaxis | FAERS: 1 | US FAERS | |
| 36 | Erythema | FAERS: 1 | US FAERS | |
| 37 | Exophthalmos | FAERS: 1 | US FAERS | |
| 38 | Eyelash changes | FAERS: 1 | US FAERS | |
| 39 | Eyelash thickening | FAERS: 1 | US FAERS | |
| 40 | Eyelid irritation | FAERS: 1 | US FAERS | |
| 41 | Eyelid pain | FAERS: 1 | US FAERS | |
| 42 | Flatulence | FAERS: 1 | US FAERS | |
| 43 | Flushing | FAERS: 1 | US FAERS | |
| 44 | Hordeolum | FAERS: 1 | US FAERS | |
| 45 | Hypokinesia | FAERS: 1 | US FAERS | |
| 46 | Hypopyon | FAERS: 1 | US FAERS | |
| 47 | Instillation site foreign body sensation | FAERS: 1 | US FAERS | |
| 48 | Keratopathy | FAERS: 1 | US FAERS | |
| 49 | Ocular discomfort | FAERS: 1 | US FAERS | |
| 50 | Palpitations | FAERS: 1 | US FAERS | |
| 51 | Product residue present | FAERS: 1 | US FAERS | |
| 52 | Pruritus | FAERS: 1 | US FAERS | |
| 53 | Swelling of eyelid | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.