Hydrocodone
(OJHZNMVJJKMFGX-BWCYBWMMSA-N)
Structure
- SMILES
- O[C@H]([C@H](C(=O)O)O)C(=O)O.COc1ccc2c3c1O[C@@H]1[C@@]43CCN([C@H](C2)[C@@H]4CCC1=O)C
- Molecular Formula:
- C22H27NO9
- Molecular Weight:
- 449.451
- Log P:
- -0.2514
- Hydrogen Bond Acceptor:
- 10
- Hydrogen Bond Donor:
- 4
- TPSA:
- 153.83
- CAS Number(s):
- 143-71-5
Synonym(s)
1.
Hydrocodone
2.
Dihydrocodeinone
3.
Hydrocodeinonebitartrate
4.
Hydrocon
5.
Codinovo
6.
Dicodid
7.
Hycodan
8.
Hycon
9.
Hydrocodon
10.
Hydrocodone Bitartrate
11.
Hydrocodone Tartrate (1:1), Hydrate (2:5)
12.
Robidone
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 373 | US FAERS | |
| 2 | Nausea | FAERS: 347 | US FAERS | |
| 3 | Inadequate analgesia | FAERS: 181 | US FAERS | |
| 4 | Headache | FAERS: 157 | US FAERS | |
| 5 | Somnolence | FAERS: 123 | US FAERS | |
| 6 | Dizziness | FAERS: 109 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 7 | Feeling abnormal | FAERS: 101 | US FAERS | |
| 8 | Vomiting | FAERS: 96 | US FAERS | |
| 9 | Pain | FAERS: 64 | US FAERS | |
| 10 | Pruritus | FAERS: 61 | US FAERS | |
| 11 | Fatigue | FAERS: 50 | US FAERS | |
| 12 | Abdominal discomfort | FAERS: 49 | US FAERS | |
| 13 | Constipation | FAERS: 44 | US FAERS | |
| 14 | Malaise | FAERS: 38 | US FAERS | |
| 15 | Drug withdrawal syndrome | FAERS: 27 | US FAERS | |
| 16 | Anxiety | FAERS: 17 | US FAERS | |
| 17 | Hypersensitivity | FAERS: 16 | US FAERS | |
| 18 | Unevaluable event | FAERS: 16 | US FAERS | |
| 19 | Urticaria | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 20 | Medication residue present | FAERS: 15 | US FAERS | |
| 21 | Overdose | FAERS: 15 | US FAERS | |
| 22 | Palpitations | FAERS: 15 | US FAERS | |
| 23 | Wrong technique in product usage process | FAERS: 13 | US FAERS | |
| 24 | Breakthrough Pain | FAERS: 12 | US FAERS | |
| 25 | Euphoric mood | FAERS: 12 | US FAERS | |
| 26 | Inappropriate schedule of drug administration | FAERS: 12 | US FAERS | |
| 27 | Peripheral swelling | FAERS: 12 | US FAERS | |
| 28 | Tremor | FAERS: 12 | US FAERS | |
| 29 | Abdominal Pain | FAERS: 11 | US FAERS | |
| 30 | Intentional product use issue | FAERS: 11 | US FAERS | |
| 31 | Chest Pain | FAERS: 10 | US FAERS | |
| 32 | Drug abuse | FAERS: 10 | US FAERS | |
| 33 | Feeling jittery | FAERS: 10 | US FAERS | |
| 34 | Lethargy | FAERS: 10 | US FAERS | |
| 35 | Agitation | FAERS: 9 | US FAERS | |
| 36 | Chest discomfort | FAERS: 9 | US FAERS | |
| 37 | Asthenia | FAERS: 8 | US FAERS | |
| 38 | Extra dose administered | FAERS: 8 | US FAERS | |
| 39 | Restlessness | FAERS: 7 | US FAERS | |
| 40 | Tinnitus | FAERS: 7 | US FAERS | |
| 41 | Weight decreased | FAERS: 7 | US FAERS | |
| 42 | Drug effect incomplete | FAERS: 6 | US FAERS | |
| 43 | Drug level increased | FAERS: 6 | US FAERS | |
| 44 | Nervousness | FAERS: 6 | US FAERS | |
| 45 | Respiratory Depression | FAERS: 6 | US FAERS | |
| 46 | Choking | FAERS: 5 | US FAERS | |
| 47 | Depressed mood | FAERS: 5 | US FAERS | |
| 48 | Disorientation | FAERS: 5 | US FAERS | |
| 49 | Dysarthria | FAERS: 5 | US FAERS | |
| 50 | Memory impairment | FAERS: 5 | US FAERS | |
| 51 | Oropharyngeal pain | FAERS: 5 | US FAERS | |
| 52 | Pharmaceutical product complaint | FAERS: 5 | US FAERS | |
| 53 | Restless Legs Syndrome | FAERS: 5 | US FAERS | |
| 54 | Swelling | FAERS: 5 | US FAERS | |
| 55 | Urinary Retention | FAERS: 5 | US FAERS | |
| 56 | Urinary tract infection | FAERS: 5 | US FAERS | |
| 57 | Activities of daily living impaired | FAERS: 4 | US FAERS | |
| 58 | Back Pain | FAERS: 4 | US FAERS | |
| 59 | Burning sensation | FAERS: 4 | US FAERS | |
| 60 | Cardiac Arrest | FAERS: 4 | US FAERS | |
| 61 | Drug Dependence | FAERS: 4 | US FAERS | |
| 62 | Drug prescribing error | FAERS: 4 | US FAERS | |
| 63 | Drug toxicity | FAERS: 4 | US FAERS | |
| 64 | Dyspepsia | FAERS: 4 | US FAERS | |
| 65 | Erectile dysfunction | FAERS: 4 | US FAERS | |
| 66 | Flatulence | FAERS: 4 | US FAERS | |
| 67 | Flushing | FAERS: 4 | US FAERS | |
| 68 | Incorrect dose administered | FAERS: 4 | US FAERS | |
| 69 | Influenza | FAERS: 4 | US FAERS | |
| 70 | Malabsorption | FAERS: 4 | US FAERS | |
| 71 | Urinary hesitation | FAERS: 4 | US FAERS | |
| 72 | Anger | FAERS: 3 | US FAERS | |
| 73 | Arthralgia | FAERS: 3 | US FAERS | |
| 74 | Bedridden | FAERS: 3 | US FAERS | |
| 75 | Dysgeusia | FAERS: 3 | US FAERS | |
| 76 | Feeling Cold | FAERS: 3 | US FAERS | |
| 77 | Foreign body in respiratory tract | FAERS: 3 | US FAERS | |
| 78 | Hypotension | FAERS: 3 | US FAERS | |
| 79 | Nasopharyngitis | FAERS: 3 | US FAERS | |
| 80 | Night sweats | FAERS: 3 | US FAERS | |
| 81 | Pneumonia | FAERS: 3 | US FAERS | |
| 82 | Product physical issue | FAERS: 3 | US FAERS | |
| 83 | Product size issue | FAERS: 3 | US FAERS | |
| 84 | Skin reaction | FAERS: 3 | US FAERS | |
| 85 | Toxicity to various agents | FAERS: 3 | US FAERS | |
| 86 | Visual Impairment | FAERS: 3 | US FAERS | |
| 87 | Accidental overdose | FAERS: 2 | US FAERS | |
| 88 | Alopecia | FAERS: 2 | US FAERS | |
| 89 | Amnesia | FAERS: 2 | US FAERS | |
| 90 | Asthma | FAERS: 2 | US FAERS | |
| 91 | Cartilage injury | FAERS: 2 | US FAERS | |
| 92 | Cerebrovascular accident | FAERS: 2 | US FAERS | |
| 93 | Completed Suicide | FAERS: 2 | US FAERS | |
| 94 | Dehydration | FAERS: 2 | US FAERS | |
| 95 | Discomfort | FAERS: 2 | US FAERS | |
| 96 | Documented hypersensitivity to administered drug | FAERS: 2 | US FAERS | |
| 97 | Drug effect delayed | FAERS: 2 | US FAERS | |
| 98 | Drug effect variable | FAERS: 2 | US FAERS | |
| 99 | Dysuria | FAERS: 2 | US FAERS | |
| 100 | Eructation | FAERS: 2 | US FAERS | |
| 101 | Erythema | FAERS: 2 | US FAERS | |
| 102 | Head discomfort | FAERS: 2 | US FAERS | |
| 103 | Hypersomnia | FAERS: 2 | US FAERS | |
| 104 | Impaired driving ability | FAERS: 2 | US FAERS | |
| 105 | Medication Error | FAERS: 2 | US FAERS | |
| 106 | Medication overuse headache | FAERS: 2 | US FAERS | |
| 107 | Mood swings | FAERS: 2 | US FAERS | |
| 108 | Muscle tightness | FAERS: 2 | US FAERS | |
| 109 | Myalgia | FAERS: 2 | US FAERS | |
| 110 | Paranoia | FAERS: 2 | US FAERS | |
| 111 | Personality Change | FAERS: 2 | US FAERS | |
| 112 | Product quality issue | FAERS: 2 | US FAERS | |
| 113 | Product residue present | FAERS: 2 | US FAERS | |
| 114 | Product solubility abnormal | FAERS: 2 | US FAERS | |
| 115 | Product substitution issue | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 116 | Product taste abnormal | FAERS: 2 | US FAERS | |
| 117 | Product use complaint | FAERS: 2 | US FAERS | |
| 118 | Retching | FAERS: 2 | US FAERS | |
| 119 | Sexual Dysfunction | FAERS: 2 | US FAERS | |
| 120 | Sluggishness | FAERS: 2 | US FAERS | |
| 121 | Somnambulism | FAERS: 2 | US FAERS | |
| 122 | Tachycardia | FAERS: 2 | US FAERS | |
| 123 | Thirst | FAERS: 2 | US FAERS | |
| 124 | Abasia | FAERS: 1 | US FAERS | |
| 125 | Adverse event | FAERS: 1 | US FAERS | |
| 126 | Allergy to chemicals | FAERS: 1 | US FAERS | |
| 127 | Anoxic Encephalopathy | FAERS: 1 | US FAERS | |
| 128 | Apparent death | FAERS: 1 | US FAERS | |
| 129 | Arthropathy | FAERS: 1 | US FAERS | |
| 130 | Arthropod bite | FAERS: 1 | US FAERS | |
| 131 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 132 | Autophobia | FAERS: 1 | US FAERS | |
| 133 | Bipolar Disorder | FAERS: 1 | US FAERS | |
| 134 | Blindness | FAERS: 1 | US FAERS | |
| 135 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 136 | Bradycardia | FAERS: 1 | US FAERS | |
| 137 | Bronchospasm | FAERS: 1 | US FAERS | |
| 138 | Cardiomegaly | FAERS: 1 | US FAERS | |
| 139 | Chills | FAERS: 1 | US FAERS | |
| 140 | Choking sensation | FAERS: 1 | US FAERS | |
| 141 | Clostridium difficile sepsis | FAERS: 1 | US FAERS | |
| 142 | Cold sweat | FAERS: 1 | US FAERS | |
| 143 | Colitis | FAERS: 1 | US FAERS | |
| 144 | Conversion disorder | FAERS: 1 | US FAERS | |
| 145 | Crying | FAERS: 1 | US FAERS | |
| 146 | Deafness | FAERS: 1 | US FAERS | |
| 147 | Diverticulum | FAERS: 1 | US FAERS | |
| 148 | Drooling | FAERS: 1 | US FAERS | |
| 149 | Drug administration error | FAERS: 1 | US FAERS | |
| 150 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 151 | Drug dose omission | FAERS: 1 | US FAERS | |
| 152 | Drug level fluctuating | FAERS: 1 | US FAERS | |
| 153 | Drug screen positive | FAERS: 1 | US FAERS | |
| 154 | Dysgraphia | FAERS: 1 | US FAERS | |
| 155 | Dysphonia | FAERS: 1 | US FAERS | |
| 156 | Ear discomfort | FAERS: 1 | US FAERS | |
| 157 | Economic problem | FAERS: 1 | US FAERS | |
| 158 | Emergency Care | FAERS: 1 | US FAERS | |
| 159 | Emotional disorder | FAERS: 1 | US FAERS | |
| 160 | Eye irritation | FAERS: 1 | US FAERS | |
| 161 | Eye pain | FAERS: 1 | US FAERS | |
| 162 | Fibromyalgia | FAERS: 1 | US FAERS | |
| 163 | Flight of ideas | FAERS: 1 | US FAERS | |
| 164 | Gait inability | FAERS: 1 | US FAERS | |
| 165 | Gastric Bypass | FAERS: 1 | US FAERS | |
| 166 | Gastrointestinal Pain | FAERS: 1 | US FAERS | |
| 167 | Gastrointestinal ulcer | FAERS: 1 | US FAERS | |
| 168 | Hypervigilance | FAERS: 1 | US FAERS | |
| 169 | Hypoaesthesia facial | FAERS: 1 | US FAERS | |
| 170 | Hypometabolism | FAERS: 1 | US FAERS | |
| 171 | Hypophagia | FAERS: 1 | US FAERS | |
| 172 | Illogical thinking | FAERS: 1 | US FAERS | |
| 173 | Inability to afford medication | FAERS: 1 | US FAERS | |
| 174 | Incoherent | FAERS: 1 | US FAERS | |
| 175 | Increased bronchial secretion | FAERS: 1 | US FAERS | |
| 176 | Insurance issue | FAERS: 1 | US FAERS | |
| 177 | Intentional dose omission | FAERS: 1 | US FAERS | |
| 178 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 179 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 180 | Intestinal Obstruction | FAERS: 1 | US FAERS | |
| 181 | Intracranial Aneurysm | FAERS: 1 | US FAERS | |
| 182 | Joint injury | FAERS: 1 | US FAERS | |
| 183 | Joint swelling | FAERS: 1 | US FAERS | |
| 184 | Ligament rupture | FAERS: 1 | US FAERS | |
| 185 | Lip swelling | FAERS: 1 | US FAERS | |
| 186 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 187 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 188 | Maternal exposure timing unspecified | FAERS: 1 | US FAERS | |
| 189 | Mental impairment | FAERS: 1 | US FAERS | |
| 190 | Mental status changes | FAERS: 1 | US FAERS | |
| 191 | Middle insomnia | FAERS: 1 | US FAERS | |
| 192 | Motion Sickness | FAERS: 1 | US FAERS | |
| 193 | Mouth swelling | FAERS: 1 | US FAERS | |
| 194 | Muscle Rigidity | FAERS: 1 | US FAERS | |
| 195 | Musculoskeletal chest pain | FAERS: 1 | US FAERS | |
| 196 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 197 | Nasal discomfort | FAERS: 1 | US FAERS | |
| 198 | Obstruction | FAERS: 1 | US FAERS | |
| 199 | Pallor | FAERS: 1 | US FAERS | |
| 200 | Panic Disorder | FAERS: 1 | US FAERS | |
| 201 | Photophobia | FAERS: 1 | US FAERS | |
| 202 | Platelet count abnormal | FAERS: 1 | US FAERS | |
| 203 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 204 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 205 | Product difficult to swallow | FAERS: 1 | US FAERS | |
| 206 | Reaction to drug excipients | FAERS: 1 | US FAERS | |
| 207 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 208 | Respiratory distress | FAERS: 1 | US FAERS | |
| 209 | Rheumatoid Arthritis | FAERS: 1 | US FAERS | |
| 210 | Rotator cuff syndrome | FAERS: 1 | US FAERS | |
| 211 | Screaming | FAERS: 1 | US FAERS | |
| 212 | Skin irritation | FAERS: 1 | US FAERS | |
| 213 | Splenomegaly | FAERS: 1 | US FAERS | |
| 214 | Stomatitis | FAERS: 1 | US FAERS | |
| 215 | Stress | FAERS: 1 | US FAERS | |
| 216 | Sudden onset of sleep | FAERS: 1 | US FAERS | |
| 217 | Suicide attempt | FAERS: 1 | US FAERS | |
| 218 | Surgical failure | FAERS: 1 | US FAERS | |
| 219 | Syncope | FAERS: 1 | US FAERS | |
| 220 | Tachyphrenia | FAERS: 1 | US FAERS | |
| 221 | Therapeutic response delayed | FAERS: 1 | US FAERS | |
| 222 | Therapeutic response unexpected with drug substitution | FAERS: 1 | US FAERS | |
| 223 | Throat irritation | FAERS: 1 | US FAERS | |
| 224 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 225 | Tongue blistering | FAERS: 1 | US FAERS | |
| 226 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 227 | Vasculitis | FAERS: 1 | US FAERS | |
| 228 | Vulvovaginal dryness | FAERS: 1 | US FAERS | |
| 229 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 230 | Yawning | FAERS: 1 | US FAERS | |
| 231 | furuncle | FAERS: 1 | US FAERS | |
| 232 | nervous system disorder | FAERS: 1 | US FAERS | |
| 233 | Wheezing | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120235
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.