pramlintide
(NRKVKVQDUCJPIZ-MKAGXXMWSA-N)
Structure
- SMILES
- NCCCC[C@@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)NCC(=O)N1CCC[C@H]1C(=O)N[C@H](C(=O)N[C@H](C(=O)N1CCC[C@H]1C(=O)N1CCC[C@H]1C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)NCC(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N)Cc1ccc(cc1)O)[C@H](O)C)CC(=O)N)CO)C(C)C)CC(=O)N)[C@H](O)C)CC(C)C)[C@H](CC)C)Cc1ccccc1)CC(=O)N)CC(=O)N)CO)CO)Cc1[nH]cnc1)C(C)C)CC(C)C)Cc1ccccc1)CC(=O)N)C)CC(C)C)CCCNC(=N)N)CCC(=O)N)[C@H](O)C)C)CS)[C@H](O)C)C)[C@H](O)C)CC(=O)N)CS)N
- Molecular Formula:
- C171H269N51O53S2
- Molecular Weight:
- 3951.410
- Log P:
- -3.4532
- Hydrogen Bond Acceptor:
- 105
- Hydrogen Bond Donor:
- 58
- TPSA:
- 1768.24
- CAS Number(s):
- N/A
Synonym(s)
1.
pramlintide
2.
AC 0137
3.
AC 137
4.
LYS-CYS-ASN-THR-ALA-THR-CYS-ALA-THR-GLN-ARG-LEU-ALA-ASN-PHE-LEU-VAL-HIS-SER-SER-ASN-ASN-PHE-GLY-PRO-ILE-LEU-PRO-PRO-THR-ASN-VAL-GLY-SER-ASN-THR-TYR-NH2
5.
Symlin
6.
Tripro-Amylin
7.
pramlintide acetate
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Nausea | FAERS: 71 | SIDER US FAERS | |
| 2 | Injection site pain | FAERS: 70 | US FAERS | |
| 3 | Blood glucose increased | FAERS: 53 | US FAERS | |
| 4 | Weight decreased | FAERS: 49 | US FAERS | |
| 5 | Medication Error | FAERS: 32 | US FAERS | |
| 6 | Injection site bruising | FAERS: 31 | US FAERS | |
| 7 | Drug ineffective | FAERS: 21 | US FAERS | |
| 8 | Incorrect dose administered | FAERS: 18 | US FAERS | |
| 9 | Vomiting | FAERS: 16 | SIDER US FAERS | |
| 10 | Fatigue | FAERS: 14 | SIDER US FAERS | |
| 11 | Blood glucose decreased | FAERS: 13 | US FAERS | |
| 12 | Headache | FAERS: 11 | SIDER US FAERS | |
| 13 | Injection site irritation | FAERS: 11 | US FAERS | |
| 14 | Drug prescribing error | FAERS: 10 | US FAERS | |
| 15 | Blood glucose abnormal | FAERS: 9 | US FAERS | |
| 16 | Urticaria | FAERS: 9 | US FAERS | |
| 17 | Feeling abnormal | FAERS: 8 | US FAERS | |
| 18 | Injection site erythema | FAERS: 8 | US FAERS | |
| 19 | Malaise | FAERS: 8 | US FAERS | |
| 20 | Product quality issue | FAERS: 8 | US FAERS | |
| 21 | Circumstance or information capable of leading to medication error | FAERS: 6 | US FAERS | |
| 22 | Drug ineffective for unapproved indication | FAERS: 6 | US FAERS | |
| 23 | Therapeutic response unexpected | FAERS: 6 | US FAERS | |
| 24 | Dizziness | FAERS: 5 | SIDER US FAERS | |
| 25 | Drug dose omission | FAERS: 5 | US FAERS | |
| 26 | Intentional product misuse | FAERS: 5 | US FAERS | |
| 27 | Lethargy | FAERS: 5 | US FAERS | |
| 28 | Pharmaceutical product complaint | FAERS: 5 | US FAERS | |
| 29 | Anorexia | FAERS: 4 | SIDER US FAERS | |
| 30 | Blood glucose fluctuation | FAERS: 4 | US FAERS | |
| 31 | Constipation | FAERS: 4 | US FAERS | |
| 32 | Injection site pruritus | FAERS: 4 | US FAERS | |
| 33 | Pancreatic carcinoma | FAERS: 4 | US FAERS | |
| 34 | Abdominal Pain | FAERS: 3 | SIDER US FAERS | |
| 35 | Arthralgia | FAERS: 3 | SIDER US FAERS | |
| 36 | Asthenia | FAERS: 3 | SIDER US FAERS | |
| 37 | Chest Pain | FAERS: 3 | US FAERS | |
| 38 | Dehydration | FAERS: 3 | US FAERS | |
| 39 | Drug administration error | FAERS: 3 | US FAERS | |
| 40 | Drug dispensing error | FAERS: 3 | US FAERS | |
| 41 | Dyspepsia | FAERS: 3 | US FAERS | |
| 42 | Early satiety | FAERS: 3 | US FAERS | |
| 43 | Nasopharyngitis | FAERS: 3 | US FAERS | |
| 44 | Nervousness | FAERS: 3 | US FAERS | |
| 45 | Overdose | FAERS: 3 | US FAERS | |
| 46 | Pancreatitis | FAERS: 3 | SIDER US FAERS | |
| 47 | Pancytopenia | FAERS: 3 | US FAERS | |
| 48 | Portal Hypertension | FAERS: 3 | US FAERS | |
| 49 | Product use issue | FAERS: 3 | US FAERS | |
| 50 | Somnolence | FAERS: 3 | US FAERS | |
| 51 | Splenomegaly | FAERS: 3 | US FAERS | |
| 52 | jaundice | FAERS: 3 | US FAERS | |
| 53 | Abdominal discomfort | FAERS: 2 | US FAERS | |
| 54 | Adverse event | FAERS: 2 | US FAERS | |
| 55 | Blood pH decreased | FAERS: 2 | US FAERS | |
| 56 | Carbon dioxide decreased | FAERS: 2 | US FAERS | |
| 57 | Cellulitis | FAERS: 2 | US FAERS | |
| 58 | Chest discomfort | FAERS: 2 | US FAERS | |
| 59 | Chills | FAERS: 2 | US FAERS | |
| 60 | Depressed mood | FAERS: 2 | US FAERS | |
| 61 | Diabetic Ketoacidosis | FAERS: 2 | US FAERS | |
| 62 | Dysgeusia | FAERS: 2 | US FAERS | |
| 63 | Flatulence | FAERS: 2 | US FAERS | |
| 64 | Hypersensitivity | FAERS: 2 | SIDER US FAERS | |
| 65 | Influenza | FAERS: 2 | US FAERS | |
| 66 | Injection site extravasation | FAERS: 2 | US FAERS | |
| 67 | Injection site urticaria | FAERS: 2 | US FAERS | |
| 68 | Memory impairment | FAERS: 2 | US FAERS | |
| 69 | Myalgia | FAERS: 2 | US FAERS | |
| 70 | Myocardial Infarction | FAERS: 2 | US FAERS | |
| 71 | Nephrolithiasis | FAERS: 2 | US FAERS | |
| 72 | No adverse effect | FAERS: 2 | US FAERS | |
| 73 | Pharyngolaryngeal Pain | FAERS: 2 | US FAERS | |
| 74 | Pruritus | FAERS: 2 | US FAERS | |
| 75 | Swelling | FAERS: 2 | US FAERS | |
| 76 | Tremor | FAERS: 2 | US FAERS | |
| 77 | Vertigo | FAERS: 2 | US FAERS | |
| 78 | Visual Impairment | FAERS: 2 | US FAERS | |
| 79 | Accidental exposure | FAERS: 1 | US FAERS | |
| 80 | Accidental needle stick | FAERS: 1 | US FAERS | |
| 81 | Accidental overdose | FAERS: 1 | US FAERS | |
| 82 | Alcohol Intolerance | FAERS: 1 | US FAERS | |
| 83 | Alcohol poisoning | FAERS: 1 | US FAERS | |
| 84 | Alopecia | FAERS: 1 | US FAERS | |
| 85 | Aneurysm | FAERS: 1 | US FAERS | |
| 86 | Anxiety | FAERS: 1 | US FAERS | |
| 87 | Aphagia | FAERS: 1 | US FAERS | |
| 88 | Arthritis | FAERS: 1 | US FAERS | |
| 89 | Auricular swelling | FAERS: 1 | US FAERS | |
| 90 | Back Pain | FAERS: 1 | US FAERS | |
| 91 | Biliary cirrhosis | FAERS: 1 | US FAERS | |
| 92 | Bipolar Disorder | FAERS: 1 | US FAERS | |
| 93 | Blood calcium abnormal | FAERS: 1 | US FAERS | |
| 94 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 95 | Blood triglycerides decreased | FAERS: 1 | US FAERS | |
| 96 | Blood triglycerides increased | FAERS: 1 | US FAERS | |
| 97 | Bone pain | FAERS: 1 | US FAERS | |
| 98 | Cataract | FAERS: 1 | US FAERS | |
| 99 | Choking sensation | FAERS: 1 | US FAERS | |
| 100 | Cholecystitis | FAERS: 1 | US FAERS | |
| 101 | Cholelithiasis | FAERS: 1 | US FAERS | |
| 102 | Cold sweat | FAERS: 1 | US FAERS | |
| 103 | Corrective lens user | FAERS: 1 | US FAERS | |
| 104 | Cyst | FAERS: 1 | US FAERS | |
| 105 | Device malfunction | FAERS: 1 | US FAERS | |
| 106 | Discomfort | FAERS: 1 | US FAERS | |
| 107 | Disease complication | FAERS: 1 | US FAERS | |
| 108 | Disorientation | FAERS: 1 | US FAERS | |
| 109 | Drug administered at inappropriate site | FAERS: 1 | US FAERS | |
| 110 | Drug exposure during pregnancy | FAERS: 1 | US FAERS | |
| 111 | Epistaxis | FAERS: 1 | US FAERS | |
| 112 | Eructation | FAERS: 1 | US FAERS | |
| 113 | Erythema | FAERS: 1 | US FAERS | |
| 114 | Eye inflammation | FAERS: 1 | US FAERS | |
| 115 | Food aversion | FAERS: 1 | US FAERS | |
| 116 | Foreign body trauma | FAERS: 1 | US FAERS | |
| 117 | Full blood count decreased | FAERS: 1 | US FAERS | |
| 118 | Gastritis | FAERS: 1 | US FAERS | |
| 119 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 120 | Hyperchlorhydria | FAERS: 1 | US FAERS | |
| 121 | Hypoaesthesia facial | FAERS: 1 | US FAERS | |
| 122 | Incorrect drug dosage form administered | FAERS: 1 | US FAERS | |
| 123 | Infection | FAERS: 1 | US FAERS | |
| 124 | Injection Site Reaction | FAERS: 1 | SIDER US FAERS | |
| 125 | Injection site discomfort | FAERS: 1 | US FAERS | |
| 126 | Injection site nodule | FAERS: 1 | US FAERS | |
| 127 | Injection site pustule | FAERS: 1 | US FAERS | |
| 128 | Injection site vesicles | FAERS: 1 | US FAERS | |
| 129 | Injection site warmth | FAERS: 1 | US FAERS | |
| 130 | Lipase increased | FAERS: 1 | US FAERS | |
| 131 | Malignant neoplasm progression | FAERS: 1 | US FAERS | |
| 132 | Mastoiditis | FAERS: 1 | US FAERS | |
| 133 | Medical device complication | FAERS: 1 | US FAERS | |
| 134 | Menorrhagia | FAERS: 1 | US FAERS | |
| 135 | Mental impairment | FAERS: 1 | US FAERS | |
| 136 | Migraine with Aura | FAERS: 1 | US FAERS | |
| 137 | Muscle abscess | FAERS: 1 | US FAERS | |
| 138 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 139 | Pancreatic Neoplasm | FAERS: 1 | US FAERS | |
| 140 | Personality Change | FAERS: 1 | US FAERS | |
| 141 | Pharyngolaryngeal discomfort | FAERS: 1 | US FAERS | |
| 142 | Pneumonia | FAERS: 1 | US FAERS | |
| 143 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 144 | Presyncope | FAERS: 1 | US FAERS | |
| 145 | Procedural vomiting | FAERS: 1 | US FAERS | |
| 146 | Rectal discharge | FAERS: 1 | US FAERS | |
| 147 | Renal pain | FAERS: 1 | US FAERS | |
| 148 | Retching | FAERS: 1 | US FAERS | |
| 149 | Single functional kidney | FAERS: 1 | US FAERS | |
| 150 | Sinusitis | FAERS: 1 | US FAERS | |
| 151 | Skin laceration | FAERS: 1 | US FAERS | |
| 152 | Thrombosis | FAERS: 1 | US FAERS | |
| 153 | Unevaluable event | FAERS: 1 | US FAERS | |
| 154 | Visual disturbance | FAERS: 1 | US FAERS | |
| 155 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 156 | Wrong technique in device usage process | FAERS: 1 | US FAERS | |
| 157 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 158 | gallbladder neoplasm | FAERS: 1 | US FAERS | |
| 159 | Gastrointestinal Pain | SIDER | ||
| 160 | Inflicted injury | SIDER | ||
| 161 | Musculoskeletal discomfort | SIDER | ||
| 162 | Pharyngitis | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120235
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.