ixazomib
(MXAYKZJJDUDWDS-LBPRGKRZSA-N)
Structure
- SMILES
- OB([C@@H](NC(=O)CNC(=O)c1cc(Cl)ccc1Cl)CC(C)C)O
- Type(s)
- Approved; Investigational
- ATC code(s)
- L01XX50
- Molecular Formula:
- C14H19BCl2N2O4
- Molecular Weight:
- 361.029
- Log P:
- 2.4678
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 4
- TPSA:
- 98.66
- CAS Number(s):
- 1072833-77-2
Synonym(s)
1.
ixazomib
2.
MLN 9708
3.
MLN-9708
4.
MLN9708
5.
Ninlaro
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Pneumonia | FAERS: 39 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 2 | Nausea | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 3 | Malaise | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 4 | Vomiting | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 5 | Sepsis | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 6 | Disease Progression | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 7 | Asthenia | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 8 | Fatigue | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 9 | Drug dose omission | FAERS: 8 | US FAERS | |
| 10 | Dehydration | FAERS: 7 | US FAERS | |
| 11 | Acute kidney injury | FAERS: 6 | US FAERS | |
| 12 | Drug ineffective | FAERS: 6 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 13 | Infection | FAERS: 6 | US FAERS | |
| 14 | Lower respiratory tract infection | FAERS: 6 | US FAERS | |
| 15 | Urinary tract infection | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 16 | Cerebrovascular accident | FAERS: 5 | US FAERS | |
| 17 | Dizziness | FAERS: 5 | US FAERS | |
| 18 | Thrombocytopenia | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 19 | Abdominal Pain | FAERS: 4 | US FAERS | |
| 20 | Adverse event | FAERS: 4 | US FAERS | |
| 21 | Back Pain | FAERS: 4 | US FAERS | |
| 22 | Bone pain | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 23 | Full blood count decreased | FAERS: 4 | US FAERS | |
| 24 | Influenza | FAERS: 4 | US FAERS | |
| 25 | Nasopharyngitis | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 26 | Neutropenia | FAERS: 4 | US FAERS | |
| 27 | Pericardial effusion | FAERS: 4 | US FAERS | |
| 28 | Plasma cell myeloma recurrent | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 29 | Arthralgia | FAERS: 3 | US FAERS | |
| 30 | Basal cell carcinoma | FAERS: 3 | US FAERS | |
| 31 | Blood count abnormal | FAERS: 3 | US FAERS | |
| 32 | Clostridium difficile infection | FAERS: 3 | US FAERS | |
| 33 | Device related infection | FAERS: 3 | US FAERS | |
| 34 | Joint swelling | FAERS: 3 | US FAERS | |
| 35 | Myocardial Infarction | FAERS: 3 | US FAERS | |
| 36 | Neutropenic sepsis | FAERS: 3 | US FAERS | |
| 37 | Performance status decreased | FAERS: 3 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 38 | Pulmonary Embolism | FAERS: 3 | US FAERS | |
| 39 | Weight decreased | FAERS: 3 | US FAERS | |
| 40 | Abdominal discomfort | FAERS: 2 | US FAERS | |
| 41 | Anxiety | FAERS: 2 | US FAERS | |
| 42 | Chest Pain | FAERS: 2 | US FAERS | |
| 43 | Constipation | FAERS: 2 | US FAERS | |
| 44 | Cytopenia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 45 | Dementia | FAERS: 2 | US FAERS | |
| 46 | Disability | FAERS: 2 | US FAERS | |
| 47 | Escherichia sepsis | FAERS: 2 | US FAERS | |
| 48 | Gastroenteritis | FAERS: 2 | US FAERS | |
| 49 | Gastrointestinal infection | FAERS: 2 | US FAERS | |
| 50 | General physical health deterioration | FAERS: 2 | US FAERS | |
| 51 | Headache | FAERS: 2 | US FAERS | |
| 52 | Hernia | FAERS: 2 | US FAERS | |
| 53 | Inappropriate schedule of drug administration | FAERS: 2 | US FAERS | |
| 54 | Intestinal Obstruction | FAERS: 2 | US FAERS | |
| 55 | Lethargy | FAERS: 2 | US FAERS | |
| 56 | Mallory-Weiss Syndrome | FAERS: 2 | US FAERS | |
| 57 | No adverse event | FAERS: 2 | US FAERS | |
| 58 | Pancytopenia | FAERS: 2 | US FAERS | |
| 59 | Product packaging quantity issue | FAERS: 2 | US FAERS | |
| 60 | Respiratory Failure | FAERS: 2 | US FAERS | |
| 61 | Septic Shock | FAERS: 2 | US FAERS | |
| 62 | Thrombosis | FAERS: 2 | US FAERS | |
| 63 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 64 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 65 | Amnesia | FAERS: 1 | US FAERS | |
| 66 | Angioedema | FAERS: 1 | US FAERS | |
| 67 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 68 | Blood creatinine increased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 69 | Blood lactate dehydrogenase increased | FAERS: 1 | US FAERS | |
| 70 | Blood phosphorus abnormal | FAERS: 1 | US FAERS | |
| 71 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 72 | Bone abscess | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 73 | Bradycardia | FAERS: 1 | US FAERS | |
| 74 | Bronchitis | FAERS: 1 | US FAERS | |
| 75 | Burning sensation | FAERS: 1 | US FAERS | |
| 76 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 77 | Cardiac infection | FAERS: 1 | US FAERS | |
| 78 | Cerebral vascular occlusion | FAERS: 1 | US FAERS | |
| 79 | Chest discomfort | FAERS: 1 | US FAERS | |
| 80 | Chills | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 81 | Clostridium difficile colitis | FAERS: 1 | US FAERS | |
| 82 | Colitis | FAERS: 1 | US FAERS | |
| 83 | Conjunctivitis | FAERS: 1 | US FAERS | |
| 84 | Delirium | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 85 | Diplopia | FAERS: 1 | US FAERS | |
| 86 | Discomfort | FAERS: 1 | US FAERS | |
| 87 | Disease complication | FAERS: 1 | US FAERS | |
| 88 | Diverticulitis | FAERS: 1 | US FAERS | |
| 89 | Drug administration error | FAERS: 1 | US FAERS | |
| 90 | Dysarthria | FAERS: 1 | US FAERS | |
| 91 | Dysgraphia | FAERS: 1 | US FAERS | |
| 92 | Encephalitis | FAERS: 1 | US FAERS | |
| 93 | Erythema | FAERS: 1 | US FAERS | |
| 94 | Escherichia infection | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 95 | Facial Pain | FAERS: 1 | US FAERS | |
| 96 | Febrile Neutropenia | FAERS: 1 | US FAERS | |
| 97 | Feeling Cold | FAERS: 1 | US FAERS | |
| 98 | Gastrointestinal Pain | FAERS: 1 | US FAERS | |
| 99 | Gout | FAERS: 1 | US FAERS | |
| 100 | Haematotoxicity | FAERS: 1 | US FAERS | |
| 101 | Hyperviscosity syndrome | FAERS: 1 | US FAERS | |
| 102 | Impetigo | FAERS: 1 | US FAERS | |
| 103 | Incoherent | FAERS: 1 | US FAERS | |
| 104 | Large intestinal stenosis | FAERS: 1 | US FAERS | |
| 105 | Limb discomfort | FAERS: 1 | US FAERS | |
| 106 | Loose tooth | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 107 | Lymphoplasmacytoid lymphoma/immunocytoma | FAERS: 1 | US FAERS | |
| 108 | Mechanical ventilation | FAERS: 1 | US FAERS | |
| 109 | Medical device site infection | FAERS: 1 | US FAERS | |
| 110 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 111 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 112 | Myalgia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 113 | Nerve injury | FAERS: 1 | US FAERS | |
| 114 | Neutrophil count decreased | FAERS: 1 | US FAERS | |
| 115 | Ocular Toxicity | FAERS: 1 | US FAERS | |
| 116 | Oral candidiasis | FAERS: 1 | US FAERS | |
| 117 | Osteomyelitis | FAERS: 1 | US FAERS | |
| 118 | Osteonecrosis of Jaw | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 119 | Pain | FAERS: 1 | US FAERS | |
| 120 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 121 | Plasmacytoma | FAERS: 1 | US FAERS | |
| 122 | Pneumococcal sepsis | FAERS: 1 | US FAERS | |
| 123 | Posterior reversible encephalopathy syndrome | FAERS: 1 | US FAERS | |
| 124 | Product blister packaging issue | FAERS: 1 | US FAERS | |
| 125 | Product dose omission | FAERS: 1 | US FAERS | |
| 126 | Product quality issue | FAERS: 1 | US FAERS | |
| 127 | Product use complaint | FAERS: 1 | US FAERS | |
| 128 | Retinal Degeneration | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 129 | Retinal Detachment | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 130 | Sinusitis | FAERS: 1 | US FAERS | |
| 131 | Sudden death | FAERS: 1 | US FAERS | |
| 132 | Syncope | FAERS: 1 | US FAERS | |
| 133 | Tooth Extraction | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 134 | Transplant | FAERS: 1 | US FAERS | |
| 135 | Tremor | FAERS: 1 | US FAERS | |
| 136 | Urinary tract obstruction | FAERS: 1 | US FAERS | |
| 137 | Vertebral column mass | FAERS: 1 | US FAERS | |
| 138 | nervous system disorder | FAERS: 1 | US FAERS | |
| 139 | Therapy non-responder | Canada Vigilance: 2 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.