liposomal doxorubicin
(MWWSFMDVAYGXBV-FGBJBKNOSA-N)
Structure
- SMILES
- OCC(=O)[C@@]1(O)C[C@H](OC2CC(N)C(C(O2)C)O)c2c(C1)c(O)c1c(c2O)C(=O)c2c(C1=O)cccc2OC.Cl
- Molecular Formula:
- C27H30ClNO11
- Molecular Weight:
- 579.980
- Log P:
- 1.5036
- Hydrogen Bond Acceptor:
- 12
- Hydrogen Bond Donor:
- 7
- TPSA:
- 206.07
- CAS Number(s):
- 25316-40-9; 56390-09-1
Synonym(s)
1.
liposomal doxorubicin
2.
Caelyx
3.
DOX-SL
4.
Doxil
5.
Lipodox
6.
pegylated liposomal doxorubicin
External Link(s)
| MeSH | C506643 |
| PubChem Compound | 5458238 68441416 32874 |
| CHEMBL | CHEMBL543353 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Erythema | FAERS: 31 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 2 | Back Pain | FAERS: 16 | US FAERS | |
| 3 | Flushing | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 4 | Chest discomfort | FAERS: 15 | US FAERS | |
| 5 | Malaise | FAERS: 11 | US FAERS | |
| 6 | Nausea | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 7 | Respiratory Failure | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 8 | Hypersensitivity | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 9 | Myocardial Infarction | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 10 | Skin toxicity | FAERS: 10 | US FAERS | |
| 11 | Stomatitis | FAERS: 10 | US FAERS | |
| 12 | Hypotension | FAERS: 9 | US FAERS | |
| 13 | Product use issue | FAERS: 9 | US FAERS | |
| 14 | Pruritus | FAERS: 9 | US FAERS | |
| 15 | Skin reaction | FAERS: 9 | US FAERS | |
| 16 | Vomiting | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 17 | Pneumonia | FAERS: 8 | US FAERS | |
| 18 | Product use in unapproved indication | FAERS: 8 | US FAERS | |
| 19 | Pulmonary Embolism | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 20 | Toxic Epidermal Necrolysis | FAERS: 8 | US FAERS | |
| 21 | Abdominal Pain | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 22 | Burning sensation | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 23 | Disease Progression | FAERS: 7 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 24 | Skin necrosis | FAERS: 7 | US FAERS | |
| 25 | Neutropenia | FAERS: 6 | US FAERS | |
| 26 | Pancytopenia | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 27 | Tremor | FAERS: 6 | US FAERS | |
| 28 | Angina Pectoris | FAERS: 5 | US FAERS | |
| 29 | Bradycardia | FAERS: 5 | US FAERS | |
| 30 | Chills | FAERS: 5 | US FAERS | |
| 31 | Cyanosis | FAERS: 5 | US FAERS | |
| 32 | Dermatitis | FAERS: 5 | US FAERS | |
| 33 | Intestinal Obstruction | FAERS: 5 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 34 | Overdose | FAERS: 5 | US FAERS | |
| 35 | Skin Ulcer | FAERS: 5 | US FAERS | |
| 36 | Tachycardia | FAERS: 5 | US FAERS | |
| 37 | Visual Impairment | FAERS: 5 | US FAERS | |
| 38 | Drug toxicity | FAERS: 4 | US FAERS | |
| 39 | Headache | FAERS: 4 | US FAERS | |
| 40 | Lymphopenia | FAERS: 4 | US FAERS | |
| 41 | Malignant neoplasm progression | FAERS: 4 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 42 | Pain | FAERS: 4 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 43 | Pulmonary Fibrosis | FAERS: 4 | US FAERS | |
| 44 | Acute myocardial infarction | FAERS: 3 | US FAERS | |
| 45 | Aphthous Stomatitis | FAERS: 3 | US FAERS | |
| 46 | Asthenia | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 47 | Chest Pain | FAERS: 3 | US FAERS | |
| 48 | Cold sweat | FAERS: 3 | US FAERS | |
| 49 | Constipation | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 50 | Deep Vein Thrombosis | FAERS: 3 | US FAERS | |
| 51 | Discomfort | FAERS: 3 | US FAERS | |
| 52 | Dizziness | FAERS: 3 | US FAERS | |
| 53 | Drug ineffective | FAERS: 3 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 54 | Febrile Neutropenia | FAERS: 3 | US FAERS | |
| 55 | Haematotoxicity | FAERS: 3 | US FAERS | |
| 56 | Myalgia | FAERS: 3 | US FAERS | |
| 57 | Respiratory arrest | FAERS: 3 | US FAERS | |
| 58 | Respiratory distress | FAERS: 3 | US FAERS | |
| 59 | Skin lesion | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 60 | Syncope | FAERS: 3 | US FAERS | |
| 61 | Thrombocytopenia | FAERS: 3 | US FAERS | |
| 62 | Urticaria | FAERS: 3 | US FAERS | |
| 63 | Vasculitis | FAERS: 3 | US FAERS | |
| 64 | Alveolitis | FAERS: 2 | US FAERS | |
| 65 | Angioedema | FAERS: 2 | US FAERS | |
| 66 | Back disorder | FAERS: 2 | US FAERS | |
| 67 | Blood creatinine decreased | FAERS: 2 | US FAERS | |
| 68 | Blood pressure immeasurable | FAERS: 2 | US FAERS | |
| 69 | Bone pain | FAERS: 2 | US FAERS | |
| 70 | Bronchiolitis | FAERS: 2 | US FAERS | |
| 71 | Bronchospasm | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 72 | Cancer Pain | FAERS: 2 | US FAERS | |
| 73 | Cardiac Arrest | FAERS: 2 | US FAERS | |
| 74 | Cerebral disorder | FAERS: 2 | US FAERS | |
| 75 | Ejection Fraction Decreased | FAERS: 2 | US FAERS | |
| 76 | Epidermolysis | FAERS: 2 | US FAERS | |
| 77 | Epilepsy | FAERS: 2 | US FAERS | |
| 78 | General physical health deterioration | FAERS: 2 | US FAERS | |
| 79 | Genital infection fungal | FAERS: 2 | US FAERS | |
| 80 | Hyperpyrexia | FAERS: 2 | US FAERS | |
| 81 | Ileus | FAERS: 2 | US FAERS | |
| 82 | Incorrect route of drug administration | FAERS: 2 | US FAERS | |
| 83 | Infarction | FAERS: 2 | US FAERS | |
| 84 | Inflammation | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 85 | Infusion site reaction | FAERS: 2 | US FAERS | |
| 86 | Leukocytoclastic vasculitis | FAERS: 2 | US FAERS | |
| 87 | Leukopenia | FAERS: 2 | US FAERS | |
| 88 | Lymphoma | FAERS: 2 | US FAERS | |
| 89 | Nephrotic Syndrome | FAERS: 2 | US FAERS | |
| 90 | Petechiae | FAERS: 2 | US FAERS | |
| 91 | Pneumocystis jiroveci pneumonia | FAERS: 2 | US FAERS | |
| 92 | Pneumonitis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 93 | Poor peripheral circulation | FAERS: 2 | US FAERS | |
| 94 | Portal Vein Thrombosis | FAERS: 2 | US FAERS | |
| 95 | Presyncope | FAERS: 2 | US FAERS | |
| 96 | Product quality issue | FAERS: 2 | US FAERS | |
| 97 | Proteinuria | FAERS: 2 | US FAERS | |
| 98 | Rash erythematous | FAERS: 2 | US FAERS | |
| 99 | Rash follicular | FAERS: 2 | US FAERS | |
| 100 | Shock | FAERS: 2 | US FAERS | |
| 101 | Sinus Tachycardia | FAERS: 2 | US FAERS | |
| 102 | Thermal burn | FAERS: 2 | US FAERS | |
| 103 | Transaminases increased | FAERS: 2 | US FAERS | |
| 104 | Unevaluable event | FAERS: 2 | US FAERS | |
| 105 | Unresponsive to stimuli | FAERS: 2 | US FAERS | |
| 106 | Ventricular Fibrillation | FAERS: 2 | US FAERS | |
| 107 | Weight decreased | FAERS: 2 | US FAERS | |
| 108 | Wheezing | FAERS: 2 | US FAERS | |
| 109 | Acute kidney injury | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 110 | Acute psychosis | FAERS: 1 | US FAERS | |
| 111 | Adverse event | FAERS: 1 | US FAERS | |
| 112 | Alanine Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 113 | Alopecia | FAERS: 1 | US FAERS | |
| 114 | Anal inflammation | FAERS: 1 | US FAERS | |
| 115 | Arthralgia | FAERS: 1 | US FAERS | |
| 116 | Ascites | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 117 | Aspartate Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 118 | Asthma | FAERS: 1 | US FAERS | |
| 119 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 120 | Blood magnesium decreased | FAERS: 1 | US FAERS | |
| 121 | Blood potassium abnormal | FAERS: 1 | US FAERS | |
| 122 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 123 | Bone marrow depression | FAERS: 1 | US FAERS | |
| 124 | Bronchopneumonia | FAERS: 1 | US FAERS | |
| 125 | CD4 Lymphocytes Decreased | FAERS: 1 | US FAERS | |
| 126 | Cellulitis | FAERS: 1 | US FAERS | |
| 127 | Cerebellar Ataxia | FAERS: 1 | US FAERS | |
| 128 | Choking sensation | FAERS: 1 | US FAERS | |
| 129 | Cholangitis | FAERS: 1 | US FAERS | |
| 130 | Cholestasis | FAERS: 1 | US FAERS | |
| 131 | Colitis | FAERS: 1 | US FAERS | |
| 132 | Completed Suicide | FAERS: 1 | US FAERS | |
| 133 | Conjunctivitis | FAERS: 1 | US FAERS | |
| 134 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 135 | Dermatomyositis | FAERS: 1 | US FAERS | |
| 136 | Diverticulitis | FAERS: 1 | US FAERS | |
| 137 | Dyspepsia | FAERS: 1 | US FAERS | |
| 138 | Eczema | FAERS: 1 | US FAERS | |
| 139 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 140 | Erythema Multiforme | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 141 | Extravasation | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 142 | Extremity necrosis | FAERS: 1 | US FAERS | |
| 143 | Fatigue | FAERS: 1 | US FAERS | |
| 144 | Fibromatosis | FAERS: 1 | US FAERS | |
| 145 | Folliculitis | FAERS: 1 | US FAERS | |
| 146 | Gamma-Glutamyltransferase Increased | FAERS: 1 | US FAERS | |
| 147 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 148 | Hemiplegia | FAERS: 1 | US FAERS | |
| 149 | Hepatitis C | FAERS: 1 | US FAERS | |
| 150 | Hepatotoxicity | FAERS: 1 | US FAERS | |
| 151 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 152 | Hypertransaminasaemia | FAERS: 1 | US FAERS | |
| 153 | Hypoxia | FAERS: 1 | US FAERS | |
| 154 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 155 | Incoherent | FAERS: 1 | US FAERS | |
| 156 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 157 | Incorrect drug administration duration | FAERS: 1 | US FAERS | |
| 158 | Infection | FAERS: 1 | US FAERS | |
| 159 | Intestinal Fistula | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 160 | Intestinal Perforation | FAERS: 1 | US FAERS | |
| 161 | Laryngitis | FAERS: 1 | US FAERS | |
| 162 | Lethargy | FAERS: 1 | US FAERS | |
| 163 | Lichen Planus | FAERS: 1 | US FAERS | |
| 164 | Lymphocyte count increased | FAERS: 1 | US FAERS | |
| 165 | Mucocutaneous rash | FAERS: 1 | US FAERS | |
| 166 | Nerve injury | FAERS: 1 | US FAERS | |
| 167 | Onychomycosis | FAERS: 1 | US FAERS | |
| 168 | Oral pain | FAERS: 1 | US FAERS | |
| 169 | Oral pruritus | FAERS: 1 | US FAERS | |
| 170 | Palpitations | FAERS: 1 | US FAERS | |
| 171 | Paraneoplastic dermatomyositis | FAERS: 1 | US FAERS | |
| 172 | Pelvic Pain | FAERS: 1 | US FAERS | |
| 173 | Pemphigus | FAERS: 1 | US FAERS | |
| 174 | Phlebitis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 175 | Product contamination microbial | FAERS: 1 | US FAERS | |
| 176 | Purulence | FAERS: 1 | US FAERS | |
| 177 | Retching | FAERS: 1 | US FAERS | |
| 178 | Sense of oppression | FAERS: 1 | US FAERS | |
| 179 | Sepsis | FAERS: 1 | US FAERS | |
| 180 | Septic Shock | FAERS: 1 | US FAERS | |
| 181 | Skin Erosion | FAERS: 1 | US FAERS | |
| 182 | Stevens-Johnson Syndrome | FAERS: 1 | US FAERS | |
| 183 | Subileus | FAERS: 1 | US FAERS | |
| 184 | Swelling | FAERS: 1 | US FAERS | |
| 185 | Throat irritation | FAERS: 1 | US FAERS | |
| 186 | Toxicity to various agents | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 187 | Ulcer | FAERS: 1 | US FAERS | |
| 188 | Visual acuity reduced transiently | FAERS: 1 | US FAERS | |
| 189 | Vulvitis | FAERS: 1 | US FAERS | |
| 190 | Vulvovaginal burning sensation | FAERS: 1 | US FAERS | |
| 191 | White blood cell count decreased | FAERS: 1 | US FAERS | |
| 192 | Wrong technique in product usage process | FAERS: 1 | US FAERS | |
| 193 | jaundice | FAERS: 1 | US FAERS | |
| 194 | Anaphylactic shock | Canada Vigilance: 1 | Canada Vigilance | |
| 195 | Biopsy skin abnormal | Canada Vigilance: 1 | Canada Vigilance | |
| 196 | Dehydration | Canada Vigilance: 1 | Canada Vigilance | |
| 197 | Drug resistance | Canada Vigilance: 1 | Canada Vigilance | |
| 198 | Gait inability | Canada Vigilance: 1 | Canada Vigilance | |
| 199 | Injection Site Reaction | Canada Vigilance: 1 | Canada Vigilance | |
| 200 | Metastasis | Canada Vigilance: 1 | Canada Vigilance | |
| 201 | Palmar erythema | Canada Vigilance: 1 | Canada Vigilance | |
| 202 | Periorbital swelling | Canada Vigilance: 1 | Canada Vigilance | |
| 203 | Peripheral swelling | Canada Vigilance: 2 | Canada Vigilance | |
| 204 | Pharyngeal swelling | Canada Vigilance: 1 | Canada Vigilance | |
| 205 | Tinea Pedis | Canada Vigilance: 1 | Canada Vigilance | |
| 206 | nervous system disorder | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.