betamethasone acetate phosphate
(MQRFYYBWKRACSJ-UHFFFAOYSA-N)
Structure
- SMILES
- O=C1C=CC2(C(=C1)CCC1C2(F)C(O)CC2(C1CC(C2(O)C(=O)COP(=O)(O)O)C)C)C.[Na+]
- Molecular Formula:
- C22H30FNaO8P+
- Molecular Weight:
- 495.431
- Log P:
- 2.0127
- Hydrogen Bond Acceptor:
- 8
- Hydrogen Bond Donor:
- 4
- TPSA:
- 151.17
- CAS Number(s):
- N/A
Synonym(s)
1.
betamethasone acetate phosphate
2.
Celestone Chronodose
3.
Celestone Soluspan
4.
Celestone-R
5.
betamethasone acetate phosphate, disodium salt
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Maternal exposure during pregnancy | FAERS: 28 | US FAERS | |
| 2 | No adverse event | FAERS: 17 | US FAERS | |
| 3 | Expired product administered | FAERS: 7 | US FAERS | |
| 4 | Dizziness | FAERS: 6 | US FAERS | |
| 5 | Syncope | FAERS: 6 | US FAERS | |
| 6 | Anaphylactic shock | FAERS: 5 | US FAERS | |
| 7 | Inadequate aseptic technique in use of product | FAERS: 5 | US FAERS | |
| 8 | Arachnoiditis | FAERS: 3 | US FAERS | |
| 9 | Drug ineffective | FAERS: 3 | US FAERS | |
| 10 | Hypersensitivity | FAERS: 3 | US FAERS | |
| 11 | Incorrect product storage | FAERS: 3 | US FAERS | |
| 12 | Incorrect route of drug administration | FAERS: 3 | US FAERS | |
| 13 | Injection site pain | FAERS: 3 | US FAERS | |
| 14 | Medication Error | FAERS: 3 | US FAERS | |
| 15 | Pain | FAERS: 3 | US FAERS | |
| 16 | Palpitations | FAERS: 3 | US FAERS | |
| 17 | Product use in unapproved indication | FAERS: 3 | US FAERS | |
| 18 | Product use issue | FAERS: 3 | US FAERS | |
| 19 | Anxiety | FAERS: 2 | US FAERS | |
| 20 | Blood glucose increased | FAERS: 2 | US FAERS | |
| 21 | Burning sensation | FAERS: 2 | US FAERS | |
| 22 | Complication of delivery | FAERS: 2 | US FAERS | |
| 23 | Drug exposure during pregnancy | FAERS: 2 | US FAERS | |
| 24 | Erythema toxicum neonatorum | FAERS: 2 | US FAERS | |
| 25 | Feeling abnormal | FAERS: 2 | US FAERS | |
| 26 | Incorrect dose administered | FAERS: 2 | US FAERS | |
| 27 | Injection site necrosis | FAERS: 2 | US FAERS | |
| 28 | Malaise | FAERS: 2 | US FAERS | |
| 29 | Paraplegia | FAERS: 2 | US FAERS | |
| 30 | Pruritus | FAERS: 2 | US FAERS | |
| 31 | Wound infection staphylococcal | FAERS: 2 | US FAERS | |
| 32 | nervous system disorder | FAERS: 2 | US FAERS | |
| 33 | Adverse event | FAERS: 1 | US FAERS | |
| 34 | Alopecia | FAERS: 1 | US FAERS | |
| 35 | Amnesia | FAERS: 1 | US FAERS | |
| 36 | Anger | FAERS: 1 | US FAERS | |
| 37 | Application site pruritus | FAERS: 1 | US FAERS | |
| 38 | Breast Feeding | FAERS: 1 | US FAERS | |
| 39 | Chest discomfort | FAERS: 1 | US FAERS | |
| 40 | Conversion disorder | FAERS: 1 | US FAERS | |
| 41 | Dehydration | FAERS: 1 | US FAERS | |
| 42 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 43 | Diplegia | FAERS: 1 | US FAERS | |
| 44 | Dry skin | FAERS: 1 | US FAERS | |
| 45 | Dysarthria | FAERS: 1 | US FAERS | |
| 46 | Dyspepsia | FAERS: 1 | US FAERS | |
| 47 | Erectile dysfunction | FAERS: 1 | US FAERS | |
| 48 | Erythema | FAERS: 1 | US FAERS | |
| 49 | Exposure via breast milk | FAERS: 1 | US FAERS | |
| 50 | Eyelid margin crusting | FAERS: 1 | US FAERS | |
| 51 | Fatigue | FAERS: 1 | US FAERS | |
| 52 | Gastric pH decreased | FAERS: 1 | US FAERS | |
| 53 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 54 | Injection Site Reaction | FAERS: 1 | US FAERS | |
| 55 | Insulin Resistance | FAERS: 1 | US FAERS | |
| 56 | Intervertebral disc disorder | FAERS: 1 | US FAERS | |
| 57 | Laceration | FAERS: 1 | US FAERS | |
| 58 | Lipohypertrophy | FAERS: 1 | US FAERS | |
| 59 | Lymphocyte count increased | FAERS: 1 | US FAERS | |
| 60 | Malignant Hypertension | FAERS: 1 | US FAERS | |
| 61 | Memory impairment | FAERS: 1 | US FAERS | |
| 62 | Mental impairment | FAERS: 1 | US FAERS | |
| 63 | Musculoskeletal discomfort | FAERS: 1 | US FAERS | |
| 64 | Nausea | FAERS: 1 | US FAERS | |
| 65 | Necrosis | FAERS: 1 | US FAERS | |
| 66 | Neuralgia | FAERS: 1 | US FAERS | |
| 67 | Neuritis | FAERS: 1 | US FAERS | |
| 68 | Neurogenic Bowel | FAERS: 1 | US FAERS | |
| 69 | Neutropenia | FAERS: 1 | US FAERS | |
| 70 | No adverse effect | FAERS: 1 | US FAERS | |
| 71 | Oral mucosal exfoliation | FAERS: 1 | US FAERS | |
| 72 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 73 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 74 | Presyncope | FAERS: 1 | US FAERS | |
| 75 | Product expiration date issue | FAERS: 1 | US FAERS | |
| 76 | Product lot number issue | FAERS: 1 | US FAERS | |
| 77 | Product quality issue | FAERS: 1 | US FAERS | |
| 78 | Quadriplegia | FAERS: 1 | US FAERS | |
| 79 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 80 | Regurgitation | FAERS: 1 | US FAERS | |
| 81 | Rubber sensitivity | FAERS: 1 | US FAERS | |
| 82 | Scab | FAERS: 1 | US FAERS | |
| 83 | Sepsis | FAERS: 1 | US FAERS | |
| 84 | Shock | FAERS: 1 | US FAERS | |
| 85 | Suicide attempt | FAERS: 1 | US FAERS | |
| 86 | Swelling | FAERS: 1 | US FAERS | |
| 87 | Tachycardia | FAERS: 1 | US FAERS | |
| 88 | Thrombosis | FAERS: 1 | US FAERS | |
| 89 | Tremor | FAERS: 1 | US FAERS | |
| 90 | Urticaria | FAERS: 1 | US FAERS | |
| 91 | Vertigo | FAERS: 1 | US FAERS | |
| 92 | Vomiting | FAERS: 1 | US FAERS | |
| 93 | treatment failure | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.