regadenoson
(LZPZPHGJDAGEJZ-AKAIJSEGSA-N)
Structure
- SMILES
- OC[C@H]1O[C@H]([C@@H]([C@@H]1O)O)n1cnc2c1nc(nc2N)n1ncc(c1)C(=O)NC
- Type(s)
- Approved; Investigational
- ATC code(s)
- C01EB21
- Molecular Formula:
- C15H18N8O5
- Molecular Weight:
- 390.354
- Log P:
- -1.4626
- Hydrogen Bond Acceptor:
- 13
- Hydrogen Bond Donor:
- 5
- TPSA:
- 186.46
- CAS Number(s):
- 313348-27-5
Synonym(s)
1.
regadenoson
2.
CVT 3146
3.
CVT-3146
4.
CVT3146
5.
Lexiscan
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Nausea | FAERS: 304 | SIDER US FAERS | |
| 2 | Injection site extravasation | FAERS: 302 | US FAERS | |
| 3 | Vomiting | FAERS: 265 | SIDER US FAERS | |
| 4 | Headache | FAERS: 199 | SIDER US FAERS | |
| 5 | Hypotension | FAERS: 175 | SIDER US FAERS | |
| 6 | Cardiac Arrest | FAERS: 161 | SIDER US FAERS | |
| 7 | Dizziness | FAERS: 130 | SIDER US FAERS | |
| 8 | Chest Pain | FAERS: 116 | SIDER US FAERS | |
| 9 | Bradycardia | FAERS: 98 | SIDER US FAERS | |
| 10 | Tremor | FAERS: 80 | SIDER US FAERS | |
| 11 | Unresponsive to stimuli | FAERS: 71 | US FAERS | |
| 12 | Injection site pain | FAERS: 68 | SIDER US FAERS | |
| 13 | Malaise | FAERS: 68 | SIDER US FAERS | |
| 14 | Syncope | FAERS: 61 | SIDER US FAERS | |
| 15 | Chest discomfort | FAERS: 59 | SIDER US FAERS | |
| 16 | Infusion Site Extravasation | FAERS: 54 | US FAERS | |
| 17 | Back Pain | FAERS: 50 | US FAERS | |
| 18 | Atrioventricular Block | FAERS: 48 | SIDER US FAERS | |
| 19 | Extravasation | FAERS: 47 | US FAERS | |
| 20 | Abdominal discomfort | FAERS: 46 | SIDER US FAERS | |
| 21 | Myocardial Infarction | FAERS: 44 | SIDER US FAERS | |
| 22 | Feeling abnormal | FAERS: 42 | SIDER US FAERS | |
| 23 | Incorrect drug administration duration | FAERS: 41 | US FAERS | |
| 24 | Presyncope | FAERS: 40 | US FAERS | |
| 25 | Cerebrovascular accident | FAERS: 38 | SIDER US FAERS | |
| 26 | Flushing | FAERS: 37 | SIDER US FAERS | |
| 27 | Myalgia | FAERS: 36 | SIDER US FAERS | |
| 28 | Abdominal Pain | FAERS: 30 | SIDER US FAERS | |
| 29 | Wheezing | FAERS: 30 | SIDER US FAERS | |
| 30 | Asthenia | FAERS: 28 | SIDER US FAERS | |
| 31 | Pain | FAERS: 26 | SIDER US FAERS | |
| 32 | Fatigue | FAERS: 25 | US FAERS | |
| 33 | Tachycardia | FAERS: 24 | SIDER US FAERS | |
| 34 | Atrial Fibrillation | FAERS: 23 | SIDER US FAERS | |
| 35 | Bronchospasm | FAERS: 22 | SIDER US FAERS | |
| 36 | Drug administration error | FAERS: 22 | US FAERS | |
| 37 | Incorrect product administration duration | FAERS: 21 | US FAERS | |
| 38 | Anxiety | FAERS: 20 | SIDER US FAERS | |
| 39 | Chills | FAERS: 20 | US FAERS | |
| 40 | Infusion site pain | FAERS: 20 | US FAERS | |
| 41 | Hypersensitivity | FAERS: 19 | SIDER US FAERS | |
| 42 | Wrong technique in product usage process | FAERS: 19 | US FAERS | |
| 43 | Urticaria | FAERS: 18 | SIDER US FAERS | |
| 44 | Arthralgia | FAERS: 17 | SIDER US FAERS | |
| 45 | Burning sensation | FAERS: 17 | US FAERS | |
| 46 | Respiratory arrest | FAERS: 17 | SIDER US FAERS | |
| 47 | Pallor | FAERS: 16 | SIDER US FAERS | |
| 48 | Adverse event | FAERS: 15 | US FAERS | |
| 49 | Aphasia | FAERS: 15 | US FAERS | |
| 50 | Supraventricular tachycardia | FAERS: 15 | US FAERS | |
| 51 | Wrong technique in drug usage process | FAERS: 15 | US FAERS | |
| 52 | Electrocardiogram abnormal | FAERS: 14 | US FAERS | |
| 53 | Product quality issue | FAERS: 14 | US FAERS | |
| 54 | Retching | FAERS: 14 | US FAERS | |
| 55 | Acute myocardial infarction | FAERS: 12 | US FAERS | |
| 56 | Cold sweat | FAERS: 12 | US FAERS | |
| 57 | Erythema | FAERS: 12 | SIDER US FAERS | |
| 58 | Musculoskeletal Pain | FAERS: 12 | SIDER US FAERS | |
| 59 | Incorrect dose administered | FAERS: 10 | US FAERS | |
| 60 | Injection site erythema | FAERS: 10 | US FAERS | |
| 61 | Mental status changes | FAERS: 10 | US FAERS | |
| 62 | Respiratory distress | FAERS: 10 | SIDER US FAERS | |
| 63 | Seizure like phenomena | FAERS: 10 | US FAERS | |
| 64 | Crying | FAERS: 9 | US FAERS | |
| 65 | Depressed Level of Consciousness | FAERS: 9 | SIDER US FAERS | |
| 66 | Discomfort | FAERS: 9 | SIDER US FAERS | |
| 67 | Electrocardiogram change | FAERS: 9 | US FAERS | |
| 68 | Incorrect product storage | FAERS: 9 | US FAERS | |
| 69 | Nervousness | FAERS: 9 | US FAERS | |
| 70 | Pruritus | FAERS: 9 | US FAERS | |
| 71 | Feeling Cold | FAERS: 8 | US FAERS | |
| 72 | Limb discomfort | FAERS: 8 | US FAERS | |
| 73 | Palpitations | FAERS: 8 | SIDER US FAERS | |
| 74 | Syringe issue | FAERS: 8 | US FAERS | |
| 75 | Ventricular Fibrillation | FAERS: 8 | US FAERS | |
| 76 | Musculoskeletal stiffness | FAERS: 7 | US FAERS | |
| 77 | Neck Pain | FAERS: 7 | US FAERS | |
| 78 | Swelling | FAERS: 7 | US FAERS | |
| 79 | Urinary Incontinence | FAERS: 7 | US FAERS | |
| 80 | Visual Impairment | FAERS: 7 | US FAERS | |
| 81 | Accidental exposure to product | FAERS: 6 | US FAERS | |
| 82 | Amnesia | FAERS: 6 | US FAERS | |
| 83 | Asthma | FAERS: 6 | SIDER US FAERS | |
| 84 | Coronary Artery Disease | FAERS: 6 | US FAERS | |
| 85 | Drug ineffective | FAERS: 6 | US FAERS | |
| 86 | Electrocardiogram ST segment abnormal | FAERS: 6 | US FAERS | |
| 87 | Hemiparesis | FAERS: 6 | US FAERS | |
| 88 | Inappropriate schedule of drug administration | FAERS: 6 | US FAERS | |
| 89 | Lethargy | FAERS: 6 | US FAERS | |
| 90 | Sinus bradycardia | FAERS: 6 | SIDER US FAERS | |
| 91 | Somnolence | FAERS: 6 | SIDER US FAERS | |
| 92 | Administration site extravasation | FAERS: 5 | US FAERS | |
| 93 | Circumstance or information capable of leading to medication error | FAERS: 5 | US FAERS | |
| 94 | Device malfunction | FAERS: 5 | US FAERS | |
| 95 | Disorientation | FAERS: 5 | US FAERS | |
| 96 | Dysarthria | FAERS: 5 | US FAERS | |
| 97 | Dysgeusia | FAERS: 5 | SIDER US FAERS | |
| 98 | Emotional disorder | FAERS: 5 | US FAERS | |
| 99 | Incoherent | FAERS: 5 | US FAERS | |
| 100 | Incontinence | FAERS: 5 | US FAERS | |
| 101 | Infusion site swelling | FAERS: 5 | US FAERS | |
| 102 | Respiratory Depression | FAERS: 5 | US FAERS | |
| 103 | Restlessness | FAERS: 5 | US FAERS | |
| 104 | Angioedema | FAERS: 4 | SIDER US FAERS | |
| 105 | Atrial Flutter | FAERS: 4 | SIDER US FAERS | |
| 106 | Device Failure | FAERS: 4 | US FAERS | |
| 107 | False negative investigation result | FAERS: 4 | US FAERS | |
| 108 | Feeling jittery | FAERS: 4 | US FAERS | |
| 109 | Gait inability | FAERS: 4 | US FAERS | |
| 110 | Head discomfort | FAERS: 4 | US FAERS | |
| 111 | Hemiplegia | FAERS: 4 | US FAERS | |
| 112 | Incorrect route of drug administration | FAERS: 4 | US FAERS | |
| 113 | Injection site discomfort | FAERS: 4 | US FAERS | |
| 114 | Peripheral swelling | FAERS: 4 | US FAERS | |
| 115 | Product use issue | FAERS: 4 | US FAERS | |
| 116 | Abasia | FAERS: 3 | US FAERS | |
| 117 | Altered state of consciousness | FAERS: 3 | SIDER US FAERS | |
| 118 | Angina Pectoris | FAERS: 3 | SIDER US FAERS | |
| 119 | Blood glucose decreased | FAERS: 3 | US FAERS | |
| 120 | Blood glucose increased | FAERS: 3 | US FAERS | |
| 121 | Blood pressure immeasurable | FAERS: 3 | US FAERS | |
| 122 | Bowel movement irregularity | FAERS: 3 | US FAERS | |
| 123 | Choking | FAERS: 3 | US FAERS | |
| 124 | Facial paralysis | FAERS: 3 | US FAERS | |
| 125 | Hyperventilation | FAERS: 3 | US FAERS | |
| 126 | Hypokinesia | FAERS: 3 | US FAERS | |
| 127 | Injection site bruising | FAERS: 3 | US FAERS | |
| 128 | Injection site mass | FAERS: 3 | US FAERS | |
| 129 | Joint stiffness | FAERS: 3 | US FAERS | |
| 130 | Lip swelling | FAERS: 3 | US FAERS | |
| 131 | Medical device complication | FAERS: 3 | US FAERS | |
| 132 | Medication Error | FAERS: 3 | US FAERS | |
| 133 | Mydriasis | FAERS: 3 | US FAERS | |
| 134 | No adverse event | FAERS: 3 | US FAERS | |
| 135 | Overdose | FAERS: 3 | US FAERS | |
| 136 | Product use in unapproved indication | FAERS: 3 | US FAERS | |
| 137 | Stress | FAERS: 3 | US FAERS | |
| 138 | Therapeutic response delayed | FAERS: 3 | US FAERS | |
| 139 | Throat irritation | FAERS: 3 | SIDER US FAERS | |
| 140 | Troponin increased | FAERS: 3 | US FAERS | |
| 141 | Unevaluable event | FAERS: 3 | US FAERS | |
| 142 | Abdominal symptom | FAERS: 2 | US FAERS | |
| 143 | Acute Coronary Syndrome | FAERS: 2 | SIDER US FAERS | |
| 144 | Administration site swelling | FAERS: 2 | US FAERS | |
| 145 | Agitation | FAERS: 2 | US FAERS | |
| 146 | Alopecia | FAERS: 2 | US FAERS | |
| 147 | Aneurysm | FAERS: 2 | US FAERS | |
| 148 | Blood glucose abnormal | FAERS: 2 | US FAERS | |
| 149 | Blood pressure fluctuation | FAERS: 2 | US FAERS | |
| 150 | Bone pain | FAERS: 2 | US FAERS | |
| 151 | Catatonia | FAERS: 2 | US FAERS | |
| 152 | Choking sensation | FAERS: 2 | US FAERS | |
| 153 | Contrast media reaction | FAERS: 2 | US FAERS | |
| 154 | Deep Vein Thrombosis | FAERS: 2 | US FAERS | |
| 155 | Dehydration | FAERS: 2 | US FAERS | |
| 156 | Dyspepsia | FAERS: 2 | US FAERS | |
| 157 | Dysphonia | FAERS: 2 | US FAERS | |
| 158 | Ejection Fraction Decreased | FAERS: 2 | US FAERS | |
| 159 | Electrocardiogram ST-T change | FAERS: 2 | US FAERS | |
| 160 | Expired product administered | FAERS: 2 | US FAERS | |
| 161 | Eye irritation | FAERS: 2 | US FAERS | |
| 162 | Fasciotomy | FAERS: 2 | US FAERS | |
| 163 | Flatulence | FAERS: 2 | US FAERS | |
| 164 | Foaming at mouth | FAERS: 2 | US FAERS | |
| 165 | Immobile | FAERS: 2 | US FAERS | |
| 166 | Impaired driving ability | FAERS: 2 | US FAERS | |
| 167 | Inappropriate affect | FAERS: 2 | US FAERS | |
| 168 | Incorrect drug administration rate | FAERS: 2 | US FAERS | |
| 169 | Infusion site erythema | FAERS: 2 | US FAERS | |
| 170 | Injection site inflammation | FAERS: 2 | US FAERS | |
| 171 | Injection site irritation | FAERS: 2 | US FAERS | |
| 172 | Intercepted medication error | FAERS: 2 | US FAERS | |
| 173 | Joint swelling | FAERS: 2 | US FAERS | |
| 174 | Moaning | FAERS: 2 | US FAERS | |
| 175 | Muscle tightness | FAERS: 2 | US FAERS | |
| 176 | Nasopharyngitis | FAERS: 2 | US FAERS | |
| 177 | Pelvic Pain | FAERS: 2 | US FAERS | |
| 178 | Physical product label issue | FAERS: 2 | US FAERS | |
| 179 | Pneumonia | FAERS: 2 | US FAERS | |
| 180 | Post procedural complication | FAERS: 2 | US FAERS | |
| 181 | Procedural complication | FAERS: 2 | US FAERS | |
| 182 | Product packaging quantity issue | FAERS: 2 | US FAERS | |
| 183 | Product storage error | FAERS: 2 | US FAERS | |
| 184 | Psychogenic seizure | FAERS: 2 | US FAERS | |
| 185 | Rash erythematous | FAERS: 2 | US FAERS | |
| 186 | Regurgitation | FAERS: 2 | US FAERS | |
| 187 | Scan abnormal | FAERS: 2 | US FAERS | |
| 188 | Secretion discharge | FAERS: 2 | US FAERS | |
| 189 | Sinus Tachycardia | FAERS: 2 | US FAERS | |
| 190 | Sneezing | FAERS: 2 | US FAERS | |
| 191 | Vertigo | FAERS: 2 | US FAERS | |
| 192 | Viral upper respiratory tract infection | FAERS: 2 | US FAERS | |
| 193 | Weight decreased | FAERS: 2 | US FAERS | |
| 194 | Yawning | FAERS: 2 | US FAERS | |
| 195 | nervous system disorder | FAERS: 2 | SIDER US FAERS | |
| 196 | Accidental overdose | FAERS: 1 | US FAERS | |
| 197 | Accidental underdose | FAERS: 1 | US FAERS | |
| 198 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 199 | Amphetamines positive | FAERS: 1 | US FAERS | |
| 200 | Amphetamines | FAERS: 1 | US FAERS | |
| 201 | Anaphylactic shock | FAERS: 1 | SIDER US FAERS | |
| 202 | Bedridden | FAERS: 1 | US FAERS | |
| 203 | Blepharospasm | FAERS: 1 | US FAERS | |
| 204 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 205 | Blood urine present | FAERS: 1 | US FAERS | |
| 206 | Bruxism | FAERS: 1 | US FAERS | |
| 207 | Carotid pulse decreased | FAERS: 1 | US FAERS | |
| 208 | Cellulitis | FAERS: 1 | US FAERS | |
| 209 | Central pain syndrome | FAERS: 1 | US FAERS | |
| 210 | Cerebral Infarction | FAERS: 1 | US FAERS | |
| 211 | Chemical injury | FAERS: 1 | US FAERS | |
| 212 | Cholelithiasis | FAERS: 1 | US FAERS | |
| 213 | Circumstance or information capable of leading to device use error | FAERS: 1 | US FAERS | |
| 214 | Complication associated with device | FAERS: 1 | US FAERS | |
| 215 | Contrast media allergy | FAERS: 1 | US FAERS | |
| 216 | Conversion disorder | FAERS: 1 | US FAERS | |
| 217 | Critical Illness | FAERS: 1 | US FAERS | |
| 218 | Cyanosis | FAERS: 1 | US FAERS | |
| 219 | Deafness | FAERS: 1 | US FAERS | |
| 220 | Delirium | FAERS: 1 | US FAERS | |
| 221 | Dementia | FAERS: 1 | US FAERS | |
| 222 | Device component issue | FAERS: 1 | US FAERS | |
| 223 | Device dislocation | FAERS: 1 | US FAERS | |
| 224 | Device infusion issue | FAERS: 1 | US FAERS | |
| 225 | Device occlusion | FAERS: 1 | US FAERS | |
| 226 | Diplegia | FAERS: 1 | US FAERS | |
| 227 | Diplopia | FAERS: 1 | US FAERS | |
| 228 | Drooling | FAERS: 1 | US FAERS | |
| 229 | Drug effective for unapproved indication | FAERS: 1 | US FAERS | |
| 230 | Dysphemia | FAERS: 1 | US FAERS | |
| 231 | Dystonia | FAERS: 1 | US FAERS | |
| 232 | Electrocardiogram QRS complex | FAERS: 1 | US FAERS | |
| 233 | Electrocardiogram ST-T segment depression | FAERS: 1 | US FAERS | |
| 234 | Emotional distress | FAERS: 1 | US FAERS | |
| 235 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 236 | Epiglottitis | FAERS: 1 | US FAERS | |
| 237 | Erectile dysfunction | FAERS: 1 | US FAERS | |
| 238 | Euphoric mood | FAERS: 1 | US FAERS | |
| 239 | Eyelid Function Disorder | FAERS: 1 | US FAERS | |
| 240 | Facial Pain | FAERS: 1 | US FAERS | |
| 241 | Facial Paresis | FAERS: 1 | US FAERS | |
| 242 | Facial wasting | FAERS: 1 | US FAERS | |
| 243 | False positive investigation result | FAERS: 1 | US FAERS | |
| 244 | Fibromyalgia | FAERS: 1 | US FAERS | |
| 245 | Fracture pain | FAERS: 1 | US FAERS | |
| 246 | Gangrene | FAERS: 1 | US FAERS | |
| 247 | Gastrointestinal Pain | FAERS: 1 | SIDER US FAERS | |
| 248 | Gastrointestinal hypomotility | FAERS: 1 | US FAERS | |
| 249 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 250 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 251 | General symptom | FAERS: 1 | US FAERS | |
| 252 | Grip strength decreased | FAERS: 1 | US FAERS | |
| 253 | Grip strength | FAERS: 1 | US FAERS | |
| 254 | Head titubation | FAERS: 1 | US FAERS | |
| 255 | Hemiplegic migraine | FAERS: 1 | US FAERS | |
| 256 | Hyperkeratosis | FAERS: 1 | US FAERS | |
| 257 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 258 | Hypertrophic Cardiomyopathy | FAERS: 1 | US FAERS | |
| 259 | Hyporesponsive to stimuli | FAERS: 1 | US FAERS | |
| 260 | Immediate post-injection reaction | FAERS: 1 | US FAERS | |
| 261 | Infarction | FAERS: 1 | US FAERS | |
| 262 | Infusion site irritation | FAERS: 1 | US FAERS | |
| 263 | Infusion site reaction | FAERS: 1 | US FAERS | |
| 264 | Infusion site urticaria | FAERS: 1 | US FAERS | |
| 265 | Injection Site Reaction | FAERS: 1 | US FAERS | |
| 266 | Injection site injury | FAERS: 1 | US FAERS | |
| 267 | Intercepted wrong patient selected | FAERS: 1 | US FAERS | |
| 268 | Intervertebral disc disorder | FAERS: 1 | US FAERS | |
| 269 | Labile blood pressure | FAERS: 1 | US FAERS | |
| 270 | Loss of personal independence in daily activities | FAERS: 1 | US FAERS | |
| 271 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 272 | Memory impairment | FAERS: 1 | US FAERS | |
| 273 | Menorrhagia | FAERS: 1 | US FAERS | |
| 274 | Metrorrhagia | FAERS: 1 | US FAERS | |
| 275 | Migraine with Aura | FAERS: 1 | US FAERS | |
| 276 | Monoplegia | FAERS: 1 | US FAERS | |
| 277 | Multiple Sclerosis | FAERS: 1 | US FAERS | |
| 278 | Multiple sclerosis relapse | FAERS: 1 | US FAERS | |
| 279 | Muscle Fatigue | FAERS: 1 | US FAERS | |
| 280 | Muscle Rigidity | FAERS: 1 | US FAERS | |
| 281 | Myoclonus | FAERS: 1 | US FAERS | |
| 282 | Narcolepsy | FAERS: 1 | US FAERS | |
| 283 | Nephrolithiasis | FAERS: 1 | US FAERS | |
| 284 | Neuralgia | FAERS: 1 | US FAERS | |
| 285 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 286 | Obstruction | FAERS: 1 | US FAERS | |
| 287 | Oral pruritus | FAERS: 1 | US FAERS | |
| 288 | Oropharyngeal discomfort | FAERS: 1 | US FAERS | |
| 289 | Pancreatitis | FAERS: 1 | US FAERS | |
| 290 | Panic Disorder | FAERS: 1 | US FAERS | |
| 291 | Phlebitis | FAERS: 1 | US FAERS | |
| 292 | Photophobia | FAERS: 1 | US FAERS | |
| 293 | Physical disability | FAERS: 1 | US FAERS | |
| 294 | Procedural hypertension | FAERS: 1 | US FAERS | |
| 295 | Procedural nausea | FAERS: 1 | US FAERS | |
| 296 | Product administration error | FAERS: 1 | US FAERS | |
| 297 | Product container issue | FAERS: 1 | US FAERS | |
| 298 | Product measured potency issue | FAERS: 1 | US FAERS | |
| 299 | Product packaging issue | FAERS: 1 | US FAERS | |
| 300 | Product sterility lacking | FAERS: 1 | US FAERS | |
| 301 | Psoriasis | FAERS: 1 | US FAERS | |
| 302 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 303 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 304 | Restless Legs Syndrome | FAERS: 1 | US FAERS | |
| 305 | Retinal Artery Occlusion | FAERS: 1 | US FAERS | |
| 306 | Screaming | FAERS: 1 | US FAERS | |
| 307 | Sepsis | FAERS: 1 | US FAERS | |
| 308 | Sick Sinus Syndrome | FAERS: 1 | US FAERS | |
| 309 | Sinus Arrhythmia | FAERS: 1 | US FAERS | |
| 310 | Skin irritation | FAERS: 1 | US FAERS | |
| 311 | Slow response to stimuli | FAERS: 1 | US FAERS | |
| 312 | Slow speech | FAERS: 1 | US FAERS | |
| 313 | Spinal Stenosis | FAERS: 1 | US FAERS | |
| 314 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 315 | Thirst | FAERS: 1 | US FAERS | |
| 316 | Thrombosis in device | FAERS: 1 | US FAERS | |
| 317 | Thrombosis | FAERS: 1 | US FAERS | |
| 318 | Tongue erythema | FAERS: 1 | US FAERS | |
| 319 | Toothache | FAERS: 1 | US FAERS | |
| 320 | Trismus | FAERS: 1 | US FAERS | |
| 321 | Urge Incontinence | FAERS: 1 | US FAERS | |
| 322 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 323 | VIIth nerve paralysis | FAERS: 1 | US FAERS | |
| 324 | Venous thrombosis limb | FAERS: 1 | US FAERS | |
| 325 | Ventricular dyssynchrony | FAERS: 1 | US FAERS | |
| 326 | Vital functions abnormal | FAERS: 1 | US FAERS | |
| 327 | Wrong technique in device usage process | FAERS: 1 | US FAERS | |
| 328 | Bronchial Hyperreactivity | SIDER | ||
| 329 | Bronchoconstriction | SIDER | ||
| 330 | Cardiac Flutter | SIDER | ||
| 331 | Dermatitis | SIDER | ||
| 332 | Ear and labyrinth disorders | SIDER | ||
| 333 | Eye pain | SIDER | ||
| 334 | Gastrointestinal discomfort | SIDER | ||
| 335 | Hypotension symptomatic | SIDER | ||
| 336 | Musculoskeletal discomfort | SIDER | ||
| 337 | Nodal block | SIDER | ||
| 338 | Shock | SIDER | ||
| 339 | Supraventricular tachyarrhythmia | SIDER | ||
| 340 | Tinnitus | SIDER | ||
| 341 | Vasodilation procedure | SIDER | ||
| 342 | Vasodilation | SIDER | ||
| 343 | Ventricular arrhythmia | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.