eliglustat
(KUBARPMUNHKBIQ-VTHUDJRQSA-N)
Structure
- SMILES
- O[C@H]([C@H](C(=O)O)O)C(=O)O.CCCCCCCC(=O)N[C@@H]([C@@H](c1ccc2c(c1)OCCO2)O)CN1CCCC1.CCCCCCCC(=O)N[C@@H]([C@@H](c1ccc2c(c1)OCCO2)O)CN1CCCC1
- Molecular Formula:
- C50H78N4O14
- Molecular Weight:
- 959.173
- Log P:
- 5.3996
- Hydrogen Bond Acceptor:
- 18
- Hydrogen Bond Donor:
- 8
- TPSA:
- 257.12
- CAS Number(s):
- 928659-70-5
Synonym(s)
1.
eliglustat
2.
Cerdelga
3.
Genz-112638
4.
eliglustat tartrate
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Product dose omission | FAERS: 27 | US FAERS | |
| 2 | Fatigue | FAERS: 15 | US FAERS | |
| 3 | Dyspepsia | FAERS: 14 | US FAERS | |
| 4 | Nausea | FAERS: 12 | US FAERS | |
| 5 | Dizziness | FAERS: 10 | US FAERS | |
| 6 | Memory impairment | FAERS: 10 | US FAERS | |
| 7 | Arthralgia | FAERS: 9 | US FAERS | |
| 8 | Constipation | FAERS: 9 | US FAERS | |
| 9 | Abdominal Pain | FAERS: 8 | US FAERS | |
| 10 | Headache | FAERS: 8 | US FAERS | |
| 11 | Vomiting | FAERS: 7 | US FAERS | |
| 12 | Chest Pain | FAERS: 6 | US FAERS | |
| 13 | Drug dose omission | FAERS: 6 | US FAERS | |
| 14 | Palpitations | FAERS: 6 | US FAERS | |
| 15 | Anxiety | FAERS: 5 | US FAERS | |
| 16 | Asthenia | FAERS: 5 | US FAERS | |
| 17 | Nasopharyngitis | FAERS: 5 | US FAERS | |
| 18 | Oropharyngeal pain | FAERS: 5 | US FAERS | |
| 19 | Pain | FAERS: 5 | US FAERS | |
| 20 | Product use issue | FAERS: 5 | US FAERS | |
| 21 | Sinusitis | FAERS: 5 | US FAERS | |
| 22 | Therapy cessation | FAERS: 5 | US FAERS | |
| 23 | Bone pain | FAERS: 4 | US FAERS | |
| 24 | Drug ineffective | FAERS: 4 | US FAERS | |
| 25 | Dry skin | FAERS: 4 | US FAERS | |
| 26 | Malaise | FAERS: 4 | US FAERS | |
| 27 | Back Pain | FAERS: 3 | US FAERS | |
| 28 | Erythema | FAERS: 3 | US FAERS | |
| 29 | Feeling abnormal | FAERS: 3 | US FAERS | |
| 30 | Pruritus | FAERS: 3 | US FAERS | |
| 31 | Retching | FAERS: 3 | US FAERS | |
| 32 | Syncope | FAERS: 3 | US FAERS | |
| 33 | Tachycardia | FAERS: 3 | US FAERS | |
| 34 | Throat irritation | FAERS: 3 | US FAERS | |
| 35 | Thrombocytopenia | FAERS: 3 | US FAERS | |
| 36 | Tremor | FAERS: 3 | US FAERS | |
| 37 | Chitotriosidase increased | FAERS: 2 | US FAERS | |
| 38 | Cholecystitis | FAERS: 2 | US FAERS | |
| 39 | Dehydration | FAERS: 2 | US FAERS | |
| 40 | Disease Progression | FAERS: 2 | US FAERS | |
| 41 | Diverticulitis | FAERS: 2 | US FAERS | |
| 42 | Flatulence | FAERS: 2 | US FAERS | |
| 43 | Gastric ulcer | FAERS: 2 | US FAERS | |
| 44 | Gastritis | FAERS: 2 | US FAERS | |
| 45 | Peripheral swelling | FAERS: 2 | US FAERS | |
| 46 | Pertussis | FAERS: 2 | US FAERS | |
| 47 | Pulmonary Embolism | FAERS: 2 | US FAERS | |
| 48 | Somnolence | FAERS: 2 | US FAERS | |
| 49 | Splenomegaly | FAERS: 2 | US FAERS | |
| 50 | Transaminases increased | FAERS: 2 | US FAERS | |
| 51 | Unevaluable event | FAERS: 2 | US FAERS | |
| 52 | Urinary tract infection | FAERS: 2 | US FAERS | |
| 53 | nervous system disorder | FAERS: 2 | US FAERS | |
| 54 | Abasia | FAERS: 1 | US FAERS | |
| 55 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 56 | Acne | FAERS: 1 | US FAERS | |
| 57 | Aphonia | FAERS: 1 | US FAERS | |
| 58 | Blood urine present | FAERS: 1 | US FAERS | |
| 59 | Bone marrow infiltration | FAERS: 1 | US FAERS | |
| 60 | Bronchitis | FAERS: 1 | US FAERS | |
| 61 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 62 | Cardiac function test abnormal | FAERS: 1 | US FAERS | |
| 63 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 64 | Chest discomfort | FAERS: 1 | US FAERS | |
| 65 | Cholelithiasis | FAERS: 1 | US FAERS | |
| 66 | Contraindicated product administered | FAERS: 1 | US FAERS | |
| 67 | Cystitis | FAERS: 1 | US FAERS | |
| 68 | Cyst | FAERS: 1 | US FAERS | |
| 69 | Dysarthria | FAERS: 1 | US FAERS | |
| 70 | Economic problem | FAERS: 1 | US FAERS | |
| 71 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 72 | Eructation | FAERS: 1 | US FAERS | |
| 73 | Extra dose administered | FAERS: 1 | US FAERS | |
| 74 | Eye Infection | FAERS: 1 | US FAERS | |
| 75 | Flushing | FAERS: 1 | US FAERS | |
| 76 | Hepatic enzyme decreased | FAERS: 1 | US FAERS | |
| 77 | Hip surgery | FAERS: 1 | US FAERS | |
| 78 | Hypersomnia | FAERS: 1 | US FAERS | |
| 79 | Ileus | FAERS: 1 | US FAERS | |
| 80 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 81 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 82 | Infarction | FAERS: 1 | US FAERS | |
| 83 | Infection | FAERS: 1 | US FAERS | |
| 84 | Joint swelling | FAERS: 1 | US FAERS | |
| 85 | Limb discomfort | FAERS: 1 | US FAERS | |
| 86 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 87 | Maternal exposure timing unspecified | FAERS: 1 | US FAERS | |
| 88 | Middle insomnia | FAERS: 1 | US FAERS | |
| 89 | Myocardial Infarction | FAERS: 1 | US FAERS | |
| 90 | Nephrolithiasis | FAERS: 1 | US FAERS | |
| 91 | Nervousness | FAERS: 1 | US FAERS | |
| 92 | Neutropenia | FAERS: 1 | US FAERS | |
| 93 | Non-compaction cardiomyopathy | FAERS: 1 | US FAERS | |
| 94 | Osteomyelitis | FAERS: 1 | US FAERS | |
| 95 | Osteopenia | FAERS: 1 | US FAERS | |
| 96 | Pain of skin | FAERS: 1 | US FAERS | |
| 97 | Pancytopenia | FAERS: 1 | US FAERS | |
| 98 | Pathological fracture | FAERS: 1 | US FAERS | |
| 99 | Petechiae | FAERS: 1 | US FAERS | |
| 100 | Pharyngeal polyp | FAERS: 1 | US FAERS | |
| 101 | Pregnancy of partner | FAERS: 1 | US FAERS | |
| 102 | Pregnancy | FAERS: 1 | US FAERS | |
| 103 | Presyncope | FAERS: 1 | US FAERS | |
| 104 | Productive Cough | FAERS: 1 | US FAERS | |
| 105 | Radiculopathy | FAERS: 1 | US FAERS | |
| 106 | Rash erythematous | FAERS: 1 | US FAERS | |
| 107 | Sneezing | FAERS: 1 | US FAERS | |
| 108 | Stitch abscess | FAERS: 1 | US FAERS | |
| 109 | Therapy change | FAERS: 1 | US FAERS | |
| 110 | Thrombosis | FAERS: 1 | US FAERS | |
| 111 | Tinnitus | FAERS: 1 | US FAERS | |
| 112 | Vasculitis | FAERS: 1 | US FAERS | |
| 113 | Venous occlusion | FAERS: 1 | US FAERS | |
| 114 | Weight decreased | FAERS: 1 | US FAERS | |
| 115 | White blood cell count decreased | FAERS: 1 | US FAERS | |
| 116 | Wound Infection | FAERS: 1 | US FAERS | |
| 117 | prostatitis | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.