Choline fenofibrate
(JWAZHODZSADEHB-UHFFFAOYSA-M)
Structure
- SMILES
- Clc1ccc(cc1)C(=O)c1ccc(cc1)OC(C(=O)[O-])(C)C.OCC[N+](C)(C)C
- Molecular Formula:
- C22H28ClNO5
- Molecular Weight:
- 421.914
- Log P:
- 2.1632
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 1
- TPSA:
- 86.66
- CAS Number(s):
- 856676-23-8
Synonym(s)
1.
Choline fenofibrate
External Link(s)
| PubChem Compound | 11350701 |
| CHEMBL | CHEMBL1201745 |
| KEGG | dr:D08890 |
| Therapeutic Target Database | D01HKL |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Blood creatinine increased | FAERS: 88 | US FAERS | |
| 2 | Myalgia | FAERS: 84 | US FAERS | |
| 3 | Blood triglycerides increased | FAERS: 72 | US FAERS | |
| 4 | Nausea | FAERS: 58 | US FAERS | |
| 5 | Headache | FAERS: 41 | US FAERS | |
| 6 | Drug ineffective | FAERS: 32 | US FAERS | |
| 7 | Abdominal Pain | FAERS: 26 | US FAERS | |
| 8 | Fatigue | FAERS: 26 | US FAERS | |
| 9 | Dizziness | FAERS: 22 | US FAERS | |
| 10 | Vomiting | FAERS: 21 | US FAERS | |
| 11 | Abdominal discomfort | FAERS: 20 | US FAERS | |
| 12 | Blood creatine phosphokinase increased | FAERS: 20 | US FAERS | |
| 13 | Pain | FAERS: 19 | US FAERS | |
| 14 | Pancreatitis | FAERS: 19 | US FAERS | |
| 15 | Pruritus | FAERS: 19 | US FAERS | |
| 16 | Arthralgia | FAERS: 17 | US FAERS | |
| 17 | Low density lipoprotein increased | FAERS: 17 | US FAERS | |
| 18 | Urticaria | FAERS: 17 | US FAERS | |
| 19 | Back Pain | FAERS: 16 | US FAERS | |
| 20 | Blood creatine increased | FAERS: 16 | US FAERS | |
| 21 | Dyspepsia | FAERS: 15 | US FAERS | |
| 22 | Alopecia | FAERS: 14 | US FAERS | |
| 23 | Blood glucose increased | FAERS: 13 | US FAERS | |
| 24 | Hypersensitivity | FAERS: 12 | US FAERS | |
| 25 | Alanine Aminotransferase Increased | FAERS: 11 | US FAERS | |
| 26 | Chest Pain | FAERS: 11 | US FAERS | |
| 27 | Rhabdomyolysis | FAERS: 11 | US FAERS | |
| 28 | Aspartate Aminotransferase Increased | FAERS: 9 | US FAERS | |
| 29 | Asthenia | FAERS: 9 | US FAERS | |
| 30 | Creatinine renal clearance increased | FAERS: 9 | US FAERS | |
| 31 | Feeling abnormal | FAERS: 9 | US FAERS | |
| 32 | Malaise | FAERS: 9 | US FAERS | |
| 33 | Palpitations | FAERS: 9 | US FAERS | |
| 34 | Unevaluable event | FAERS: 8 | US FAERS | |
| 35 | Hepatitis | FAERS: 7 | US FAERS | |
| 36 | Myositis | FAERS: 7 | US FAERS | |
| 37 | Pulmonary Embolism | FAERS: 7 | US FAERS | |
| 38 | jaundice | FAERS: 7 | US FAERS | |
| 39 | Erythema | FAERS: 6 | US FAERS | |
| 40 | Flatulence | FAERS: 6 | US FAERS | |
| 41 | Vertigo | FAERS: 6 | US FAERS | |
| 42 | Blood cholesterol increased | FAERS: 5 | US FAERS | |
| 43 | Blood urea increased | FAERS: 5 | US FAERS | |
| 44 | Chills | FAERS: 5 | US FAERS | |
| 45 | Chromaturia | FAERS: 5 | US FAERS | |
| 46 | Epistaxis | FAERS: 5 | US FAERS | |
| 47 | Flushing | FAERS: 5 | US FAERS | |
| 48 | Weight decreased | FAERS: 5 | US FAERS | |
| 49 | Incorrect drug administration duration | FAERS: 4 | US FAERS | |
| 50 | Myopathy | FAERS: 4 | US FAERS | |
| 51 | Oropharyngeal pain | FAERS: 4 | US FAERS | |
| 52 | Pneumonia | FAERS: 4 | US FAERS | |
| 53 | Rash erythematous | FAERS: 4 | US FAERS | |
| 54 | Autoimmune hepatitis | FAERS: 3 | US FAERS | |
| 55 | Blood glucose decreased | FAERS: 3 | US FAERS | |
| 56 | Chest discomfort | FAERS: 3 | US FAERS | |
| 57 | Cholelithiasis | FAERS: 3 | US FAERS | |
| 58 | Colitis | FAERS: 3 | US FAERS | |
| 59 | Constipation | FAERS: 3 | US FAERS | |
| 60 | Deep Vein Thrombosis | FAERS: 3 | US FAERS | |
| 61 | Drug dispensing error | FAERS: 3 | US FAERS | |
| 62 | Erectile dysfunction | FAERS: 3 | US FAERS | |
| 63 | Eructation | FAERS: 3 | US FAERS | |
| 64 | Gout | FAERS: 3 | US FAERS | |
| 65 | Lip swelling | FAERS: 3 | US FAERS | |
| 66 | Musculoskeletal Pain | FAERS: 3 | US FAERS | |
| 67 | Sexual Dysfunction | FAERS: 3 | US FAERS | |
| 68 | Somnolence | FAERS: 3 | US FAERS | |
| 69 | Thrombocytopenia | FAERS: 3 | US FAERS | |
| 70 | Adverse event | FAERS: 2 | US FAERS | |
| 71 | Amnesia | FAERS: 2 | US FAERS | |
| 72 | Blindness | FAERS: 2 | US FAERS | |
| 73 | Blood triglycerides abnormal | FAERS: 2 | US FAERS | |
| 74 | Burning sensation | FAERS: 2 | US FAERS | |
| 75 | Dysuria | FAERS: 2 | US FAERS | |
| 76 | Incoherent | FAERS: 2 | US FAERS | |
| 77 | Incorrect dose administered | FAERS: 2 | US FAERS | |
| 78 | Joint swelling | FAERS: 2 | US FAERS | |
| 79 | Lipoprotein (a) increased | FAERS: 2 | US FAERS | |
| 80 | Low density lipoprotein abnormal | FAERS: 2 | US FAERS | |
| 81 | Medication residue | FAERS: 2 | US FAERS | |
| 82 | Memory impairment | FAERS: 2 | US FAERS | |
| 83 | Muscle tightness | FAERS: 2 | US FAERS | |
| 84 | Musculoskeletal stiffness | FAERS: 2 | US FAERS | |
| 85 | Night sweats | FAERS: 2 | US FAERS | |
| 86 | Ocular icterus | FAERS: 2 | US FAERS | |
| 87 | Product quality issue | FAERS: 2 | US FAERS | |
| 88 | Swelling | FAERS: 2 | US FAERS | |
| 89 | Urinary tract infection | FAERS: 2 | US FAERS | |
| 90 | Wrong technique in drug usage process | FAERS: 2 | US FAERS | |
| 91 | Abasia | FAERS: 1 | US FAERS | |
| 92 | Ageusia | FAERS: 1 | US FAERS | |
| 93 | Amphetamines | FAERS: 1 | US FAERS | |
| 94 | Anaphylactoid Reaction | FAERS: 1 | US FAERS | |
| 95 | Anorectal discomfort | FAERS: 1 | US FAERS | |
| 96 | Anxiety | FAERS: 1 | US FAERS | |
| 97 | Aphasia | FAERS: 1 | US FAERS | |
| 98 | Bedridden | FAERS: 1 | US FAERS | |
| 99 | Blood alkaline phosphatase increased | FAERS: 1 | US FAERS | |
| 100 | Blood blister | FAERS: 1 | US FAERS | |
| 101 | Blood triglycerides decreased | FAERS: 1 | US FAERS | |
| 102 | Blood urine present | FAERS: 1 | US FAERS | |
| 103 | Breast tenderness | FAERS: 1 | US FAERS | |
| 104 | Cardiac Arrest | FAERS: 1 | US FAERS | |
| 105 | Cataract | FAERS: 1 | US FAERS | |
| 106 | Choking sensation | FAERS: 1 | US FAERS | |
| 107 | Cold sweat | FAERS: 1 | US FAERS | |
| 108 | Creatinine renal clearance decreased | FAERS: 1 | US FAERS | |
| 109 | Dehydration | FAERS: 1 | US FAERS | |
| 110 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 111 | Discomfort | FAERS: 1 | US FAERS | |
| 112 | Drug dose omission | FAERS: 1 | US FAERS | |
| 113 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 114 | Drug level increased | FAERS: 1 | US FAERS | |
| 115 | Dysgeusia | FAERS: 1 | US FAERS | |
| 116 | Dystonia | FAERS: 1 | US FAERS | |
| 117 | Embolism | FAERS: 1 | US FAERS | |
| 118 | Emotional distress | FAERS: 1 | US FAERS | |
| 119 | Expired drug administered | FAERS: 1 | US FAERS | |
| 120 | Eye pain | FAERS: 1 | US FAERS | |
| 121 | Flank Pain | FAERS: 1 | US FAERS | |
| 122 | Gallbladder pain | FAERS: 1 | US FAERS | |
| 123 | Gastrointestinal sounds abnormal | FAERS: 1 | US FAERS | |
| 124 | Gingivitis | FAERS: 1 | US FAERS | |
| 125 | Grip strength decreased | FAERS: 1 | US FAERS | |
| 126 | Hepatic enzyme decreased | FAERS: 1 | US FAERS | |
| 127 | Hepatomegaly | FAERS: 1 | US FAERS | |
| 128 | Hepatotoxicity | FAERS: 1 | US FAERS | |
| 129 | High density lipoprotein abnormal | FAERS: 1 | US FAERS | |
| 130 | Hyperchlorhydria | FAERS: 1 | US FAERS | |
| 131 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 132 | Inflammation | FAERS: 1 | US FAERS | |
| 133 | Joint stiffness | FAERS: 1 | US FAERS | |
| 134 | Joint warmth | FAERS: 1 | US FAERS | |
| 135 | Lethargy | FAERS: 1 | US FAERS | |
| 136 | Medication Error | FAERS: 1 | US FAERS | |
| 137 | Medication residue present | FAERS: 1 | US FAERS | |
| 138 | Mental status changes | FAERS: 1 | US FAERS | |
| 139 | Middle insomnia | FAERS: 1 | US FAERS | |
| 140 | Muscle Fatigue | FAERS: 1 | US FAERS | |
| 141 | Muscle enzyme increased | FAERS: 1 | US FAERS | |
| 142 | Musculoskeletal chest pain | FAERS: 1 | US FAERS | |
| 143 | Myocardial Infarction | FAERS: 1 | US FAERS | |
| 144 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 145 | Neck Pain | FAERS: 1 | US FAERS | |
| 146 | Nephrolithiasis | FAERS: 1 | US FAERS | |
| 147 | Nervousness | FAERS: 1 | US FAERS | |
| 148 | Oral pain | FAERS: 1 | US FAERS | |
| 149 | Pain of skin | FAERS: 1 | US FAERS | |
| 150 | Pancytopenia | FAERS: 1 | US FAERS | |
| 151 | Paresis | FAERS: 1 | US FAERS | |
| 152 | Photodermatosis | FAERS: 1 | US FAERS | |
| 153 | Photophobia | FAERS: 1 | US FAERS | |
| 154 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 155 | Presbyopia | FAERS: 1 | US FAERS | |
| 156 | Presyncope | FAERS: 1 | US FAERS | |
| 157 | Proctitis | FAERS: 1 | US FAERS | |
| 158 | Product physical issue | FAERS: 1 | US FAERS | |
| 159 | Product substitution issue | FAERS: 1 | US FAERS | |
| 160 | Product taste abnormal | FAERS: 1 | US FAERS | |
| 161 | Productive Cough | FAERS: 1 | US FAERS | |
| 162 | Protein urine present | FAERS: 1 | US FAERS | |
| 163 | Prothrombin level abnormal | FAERS: 1 | US FAERS | |
| 164 | Regurgitation | FAERS: 1 | US FAERS | |
| 165 | Renal lipomatosis | FAERS: 1 | US FAERS | |
| 166 | Respiratory tract congestion | FAERS: 1 | US FAERS | |
| 167 | Restless Legs Syndrome | FAERS: 1 | US FAERS | |
| 168 | Serum Sickness | FAERS: 1 | US FAERS | |
| 169 | Sinusitis | FAERS: 1 | US FAERS | |
| 170 | Skin irritation | FAERS: 1 | US FAERS | |
| 171 | Stomatitis | FAERS: 1 | US FAERS | |
| 172 | Syncope | FAERS: 1 | US FAERS | |
| 173 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 174 | Tremor | FAERS: 1 | US FAERS | |
| 175 | Umbilical hernia | FAERS: 1 | US FAERS | |
| 176 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 177 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 178 | Vasculitis | FAERS: 1 | US FAERS | |
| 179 | Vitreous Detachment | FAERS: 1 | US FAERS | |
| 180 | Vitreous floaters | FAERS: 1 | US FAERS | |
| 181 | Wheezing | FAERS: 1 | US FAERS | |
| 182 | White blood cell count decreased | FAERS: 1 | US FAERS | |
| 183 | Wrong drug administered | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.