Simeprevir
(JTZZSQYMACOLNN-VDWJNHBNSA-N)
Structure
- SMILES
- COc1ccc2c(c1C)nc(cc2O[C@@H]1C[C@@H]2[C@@H](C1)C(=O)N(C)CCCC/C=C\[C@H]1[C@](NC2=O)(C1)C(=O)NS(=O)(=O)C1CC1)c1scc(n1)C(C)C
- Type(s)
- Approved
- ATC code(s)
- G01AE10; J05AP05
- Molecular Formula:
- C38H47N5O7S2
- Molecular Weight:
- 749.939
- Log P:
- 6.9925
- Hydrogen Bond Acceptor:
- 13
- Hydrogen Bond Donor:
- 2
- TPSA:
- 193.51
- CAS Number(s):
- 923604-59-5
Synonym(s)
1.
Simeprevir
2.
N-(17-(2-(4-isopropylthiazole-2-yl)-7-methoxy-8-methylquinolin-4-yloxy)-13-methyl-2,14-dioxo-3,13-diazatricyclo(13.3.0.04,6)octadec-7-ene-4-carbonyl)(cyclopropyl)sulfonamide
3.
Olysio
4.
TMC 435
5.
TMC 435350
6.
TMC-435
7.
TMC-435350
8.
TMC435
9.
TMC435350
10.
435, TMC
11.
435350, TMC
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug dose omission | FAERS: 35 | US FAERS | |
| 2 | Hepatitis C | FAERS: 21 | 25937625 26052383 | CTD US FAERS |
| 3 | Drug ineffective | FAERS: 12 | US FAERS | |
| 4 | Fatigue | FAERS: 11 | SIDER US FAERS | |
| 5 | Headache | FAERS: 10 | SIDER US FAERS | |
| 6 | Adverse event | FAERS: 9 | US FAERS | |
| 7 | Product packaging quantity issue | FAERS: 7 | US FAERS | |
| 8 | Incorrect product storage | FAERS: 6 | US FAERS | |
| 9 | Malaise | FAERS: 6 | US FAERS | |
| 10 | Nausea | FAERS: 6 | SIDER US FAERS | |
| 11 | Product use issue | FAERS: 6 | US FAERS | |
| 12 | Remission not achieved | FAERS: 6 | US FAERS | |
| 13 | Asthenia | FAERS: 4 | SIDER US FAERS | |
| 14 | Dizziness | FAERS: 4 | US FAERS | |
| 15 | Product physical issue | FAERS: 4 | US FAERS | |
| 16 | treatment failure | FAERS: 4 | US FAERS | |
| 17 | Arthralgia | FAERS: 3 | US FAERS | |
| 18 | Viral load increased | FAERS: 3 | US FAERS | |
| 19 | Vomiting | FAERS: 3 | US FAERS | |
| 20 | Wrong technique in drug usage process | FAERS: 3 | US FAERS | |
| 21 | Agitation | FAERS: 2 | US FAERS | |
| 22 | Alopecia | FAERS: 2 | US FAERS | |
| 23 | Anxiety | FAERS: 2 | US FAERS | |
| 24 | Burning sensation | FAERS: 2 | US FAERS | |
| 25 | Cheilitis | FAERS: 2 | US FAERS | |
| 26 | Constipation | FAERS: 2 | SIDER US FAERS | |
| 27 | Diplopia | FAERS: 2 | US FAERS | |
| 28 | Drug prescribing error | FAERS: 2 | US FAERS | |
| 29 | Drug resistance | FAERS: 2 | US FAERS | |
| 30 | Erythema | FAERS: 2 | US FAERS | |
| 31 | Hepatitis B | FAERS: 2 | US FAERS | |
| 32 | Joint swelling | FAERS: 2 | US FAERS | |
| 33 | Medication Error | FAERS: 2 | US FAERS | |
| 34 | Pneumonia | FAERS: 2 | US FAERS | |
| 35 | Product quality issue | FAERS: 2 | US FAERS | |
| 36 | Pruritus | FAERS: 2 | SIDER US FAERS | |
| 37 | Sunburn | FAERS: 2 | US FAERS | |
| 38 | Viral mutation identified | FAERS: 2 | US FAERS | |
| 39 | jaundice | FAERS: 2 | US FAERS | |
| 40 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 41 | Anal Fissure | FAERS: 1 | US FAERS | |
| 42 | Anger | FAERS: 1 | US FAERS | |
| 43 | Ascites | FAERS: 1 | US FAERS | |
| 44 | Back Pain | FAERS: 1 | US FAERS | |
| 45 | Blood count abnormal | FAERS: 1 | US FAERS | |
| 46 | Blood creatinine increased | FAERS: 1 | US FAERS | |
| 47 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 48 | Blood magnesium decreased | FAERS: 1 | US FAERS | |
| 49 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 50 | Blood testosterone increased | FAERS: 1 | US FAERS | |
| 51 | Blood triglycerides increased | FAERS: 1 | US FAERS | |
| 52 | Cardiotoxicity | FAERS: 1 | US FAERS | |
| 53 | Cell Death | FAERS: 1 | US FAERS | |
| 54 | Chest Pain | FAERS: 1 | US FAERS | |
| 55 | Chills | FAERS: 1 | US FAERS | |
| 56 | Cholecystitis | FAERS: 1 | US FAERS | |
| 57 | Drug Dependence | FAERS: 1 | US FAERS | |
| 58 | Drug administration error | FAERS: 1 | US FAERS | |
| 59 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 60 | Drug screen false positive | FAERS: 1 | US FAERS | |
| 61 | Dry skin | FAERS: 1 | US FAERS | |
| 62 | Dysuria | FAERS: 1 | US FAERS | |
| 63 | Epistaxis | FAERS: 1 | US FAERS | |
| 64 | Exfoliative rash | FAERS: 1 | US FAERS | |
| 65 | Extra dose administered | FAERS: 1 | US FAERS | |
| 66 | Flank Pain | FAERS: 1 | US FAERS | |
| 67 | Full blood count abnormal | FAERS: 1 | US FAERS | |
| 68 | Gastrostomy | FAERS: 1 | US FAERS | |
| 69 | Gout | FAERS: 1 | US FAERS | |
| 70 | Guillain-Barre Syndrome | FAERS: 1 | US FAERS | |
| 71 | Hepatic Encephalopathy | FAERS: 1 | US FAERS | |
| 72 | Hepatitis | FAERS: 1 | US FAERS | |
| 73 | Hepatomegaly | FAERS: 1 | US FAERS | |
| 74 | Hordeolum | FAERS: 1 | US FAERS | |
| 75 | Hypersensitivity | FAERS: 1 | US FAERS | |
| 76 | Hypersomnia | FAERS: 1 | US FAERS | |
| 77 | Incorrect drug administration duration | FAERS: 1 | US FAERS | |
| 78 | Intervertebral disc disorder | FAERS: 1 | US FAERS | |
| 79 | Joint injury | FAERS: 1 | US FAERS | |
| 80 | Leukocytosis | FAERS: 1 | US FAERS | |
| 81 | Leukopenia | FAERS: 1 | US FAERS | |
| 82 | Lipase increased | FAERS: 1 | US FAERS | |
| 83 | Lymphocytosis | FAERS: 1 | US FAERS | |
| 84 | Memory impairment | FAERS: 1 | US FAERS | |
| 85 | Meniscus injury | FAERS: 1 | US FAERS | |
| 86 | Mood swings | FAERS: 1 | US FAERS | |
| 87 | Myalgia | FAERS: 1 | SIDER US FAERS | |
| 88 | Myasthenia Gravis | FAERS: 1 | US FAERS | |
| 89 | Myocardial Infarction | FAERS: 1 | US FAERS | |
| 90 | Nervousness | FAERS: 1 | US FAERS | |
| 91 | Neutropenia | FAERS: 1 | US FAERS | |
| 92 | Ocular icterus | FAERS: 1 | US FAERS | |
| 93 | Overdose | FAERS: 1 | US FAERS | |
| 94 | Pancreatitis | FAERS: 1 | US FAERS | |
| 95 | Pancytopenia | FAERS: 1 | US FAERS | |
| 96 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 97 | Product dose omission | FAERS: 1 | US FAERS | |
| 98 | Purulence | FAERS: 1 | US FAERS | |
| 99 | Rash erythematous | FAERS: 1 | US FAERS | |
| 100 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 101 | Scab | FAERS: 1 | US FAERS | |
| 102 | Sexual Dysfunction | FAERS: 1 | US FAERS | |
| 103 | Sinusitis | FAERS: 1 | US FAERS | |
| 104 | Skin reaction | FAERS: 1 | US FAERS | |
| 105 | Swelling | FAERS: 1 | US FAERS | |
| 106 | Syncope | FAERS: 1 | US FAERS | |
| 107 | Therapeutic product ineffective | FAERS: 1 | US FAERS | |
| 108 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 109 | Therapy responder | FAERS: 1 | US FAERS | |
| 110 | Tongue blistering | FAERS: 1 | US FAERS | |
| 111 | Transaminases increased | FAERS: 1 | US FAERS | |
| 112 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 113 | Urine output increased | FAERS: 1 | US FAERS | |
| 114 | Vertigo | FAERS: 1 | US FAERS | |
| 115 | Visual Impairment | FAERS: 1 | US FAERS | |
| 116 | Weight decreased | FAERS: 1 | US FAERS | |
| 117 | White blood cell count decreased | FAERS: 1 | US FAERS | |
| 118 | skin abrasion | FAERS: 1 | US FAERS | |
| 119 | Dermatitis | SIDER | ||
| 120 | Hepatitis C, Chronic | 25987834 26239358 | CTD | |
| 121 | Infection | SIDER | ||
| 122 | Musculoskeletal discomfort | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.