Lidocaine
(IYBQHJMYDGVZRY-UHFFFAOYSA-N)
Structure
- SMILES
- CCN(CC(=O)Nc1c(C)cccc1C)CC.Cl
- Molecular Formula:
- C14H23ClN2O
- Molecular Weight:
- 270.798
- Log P:
- 3.4587
- Hydrogen Bond Acceptor:
- 3
- Hydrogen Bond Donor:
- 2
- TPSA:
- 32.34
- CAS Number(s):
- 73-78-9
Synonym(s)
1.
Lidocaine
2.
Lignocaine
3.
2-(Diethylamino)-N-(2,6-Dimethylphenyl)Acetamide
4.
2-2EtN-2MePhAcN
5.
Dalcaine
6.
Lidocaine Carbonate
7.
Lidocaine Carbonate (2:1)
8.
Lidocaine Hydrocarbonate
9.
Lidocaine Hydrochloride
10.
Lidocaine Monoacetate
11.
Lidocaine Monohydrochloride
12.
Lidocaine Monohydrochloride, Monohydrate
13.
Lidocaine Sulfate (1:1)
14.
Octocaine
15.
Xylesthesin
16.
Xylocaine
17.
Xylocitin
18.
Xyloneural
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 184 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 2 | Cardiac Arrest | FAERS: 66 | US FAERS | |
| 3 | Product quality issue | FAERS: 30 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 4 | Toxicity to various agents | FAERS: 27 | US FAERS | |
| 5 | Dizziness | FAERS: 24 | US FAERS | |
| 6 | Medication Error | FAERS: 21 | US FAERS | |
| 7 | Nausea | FAERS: 19 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 8 | Pain | FAERS: 19 | US FAERS | |
| 9 | Overdose | FAERS: 18 | US FAERS | |
| 10 | Pruritus | FAERS: 16 | US FAERS | |
| 11 | Urticaria | FAERS: 16 | US FAERS | |
| 12 | Incorrect route of drug administration | FAERS: 15 | US FAERS | |
| 13 | Swelling | FAERS: 15 | US FAERS | |
| 14 | Device breakage | FAERS: 14 | US FAERS | |
| 15 | Erythema | FAERS: 14 | US FAERS | |
| 16 | Anaphylactic shock | FAERS: 13 | US FAERS | |
| 17 | Dysarthria | FAERS: 12 | US FAERS | |
| 18 | Respiratory arrest | FAERS: 12 | US FAERS | |
| 19 | Aphasia | FAERS: 11 | US FAERS | |
| 20 | Hypotension | FAERS: 11 | US FAERS | |
| 21 | Laceration | FAERS: 11 | US FAERS | |
| 22 | Product use in unapproved indication | FAERS: 11 | US FAERS | |
| 23 | Tremor | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 24 | Unresponsive to stimuli | FAERS: 11 | US FAERS | |
| 25 | Vomiting | FAERS: 11 | US FAERS | |
| 26 | Accidental exposure to product | FAERS: 10 | US FAERS | |
| 27 | Bronchospasm | FAERS: 10 | US FAERS | |
| 28 | Hypersensitivity | FAERS: 10 | US FAERS | |
| 29 | Pallor | FAERS: 10 | US FAERS | |
| 30 | Accidental overdose | FAERS: 9 | US FAERS | |
| 31 | Burning sensation | FAERS: 9 | US FAERS | |
| 32 | Product container issue | FAERS: 9 | US FAERS | |
| 33 | Syncope | FAERS: 9 | US FAERS | |
| 34 | Drug ineffective for unapproved indication | FAERS: 8 | US FAERS | |
| 35 | Drug toxicity | FAERS: 8 | US FAERS | |
| 36 | Infection | FAERS: 8 | US FAERS | |
| 37 | Palpitations | FAERS: 8 | US FAERS | |
| 38 | Drug administration error | FAERS: 7 | US FAERS | |
| 39 | Headache | FAERS: 7 | US FAERS | |
| 40 | Procedural complication | FAERS: 7 | US FAERS | |
| 41 | Wrong drug administered | FAERS: 7 | US FAERS | |
| 42 | Wrong technique in drug usage process | FAERS: 7 | US FAERS | |
| 43 | Back Pain | FAERS: 6 | US FAERS | |
| 44 | Discomfort | FAERS: 6 | US FAERS | |
| 45 | Injection site pain | FAERS: 6 | US FAERS | |
| 46 | Poor quality drug administered | FAERS: 6 | US FAERS | |
| 47 | Respiratory Failure | FAERS: 6 | US FAERS | |
| 48 | Somnolence | FAERS: 6 | US FAERS | |
| 49 | Agitation | FAERS: 5 | US FAERS | |
| 50 | Cyanosis | FAERS: 5 | US FAERS | |
| 51 | Hoigne's syndrome | FAERS: 5 | US FAERS | |
| 52 | Injection site erythema | FAERS: 5 | US FAERS | |
| 53 | Poisoning | FAERS: 5 | US FAERS | |
| 54 | Shock | FAERS: 5 | US FAERS | |
| 55 | Tachycardia | FAERS: 5 | US FAERS | |
| 56 | Tinnitus | FAERS: 5 | US FAERS | |
| 57 | Vertigo | FAERS: 5 | US FAERS | |
| 58 | Wrong technique in product usage process | FAERS: 5 | US FAERS | |
| 59 | nervous system disorder | FAERS: 5 | US FAERS | |
| 60 | Asthenia | FAERS: 4 | US FAERS | |
| 61 | Bradycardia | FAERS: 4 | US FAERS | |
| 62 | Cardiotoxicity | FAERS: 4 | US FAERS | |
| 63 | Diplopia | FAERS: 4 | US FAERS | |
| 64 | Drug exposure during pregnancy | FAERS: 4 | US FAERS | |
| 65 | Endophthalmitis | FAERS: 4 | US FAERS | |
| 66 | Expired product administered | FAERS: 4 | US FAERS | |
| 67 | Fatigue | FAERS: 4 | US FAERS | |
| 68 | Feeling Cold | FAERS: 4 | US FAERS | |
| 69 | Feeling abnormal | FAERS: 4 | US FAERS | |
| 70 | Hypoxia | FAERS: 4 | US FAERS | |
| 71 | Incorrect route of product administration | FAERS: 4 | US FAERS | |
| 72 | Malaise | FAERS: 4 | US FAERS | |
| 73 | Meningitis | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 74 | Metabolic acidosis | FAERS: 4 | US FAERS | |
| 75 | Product contamination physical | FAERS: 4 | US FAERS | |
| 76 | Restlessness | FAERS: 4 | US FAERS | |
| 77 | Retinal Artery Occlusion | FAERS: 4 | US FAERS | |
| 78 | Sinus Tachycardia | FAERS: 4 | US FAERS | |
| 79 | Skin necrosis | FAERS: 4 | US FAERS | |
| 80 | Status Epilepticus | FAERS: 4 | US FAERS | |
| 81 | Subcutaneous Abscess | FAERS: 4 | US FAERS | |
| 82 | Accidental exposure to product by child | FAERS: 3 | US FAERS | |
| 83 | Angioedema | FAERS: 3 | US FAERS | |
| 84 | Arthralgia | FAERS: 3 | US FAERS | |
| 85 | Chest discomfort | FAERS: 3 | US FAERS | |
| 86 | Chills | FAERS: 3 | US FAERS | |
| 87 | Completed Suicide | FAERS: 3 | US FAERS | |
| 88 | Disorientation | FAERS: 3 | US FAERS | |
| 89 | Drug abuse | FAERS: 3 | US FAERS | |
| 90 | Drug effect incomplete | FAERS: 3 | US FAERS | |
| 91 | Eye pain | FAERS: 3 | US FAERS | |
| 92 | Iatrogenic injury | FAERS: 3 | US FAERS | |
| 93 | Intentional product misuse | FAERS: 3 | US FAERS | |
| 94 | Lip swelling | FAERS: 3 | US FAERS | |
| 95 | Multiple drug overdose | FAERS: 3 | US FAERS | |
| 96 | Myocardial Infarction | FAERS: 3 | US FAERS | |
| 97 | Nystagmus | FAERS: 3 | US FAERS | |
| 98 | Pharmaceutical product complaint | FAERS: 3 | US FAERS | |
| 99 | Product contamination | FAERS: 3 | US FAERS | |
| 100 | Product label issue | FAERS: 3 | US FAERS | |
| 101 | Product packaging confusion | FAERS: 3 | US FAERS | |
| 102 | Product use issue | FAERS: 3 | US FAERS | |
| 103 | Retinal artery spasm | FAERS: 3 | US FAERS | |
| 104 | Suicide attempt | FAERS: 3 | US FAERS | |
| 105 | Syringe issue | FAERS: 3 | US FAERS | |
| 106 | Abdominal discomfort | FAERS: 2 | US FAERS | |
| 107 | Abscess | FAERS: 2 | US FAERS | |
| 108 | Acute kidney injury | FAERS: 2 | US FAERS | |
| 109 | Anxiety | FAERS: 2 | US FAERS | |
| 110 | Arterial Injury | FAERS: 2 | US FAERS | |
| 111 | Aspiration joint abnormal | FAERS: 2 | US FAERS | |
| 112 | Blindness | FAERS: 2 | US FAERS | |
| 113 | Blood pH decreased | FAERS: 2 | US FAERS | |
| 114 | Cervix carcinoma | FAERS: 2 | US FAERS | |
| 115 | Chest Pain | FAERS: 2 | US FAERS | |
| 116 | Dehydration | FAERS: 2 | US FAERS | |
| 117 | Depressed Level of Consciousness | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 118 | Device Failure | FAERS: 2 | US FAERS | |
| 119 | Device component issue | FAERS: 2 | US FAERS | |
| 120 | Disease recurrence | FAERS: 2 | US FAERS | |
| 121 | Dysgeusia | FAERS: 2 | US FAERS | |
| 122 | Endotracheal intubation complication | FAERS: 2 | US FAERS | |
| 123 | Facial paralysis | FAERS: 2 | US FAERS | |
| 124 | Foreign body in respiratory tract | FAERS: 2 | US FAERS | |
| 125 | Foreign body trauma | FAERS: 2 | US FAERS | |
| 126 | Guillain-Barre Syndrome | FAERS: 2 | US FAERS | |
| 127 | Incorrect dose administered | FAERS: 2 | US FAERS | |
| 128 | Injection site abscess | FAERS: 2 | US FAERS | |
| 129 | Joint swelling | FAERS: 2 | US FAERS | |
| 130 | Lethargy | FAERS: 2 | US FAERS | |
| 131 | Mental status changes | FAERS: 2 | US FAERS | |
| 132 | Musculoskeletal discomfort | FAERS: 2 | US FAERS | |
| 133 | No adverse event | FAERS: 2 | US FAERS | |
| 134 | Osteopenia | FAERS: 2 | US FAERS | |
| 135 | Paraspinal abscess | FAERS: 2 | US FAERS | |
| 136 | Post procedural complication | FAERS: 2 | US FAERS | |
| 137 | Product closure issue | FAERS: 2 | US FAERS | |
| 138 | Product container seal issue | FAERS: 2 | US FAERS | |
| 139 | Product label confusion | FAERS: 2 | US FAERS | |
| 140 | Product package associated injury | FAERS: 2 | US FAERS | |
| 141 | Removal of foreign body from larynx | FAERS: 2 | US FAERS | |
| 142 | Retinogram abnormal | FAERS: 2 | US FAERS | |
| 143 | Screaming | FAERS: 2 | US FAERS | |
| 144 | Sedation complication | FAERS: 2 | US FAERS | |
| 145 | Wheezing | FAERS: 2 | US FAERS | |
| 146 | Abasia | FAERS: 1 | US FAERS | |
| 147 | Accidental death | FAERS: 1 | US FAERS | |
| 148 | Accidental drug intake by child | FAERS: 1 | US FAERS | |
| 149 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 150 | Acute Coronary Syndrome | FAERS: 1 | US FAERS | |
| 151 | Adverse event | FAERS: 1 | US FAERS | |
| 152 | Altered state of consciousness | FAERS: 1 | US FAERS | |
| 153 | Amaurosis Fugax | FAERS: 1 | US FAERS | |
| 154 | Amaurosis | FAERS: 1 | US FAERS | |
| 155 | Anaphylactoid Reaction | FAERS: 1 | US FAERS | |
| 156 | Aphagia | FAERS: 1 | US FAERS | |
| 157 | Apparent death | FAERS: 1 | US FAERS | |
| 158 | Application site pain | FAERS: 1 | US FAERS | |
| 159 | Application site vesicles | FAERS: 1 | US FAERS | |
| 160 | Asphyxia | FAERS: 1 | US FAERS | |
| 161 | Atopy | FAERS: 1 | US FAERS | |
| 162 | Atrial Flutter | FAERS: 1 | US FAERS | |
| 163 | Balanitis | FAERS: 1 | US FAERS | |
| 164 | Biopsy site unspecified abnormal | FAERS: 1 | US FAERS | |
| 165 | Bladder pain | FAERS: 1 | US FAERS | |
| 166 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 167 | Brain Death | FAERS: 1 | US FAERS | |
| 168 | Brain Hypoxia | FAERS: 1 | US FAERS | |
| 169 | Bronchoscopy | FAERS: 1 | US FAERS | |
| 170 | Cardiomyopathy acute | FAERS: 1 | US FAERS | |
| 171 | Catatonia | FAERS: 1 | US FAERS | |
| 172 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 173 | Chromaturia | FAERS: 1 | US FAERS | |
| 174 | Cold sweat | FAERS: 1 | US FAERS | |
| 175 | Contraindicated product administered | FAERS: 1 | US FAERS | |
| 176 | Conversion disorder | FAERS: 1 | US FAERS | |
| 177 | Cystitis | FAERS: 1 | US FAERS | |
| 178 | Delirium | FAERS: 1 | US FAERS | |
| 179 | Depressed mood | FAERS: 1 | US FAERS | |
| 180 | Dermatitis | FAERS: 1 | US FAERS | |
| 181 | Device dislocation | FAERS: 1 | US FAERS | |
| 182 | Device programming error | FAERS: 1 | US FAERS | |
| 183 | Device use issue | FAERS: 1 | US FAERS | |
| 184 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 185 | Disease complication | FAERS: 1 | US FAERS | |
| 186 | Dose calculation error | FAERS: 1 | US FAERS | |
| 187 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 188 | Drug exposure before pregnancy | FAERS: 1 | US FAERS | |
| 189 | Drug level increased | FAERS: 1 | US FAERS | |
| 190 | Drug monitoring procedure incorrectly performed | FAERS: 1 | US FAERS | |
| 191 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 192 | Dysphonia | FAERS: 1 | US FAERS | |
| 193 | Electromechanical dissociation | FAERS: 1 | US FAERS | |
| 194 | Endocardial disease | FAERS: 1 | US FAERS | |
| 195 | Enuresis | FAERS: 1 | US FAERS | |
| 196 | Epilepsy | FAERS: 1 | US FAERS | |
| 197 | Epistaxis | FAERS: 1 | US FAERS | |
| 198 | Erectile dysfunction | FAERS: 1 | US FAERS | |
| 199 | Exfoliative rash | FAERS: 1 | US FAERS | |
| 200 | Exposure via eye contact | FAERS: 1 | US FAERS | |
| 201 | Extraocular Muscle Paresis | FAERS: 1 | US FAERS | |
| 202 | Extremity necrosis | FAERS: 1 | US FAERS | |
| 203 | Eye Burns | FAERS: 1 | US FAERS | |
| 204 | Eye allergy | FAERS: 1 | US FAERS | |
| 205 | Eye irritation | FAERS: 1 | US FAERS | |
| 206 | Facial asymmetry | FAERS: 1 | US FAERS | |
| 207 | Gene Mutation | FAERS: 1 | US FAERS | |
| 208 | Genital burning sensation | FAERS: 1 | US FAERS | |
| 209 | Genital rash | FAERS: 1 | US FAERS | |
| 210 | Haematotoxicity | FAERS: 1 | US FAERS | |
| 211 | Hemiparesis | FAERS: 1 | US FAERS | |
| 212 | Hyperventilation | FAERS: 1 | US FAERS | |
| 213 | Hyporesponsive to stimuli | FAERS: 1 | US FAERS | |
| 214 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 215 | Incorrect drug administration rate | FAERS: 1 | US FAERS | |
| 216 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 217 | Inflammatory pain | FAERS: 1 | US FAERS | |
| 218 | Influenza | FAERS: 1 | US FAERS | |
| 219 | Infusion site rash | FAERS: 1 | US FAERS | |
| 220 | Infusion site swelling | FAERS: 1 | US FAERS | |
| 221 | Injection site extravasation | FAERS: 1 | US FAERS | |
| 222 | Injection site inflammation | FAERS: 1 | US FAERS | |
| 223 | Injection site urticaria | FAERS: 1 | US FAERS | |
| 224 | Injection site vesicles | FAERS: 1 | US FAERS | |
| 225 | Injury associated with device | FAERS: 1 | US FAERS | |
| 226 | Intentional dose omission | FAERS: 1 | US FAERS | |
| 227 | Intentional drug misuse | FAERS: 1 | US FAERS | |
| 228 | Intentional product use issue | FAERS: 1 | US FAERS | |
| 229 | Joint injury | FAERS: 1 | US FAERS | |
| 230 | Joint warmth | FAERS: 1 | US FAERS | |
| 231 | Limb discomfort | FAERS: 1 | US FAERS | |
| 232 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 233 | Malabsorption from application site | FAERS: 1 | US FAERS | |
| 234 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 235 | Medication residue present | FAERS: 1 | US FAERS | |
| 236 | Memory impairment | FAERS: 1 | US FAERS | |
| 237 | Muscle Rigidity | FAERS: 1 | US FAERS | |
| 238 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 239 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 240 | Myalgia | FAERS: 1 | US FAERS | |
| 241 | Mydriasis | FAERS: 1 | US FAERS | |
| 242 | Neck Pain | FAERS: 1 | US FAERS | |
| 243 | Nervousness | FAERS: 1 | US FAERS | |
| 244 | Neurological examination abnormal | FAERS: 1 | US FAERS | |
| 245 | Occupational exposure to product | FAERS: 1 | US FAERS | |
| 246 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 247 | Penile blister | FAERS: 1 | US FAERS | |
| 248 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 249 | Perseveration | FAERS: 1 | US FAERS | |
| 250 | Pneumocephalus | FAERS: 1 | US FAERS | |
| 251 | Posterior reversible encephalopathy syndrome | FAERS: 1 | US FAERS | |
| 252 | Presyncope | FAERS: 1 | US FAERS | |
| 253 | Product adhesion issue | FAERS: 1 | US FAERS | |
| 254 | Product friable | FAERS: 1 | US FAERS | |
| 255 | Product measured potency issue | FAERS: 1 | US FAERS | |
| 256 | Product outer packaging issue | FAERS: 1 | US FAERS | |
| 257 | Product packaging issue | FAERS: 1 | US FAERS | |
| 258 | Product physical issue | FAERS: 1 | US FAERS | |
| 259 | Product preparation error | FAERS: 1 | US FAERS | |
| 260 | Product taste abnormal | FAERS: 1 | US FAERS | |
| 261 | Product use complaint | FAERS: 1 | US FAERS | |
| 262 | Prurigo | FAERS: 1 | US FAERS | |
| 263 | Pulmonary congestion | FAERS: 1 | US FAERS | |
| 264 | Rash erythematous | FAERS: 1 | US FAERS | |
| 265 | Reaction to preservatives | FAERS: 1 | US FAERS | |
| 266 | Respiratory Depression | FAERS: 1 | US FAERS | |
| 267 | Respiratory distress | FAERS: 1 | US FAERS | |
| 268 | Retching | FAERS: 1 | US FAERS | |
| 269 | Retinal Vein Occlusion | FAERS: 1 | US FAERS | |
| 270 | Retinal depigmentation | FAERS: 1 | US FAERS | |
| 271 | Retinal toxicity | FAERS: 1 | US FAERS | |
| 272 | Retinal vascular occlusion | FAERS: 1 | US FAERS | |
| 273 | Rhabdomyolysis | FAERS: 1 | US FAERS | |
| 274 | Rubber sensitivity | FAERS: 1 | US FAERS | |
| 275 | Seizure like phenomena | FAERS: 1 | US FAERS | |
| 276 | Sepsis | FAERS: 1 | US FAERS | |
| 277 | Sick Sinus Syndrome | FAERS: 1 | US FAERS | |
| 278 | Sinus bradycardia | FAERS: 1 | US FAERS | |
| 279 | Skin test positive | FAERS: 1 | US FAERS | |
| 280 | Sneezing | FAERS: 1 | US FAERS | |
| 281 | Staring | FAERS: 1 | US FAERS | |
| 282 | Stomatitis | FAERS: 1 | US FAERS | |
| 283 | Sudden death | FAERS: 1 | US FAERS | |
| 284 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 285 | Syringomyelia | FAERS: 1 | US FAERS | |
| 286 | Therapeutic product effect decreased | FAERS: 1 | US FAERS | |
| 287 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 288 | Thrombosis | FAERS: 1 | US FAERS | |
| 289 | Tinea cruris | FAERS: 1 | US FAERS | |
| 290 | Tonic clonic movements | FAERS: 1 | US FAERS | |
| 291 | Toxicologic test abnormal | FAERS: 1 | US FAERS | |
| 292 | Trigeminal Neuralgia | FAERS: 1 | US FAERS | |
| 293 | Trismus | FAERS: 1 | US FAERS | |
| 294 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 295 | Urticaria Pigmentosa | FAERS: 1 | US FAERS | |
| 296 | Ventricular Fibrillation | FAERS: 1 | US FAERS | |
| 297 | Vocal Cord Paralysis | FAERS: 1 | US FAERS | |
| 298 | Weight decreased | FAERS: 1 | US FAERS | |
| 299 | Wrong product administered | FAERS: 1 | US FAERS | |
| 300 | Wrong product stored | FAERS: 1 | US FAERS | |
| 301 | Sudden Cardiac Death | Canada Vigilance: 1 | Canada Vigilance | |
| 302 | Therapeutic product effect incomplete | Canada Vigilance: 2 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120235
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.