7-amino-12-fluoro-2,10,16-trimethyl-15-oxo-10,15,16,17-tetrahydro-2H-8,4-(metheno)pyrazolo(4,3-h)(2,5,11)benzoxadiazacyclotetradecine-3-carbonitrile
(IIXWYSCJSQVBQM-LLVKDONJSA-N)
Structure
- SMILES
- N#Cc1n(C)nc2c1c1cnc(c(c1)O[C@H](C)c1c(C(=O)N(C2)C)ccc(c1)F)N
- Type(s)
- Approved; Investigational
- ATC code(s)
- L01XE44
- Molecular Formula:
- C21H19FN6O2
- Molecular Weight:
- 406.413
- Log P:
- 3.3198
- Hydrogen Bond Acceptor:
- 8
- Hydrogen Bond Donor:
- 1
- TPSA:
- 110.06
- CAS Number(s):
- 1454846-35-5
Synonym(s)
1.
7-amino-12-fluoro-2,10,16-trimethyl-15-oxo-10,15,16,17-tetrahydro-2H-8,4-(metheno)pyrazolo(4,3-h)(2,5,11)benzoxadiazacyclotetradecine-3-carbonitrile
2.
PF-06463922
3.
PF06463922
4.
lorlatinib
External Link(s)
| MeSH | C000590786 |
| PubChem Compound | 71731823 |
| BindingDB | 50018830 |
| ChEBI | 143117 |
| CHEMBL | CHEMBL3286830 |
| DrugBank | DB12130 |
| IUPHAR/BPS Guide to PHARMACOLOGY | 7476 |
| KEGG | dr:D11012 |
| ZINC | 98208524 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Blood cholesterol increased | FAERS: 10 | US FAERS | |
| 2 | Pneumonia | FAERS: 9 | US FAERS | |
| 3 | Asthenia | FAERS: 5 | US FAERS | |
| 4 | Blood triglycerides increased | FAERS: 4 | US FAERS | |
| 5 | Low density lipoprotein increased | FAERS: 4 | US FAERS | |
| 6 | Malaise | FAERS: 4 | US FAERS | |
| 7 | Nephrotic Syndrome | FAERS: 4 | US FAERS | |
| 8 | Pulmonary Embolism | FAERS: 4 | US FAERS | |
| 9 | Altered state of consciousness | FAERS: 3 | US FAERS | |
| 10 | Amnesia | FAERS: 3 | US FAERS | |
| 11 | Aphasia | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 12 | Blood glucose increased | FAERS: 3 | US FAERS | |
| 13 | Delirium | FAERS: 3 | US FAERS | |
| 14 | Feeling abnormal | FAERS: 3 | US FAERS | |
| 15 | Neutropenia | FAERS: 3 | US FAERS | |
| 16 | Pneumonitis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 17 | Thrombocytopenia | FAERS: 3 | US FAERS | |
| 18 | Urinary tract infection | FAERS: 3 | US FAERS | |
| 19 | Visual Impairment | FAERS: 3 | US FAERS | |
| 20 | nervous system disorder | FAERS: 3 | US FAERS | |
| 21 | Alanine Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 22 | Arthralgia | FAERS: 2 | US FAERS | |
| 23 | Aspartate Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 24 | Atrioventricular Block | FAERS: 2 | US FAERS | |
| 25 | Autoimmune colitis | FAERS: 2 | US FAERS | |
| 26 | Burning sensation | FAERS: 2 | US FAERS | |
| 27 | Cerebrovascular accident | FAERS: 2 | US FAERS | |
| 28 | Compression fracture | FAERS: 2 | US FAERS | |
| 29 | Deep Vein Thrombosis | FAERS: 2 | US FAERS | |
| 30 | Dehydration | FAERS: 2 | US FAERS | |
| 31 | Dizziness | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 32 | Epilepsy | FAERS: 2 | US FAERS | |
| 33 | Facial paralysis | FAERS: 2 | US FAERS | |
| 34 | Fatigue | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 35 | Gait inability | FAERS: 2 | US FAERS | |
| 36 | General physical health deterioration | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 37 | Headache | FAERS: 2 | US FAERS | |
| 38 | Hypoxia | FAERS: 2 | US FAERS | |
| 39 | Leukopenia | FAERS: 2 | US FAERS | |
| 40 | Mental status changes | FAERS: 2 | US FAERS | |
| 41 | Nasopharyngitis | FAERS: 2 | US FAERS | |
| 42 | Nausea | FAERS: 2 | US FAERS | |
| 43 | Pericardial effusion | FAERS: 2 | US FAERS | |
| 44 | Respiratory Failure | FAERS: 2 | US FAERS | |
| 45 | Sepsis | FAERS: 2 | US FAERS | |
| 46 | Stomatitis | FAERS: 2 | US FAERS | |
| 47 | Swelling | FAERS: 2 | US FAERS | |
| 48 | Therapy cessation | FAERS: 2 | US FAERS | |
| 49 | Abdominal Pain | FAERS: 1 | US FAERS | |
| 50 | Agitation | FAERS: 1 | US FAERS | |
| 51 | Albuminuria | FAERS: 1 | US FAERS | |
| 52 | Anger | FAERS: 1 | US FAERS | |
| 53 | Anosmia | FAERS: 1 | US FAERS | |
| 54 | Anxiety | FAERS: 1 | US FAERS | |
| 55 | Asthma | FAERS: 1 | US FAERS | |
| 56 | Back Pain | FAERS: 1 | US FAERS | |
| 57 | Basilar artery thrombosis | FAERS: 1 | US FAERS | |
| 58 | Blood albumin decreased | FAERS: 1 | US FAERS | |
| 59 | Blood alkaline phosphatase increased | FAERS: 1 | US FAERS | |
| 60 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 61 | Bradycardia | FAERS: 1 | US FAERS | |
| 62 | Brain Abscess | FAERS: 1 | US FAERS | |
| 63 | Carcinoembryonic antigen increased | FAERS: 1 | US FAERS | |
| 64 | Cardiac Tamponade | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 65 | Cauda Equina Syndrome | FAERS: 1 | US FAERS | |
| 66 | Cellulitis | FAERS: 1 | US FAERS | |
| 67 | Cerebral Infarction | FAERS: 1 | US FAERS | |
| 68 | Chest Pain | FAERS: 1 | US FAERS | |
| 69 | Chest discomfort | FAERS: 1 | US FAERS | |
| 70 | Choking sensation | FAERS: 1 | US FAERS | |
| 71 | Constipation | FAERS: 1 | US FAERS | |
| 72 | Crying | FAERS: 1 | US FAERS | |
| 73 | Dementia | FAERS: 1 | US FAERS | |
| 74 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 75 | Device related infection | FAERS: 1 | US FAERS | |
| 76 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 77 | Dysphonia | FAERS: 1 | US FAERS | |
| 78 | Emergency Care | FAERS: 1 | US FAERS | |
| 79 | Endocarditis | FAERS: 1 | US FAERS | |
| 80 | Enteritis | FAERS: 1 | US FAERS | |
| 81 | Epistaxis | FAERS: 1 | US FAERS | |
| 82 | Flatulence | FAERS: 1 | US FAERS | |
| 83 | Food craving | FAERS: 1 | US FAERS | |
| 84 | Hemiparesis | FAERS: 1 | US FAERS | |
| 85 | Hemiplegia | FAERS: 1 | US FAERS | |
| 86 | Inflammation | FAERS: 1 | US FAERS | |
| 87 | Influenza | FAERS: 1 | US FAERS | |
| 88 | Joint stiffness | FAERS: 1 | US FAERS | |
| 89 | Joint swelling | FAERS: 1 | US FAERS | |
| 90 | Limb discomfort | FAERS: 1 | US FAERS | |
| 91 | Malignant neoplasm progression | FAERS: 1 | US FAERS | |
| 92 | Myelitis | FAERS: 1 | US FAERS | |
| 93 | Myocardial Infarction | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 94 | Neck Pain | FAERS: 1 | US FAERS | |
| 95 | Nervousness | FAERS: 1 | US FAERS | |
| 96 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 97 | Pain | FAERS: 1 | US FAERS | |
| 98 | Palpable purpura | FAERS: 1 | US FAERS | |
| 99 | Pancytopenia | FAERS: 1 | US FAERS | |
| 100 | Paranasal sinus hypersecretion | FAERS: 1 | US FAERS | |
| 101 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 102 | Pharyngeal swelling | FAERS: 1 | US FAERS | |
| 103 | Pleuritic pain | FAERS: 1 | US FAERS | |
| 104 | Poor quality product administered | FAERS: 1 | US FAERS | |
| 105 | Product dose omission | FAERS: 1 | US FAERS | |
| 106 | Product quality issue | FAERS: 1 | US FAERS | |
| 107 | Product use in unapproved indication | FAERS: 1 | US FAERS | |
| 108 | Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 109 | Pulmonary arterial hypertension | FAERS: 1 | US FAERS | |
| 110 | Quadriplegia | FAERS: 1 | US FAERS | |
| 111 | Rhabdomyolysis | FAERS: 1 | US FAERS | |
| 112 | Rosacea | FAERS: 1 | US FAERS | |
| 113 | Sinus pain | FAERS: 1 | US FAERS | |
| 114 | Slow speech | FAERS: 1 | US FAERS | |
| 115 | Thrombosis | FAERS: 1 | US FAERS | |
| 116 | Trousseau's syndrome | FAERS: 1 | US FAERS | |
| 117 | Unevaluable event | FAERS: 1 | US FAERS | |
| 118 | Weight decreased | FAERS: 1 | US FAERS | |
| 119 | Wrong dose | FAERS: 1 | US FAERS | |
| 120 | jaundice | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120240
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.