methylnaltrexone
(IFGIYSGOEZJNBE-KNLJMPJLSA-N)
Structure
- SMILES
- O=C1CC[C@@]2([C@@]34[C@H]1Oc1c4c(C[C@H]2[N+](CC3)(C)CC2CC2)ccc1O)O.[Br-]
- Molecular Formula:
- C21H26BrNO4
- Molecular Weight:
- 436.339
- Log P:
- -1.3672
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 2
- TPSA:
- 66.76
- CAS Number(s):
- 73232-52-7
Synonym(s)
1.
methylnaltrexone
2.
(5alpha)-17-(cyclopropylmethyl)-3,14-dihydroxy-17-methyl-4,5-epoxymorphinan-17-ium-6-one
3.
17-(cyclopropylmethyl)-4,5-epoxy-3,14-dihydroxymorphinanium-6-one
4.
MRZ 2663BR
5.
MRZ-2663
6.
N-methylnaltrexone bromide
7.
Relistor
8.
methyl-naltrexone hydrobromide
9.
methylnaltrexone bromide
10.
morphinan-17-ium-6-one, 17-(cyclopropylmethyl)-4,5-epoxy-3,14-dihydroxy-17-methyl-, (5alpha)-
11.
morphinan-17-ium-6-one, 17-(cyclopropylmethyl)-4,5-epoxy-3,14-dihydroxy-17-methyl-, bromide, (5alpha,17R)-
12.
morphinanium, 17-(cyclopropylmethyl)-4,5-epoxy-3,14-dihydroxy-17-methyl-6-oxo-, (5alpha)-
13.
naltrexone MB
14.
naltrexone methobromide
15.
naltrexone methylbromide
16.
naltrexonium methiodide
17.
quaternary ammonium naltrexone
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 68 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 2 | Abdominal Pain | FAERS: 23 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 3 | Headache | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 4 | Nausea | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 5 | Vomiting | FAERS: 13 | US FAERS | |
| 6 | Drug effect incomplete | FAERS: 11 | US FAERS | |
| 7 | Feeling abnormal | FAERS: 9 | US FAERS | |
| 8 | Pain | FAERS: 9 | US FAERS | |
| 9 | Constipation | FAERS: 8 | US FAERS | |
| 10 | Flushing | FAERS: 8 | US FAERS | |
| 11 | Chest Pain | FAERS: 7 | US FAERS | |
| 12 | Drug withdrawal syndrome | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 13 | Incorrect route of drug administration | FAERS: 7 | US FAERS | |
| 14 | Intestinal Perforation | FAERS: 7 | US FAERS | |
| 15 | Malaise | FAERS: 7 | US FAERS | |
| 16 | Chills | FAERS: 6 | US FAERS | |
| 17 | Drug dose omission | FAERS: 6 | US FAERS | |
| 18 | Therapy cessation | FAERS: 6 | US FAERS | |
| 19 | Dehydration | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 20 | Inability to afford medication | FAERS: 5 | US FAERS | |
| 21 | No adverse event | FAERS: 5 | US FAERS | |
| 22 | Product packaging issue | FAERS: 5 | US FAERS | |
| 23 | Syringe issue | FAERS: 5 | US FAERS | |
| 24 | Tachycardia | FAERS: 5 | US FAERS | |
| 25 | Anxiety | FAERS: 4 | US FAERS | |
| 26 | Dizziness | FAERS: 4 | US FAERS | |
| 27 | Injection site injury | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 28 | Large intestine perforation | FAERS: 4 | US FAERS | |
| 29 | Needle issue | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 30 | Product quality issue | FAERS: 4 | US FAERS | |
| 31 | Abdominal discomfort | FAERS: 3 | US FAERS | |
| 32 | Abdominal rigidity | FAERS: 3 | US FAERS | |
| 33 | Asthenia | FAERS: 3 | US FAERS | |
| 34 | Bowel movement irregularity | FAERS: 3 | US FAERS | |
| 35 | Burning sensation | FAERS: 3 | US FAERS | |
| 36 | Discomfort | FAERS: 3 | US FAERS | |
| 37 | Drug prescribing error | FAERS: 3 | US FAERS | |
| 38 | Erythema | FAERS: 3 | US FAERS | |
| 39 | Feeling Cold | FAERS: 3 | US FAERS | |
| 40 | Hypotension | FAERS: 3 | US FAERS | |
| 41 | Injection site pain | FAERS: 3 | US FAERS | |
| 42 | Insurance issue | FAERS: 3 | US FAERS | |
| 43 | Respiratory distress | FAERS: 3 | US FAERS | |
| 44 | Tremor | FAERS: 3 | US FAERS | |
| 45 | Weight decreased | FAERS: 3 | US FAERS | |
| 46 | Accidental exposure to product | FAERS: 2 | US FAERS | |
| 47 | Angina Pectoris | FAERS: 2 | US FAERS | |
| 48 | Bronchitis | FAERS: 2 | US FAERS | |
| 49 | Cold sweat | FAERS: 2 | US FAERS | |
| 50 | Device malfunction | FAERS: 2 | US FAERS | |
| 51 | Drug effect variable | FAERS: 2 | US FAERS | |
| 52 | Drug effective for unapproved indication | FAERS: 2 | US FAERS | |
| 53 | Drug ineffective for unapproved indication | FAERS: 2 | US FAERS | |
| 54 | Fatigue | FAERS: 2 | US FAERS | |
| 55 | Flatulence | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 56 | Hospice Care | FAERS: 2 | US FAERS | |
| 57 | Incorrect dose administered | FAERS: 2 | US FAERS | |
| 58 | Intestinal Obstruction | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 59 | Intussusception | FAERS: 2 | US FAERS | |
| 60 | Liquid product physical issue | FAERS: 2 | US FAERS | |
| 61 | Memory impairment | FAERS: 2 | US FAERS | |
| 62 | Product supply issue | FAERS: 2 | US FAERS | |
| 63 | Sepsis | FAERS: 2 | US FAERS | |
| 64 | Septic Shock | FAERS: 2 | US FAERS | |
| 65 | Therapeutic product effect incomplete | FAERS: 2 | US FAERS | |
| 66 | Therapeutic response unexpected | FAERS: 2 | US FAERS | |
| 67 | Urinary tract infection | FAERS: 2 | US FAERS | |
| 68 | Acidosis | FAERS: 1 | US FAERS | |
| 69 | Adverse event | FAERS: 1 | US FAERS | |
| 70 | Agitation | FAERS: 1 | US FAERS | |
| 71 | Application site erythema | FAERS: 1 | US FAERS | |
| 72 | Application site pain | FAERS: 1 | US FAERS | |
| 73 | Back Pain | FAERS: 1 | US FAERS | |
| 74 | Bedridden | FAERS: 1 | US FAERS | |
| 75 | Blood creatinine increased | FAERS: 1 | US FAERS | |
| 76 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 77 | Bradycardia | FAERS: 1 | US FAERS | |
| 78 | Catheter site pain | FAERS: 1 | US FAERS | |
| 79 | Cervix carcinoma | FAERS: 1 | US FAERS | |
| 80 | Chest discomfort | FAERS: 1 | US FAERS | |
| 81 | Conjunctivitis | FAERS: 1 | US FAERS | |
| 82 | Creatinine renal clearance decreased | FAERS: 1 | US FAERS | |
| 83 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 84 | Disease Progression | FAERS: 1 | US FAERS | |
| 85 | Drug Tolerance | FAERS: 1 | US FAERS | |
| 86 | Drug administration error | FAERS: 1 | US FAERS | |
| 87 | Drug screen positive | FAERS: 1 | US FAERS | |
| 88 | Dysgeusia | FAERS: 1 | US FAERS | |
| 89 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 90 | Emotional distress | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 91 | Expired product administered | FAERS: 1 | US FAERS | |
| 92 | Eye Infection | FAERS: 1 | US FAERS | |
| 93 | Eyelid margin crusting | FAERS: 1 | US FAERS | |
| 94 | Feeling of body temperature change | FAERS: 1 | US FAERS | |
| 95 | Gait inability | FAERS: 1 | US FAERS | |
| 96 | Gastrectomy | FAERS: 1 | US FAERS | |
| 97 | Gastroenteritis | FAERS: 1 | US FAERS | |
| 98 | Gastrointestinal hypomotility | FAERS: 1 | US FAERS | |
| 99 | Gastrointestinal motility disorder | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 100 | Gastrointestinal perforation | FAERS: 1 | US FAERS | |
| 101 | Genital erythema | FAERS: 1 | US FAERS | |
| 102 | Genital swelling | FAERS: 1 | US FAERS | |
| 103 | Hepatic cancer metastatic | FAERS: 1 | US FAERS | |
| 104 | Hernia | FAERS: 1 | US FAERS | |
| 105 | Hypokinesia | FAERS: 1 | US FAERS | |
| 106 | Hypoxia | FAERS: 1 | US FAERS | |
| 107 | Influenza | FAERS: 1 | US FAERS | |
| 108 | Infrequent bowel movements | FAERS: 1 | US FAERS | |
| 109 | Injection site bruising | FAERS: 1 | US FAERS | |
| 110 | Injection site erythema | FAERS: 1 | US FAERS | |
| 111 | Injection site mass | FAERS: 1 | US FAERS | |
| 112 | Injection site papule | FAERS: 1 | US FAERS | |
| 113 | Injury associated with device | FAERS: 1 | US FAERS | |
| 114 | Leukocytosis | FAERS: 1 | US FAERS | |
| 115 | Medical device removal | FAERS: 1 | US FAERS | |
| 116 | Mental status changes | FAERS: 1 | US FAERS | |
| 117 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 118 | Nephrolithiasis | FAERS: 1 | US FAERS | |
| 119 | Overdose | FAERS: 1 | US FAERS | |
| 120 | Pallor | FAERS: 1 | US FAERS | |
| 121 | Palpitations | FAERS: 1 | US FAERS | |
| 122 | Perforated ulcer | FAERS: 1 | US FAERS | |
| 123 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 124 | Presyncope | FAERS: 1 | US FAERS | |
| 125 | Product packaging quantity issue | FAERS: 1 | US FAERS | |
| 126 | Product use complaint | FAERS: 1 | US FAERS | |
| 127 | Productive Cough | FAERS: 1 | US FAERS | |
| 128 | Pruritus | FAERS: 1 | US FAERS | |
| 129 | Pulmonary pain | FAERS: 1 | US FAERS | |
| 130 | Restlessness | FAERS: 1 | US FAERS | |
| 131 | Screaming | FAERS: 1 | US FAERS | |
| 132 | Shock | FAERS: 1 | US FAERS | |
| 133 | Skin hypertrophy | FAERS: 1 | US FAERS | |
| 134 | Squamous cell carcinoma | FAERS: 1 | US FAERS | |
| 135 | Syncope | FAERS: 1 | US FAERS | |
| 136 | Terminal state | FAERS: 1 | US FAERS | |
| 137 | Therapeutic response delayed | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 138 | Thirst | FAERS: 1 | US FAERS | |
| 139 | Throat irritation | FAERS: 1 | US FAERS | |
| 140 | Thrombosis | FAERS: 1 | US FAERS | |
| 141 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 142 | Wrong technique in product usage process | FAERS: 1 | US FAERS | |
| 143 | treatment failure | FAERS: 1 | US FAERS | |
| 144 | Product complaint | Canada Vigilance: 1 | Canada Vigilance | |
| 145 | Therapeutic product effect decreased | Canada Vigilance: 2 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.