Quinapril
(IBBLRJGOOANPTQ-JKVLGAQCSA-N)
Structure
- SMILES
- CCOC(=O)[C@@H](N[C@H](C(=O)N1Cc2ccccc2C[C@H]1C(=O)O)C)CCc1ccccc1.Cl
- Molecular Formula:
- C25H31ClN2O5
- Molecular Weight:
- 474.977
- Log P:
- 3.6979
- Hydrogen Bond Acceptor:
- 7
- Hydrogen Bond Donor:
- 3
- TPSA:
- 95.94
- CAS Number(s):
- 82586-55-8
Synonym(s)
1.
Quinapril
2.
2-(2-((1-(Ethoxycarbonyl)-3-phenylpropyl)amino)-1-oxopropyl)-1,2,3,4-tetrahydro-3-isoquinolinecarboxylic acid
3.
Accupril
4.
CI 906
5.
CI-906
6.
PD 109452-2
7.
PD-109,452-2
8.
Quinapril Hydrochloride
9.
PD 109,452 2
10.
PD 109452 2
11.
PD 1094522
External Link(s)
| MeSH | D000077583 |
| PubChem Compound | 54891 |
| ChEBI | 8714 |
| CHEMBL | CHEMBL1201011 |
| KEGG | cpd:C07340 dr:D00459 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 32 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 2 | Dizziness | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 3 | Malaise | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 4 | Blood pressure inadequately controlled | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 5 | Diabetes Mellitus | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 6 | Headache | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 7 | Angioedema | FAERS: 10 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 8 | Hypersensitivity | FAERS: 10 | US FAERS | |
| 9 | Feeling abnormal | FAERS: 9 | US FAERS | |
| 10 | Cerebrovascular accident | FAERS: 8 | US FAERS | |
| 11 | Fatigue | FAERS: 8 | US FAERS | |
| 12 | Medication Error | FAERS: 7 | US FAERS | |
| 13 | Nausea | FAERS: 7 | US FAERS | |
| 14 | Blood glucose increased | FAERS: 6 | US FAERS | |
| 15 | Medication residue | FAERS: 6 | US FAERS | |
| 16 | Nasopharyngitis | FAERS: 6 | US FAERS | |
| 17 | Urticaria | FAERS: 6 | US FAERS | |
| 18 | Vomiting | FAERS: 6 | US FAERS | |
| 19 | Blood triglycerides increased | FAERS: 5 | US FAERS | |
| 20 | Drug dose omission | FAERS: 5 | US FAERS | |
| 21 | Pain | FAERS: 5 | US FAERS | |
| 22 | Weight decreased | FAERS: 5 | US FAERS | |
| 23 | Chest Pain | FAERS: 4 | US FAERS | |
| 24 | Dyspepsia | FAERS: 4 | US FAERS | |
| 25 | Myocardial Infarction | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 26 | No adverse event | FAERS: 4 | US FAERS | |
| 27 | Pharmaceutical product complaint | FAERS: 4 | US FAERS | |
| 28 | Pruritus | FAERS: 4 | US FAERS | |
| 29 | Swelling | FAERS: 4 | US FAERS | |
| 30 | Vertigo | FAERS: 4 | US FAERS | |
| 31 | Alopecia | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 32 | Amnesia | FAERS: 3 | US FAERS | |
| 33 | Anxiety | FAERS: 3 | US FAERS | |
| 34 | Blood cholesterol increased | FAERS: 3 | US FAERS | |
| 35 | Dehydration | FAERS: 3 | US FAERS | |
| 36 | Drug dispensing error | FAERS: 3 | US FAERS | |
| 37 | Flushing | FAERS: 3 | US FAERS | |
| 38 | Hypotension | FAERS: 3 | US FAERS | |
| 39 | Infection | FAERS: 3 | US FAERS | |
| 40 | Joint swelling | FAERS: 3 | US FAERS | |
| 41 | Lip swelling | FAERS: 3 | US FAERS | |
| 42 | Nervousness | FAERS: 3 | US FAERS | |
| 43 | Palpitations | FAERS: 3 | US FAERS | |
| 44 | Pneumonia | FAERS: 3 | US FAERS | |
| 45 | Therapeutic response unexpected with drug substitution | FAERS: 3 | US FAERS | |
| 46 | Throat cancer | FAERS: 3 | US FAERS | |
| 47 | Tremor | FAERS: 3 | US FAERS | |
| 48 | Abasia | FAERS: 2 | US FAERS | |
| 49 | Abdominal discomfort | FAERS: 2 | US FAERS | |
| 50 | Activities of daily living impaired | FAERS: 2 | US FAERS | |
| 51 | Aphasia | FAERS: 2 | US FAERS | |
| 52 | Arthralgia | FAERS: 2 | US FAERS | |
| 53 | Arthropathy | FAERS: 2 | US FAERS | |
| 54 | Asthenia | FAERS: 2 | US FAERS | |
| 55 | Atrial Fibrillation | FAERS: 2 | US FAERS | |
| 56 | Back Pain | FAERS: 2 | US FAERS | |
| 57 | Back disorder | FAERS: 2 | US FAERS | |
| 58 | Blood creatinine increased | FAERS: 2 | US FAERS | |
| 59 | Bronchitis | FAERS: 2 | US FAERS | |
| 60 | Cardiac Arrest | FAERS: 2 | US FAERS | |
| 61 | Creatinine renal clearance decreased | FAERS: 2 | US FAERS | |
| 62 | Diabetic Retinopathy | FAERS: 2 | US FAERS | |
| 63 | Disorientation | FAERS: 2 | US FAERS | |
| 64 | Drug Dependence | FAERS: 2 | US FAERS | |
| 65 | Epistaxis | FAERS: 2 | US FAERS | |
| 66 | Erythema | FAERS: 2 | US FAERS | |
| 67 | Gastric infection | FAERS: 2 | US FAERS | |
| 68 | General physical health deterioration | FAERS: 2 | US FAERS | |
| 69 | Intentional product misuse | FAERS: 2 | US FAERS | |
| 70 | Nephrolithiasis | FAERS: 2 | US FAERS | |
| 71 | Pharyngitis | FAERS: 2 | US FAERS | |
| 72 | Product quality issue | FAERS: 2 | US FAERS | |
| 73 | Product substitution issue | FAERS: 2 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 74 | Respiratory distress | FAERS: 2 | US FAERS | |
| 75 | Sjogren's Syndrome | FAERS: 2 | US FAERS | |
| 76 | Sluggishness | FAERS: 2 | US FAERS | |
| 77 | Somnolence | FAERS: 2 | US FAERS | |
| 78 | Stress | FAERS: 2 | US FAERS | |
| 79 | Throat irritation | FAERS: 2 | US FAERS | |
| 80 | Urinary tract infection | FAERS: 2 | US FAERS | |
| 81 | Wrong technique in product usage process | FAERS: 2 | US FAERS | |
| 82 | Agitation | FAERS: 1 | US FAERS | |
| 83 | Amylase increased | FAERS: 1 | US FAERS | |
| 84 | Anaphylactic shock | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 85 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 86 | Anosmia | FAERS: 1 | US FAERS | |
| 87 | Apparent death | FAERS: 1 | US FAERS | |
| 88 | Arthritis | FAERS: 1 | US FAERS | |
| 89 | Arthropod bite | FAERS: 1 | US FAERS | |
| 90 | Asthma | FAERS: 1 | US FAERS | |
| 91 | Biliary Colic | FAERS: 1 | US FAERS | |
| 92 | Biliary cirrhosis | FAERS: 1 | US FAERS | |
| 93 | Bipolar Disorder | FAERS: 1 | US FAERS | |
| 94 | Bladder cancer recurrent | FAERS: 1 | US FAERS | |
| 95 | Blood creatine increased | FAERS: 1 | US FAERS | |
| 96 | Blood magnesium increased | FAERS: 1 | US FAERS | |
| 97 | Blood potassium increased | FAERS: 1 | US FAERS | |
| 98 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 99 | Blood sodium increased | FAERS: 1 | US FAERS | |
| 100 | Brain Death | FAERS: 1 | US FAERS | |
| 101 | Bronchopneumonia | FAERS: 1 | US FAERS | |
| 102 | Bronchospasm | FAERS: 1 | US FAERS | |
| 103 | Burning sensation | FAERS: 1 | US FAERS | |
| 104 | Cervical cord compression | FAERS: 1 | US FAERS | |
| 105 | Chest discomfort | FAERS: 1 | US FAERS | |
| 106 | Chills | FAERS: 1 | US FAERS | |
| 107 | Choking | FAERS: 1 | US FAERS | |
| 108 | Cholelithiasis | FAERS: 1 | US FAERS | |
| 109 | Constipation | FAERS: 1 | US FAERS | |
| 110 | Corneal lesion | FAERS: 1 | US FAERS | |
| 111 | Corrective lens user | FAERS: 1 | US FAERS | |
| 112 | Cystitis | FAERS: 1 | US FAERS | |
| 113 | Dementia | FAERS: 1 | US FAERS | |
| 114 | Dysarthria | FAERS: 1 | US FAERS | |
| 115 | Dysgraphia | FAERS: 1 | US FAERS | |
| 116 | Eczema | FAERS: 1 | US FAERS | |
| 117 | Epilepsy | FAERS: 1 | US FAERS | |
| 118 | Erectile dysfunction | FAERS: 1 | US FAERS | |
| 119 | Fracture | FAERS: 1 | US FAERS | |
| 120 | Gait inability | FAERS: 1 | US FAERS | |
| 121 | Glomerulonephritis | FAERS: 1 | US FAERS | |
| 122 | Gout | FAERS: 1 | US FAERS | |
| 123 | Head discomfort | FAERS: 1 | US FAERS | |
| 124 | Hernia | FAERS: 1 | US FAERS | |
| 125 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 126 | Impaired gastric emptying | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 127 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 128 | Increased upper airway secretion | FAERS: 1 | US FAERS | |
| 129 | Intentional drug misuse | FAERS: 1 | US FAERS | |
| 130 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 131 | Intestinal Obstruction | FAERS: 1 | US FAERS | |
| 132 | Intracranial Aneurysm | FAERS: 1 | US FAERS | |
| 133 | Limb discomfort | FAERS: 1 | US FAERS | |
| 134 | MYELODYSPLASTIC SYNDROME | FAERS: 1 | US FAERS | |
| 135 | Macular degeneration | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 136 | Medication residue present | FAERS: 1 | US FAERS | |
| 137 | Monoplegia | FAERS: 1 | US FAERS | |
| 138 | Multiple allergies | FAERS: 1 | US FAERS | |
| 139 | Muscle enzyme increased | FAERS: 1 | US FAERS | |
| 140 | Muscle strain | FAERS: 1 | US FAERS | |
| 141 | Musculoskeletal discomfort | FAERS: 1 | US FAERS | |
| 142 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 143 | Myalgia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 144 | Night sweats | FAERS: 1 | US FAERS | |
| 145 | Nodule | FAERS: 1 | US FAERS | |
| 146 | Overdose | FAERS: 1 | US FAERS | |
| 147 | Pancreatic Pseudocyst | FAERS: 1 | US FAERS | |
| 148 | Pancreatitis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 149 | Pancytopenia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 150 | Pharyngolaryngeal discomfort | FAERS: 1 | US FAERS | |
| 151 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 152 | Post procedural complication | FAERS: 1 | US FAERS | |
| 153 | Post procedural pneumonia | FAERS: 1 | US FAERS | |
| 154 | Presyncope | FAERS: 1 | US FAERS | |
| 155 | Product use issue | FAERS: 1 | US FAERS | |
| 156 | Psoriasis | FAERS: 1 | US FAERS | |
| 157 | Psychomotor skills impaired | FAERS: 1 | US FAERS | |
| 158 | Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 159 | Pulmonary Hypertension | FAERS: 1 | US FAERS | |
| 160 | Reaction to drug excipients | FAERS: 1 | US FAERS | |
| 161 | Renal Artery Stenosis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 162 | Renal cyst | FAERS: 1 | US FAERS | |
| 163 | Suicide attempt | FAERS: 1 | US FAERS | |
| 164 | Suspected counterfeit product | FAERS: 1 | US FAERS | |
| 165 | Syncope | FAERS: 1 | US FAERS | |
| 166 | Thrombosis | FAERS: 1 | US FAERS | |
| 167 | Toothache | FAERS: 1 | US FAERS | |
| 168 | Urinary Incontinence | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 169 | Urine output increased | FAERS: 1 | US FAERS | |
| 170 | Visual disturbance | FAERS: 1 | US FAERS | |
| 171 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 172 | Acute kidney injury | Canada Vigilance: 1 | Canada Vigilance | |
| 173 | Alanine Aminotransferase Increased | Canada Vigilance: 1 | Canada Vigilance | |
| 174 | Crying | Canada Vigilance: 1 | Canada Vigilance | |
| 175 | Gamma-Glutamyltransferase Increased | Canada Vigilance: 1 | Canada Vigilance | |
| 176 | Hepatic necrosis | Canada Vigilance: 1 | Canada Vigilance | |
| 177 | Metastasis | Canada Vigilance: 1 | Canada Vigilance | |
| 178 | Pericardial effusion | Canada Vigilance: 1 | Canada Vigilance | |
| 179 | Product residue present | Canada Vigilance: 1 | Canada Vigilance | |
| 180 | Tinnitus | Canada Vigilance: 1 | Canada Vigilance | |
| 181 | Visual Impairment | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.