Homoharringtonine
(HYFHYPWGAURHIV-JFIAXGOJSA-N)
Structure
- SMILES
- COC(=O)C[C@@](C(=O)O[C@@H]1C(=C[C@]23[C@@H]1c1cc4OCOc4cc1CCN3CCC2)OC)(CCCC(O)(C)C)O
- Type(s)
- Approved; Investigational
- ATC code(s)
- L01XX40
- Molecular Formula:
- C29H39NO9
- Molecular Weight:
- 545.621
- Log P:
- 2.5186
- Hydrogen Bond Acceptor:
- 10
- Hydrogen Bond Donor:
- 2
- TPSA:
- 123.99
- CAS Number(s):
- 26833-87-4
Synonym(s)
1.
Homoharringtonine
2.
Ceflatonin
3.
Cephalotaxine
4.
Homoharringtonine (3(R))-isomer
5.
Omacetaxine
6.
Omacetaxine Mepesuccinate
7.
Synribo
External Link(s)
| MeSH | D000077863 |
| PubChem Compound | 285033 |
| ChEBI | 71019 |
| CHEMBL | CHEMBL46286 |
| DrugBank | DB04865 |
| DrugCentral | 4677 |
| IUPHAR/BPS Guide to PHARMACOLOGY | 7454 |
| KEGG | dr:D08956 |
| Therapeutic Target Database | D0M4XY |
| ZINC | 26011099 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Nausea | FAERS: 24 | US FAERS | |
| 2 | Injection site erythema | FAERS: 19 | US FAERS | |
| 3 | Fatigue | FAERS: 14 | US FAERS | |
| 4 | Drug ineffective | FAERS: 13 | US FAERS | |
| 5 | White blood cell count decreased | FAERS: 12 | US FAERS | |
| 6 | Blood count abnormal | FAERS: 11 | US FAERS | |
| 7 | Neutropenia | FAERS: 11 | US FAERS | |
| 8 | Vomiting | FAERS: 11 | US FAERS | |
| 9 | Headache | FAERS: 10 | US FAERS | |
| 10 | Pancytopenia | FAERS: 10 | US FAERS | |
| 11 | Injection site pain | FAERS: 9 | US FAERS | |
| 12 | Asthenia | FAERS: 8 | US FAERS | |
| 13 | Drug dose omission | FAERS: 7 | US FAERS | |
| 14 | Disease Progression | FAERS: 6 | US FAERS | |
| 15 | Incorrect dose administered | FAERS: 6 | US FAERS | |
| 16 | Abdominal Pain | FAERS: 5 | US FAERS | |
| 17 | Sepsis | FAERS: 5 | US FAERS | |
| 18 | Adverse event | FAERS: 4 | US FAERS | |
| 19 | Alopecia | FAERS: 4 | US FAERS | |
| 20 | Blood glucose increased | FAERS: 4 | US FAERS | |
| 21 | Cellulitis | FAERS: 4 | US FAERS | |
| 22 | Chills | FAERS: 4 | US FAERS | |
| 23 | Dizziness | FAERS: 4 | US FAERS | |
| 24 | Febrile Neutropenia | FAERS: 4 | US FAERS | |
| 25 | Injection site irritation | FAERS: 4 | US FAERS | |
| 26 | Injection site pruritus | FAERS: 4 | US FAERS | |
| 27 | Neutrophil count decreased | FAERS: 4 | US FAERS | |
| 28 | Pain | FAERS: 4 | US FAERS | |
| 29 | Pneumonia | FAERS: 4 | US FAERS | |
| 30 | Product use issue | FAERS: 4 | US FAERS | |
| 31 | Dehydration | FAERS: 3 | US FAERS | |
| 32 | Full blood count decreased | FAERS: 3 | US FAERS | |
| 33 | Injection Site Reaction | FAERS: 3 | US FAERS | |
| 34 | Injection site bruising | FAERS: 3 | US FAERS | |
| 35 | Myalgia | FAERS: 3 | US FAERS | |
| 36 | Urticaria | FAERS: 3 | US FAERS | |
| 37 | Activities of daily living impaired | FAERS: 2 | US FAERS | |
| 38 | Agranulocytosis | FAERS: 2 | US FAERS | |
| 39 | Bone marrow toxicity | FAERS: 2 | US FAERS | |
| 40 | Drug dispensing error | FAERS: 2 | US FAERS | |
| 41 | Drug ineffective for unapproved indication | FAERS: 2 | US FAERS | |
| 42 | Erythema | FAERS: 2 | US FAERS | |
| 43 | Expired product administered | FAERS: 2 | US FAERS | |
| 44 | Gout | FAERS: 2 | US FAERS | |
| 45 | Hemiparesis | FAERS: 2 | US FAERS | |
| 46 | Hypersensitivity | FAERS: 2 | US FAERS | |
| 47 | Hypotension | FAERS: 2 | US FAERS | |
| 48 | Infection | FAERS: 2 | US FAERS | |
| 49 | Injection site exfoliation | FAERS: 2 | US FAERS | |
| 50 | Injury associated with device | FAERS: 2 | US FAERS | |
| 51 | Personality Change | FAERS: 2 | US FAERS | |
| 52 | Pruritus | FAERS: 2 | US FAERS | |
| 53 | Rash erythematous | FAERS: 2 | US FAERS | |
| 54 | Somnolence | FAERS: 2 | US FAERS | |
| 55 | Swelling | FAERS: 2 | US FAERS | |
| 56 | Thrombocytopenia | FAERS: 2 | US FAERS | |
| 57 | Toxicity to various agents | FAERS: 2 | US FAERS | |
| 58 | Transplant | FAERS: 2 | US FAERS | |
| 59 | Weight decreased | FAERS: 2 | US FAERS | |
| 60 | treatment failure | FAERS: 2 | US FAERS | |
| 61 | Abasia | FAERS: 1 | US FAERS | |
| 62 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 63 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 64 | Acute Coronary Syndrome | FAERS: 1 | US FAERS | |
| 65 | Ageusia | FAERS: 1 | US FAERS | |
| 66 | Application site erythema | FAERS: 1 | US FAERS | |
| 67 | Application site irritation | FAERS: 1 | US FAERS | |
| 68 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 69 | Blood creatinine abnormal | FAERS: 1 | US FAERS | |
| 70 | Blood iron decreased | FAERS: 1 | US FAERS | |
| 71 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 72 | Cerebrospinal fluid circulation disorder | FAERS: 1 | US FAERS | |
| 73 | Chest Pain | FAERS: 1 | US FAERS | |
| 74 | Clostridium difficile infection | FAERS: 1 | US FAERS | |
| 75 | Device related infection | FAERS: 1 | US FAERS | |
| 76 | Diabetes mellitus inadequate control | FAERS: 1 | US FAERS | |
| 77 | Drug resistance | FAERS: 1 | US FAERS | |
| 78 | Dysgraphia | FAERS: 1 | US FAERS | |
| 79 | Dyspepsia | FAERS: 1 | US FAERS | |
| 80 | Epistaxis | FAERS: 1 | US FAERS | |
| 81 | Feeling abnormal | FAERS: 1 | US FAERS | |
| 82 | Fluid overload | FAERS: 1 | US FAERS | |
| 83 | Gastrointestinal Pain | FAERS: 1 | US FAERS | |
| 84 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 85 | Hospice Care | FAERS: 1 | US FAERS | |
| 86 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 87 | Injection site nodule | FAERS: 1 | US FAERS | |
| 88 | Injection site scab | FAERS: 1 | US FAERS | |
| 89 | Injection site urticaria | FAERS: 1 | US FAERS | |
| 90 | Injection site vesicles | FAERS: 1 | US FAERS | |
| 91 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 92 | Intestinal Obstruction | FAERS: 1 | US FAERS | |
| 93 | Leukopenia | FAERS: 1 | US FAERS | |
| 94 | Lip swelling | FAERS: 1 | US FAERS | |
| 95 | Malaise | FAERS: 1 | US FAERS | |
| 96 | Palliative Care | FAERS: 1 | US FAERS | |
| 97 | Pancreatitis | FAERS: 1 | US FAERS | |
| 98 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 99 | Phlebitis | FAERS: 1 | US FAERS | |
| 100 | Platelet count abnormal | FAERS: 1 | US FAERS | |
| 101 | Product physical issue | FAERS: 1 | US FAERS | |
| 102 | Product quality issue | FAERS: 1 | US FAERS | |
| 103 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 104 | Renal mass | FAERS: 1 | US FAERS | |
| 105 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 106 | Rhinalgia | FAERS: 1 | US FAERS | |
| 107 | Skin lesion | FAERS: 1 | US FAERS | |
| 108 | Stomatitis | FAERS: 1 | US FAERS | |
| 109 | Therapy cessation | FAERS: 1 | US FAERS | |
| 110 | Vertigo | FAERS: 1 | US FAERS | |
| 111 | Visual Impairment | FAERS: 1 | US FAERS | |
| 112 | White blood cell count abnormal | FAERS: 1 | US FAERS | |
| 113 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 114 | Lymphoma | 19412536 | CTD |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.