abiraterone
(GZOSMCIZMLWJML-VJLLXTKPSA-N)
Structure
- SMILES
- O[C@H]1CC[C@]2(C(=CC[C@@H]3[C@@H]2CC[C@]2([C@H]3CC=C2c2cccnc2)C)C1)C
- Type(s)
- Approved
- ATC code(s)
- L02BX03
- Molecular Formula:
- C24H31NO
- Molecular Weight:
- 349.509
- Log P:
- 5.3986
- Hydrogen Bond Acceptor:
- 2
- Hydrogen Bond Donor:
- 1
- TPSA:
- 33.12
- CAS Number(s):
- 154229-19-3
Synonym(s)
1.
abiraterone
2.
17-(3-pyridyl)androsta-5,16-dien-3beta-ol
3.
CB 7598
4.
CB-7598
5.
CB7598
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Fatigue | FAERS: 13 | SIDER US FAERS | |
| 2 | Disease Progression | FAERS: 10 | US FAERS | |
| 3 | Product substitution issue | FAERS: 10 | US FAERS | |
| 4 | Asthenia | FAERS: 7 | SIDER US FAERS | |
| 5 | Constipation | FAERS: 6 | SIDER US FAERS | |
| 6 | Drug ineffective | FAERS: 6 | US FAERS | |
| 7 | Pain | FAERS: 4 | US FAERS | |
| 8 | Therapy cessation | FAERS: 4 | US FAERS | |
| 9 | Thrombocytopenia | FAERS: 4 | US FAERS | |
| 10 | Nausea | FAERS: 3 | US FAERS | |
| 11 | Peripheral swelling | FAERS: 3 | US FAERS | |
| 12 | Product use complaint | FAERS: 3 | US FAERS | |
| 13 | Toxicity to various agents | FAERS: 3 | US FAERS | |
| 14 | Vomiting | FAERS: 3 | SIDER US FAERS | |
| 15 | Abdominal discomfort | FAERS: 2 | US FAERS | |
| 16 | Adverse event | FAERS: 2 | US FAERS | |
| 17 | Alanine Aminotransferase Increased | FAERS: 2 | SIDER US FAERS | |
| 18 | Arthralgia | FAERS: 2 | US FAERS | |
| 19 | Aspartate Aminotransferase Increased | FAERS: 2 | SIDER US FAERS | |
| 20 | Back Pain | FAERS: 2 | US FAERS | |
| 21 | Blood alkaline phosphatase increased | FAERS: 2 | SIDER US FAERS | |
| 22 | Blood potassium decreased | FAERS: 2 | SIDER US FAERS | |
| 23 | Cerebrovascular accident | FAERS: 2 | US FAERS | |
| 24 | Chest Pain | FAERS: 2 | SIDER US FAERS | |
| 25 | Hospice Care | FAERS: 2 | US FAERS | |
| 26 | Insurance issue | FAERS: 2 | US FAERS | |
| 27 | Lymphangitis | FAERS: 2 | US FAERS | |
| 28 | Prothrombin level decreased | FAERS: 2 | US FAERS | |
| 29 | Pulmonary Fibrosis | FAERS: 2 | US FAERS | |
| 30 | Swelling | FAERS: 2 | US FAERS | |
| 31 | Throat irritation | FAERS: 2 | US FAERS | |
| 32 | Urinary tract infection | FAERS: 2 | SIDER US FAERS | |
| 33 | Wrong technique in product usage process | FAERS: 2 | US FAERS | |
| 34 | jaundice | FAERS: 2 | US FAERS | |
| 35 | Acute Coronary Syndrome | FAERS: 1 | SIDER US FAERS | |
| 36 | Acute kidney injury | FAERS: 1 | US FAERS | |
| 37 | Alopecia | FAERS: 1 | US FAERS | |
| 38 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 39 | Bone pain | FAERS: 1 | US FAERS | |
| 40 | Cardiac Arrest | FAERS: 1 | US FAERS | |
| 41 | Cardiotoxicity | FAERS: 1 | US FAERS | |
| 42 | Chest discomfort | FAERS: 1 | SIDER US FAERS | |
| 43 | Chills | FAERS: 1 | US FAERS | |
| 44 | Choking | FAERS: 1 | US FAERS | |
| 45 | Deafness Neurosensory | FAERS: 1 | US FAERS | |
| 46 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 47 | Diplopia | FAERS: 1 | US FAERS | |
| 48 | Discontinued product administered | FAERS: 1 | US FAERS | |
| 49 | Disorientation | FAERS: 1 | US FAERS | |
| 50 | Diverticulitis | FAERS: 1 | US FAERS | |
| 51 | Dizziness | FAERS: 1 | US FAERS | |
| 52 | Drug level below therapeutic | FAERS: 1 | US FAERS | |
| 53 | Eczema | FAERS: 1 | US FAERS | |
| 54 | Ejection Fraction Decreased | FAERS: 1 | US FAERS | |
| 55 | Emergency Care | FAERS: 1 | US FAERS | |
| 56 | Epidural lipomatosis | FAERS: 1 | US FAERS | |
| 57 | Facial paralysis | FAERS: 1 | US FAERS | |
| 58 | Flank Pain | FAERS: 1 | US FAERS | |
| 59 | Gait inability | FAERS: 1 | US FAERS | |
| 60 | Gastric pH decreased | FAERS: 1 | US FAERS | |
| 61 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 62 | Headache | FAERS: 1 | US FAERS | |
| 63 | Hepatic Encephalopathy | FAERS: 1 | US FAERS | |
| 64 | Hepatotoxicity | FAERS: 1 | SIDER US FAERS | |
| 65 | Hydronephrosis | FAERS: 1 | US FAERS | |
| 66 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 67 | Hypotension | FAERS: 1 | US FAERS | |
| 68 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 69 | Influenza | FAERS: 1 | US FAERS | |
| 70 | Lethargy | FAERS: 1 | US FAERS | |
| 71 | Malaise | FAERS: 1 | US FAERS | |
| 72 | Meningioma | FAERS: 1 | US FAERS | |
| 73 | Mental status changes | FAERS: 1 | US FAERS | |
| 74 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 75 | Myalgia | FAERS: 1 | SIDER US FAERS | |
| 76 | Myocardial Infarction | FAERS: 1 | SIDER US FAERS | |
| 77 | Nasopharyngitis | FAERS: 1 | SIDER US FAERS | |
| 78 | Non-dipping | FAERS: 1 | US FAERS | |
| 79 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 80 | Palpitations | FAERS: 1 | US FAERS | |
| 81 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 82 | Pancreatitis | FAERS: 1 | US FAERS | |
| 83 | Pancytopenia | FAERS: 1 | US FAERS | |
| 84 | Personality Change | FAERS: 1 | US FAERS | |
| 85 | Product dose omission | FAERS: 1 | US FAERS | |
| 86 | Product size issue | FAERS: 1 | US FAERS | |
| 87 | Product use issue | FAERS: 1 | US FAERS | |
| 88 | Pruritus | FAERS: 1 | US FAERS | |
| 89 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 90 | Retching | FAERS: 1 | US FAERS | |
| 91 | Sepsis | FAERS: 1 | US FAERS | |
| 92 | Septic Shock | FAERS: 1 | US FAERS | |
| 93 | Shock | FAERS: 1 | US FAERS | |
| 94 | Sinus operation | FAERS: 1 | US FAERS | |
| 95 | Sitting disability | FAERS: 1 | US FAERS | |
| 96 | Syncope | FAERS: 1 | US FAERS | |
| 97 | Therapy change | FAERS: 1 | US FAERS | |
| 98 | Tinnitus | FAERS: 1 | US FAERS | |
| 99 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 100 | Ventricular Fibrillation | FAERS: 1 | US FAERS | |
| 101 | Blood triglycerides increased | SIDER | ||
| 102 | Dermatitis | SIDER | ||
| 103 | Discomfort | SIDER | ||
| 104 | Dyspepsia | SIDER | ||
| 105 | Fracture | SIDER | ||
| 106 | Infection | SIDER | ||
| 107 | Infectious pneumonitis | SIDER | ||
| 108 | Infestation | SIDER | ||
| 109 | Joint swelling | SIDER | ||
| 110 | Lymphopenia | SIDER | ||
| 111 | Musculoskeletal discomfort | SIDER | ||
| 112 | Nocturia | SIDER | ||
| 113 | Pneumonia | SIDER | ||
| 114 | Potassium low | SIDER | ||
| 115 | Prostatic Neoplasms, Castration-Resistant | 25062956 25908785 30185663 | CTD | |
| 116 | Prostatic Neoplasms | 24418724 25514466 | CTD | |
| 117 | Sudden death | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120237
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.