Cariprazine hydrochloride
(GPPJWWMREQHLQT-UHFFFAOYSA-N)
Structure
- SMILES
- O=C(N(C)C)NC1CCC(CC1)CCN1CCN(CC1)c1cccc(c1Cl)Cl.Cl
- Molecular Formula:
- C21H33Cl3N4O
- Molecular Weight:
- 463.872
- Log P:
- 5.5313
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 2
- TPSA:
- 38.82
- CAS Number(s):
- 1083076-69-0
Synonym(s)
1.
Cariprazine hydrochloride
External Link(s)
| PubChem Compound | 25096873 |
| ChEBI | 90932 |
| CHEMBL | CHEMBL2024517 |
| KEGG | dr:D09876 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Akathisia | FAERS: 38 | US FAERS | |
| 2 | Drug ineffective | FAERS: 26 | US FAERS | |
| 3 | Nausea | FAERS: 19 | US FAERS | |
| 4 | Tardive Dyskinesia | FAERS: 18 | US FAERS | |
| 5 | Tremor | FAERS: 15 | US FAERS | |
| 6 | Restlessness | FAERS: 14 | US FAERS | |
| 7 | Dizziness | FAERS: 13 | US FAERS | |
| 8 | Fatigue | FAERS: 12 | US FAERS | |
| 9 | Anxiety | FAERS: 10 | US FAERS | |
| 10 | Musculoskeletal stiffness | FAERS: 10 | US FAERS | |
| 11 | Somnolence | FAERS: 10 | US FAERS | |
| 12 | Drug dose omission | FAERS: 9 | US FAERS | |
| 13 | Headache | FAERS: 9 | US FAERS | |
| 14 | Vomiting | FAERS: 9 | US FAERS | |
| 15 | Agitation | FAERS: 8 | US FAERS | |
| 16 | Asthenia | FAERS: 6 | US FAERS | |
| 17 | Blepharospasm | FAERS: 6 | US FAERS | |
| 18 | Feeling abnormal | FAERS: 6 | US FAERS | |
| 19 | Inappropriate schedule of drug administration | FAERS: 6 | US FAERS | |
| 20 | Memory impairment | FAERS: 6 | US FAERS | |
| 21 | Pruritus | FAERS: 6 | US FAERS | |
| 22 | Syncope | FAERS: 6 | US FAERS | |
| 23 | Drug prescribing error | FAERS: 5 | US FAERS | |
| 24 | Myalgia | FAERS: 5 | US FAERS | |
| 25 | Dystonia | FAERS: 4 | US FAERS | |
| 26 | Malaise | FAERS: 4 | US FAERS | |
| 27 | Nervousness | FAERS: 4 | US FAERS | |
| 28 | Neuroleptic Malignant Syndrome | FAERS: 4 | US FAERS | |
| 29 | Palpitations | FAERS: 4 | US FAERS | |
| 30 | Therapeutic response unexpected | FAERS: 4 | US FAERS | |
| 31 | Urticaria | FAERS: 4 | US FAERS | |
| 32 | Constipation | FAERS: 3 | US FAERS | |
| 33 | Emotional disorder | FAERS: 3 | US FAERS | |
| 34 | Feeling jittery | FAERS: 3 | US FAERS | |
| 35 | Hypersensitivity | FAERS: 3 | US FAERS | |
| 36 | Hypersomnia | FAERS: 3 | US FAERS | |
| 37 | Hypotension | FAERS: 3 | US FAERS | |
| 38 | Impaired driving ability | FAERS: 3 | US FAERS | |
| 39 | Limb discomfort | FAERS: 3 | US FAERS | |
| 40 | Stevens-Johnson Syndrome | FAERS: 3 | US FAERS | |
| 41 | Trismus | FAERS: 3 | US FAERS | |
| 42 | White blood cell count decreased | FAERS: 3 | US FAERS | |
| 43 | Accidental exposure to product | FAERS: 2 | US FAERS | |
| 44 | Alanine Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 45 | Alopecia | FAERS: 2 | US FAERS | |
| 46 | Amnesia | FAERS: 2 | US FAERS | |
| 47 | Arthralgia | FAERS: 2 | US FAERS | |
| 48 | Cerebrovascular accident | FAERS: 2 | US FAERS | |
| 49 | Completed Suicide | FAERS: 2 | US FAERS | |
| 50 | Depressed mood | FAERS: 2 | US FAERS | |
| 51 | Drug screen positive | FAERS: 2 | US FAERS | |
| 52 | Hunger | FAERS: 2 | US FAERS | |
| 53 | Incorrect dose administered | FAERS: 2 | US FAERS | |
| 54 | Intentional dose omission | FAERS: 2 | US FAERS | |
| 55 | Intentional product misuse | FAERS: 2 | US FAERS | |
| 56 | Lethargy | FAERS: 2 | US FAERS | |
| 57 | Mental impairment | FAERS: 2 | US FAERS | |
| 58 | Muscle Rigidity | FAERS: 2 | US FAERS | |
| 59 | Muscle tightness | FAERS: 2 | US FAERS | |
| 60 | Musculoskeletal Pain | FAERS: 2 | US FAERS | |
| 61 | Mydriasis | FAERS: 2 | US FAERS | |
| 62 | Nasopharyngitis | FAERS: 2 | US FAERS | |
| 63 | Oromandibular dystonia | FAERS: 2 | US FAERS | |
| 64 | Pain | FAERS: 2 | US FAERS | |
| 65 | Peripheral swelling | FAERS: 2 | US FAERS | |
| 66 | Pregnancy | FAERS: 2 | US FAERS | |
| 67 | Restless Legs Syndrome | FAERS: 2 | US FAERS | |
| 68 | Tachyphrenia | FAERS: 2 | US FAERS | |
| 69 | Therapeutic product effective for unapproved indication | FAERS: 2 | US FAERS | |
| 70 | Vertigo | FAERS: 2 | US FAERS | |
| 71 | Visual Impairment | FAERS: 2 | US FAERS | |
| 72 | Weight decreased | FAERS: 2 | US FAERS | |
| 73 | Wrong technique in product usage process | FAERS: 2 | US FAERS | |
| 74 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 75 | Accidental exposure to product by child | FAERS: 1 | US FAERS | |
| 76 | Accidental overdose | FAERS: 1 | US FAERS | |
| 77 | Adverse event | FAERS: 1 | US FAERS | |
| 78 | Agranulocytosis | FAERS: 1 | US FAERS | |
| 79 | Alcohol interaction | FAERS: 1 | US FAERS | |
| 80 | Ammonia increased | FAERS: 1 | US FAERS | |
| 81 | Amphetamines positive | FAERS: 1 | US FAERS | |
| 82 | Anger | FAERS: 1 | US FAERS | |
| 83 | Angioedema | FAERS: 1 | US FAERS | |
| 84 | Aphonia | FAERS: 1 | US FAERS | |
| 85 | Aspartate Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 86 | Autoscopy | FAERS: 1 | US FAERS | |
| 87 | Back Pain | FAERS: 1 | US FAERS | |
| 88 | Bipolar Disorder | FAERS: 1 | US FAERS | |
| 89 | Blood aldosterone decreased | FAERS: 1 | US FAERS | |
| 90 | Blood alkaline phosphatase increased | FAERS: 1 | US FAERS | |
| 91 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 92 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 93 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 94 | Body temperature fluctuation | FAERS: 1 | US FAERS | |
| 95 | Borderline Personality Disorder | FAERS: 1 | US FAERS | |
| 96 | Cataract | FAERS: 1 | US FAERS | |
| 97 | Cerebral disorder | FAERS: 1 | US FAERS | |
| 98 | Chills | FAERS: 1 | US FAERS | |
| 99 | Compulsive shopping | FAERS: 1 | US FAERS | |
| 100 | Crying | FAERS: 1 | US FAERS | |
| 101 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 102 | Disorientation | FAERS: 1 | US FAERS | |
| 103 | Drooling | FAERS: 1 | US FAERS | |
| 104 | Drug effect variable | FAERS: 1 | US FAERS | |
| 105 | Drug titration error | FAERS: 1 | US FAERS | |
| 106 | Dysarthria | FAERS: 1 | US FAERS | |
| 107 | Dysgeusia | FAERS: 1 | US FAERS | |
| 108 | Dyspepsia | FAERS: 1 | US FAERS | |
| 109 | Encephalitis | FAERS: 1 | US FAERS | |
| 110 | Erection increased | FAERS: 1 | US FAERS | |
| 111 | Excessive eye blinking | FAERS: 1 | US FAERS | |
| 112 | Expired product administered | FAERS: 1 | US FAERS | |
| 113 | Feeling Cold | FAERS: 1 | US FAERS | |
| 114 | Fibromyalgia | FAERS: 1 | US FAERS | |
| 115 | Flushing | FAERS: 1 | US FAERS | |
| 116 | Food craving | FAERS: 1 | US FAERS | |
| 117 | Frostbite | FAERS: 1 | US FAERS | |
| 118 | Gait inability | FAERS: 1 | US FAERS | |
| 119 | Gambling | FAERS: 1 | US FAERS | |
| 120 | Gastric Dilatation | FAERS: 1 | US FAERS | |
| 121 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 122 | Homosexuality | FAERS: 1 | US FAERS | |
| 123 | Hostility | FAERS: 1 | US FAERS | |
| 124 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 125 | Hyperventilation | FAERS: 1 | US FAERS | |
| 126 | Hypomania | FAERS: 1 | US FAERS | |
| 127 | Incoherent | FAERS: 1 | US FAERS | |
| 128 | Incorrect product dosage form administered | FAERS: 1 | US FAERS | |
| 129 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 130 | Intentional product use issue | FAERS: 1 | US FAERS | |
| 131 | Intentional self-injury | FAERS: 1 | US FAERS | |
| 132 | Intrusive thoughts | FAERS: 1 | US FAERS | |
| 133 | Laceration | FAERS: 1 | US FAERS | |
| 134 | Limb injury | FAERS: 1 | US FAERS | |
| 135 | Lip swelling | FAERS: 1 | US FAERS | |
| 136 | Meningitis | FAERS: 1 | US FAERS | |
| 137 | Menorrhagia | FAERS: 1 | US FAERS | |
| 138 | Mental status changes | FAERS: 1 | US FAERS | |
| 139 | Multiple Sclerosis | FAERS: 1 | US FAERS | |
| 140 | Myoclonic Epilepsy | FAERS: 1 | US FAERS | |
| 141 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 142 | Overdose | FAERS: 1 | US FAERS | |
| 143 | Overweight | FAERS: 1 | US FAERS | |
| 144 | Paranoia | FAERS: 1 | US FAERS | |
| 145 | Pharyngeal swelling | FAERS: 1 | US FAERS | |
| 146 | Pneumothorax | FAERS: 1 | US FAERS | |
| 147 | Product dispensing error | FAERS: 1 | US FAERS | |
| 148 | Product dose omission | FAERS: 1 | US FAERS | |
| 149 | Product storage error | FAERS: 1 | US FAERS | |
| 150 | Product use issue | FAERS: 1 | US FAERS | |
| 151 | Psychiatric symptom | FAERS: 1 | US FAERS | |
| 152 | Psychogenic seizure | FAERS: 1 | US FAERS | |
| 153 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 154 | Rash erythematous | FAERS: 1 | US FAERS | |
| 155 | Retching | FAERS: 1 | US FAERS | |
| 156 | Rotator cuff syndrome | FAERS: 1 | US FAERS | |
| 157 | Sedation complication | FAERS: 1 | US FAERS | |
| 158 | Sexual Dysfunction | FAERS: 1 | US FAERS | |
| 159 | Skin tightness | FAERS: 1 | US FAERS | |
| 160 | Soliloquy | FAERS: 1 | US FAERS | |
| 161 | Somatic symptom disorder | FAERS: 1 | US FAERS | |
| 162 | Substance-induced mood disorder | FAERS: 1 | US FAERS | |
| 163 | Sudden death | FAERS: 1 | US FAERS | |
| 164 | Tachycardia | FAERS: 1 | US FAERS | |
| 165 | Tension | FAERS: 1 | US FAERS | |
| 166 | Theft | FAERS: 1 | US FAERS | |
| 167 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 168 | Tongue movement disturbance | FAERS: 1 | US FAERS | |
| 169 | Tongue spasm | FAERS: 1 | US FAERS | |
| 170 | Toothache | FAERS: 1 | US FAERS | |
| 171 | Transcription medication error | FAERS: 1 | US FAERS | |
| 172 | Unevaluable event | FAERS: 1 | US FAERS | |
| 173 | Urinary Retention | FAERS: 1 | US FAERS | |
| 174 | Urinary hesitation | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120237
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.