Butorphanol
(GMTYREVWZXJPLF-AFHUBHILSA-N)
Structure
- SMILES
- O[C@@H]([C@@H](C(=O)O)O)C(=O)O.Oc1ccc2c(c1)[C@]13CCCC[C@]3([C@@H](C2)N(CC1)CC1CCC1)O
- Molecular Formula:
- C25H35NO8
- Molecular Weight:
- 477.547
- Log P:
- 1.1809
- Hydrogen Bond Acceptor:
- 9
- Hydrogen Bond Donor:
- 6
- TPSA:
- 158.76
- CAS Number(s):
- 58786-99-5
Synonym(s)
1.
Butorphanol
2.
17-(Cyclobutylmethyl)morphinan-3,14-diol
3.
Apo-Butorphanol
4.
BC-2627
5.
Beforal
6.
Butorphanol Tartrate
7.
Dolorex
8.
Moradol
9.
Stadol
10.
Stadol NS
11.
Torbugesic
12.
BC 2627
13.
BC2627
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Dependence | FAERS: 834 | US FAERS | |
| 2 | Drug withdrawal syndrome | FAERS: 115 | US FAERS | |
| 3 | Drug addict | FAERS: 68 | US FAERS | |
| 4 | Drug ineffective | FAERS: 38 | US FAERS | |
| 5 | Nausea | FAERS: 17 | US FAERS | |
| 6 | Dizziness | FAERS: 15 | US FAERS | |
| 7 | Pregnancy | FAERS: 15 | US FAERS | |
| 8 | Drug Dependence | FAERS: 13 | US FAERS | |
| 9 | Product quality issue | FAERS: 12 | US FAERS | |
| 10 | Dysgeusia | FAERS: 11 | US FAERS | |
| 11 | Headache | FAERS: 11 | US FAERS | |
| 12 | Pruritus | FAERS: 11 | US FAERS | |
| 13 | Asthenia | FAERS: 9 | US FAERS | |
| 14 | Drug exposure during pregnancy | FAERS: 9 | US FAERS | |
| 15 | Vomiting | FAERS: 9 | US FAERS | |
| 16 | Product packaging quantity issue | FAERS: 8 | US FAERS | |
| 17 | Nasal discomfort | FAERS: 7 | US FAERS | |
| 18 | Palpitations | FAERS: 7 | US FAERS | |
| 19 | Product taste abnormal | FAERS: 7 | US FAERS | |
| 20 | Chest Pain | FAERS: 6 | US FAERS | |
| 21 | Syncope | FAERS: 6 | US FAERS | |
| 22 | Pain | FAERS: 5 | US FAERS | |
| 23 | Anxiety | FAERS: 4 | US FAERS | |
| 24 | Burning sensation | FAERS: 4 | US FAERS | |
| 25 | Pharmaceutical product complaint | FAERS: 4 | US FAERS | |
| 26 | Somnolence | FAERS: 4 | US FAERS | |
| 27 | Tremor | FAERS: 4 | US FAERS | |
| 28 | Abdominal discomfort | FAERS: 3 | US FAERS | |
| 29 | Agitation | FAERS: 3 | US FAERS | |
| 30 | Complications of maternal exposure to therapeutic drugs | FAERS: 3 | US FAERS | |
| 31 | Feeling abnormal | FAERS: 3 | US FAERS | |
| 32 | Product packaging issue | FAERS: 3 | US FAERS | |
| 33 | Respiratory Depression | FAERS: 3 | US FAERS | |
| 34 | Suicide attempt | FAERS: 3 | US FAERS | |
| 35 | Throat irritation | FAERS: 3 | US FAERS | |
| 36 | Tinnitus | FAERS: 3 | US FAERS | |
| 37 | Accidental underdose | FAERS: 2 | US FAERS | |
| 38 | Anger | FAERS: 2 | US FAERS | |
| 39 | Arthralgia | FAERS: 2 | US FAERS | |
| 40 | Bronchitis | FAERS: 2 | US FAERS | |
| 41 | Cyanosis | FAERS: 2 | US FAERS | |
| 42 | Device malfunction | FAERS: 2 | US FAERS | |
| 43 | Drug abuse | FAERS: 2 | US FAERS | |
| 44 | Drug dispensing error | FAERS: 2 | US FAERS | |
| 45 | Drug dose omission | FAERS: 2 | US FAERS | |
| 46 | Drug effect incomplete | FAERS: 2 | US FAERS | |
| 47 | Drug screen false positive | FAERS: 2 | US FAERS | |
| 48 | Emotional distress | FAERS: 2 | US FAERS | |
| 49 | Fatigue | FAERS: 2 | US FAERS | |
| 50 | Hypersensitivity | FAERS: 2 | US FAERS | |
| 51 | Hypersomnia | FAERS: 2 | US FAERS | |
| 52 | Maternal exposure during pregnancy | FAERS: 2 | US FAERS | |
| 53 | Medication Error | FAERS: 2 | US FAERS | |
| 54 | Medication residue | FAERS: 2 | US FAERS | |
| 55 | No adverse event | FAERS: 2 | US FAERS | |
| 56 | Overdose | FAERS: 2 | US FAERS | |
| 57 | Product physical issue | FAERS: 2 | US FAERS | |
| 58 | Product substitution issue | FAERS: 2 | US FAERS | |
| 59 | Respiratory distress | FAERS: 2 | US FAERS | |
| 60 | Stillbirth | FAERS: 2 | US FAERS | |
| 61 | Urticaria | FAERS: 2 | US FAERS | |
| 62 | Wrong drug administered | FAERS: 2 | US FAERS | |
| 63 | Abasia | FAERS: 1 | US FAERS | |
| 64 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 65 | Accidental exposure | FAERS: 1 | US FAERS | |
| 66 | Accidental overdose | FAERS: 1 | US FAERS | |
| 67 | Ageusia | FAERS: 1 | US FAERS | |
| 68 | Amnesia | FAERS: 1 | US FAERS | |
| 69 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 70 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 71 | Anosmia | FAERS: 1 | US FAERS | |
| 72 | Apallic syndrome | FAERS: 1 | US FAERS | |
| 73 | Asthma | FAERS: 1 | US FAERS | |
| 74 | Barbiturates positive | FAERS: 1 | US FAERS | |
| 75 | Bipolar Disorder | FAERS: 1 | US FAERS | |
| 76 | Blood pressure inadequately controlled | FAERS: 1 | US FAERS | |
| 77 | Bone pain | FAERS: 1 | US FAERS | |
| 78 | Breech Presentation | FAERS: 1 | US FAERS | |
| 79 | Cardiac Arrest | FAERS: 1 | US FAERS | |
| 80 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 81 | Chest discomfort | FAERS: 1 | US FAERS | |
| 82 | Chorioamnionitis | FAERS: 1 | US FAERS | |
| 83 | Cold sweat | FAERS: 1 | US FAERS | |
| 84 | Constipation | FAERS: 1 | US FAERS | |
| 85 | Deafness | FAERS: 1 | US FAERS | |
| 86 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 87 | Device leakage | FAERS: 1 | US FAERS | |
| 88 | Disorientation | FAERS: 1 | US FAERS | |
| 89 | Dreamy state | FAERS: 1 | US FAERS | |
| 90 | Drug abuser | FAERS: 1 | US FAERS | |
| 91 | Drug exposure via breast milk | FAERS: 1 | US FAERS | |
| 92 | Dysuria | FAERS: 1 | US FAERS | |
| 93 | Ectopic Pregnancy | FAERS: 1 | US FAERS | |
| 94 | Epistaxis | FAERS: 1 | US FAERS | |
| 95 | Erythema | FAERS: 1 | US FAERS | |
| 96 | Feeling jittery | FAERS: 1 | US FAERS | |
| 97 | Flushing | FAERS: 1 | US FAERS | |
| 98 | Forceps delivery | FAERS: 1 | US FAERS | |
| 99 | Head discomfort | FAERS: 1 | US FAERS | |
| 100 | Hyporeflexia | FAERS: 1 | US FAERS | |
| 101 | Hypotension | FAERS: 1 | US FAERS | |
| 102 | Hypoventilation | FAERS: 1 | US FAERS | |
| 103 | Incoherent | FAERS: 1 | US FAERS | |
| 104 | Incorrect dose administered by device | FAERS: 1 | US FAERS | |
| 105 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 106 | Infant | FAERS: 1 | US FAERS | |
| 107 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 108 | Juvenile arthritis | FAERS: 1 | US FAERS | |
| 109 | Medical device complication | FAERS: 1 | US FAERS | |
| 110 | Medication tampering | FAERS: 1 | US FAERS | |
| 111 | Memory impairment | FAERS: 1 | US FAERS | |
| 112 | Migraine with Aura | FAERS: 1 | US FAERS | |
| 113 | Motion Sickness | FAERS: 1 | US FAERS | |
| 114 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 115 | Mydriasis | FAERS: 1 | US FAERS | |
| 116 | Neonatal disorder | FAERS: 1 | US FAERS | |
| 117 | Neonatal respiratory arrest | FAERS: 1 | US FAERS | |
| 118 | Obesity | FAERS: 1 | US FAERS | |
| 119 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 120 | Pallor | FAERS: 1 | US FAERS | |
| 121 | Pancreatitis | FAERS: 1 | US FAERS | |
| 122 | Paraplegia | FAERS: 1 | US FAERS | |
| 123 | Personality Change | FAERS: 1 | US FAERS | |
| 124 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 125 | Product availability issue | FAERS: 1 | US FAERS | |
| 126 | Product container issue | FAERS: 1 | US FAERS | |
| 127 | Product dose omission | FAERS: 1 | US FAERS | |
| 128 | Product dropper issue | FAERS: 1 | US FAERS | |
| 129 | Product leakage | FAERS: 1 | US FAERS | |
| 130 | Product physical consistency issue | FAERS: 1 | US FAERS | |
| 131 | Product use issue | FAERS: 1 | US FAERS | |
| 132 | Restlessness | FAERS: 1 | US FAERS | |
| 133 | Retching | FAERS: 1 | US FAERS | |
| 134 | Rhinalgia | FAERS: 1 | US FAERS | |
| 135 | Rhinitis | FAERS: 1 | US FAERS | |
| 136 | Sinusitis | FAERS: 1 | US FAERS | |
| 137 | Toxicologic test abnormal | FAERS: 1 | US FAERS | |
| 138 | Trisomy 21 | FAERS: 1 | US FAERS | |
| 139 | Upper-airway cough syndrome | FAERS: 1 | US FAERS | |
| 140 | Vasodilation procedure | FAERS: 1 | US FAERS | |
| 141 | Vertigo | FAERS: 1 | US FAERS | |
| 142 | Visual disturbance | FAERS: 1 | US FAERS | |
| 143 | Weight decreased | FAERS: 1 | US FAERS | |
| 144 | Wrong dose | FAERS: 1 | US FAERS | |
| 145 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 146 | Wrong technique in product usage process | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.