Tetracaine
(GKCBAIGFKIBETG-UHFFFAOYSA-N)
Structure
- SMILES
- CCCCNc1ccc(cc1)C(=O)OCCN(C)C
- Type(s)
- Approved; Vet_approved
- ATC code(s)
- C05AD02; D04AB06; N01BA03; N01BA53; S01HA03
- Molecular Formula:
- C15H24N2O2
- Molecular Weight:
- 264.363
- Log P:
- 2.6900
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 1
- TPSA:
- 41.57
- CAS Number(s):
- 94-24-6; 136-47-0
Synonym(s)
1.
Tetracaine
2.
Tetrakain
3.
Amethocaine
4.
Ametop
5.
Dicaine
6.
Pantocaine
7.
Pontocaine
8.
Tetracaine Monohydrochloride
9.
Tetrracaine Hydrochloride
10.
Hydrochloride, Tetrracaine
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Corneal epithelium defect | FAERS: 3 | US FAERS | |
| 2 | Drug ineffective | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 3 | Prescription drug used without a prescription | FAERS: 3 | US FAERS | |
| 4 | Product quality issue | FAERS: 2 | US FAERS | |
| 5 | Blindness | FAERS: 1 | US FAERS | |
| 6 | Corneal Scar | FAERS: 1 | US FAERS | |
| 7 | Corneal decompensation | FAERS: 1 | US FAERS | |
| 8 | Corneal erosion | FAERS: 1 | US FAERS | |
| 9 | Eye Infection | FAERS: 1 | US FAERS | |
| 10 | Foreign body sensation in eyes | FAERS: 1 | US FAERS | |
| 11 | Hypersensitivity | FAERS: 1 | SIDER US FAERS | |
| 12 | Hypopyon | FAERS: 1 | US FAERS | |
| 13 | Muscle Rigidity | FAERS: 1 | US FAERS | |
| 14 | Mydriasis | FAERS: 1 | US FAERS | |
| 15 | Punctate keratitis | FAERS: 1 | US FAERS | |
| 16 | Tachycardia | FAERS: 1 | US FAERS | |
| 17 | Wrong technique in product usage process | FAERS: 1 | US FAERS | |
| 18 | Agitation | SIDER | ||
| 19 | Anaphylactic shock | Canada Vigilance: 1 | Canada Vigilance SIDER | |
| 20 | Apnea | 9836035 | CTD | |
| 21 | Arachnoiditis | SIDER | ||
| 22 | Asthenia | Canada Vigilance: 2 | Canada Vigilance | |
| 23 | Bradycardia | 9836035 16368805 | CTD | |
| 24 | Burning sensation | Canada Vigilance: 1 | Canada Vigilance | |
| 25 | Cardiac Arrest | SIDER | ||
| 26 | Chills | SIDER | ||
| 27 | Corneal stromal edema | SIDER | ||
| 28 | Cyanosis | Canada Vigilance: 3 | Canada Vigilance | |
| 29 | Dermatitis, Allergic Contact | 16778708 | CTD | |
| 30 | Descemetitis | SIDER | ||
| 31 | Dizziness | SIDER | ||
| 32 | Drowsiness | SIDER | ||
| 33 | Edema | 7508328 | CTD | |
| 34 | Hypokalemia | 900457 | CTD | |
| 35 | Hypotension | Canada Vigilance: 2 | CTD SIDER Canada Vigilance | |
| 36 | Injection site inflammation | Canada Vigilance: 1 | Canada Vigilance | |
| 37 | Iritis | SIDER | ||
| 38 | Keratitis | Canada Vigilance: 1 | 4232838 | CTD SIDER Canada Vigilance |
| 39 | Lip swelling | Canada Vigilance: 3 | Canada Vigilance | |
| 40 | Meningism | SIDER | ||
| 41 | Nausea | SIDER | ||
| 42 | Necrosis | SIDER | ||
| 43 | Nervousness | SIDER | ||
| 44 | Oropharyngeal pain | Canada Vigilance: 1 | Canada Vigilance | |
| 45 | Pain, Postoperative | 4232838 8610872 14533061 | CTD | |
| 46 | Pain | 9570604 15681958 20975464 | CTD SIDER | |
| 47 | Paresis | 900457 | CTD | |
| 48 | Polyradiculopathy | 11685003 | CTD | |
| 49 | Post lumbar puncture syndrome | SIDER | ||
| 50 | Pruritus | Canada Vigilance: 1 | Canada Vigilance | |
| 51 | Seizures | CTD | ||
| 52 | Somnolence | SIDER | ||
| 53 | Tension | SIDER | ||
| 54 | Tinnitus | SIDER | ||
| 55 | Tremor | SIDER | ||
| 56 | Urethral stricture | 8306157 | CTD | |
| 57 | Urticaria | SIDER | ||
| 58 | Vasodilation procedure | SIDER | ||
| 59 | Vasodilation | SIDER | ||
| 60 | Vomiting | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.