Tribenzor
(GIZHHWONNRGSDD-UHFFFAOYSA-N)
Structure
- SMILES
- Clc1cc2NCNS(=O)(=O)c2cc1S(=O)(=O)N.CCCc1nc(c(n1Cc1ccc(cc1)c1ccccc1c1n[nH]nn1)C(=O)OCc1oc(=O)oc1C)C(O)(C)C.NCCOCC1=C(C(=O)OCC)C(C(=C(N1)C)C(=O)OC)c1ccccc1Cl
- Molecular Formula:
- C56H63Cl2N11O15S2
- Molecular Weight:
- 1265.200
- Log P:
- 10.4428
- Hydrogen Bond Acceptor:
- 25
- Hydrogen Bond Donor:
- 7
- TPSA:
- 397.16
- CAS Number(s):
- 1394251-60-5
Synonym(s)
1.
Tribenzor
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Sprue-like enteropathy | FAERS: 53 | US FAERS | |
| 2 | Weight decreased | FAERS: 36 | US FAERS | |
| 3 | Acute kidney injury | FAERS: 20 | US FAERS | |
| 4 | Nausea | FAERS: 18 | US FAERS | |
| 5 | Abdominal Pain | FAERS: 15 | US FAERS | |
| 6 | Diverticulitis | FAERS: 15 | US FAERS | |
| 7 | Vomiting | FAERS: 15 | US FAERS | |
| 8 | Hypotension | FAERS: 13 | US FAERS | |
| 9 | Constipation | FAERS: 11 | US FAERS | |
| 10 | Dehydration | FAERS: 9 | US FAERS | |
| 11 | Diverticulum | FAERS: 9 | US FAERS | |
| 12 | Dizziness | FAERS: 8 | US FAERS | |
| 13 | Fatigue | FAERS: 8 | US FAERS | |
| 14 | Cerebrovascular accident | FAERS: 7 | US FAERS | |
| 15 | Headache | FAERS: 7 | US FAERS | |
| 16 | Gastritis | FAERS: 6 | US FAERS | |
| 17 | Irritable Bowel Syndrome | FAERS: 6 | US FAERS | |
| 18 | No adverse event | FAERS: 6 | US FAERS | |
| 19 | Cholecystitis | FAERS: 5 | US FAERS | |
| 20 | Joint swelling | FAERS: 5 | US FAERS | |
| 21 | Malaise | FAERS: 5 | US FAERS | |
| 22 | Alopecia | FAERS: 4 | US FAERS | |
| 23 | Asthenia | FAERS: 4 | US FAERS | |
| 24 | Cholelithiasis | FAERS: 4 | US FAERS | |
| 25 | Diverticular perforation | FAERS: 4 | US FAERS | |
| 26 | Drug administration error | FAERS: 4 | US FAERS | |
| 27 | Malabsorption | FAERS: 4 | US FAERS | |
| 28 | Myalgia | FAERS: 4 | US FAERS | |
| 29 | Syncope | FAERS: 4 | US FAERS | |
| 30 | Ulcer | FAERS: 4 | US FAERS | |
| 31 | Anxiety | FAERS: 3 | US FAERS | |
| 32 | Blood potassium decreased | FAERS: 3 | US FAERS | |
| 33 | Bradycardia | FAERS: 3 | US FAERS | |
| 34 | Colon adenoma | FAERS: 3 | US FAERS | |
| 35 | Drug dose omission | FAERS: 3 | US FAERS | |
| 36 | Drug ineffective | FAERS: 3 | US FAERS | |
| 37 | Flatulence | FAERS: 3 | US FAERS | |
| 38 | Myocardial Infarction | FAERS: 3 | US FAERS | |
| 39 | Peripheral swelling | FAERS: 3 | US FAERS | |
| 40 | Peritonitis | FAERS: 3 | US FAERS | |
| 41 | Rectal polyp | FAERS: 3 | US FAERS | |
| 42 | Somnolence | FAERS: 3 | US FAERS | |
| 43 | Thirst | FAERS: 3 | US FAERS | |
| 44 | Urinary tract infection | FAERS: 3 | US FAERS | |
| 45 | Blood potassium increased | FAERS: 2 | US FAERS | |
| 46 | Blood sodium decreased | FAERS: 2 | US FAERS | |
| 47 | Clostridium difficile infection | FAERS: 2 | US FAERS | |
| 48 | Flushing | FAERS: 2 | US FAERS | |
| 49 | Gastroenteritis | FAERS: 2 | US FAERS | |
| 50 | Gout | FAERS: 2 | US FAERS | |
| 51 | Hypersensitivity | FAERS: 2 | US FAERS | |
| 52 | Limb injury | FAERS: 2 | US FAERS | |
| 53 | Lip swelling | FAERS: 2 | US FAERS | |
| 54 | Memory impairment | FAERS: 2 | US FAERS | |
| 55 | Occult blood positive | FAERS: 2 | US FAERS | |
| 56 | Restlessness | FAERS: 2 | US FAERS | |
| 57 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 58 | Amnesia | FAERS: 1 | US FAERS | |
| 59 | Anuria | FAERS: 1 | US FAERS | |
| 60 | Arthralgia | FAERS: 1 | US FAERS | |
| 61 | Arthritis | FAERS: 1 | US FAERS | |
| 62 | Back Pain | FAERS: 1 | US FAERS | |
| 63 | Biliary Colic | FAERS: 1 | US FAERS | |
| 64 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 65 | Blood pressure inadequately controlled | FAERS: 1 | US FAERS | |
| 66 | Cellulitis | FAERS: 1 | US FAERS | |
| 67 | Chest Pain | FAERS: 1 | US FAERS | |
| 68 | Delirium | FAERS: 1 | US FAERS | |
| 69 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 70 | Dermatitis | FAERS: 1 | US FAERS | |
| 71 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 72 | Duodenal Ulcer | FAERS: 1 | US FAERS | |
| 73 | Duodenitis | FAERS: 1 | US FAERS | |
| 74 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 75 | Enteritis | FAERS: 1 | US FAERS | |
| 76 | Erectile dysfunction | FAERS: 1 | US FAERS | |
| 77 | Erysipelas | FAERS: 1 | US FAERS | |
| 78 | Erythema | FAERS: 1 | US FAERS | |
| 79 | Essential Hypertension | FAERS: 1 | US FAERS | |
| 80 | Gastrointestinal wall thickening | FAERS: 1 | US FAERS | |
| 81 | Impaired work ability | FAERS: 1 | US FAERS | |
| 82 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 83 | Infection | FAERS: 1 | US FAERS | |
| 84 | Intestinal Obstruction | FAERS: 1 | US FAERS | |
| 85 | Lethargy | FAERS: 1 | US FAERS | |
| 86 | Liver Abscess | FAERS: 1 | US FAERS | |
| 87 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 88 | Muscle Fatigue | FAERS: 1 | US FAERS | |
| 89 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 90 | Neck Pain | FAERS: 1 | US FAERS | |
| 91 | Nocturia | FAERS: 1 | US FAERS | |
| 92 | Ocular icterus | FAERS: 1 | US FAERS | |
| 93 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 94 | Overdose | FAERS: 1 | US FAERS | |
| 95 | Pain | FAERS: 1 | US FAERS | |
| 96 | Product administration error | FAERS: 1 | US FAERS | |
| 97 | Pruritus | FAERS: 1 | US FAERS | |
| 98 | Renal tubular necrosis | FAERS: 1 | US FAERS | |
| 99 | Sinus headache | FAERS: 1 | US FAERS | |
| 100 | Skin lesion | FAERS: 1 | US FAERS | |
| 101 | Stress | FAERS: 1 | US FAERS | |
| 102 | Swelling | FAERS: 1 | US FAERS | |
| 103 | Umbilical hernia | FAERS: 1 | US FAERS | |
| 104 | Unevaluable event | FAERS: 1 | US FAERS | |
| 105 | Urticaria | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.