1-N'-[2-[[5-[(Dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-1-N-methyl-2-nitroethene-1,1-diamine;hydron;chloride
(GGWBHVILAJZWKJ-UHFFFAOYSA-N)
Structure
- SMILES
- CNC(=C[N+](=O)[O-])NCCSCc1ccc(o1)CN(C)C.Cl
- Molecular Formula:
- C13H23ClN4O3S
- Molecular Weight:
- 350.865
- Log P:
- 3.5660
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 3
- TPSA:
- 111.56
- CAS Number(s):
- 66357-59-3; 71130-06-8
Synonym(s)
1.
1-N'-[2-[[5-[(Dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-1-N-methyl-2-nitroethene-1,1-diamine;hydron;chloride
2.
Zantac 75
External Link(s)
| PubChem Compound | 53395206 47909 |
| CHEMBL | CHEMBL2110372 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 629 | US FAERS | |
| 2 | Dyspepsia | FAERS: 114 | US FAERS | |
| 3 | Accidental overdose | FAERS: 106 | US FAERS | |
| 4 | Accidental drug intake by child | FAERS: 92 | US FAERS | |
| 5 | Dizziness | FAERS: 73 | US FAERS | |
| 6 | Vomiting | FAERS: 72 | US FAERS | |
| 7 | Nausea | FAERS: 69 | US FAERS | |
| 8 | Headache | FAERS: 65 | US FAERS | |
| 9 | Drug screen positive | FAERS: 61 | US FAERS | |
| 10 | Overdose | FAERS: 52 | US FAERS | |
| 11 | Pruritus | FAERS: 49 | US FAERS | |
| 12 | Chest Pain | FAERS: 43 | US FAERS | |
| 13 | Constipation | FAERS: 43 | US FAERS | |
| 14 | Drug screen false positive | FAERS: 40 | US FAERS | |
| 15 | Flatulence | FAERS: 40 | US FAERS | |
| 16 | Incorrect dose administered | FAERS: 38 | US FAERS | |
| 17 | Feeling abnormal | FAERS: 33 | US FAERS | |
| 18 | Urine amphetamine positive | FAERS: 33 | US FAERS | |
| 19 | Incorrect drug administration duration | FAERS: 26 | US FAERS | |
| 20 | Amphetamines positive | FAERS: 25 | US FAERS | |
| 21 | Urticaria | FAERS: 25 | US FAERS | |
| 22 | Accidental exposure | FAERS: 24 | US FAERS | |
| 23 | No adverse event | FAERS: 23 | US FAERS | |
| 24 | Dysgeusia | FAERS: 22 | US FAERS | |
| 25 | Eructation | FAERS: 22 | US FAERS | |
| 26 | Abdominal discomfort | FAERS: 20 | US FAERS | |
| 27 | Abdominal Pain | FAERS: 19 | US FAERS | |
| 28 | Musculoskeletal Pain | FAERS: 19 | US FAERS | |
| 29 | Somnolence | FAERS: 19 | US FAERS | |
| 30 | Throat irritation | FAERS: 19 | US FAERS | |
| 31 | Fatigue | FAERS: 18 | US FAERS | |
| 32 | Malaise | FAERS: 18 | US FAERS | |
| 33 | Wrong technique in drug usage process | FAERS: 17 | US FAERS | |
| 34 | Medication Error | FAERS: 16 | US FAERS | |
| 35 | Pain | FAERS: 16 | US FAERS | |
| 36 | Weight decreased | FAERS: 15 | US FAERS | |
| 37 | Back Pain | FAERS: 14 | US FAERS | |
| 38 | Unevaluable event | FAERS: 14 | US FAERS | |
| 39 | Chest discomfort | FAERS: 13 | US FAERS | |
| 40 | Oropharyngeal pain | FAERS: 13 | US FAERS | |
| 41 | Asthenia | FAERS: 12 | US FAERS | |
| 42 | Chromaturia | FAERS: 12 | US FAERS | |
| 43 | Nervousness | FAERS: 12 | US FAERS | |
| 44 | Tremor | FAERS: 12 | US FAERS | |
| 45 | Anxiety | FAERS: 10 | US FAERS | |
| 46 | Burning sensation | FAERS: 10 | US FAERS | |
| 47 | Palpitations | FAERS: 10 | US FAERS | |
| 48 | Alopecia | FAERS: 9 | US FAERS | |
| 49 | Blood glucose increased | FAERS: 9 | US FAERS | |
| 50 | Hypersensitivity | FAERS: 9 | US FAERS | |
| 51 | Erythema | FAERS: 8 | US FAERS | |
| 52 | Lip swelling | FAERS: 8 | US FAERS | |
| 53 | Arthralgia | FAERS: 7 | US FAERS | |
| 54 | Drug administration error | FAERS: 7 | US FAERS | |
| 55 | Feeling jittery | FAERS: 7 | US FAERS | |
| 56 | Inappropriate schedule of drug administration | FAERS: 7 | US FAERS | |
| 57 | Neck Pain | FAERS: 7 | US FAERS | |
| 58 | Product taste abnormal | FAERS: 7 | US FAERS | |
| 59 | Drug ineffective for unapproved indication | FAERS: 6 | US FAERS | |
| 60 | Lethargy | FAERS: 6 | US FAERS | |
| 61 | Product use issue | FAERS: 6 | US FAERS | |
| 62 | Vertigo | FAERS: 6 | US FAERS | |
| 63 | Wrong technique in product usage process | FAERS: 6 | US FAERS | |
| 64 | Adverse event | FAERS: 5 | US FAERS | |
| 65 | Drug dispensing error | FAERS: 5 | US FAERS | |
| 66 | Epistaxis | FAERS: 5 | US FAERS | |
| 67 | Erythema Multiforme | FAERS: 5 | US FAERS | |
| 68 | Extra dose administered | FAERS: 5 | US FAERS | |
| 69 | Glossitis | FAERS: 5 | US FAERS | |
| 70 | Intentional drug misuse | FAERS: 5 | US FAERS | |
| 71 | Musculoskeletal chest pain | FAERS: 5 | US FAERS | |
| 72 | Product packaging issue | FAERS: 5 | US FAERS | |
| 73 | Therapeutic response unexpected | FAERS: 5 | US FAERS | |
| 74 | Wheezing | FAERS: 5 | US FAERS | |
| 75 | Acne | FAERS: 4 | US FAERS | |
| 76 | Blood cholesterol increased | FAERS: 4 | US FAERS | |
| 77 | Chills | FAERS: 4 | US FAERS | |
| 78 | Cold sweat | FAERS: 4 | US FAERS | |
| 79 | Discomfort | FAERS: 4 | US FAERS | |
| 80 | Drug abuse | FAERS: 4 | US FAERS | |
| 81 | Dysphonia | FAERS: 4 | US FAERS | |
| 82 | Expired drug administered | FAERS: 4 | US FAERS | |
| 83 | Eye pain | FAERS: 4 | US FAERS | |
| 84 | Myalgia | FAERS: 4 | US FAERS | |
| 85 | Pharmaceutical product complaint | FAERS: 4 | US FAERS | |
| 86 | Productive Cough | FAERS: 4 | US FAERS | |
| 87 | Sneezing | FAERS: 4 | US FAERS | |
| 88 | Swelling | FAERS: 4 | US FAERS | |
| 89 | Urinary Incontinence | FAERS: 4 | US FAERS | |
| 90 | Agitation | FAERS: 3 | US FAERS | |
| 91 | Atrial Fibrillation | FAERS: 3 | US FAERS | |
| 92 | Crying | FAERS: 3 | US FAERS | |
| 93 | Disorientation | FAERS: 3 | US FAERS | |
| 94 | Drug Tolerance | FAERS: 3 | US FAERS | |
| 95 | Expired product administered | FAERS: 3 | US FAERS | |
| 96 | Feeling Cold | FAERS: 3 | US FAERS | |
| 97 | Gastrointestinal sounds abnormal | FAERS: 3 | US FAERS | |
| 98 | Laceration | FAERS: 3 | US FAERS | |
| 99 | Nasopharyngitis | FAERS: 3 | US FAERS | |
| 100 | No adverse reaction | FAERS: 3 | US FAERS | |
| 101 | Opiates positive | FAERS: 3 | US FAERS | |
| 102 | Product quality issue | FAERS: 3 | US FAERS | |
| 103 | Retching | FAERS: 3 | US FAERS | |
| 104 | Therapeutic reaction time decreased | FAERS: 3 | US FAERS | |
| 105 | Therapeutic response delayed | FAERS: 3 | US FAERS | |
| 106 | Ulcer | FAERS: 3 | US FAERS | |
| 107 | Urinary tract infection | FAERS: 3 | US FAERS | |
| 108 | Anaphylactic shock | FAERS: 2 | US FAERS | |
| 109 | Angina Pectoris | FAERS: 2 | US FAERS | |
| 110 | Anorexia | FAERS: 2 | US FAERS | |
| 111 | Arthritis | FAERS: 2 | US FAERS | |
| 112 | Cerebrovascular accident | FAERS: 2 | US FAERS | |
| 113 | Dehydration | FAERS: 2 | US FAERS | |
| 114 | Depressed mood | FAERS: 2 | US FAERS | |
| 115 | Dry skin | FAERS: 2 | US FAERS | |
| 116 | Dysuria | FAERS: 2 | US FAERS | |
| 117 | Eye irritation | FAERS: 2 | US FAERS | |
| 118 | False positive investigation result | FAERS: 2 | US FAERS | |
| 119 | False positive laboratory result | FAERS: 2 | US FAERS | |
| 120 | Flushing | FAERS: 2 | US FAERS | |
| 121 | Gastric pH decreased | FAERS: 2 | US FAERS | |
| 122 | Hyperchlorhydria | FAERS: 2 | US FAERS | |
| 123 | Increased upper airway secretion | FAERS: 2 | US FAERS | |
| 124 | Infantile spitting up | FAERS: 2 | US FAERS | |
| 125 | Laboratory test interference | FAERS: 2 | US FAERS | |
| 126 | Limb injury | FAERS: 2 | US FAERS | |
| 127 | Muscle tightness | FAERS: 2 | US FAERS | |
| 128 | Musculoskeletal discomfort | FAERS: 2 | US FAERS | |
| 129 | Nasal discomfort | FAERS: 2 | US FAERS | |
| 130 | Osteopenia | FAERS: 2 | US FAERS | |
| 131 | Product storage error | FAERS: 2 | US FAERS | |
| 132 | Product use in unapproved indication | FAERS: 2 | US FAERS | |
| 133 | Regurgitation | FAERS: 2 | US FAERS | |
| 134 | Syncope | FAERS: 2 | US FAERS | |
| 135 | Tachycardia | FAERS: 2 | US FAERS | |
| 136 | Therapeutic product effect delayed | FAERS: 2 | US FAERS | |
| 137 | Thrombosis | FAERS: 2 | US FAERS | |
| 138 | Tinnitus | FAERS: 2 | US FAERS | |
| 139 | Tooth Loss | FAERS: 2 | US FAERS | |
| 140 | Visual Impairment | FAERS: 2 | US FAERS | |
| 141 | Vulvovaginal pruritus | FAERS: 2 | US FAERS | |
| 142 | Wrong drug administered | FAERS: 2 | US FAERS | |
| 143 | Abdominal tenderness | FAERS: 1 | US FAERS | |
| 144 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 145 | Accidental exposure to product by child | FAERS: 1 | US FAERS | |
| 146 | Achlorhydria | FAERS: 1 | US FAERS | |
| 147 | Ageusia | FAERS: 1 | US FAERS | |
| 148 | Alcohol interaction | FAERS: 1 | US FAERS | |
| 149 | Allergic reaction to excipient | FAERS: 1 | US FAERS | |
| 150 | Amnesia | FAERS: 1 | US FAERS | |
| 151 | Anticoagulation drug level above therapeutic | FAERS: 1 | US FAERS | |
| 152 | Aphagia | FAERS: 1 | US FAERS | |
| 153 | Aphonia | FAERS: 1 | US FAERS | |
| 154 | Asthma | FAERS: 1 | US FAERS | |
| 155 | Bipolar Disorder | FAERS: 1 | US FAERS | |
| 156 | Bipolar I disorder | FAERS: 1 | US FAERS | |
| 157 | Bladder pain | FAERS: 1 | US FAERS | |
| 158 | Blood alcohol increased | FAERS: 1 | US FAERS | |
| 159 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 160 | Blood potassium increased | FAERS: 1 | US FAERS | |
| 161 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 162 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 163 | Blood testosterone decreased | FAERS: 1 | US FAERS | |
| 164 | Blood urine present | FAERS: 1 | US FAERS | |
| 165 | Bone pain | FAERS: 1 | US FAERS | |
| 166 | Bowel movement irregularity | FAERS: 1 | US FAERS | |
| 167 | Cardiac Arrest | FAERS: 1 | US FAERS | |
| 168 | Choking sensation | FAERS: 1 | US FAERS | |
| 169 | Choking | FAERS: 1 | US FAERS | |
| 170 | Colitis | FAERS: 1 | US FAERS | |
| 171 | Cystitis | FAERS: 1 | US FAERS | |
| 172 | Delirium | FAERS: 1 | US FAERS | |
| 173 | Dementia | FAERS: 1 | US FAERS | |
| 174 | Dermatitis | FAERS: 1 | US FAERS | |
| 175 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 176 | Drug Dependence | FAERS: 1 | US FAERS | |
| 177 | Drug effect delayed | FAERS: 1 | US FAERS | |
| 178 | Drug exposure before pregnancy | FAERS: 1 | US FAERS | |
| 179 | Drug screen negative | FAERS: 1 | US FAERS | |
| 180 | Drug withdrawal syndrome | FAERS: 1 | US FAERS | |
| 181 | Dysarthria | FAERS: 1 | US FAERS | |
| 182 | Dysgraphia | FAERS: 1 | US FAERS | |
| 183 | Ear congestion | FAERS: 1 | US FAERS | |
| 184 | Eczema | FAERS: 1 | US FAERS | |
| 185 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 186 | Enuresis | FAERS: 1 | US FAERS | |
| 187 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 188 | Erectile dysfunction | FAERS: 1 | US FAERS | |
| 189 | Formication | FAERS: 1 | US FAERS | |
| 190 | Gamma-Glutamyltransferase Increased | FAERS: 1 | US FAERS | |
| 191 | Gastritis | FAERS: 1 | US FAERS | |
| 192 | Gastroenteritis | FAERS: 1 | US FAERS | |
| 193 | Gastrointestinal Pain | FAERS: 1 | US FAERS | |
| 194 | Gingival erythema | FAERS: 1 | US FAERS | |
| 195 | Hunger | FAERS: 1 | US FAERS | |
| 196 | Hypersomnia | FAERS: 1 | US FAERS | |
| 197 | Hypomania | FAERS: 1 | US FAERS | |
| 198 | Impaired work ability | FAERS: 1 | US FAERS | |
| 199 | Inappropriate schedule of product administration | FAERS: 1 | US FAERS | |
| 200 | Incorrect drug dosage form administered | FAERS: 1 | US FAERS | |
| 201 | Influenza | FAERS: 1 | US FAERS | |
| 202 | Initial insomnia | FAERS: 1 | US FAERS | |
| 203 | Intentional self-injury | FAERS: 1 | US FAERS | |
| 204 | Intraocular pressure test abnormal | FAERS: 1 | US FAERS | |
| 205 | Labyrinthitis | FAERS: 1 | US FAERS | |
| 206 | Limb discomfort | FAERS: 1 | US FAERS | |
| 207 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 208 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 209 | Medication tampering | FAERS: 1 | US FAERS | |
| 210 | Memory impairment | FAERS: 1 | US FAERS | |
| 211 | Metrorrhagia | FAERS: 1 | US FAERS | |
| 212 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 213 | Mydriasis | FAERS: 1 | US FAERS | |
| 214 | Myocardial Infarction | FAERS: 1 | US FAERS | |
| 215 | Nasal inflammation | FAERS: 1 | US FAERS | |
| 216 | Nephrolithiasis | FAERS: 1 | US FAERS | |
| 217 | Night sweats | FAERS: 1 | US FAERS | |
| 218 | Nocturia | FAERS: 1 | US FAERS | |
| 219 | Non-cardiac chest pain | FAERS: 1 | US FAERS | |
| 220 | Nontherapeutic agent urine positive | FAERS: 1 | US FAERS | |
| 221 | Oral pain | FAERS: 1 | US FAERS | |
| 222 | Oropharyngeal blistering | FAERS: 1 | US FAERS | |
| 223 | Oropharyngeal discomfort | FAERS: 1 | US FAERS | |
| 224 | Osteoporosis | FAERS: 1 | US FAERS | |
| 225 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 226 | Pancreatitis | FAERS: 1 | US FAERS | |
| 227 | Pelvic Pain | FAERS: 1 | US FAERS | |
| 228 | Peptic Ulcer | FAERS: 1 | US FAERS | |
| 229 | Pericarditis | FAERS: 1 | US FAERS | |
| 230 | Perineal pain | FAERS: 1 | US FAERS | |
| 231 | Periodontitis | FAERS: 1 | US FAERS | |
| 232 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 233 | Petechiae | FAERS: 1 | US FAERS | |
| 234 | Pharyngolaryngeal Pain | FAERS: 1 | US FAERS | |
| 235 | Platelet count abnormal | FAERS: 1 | US FAERS | |
| 236 | Product administration error | FAERS: 1 | US FAERS | |
| 237 | Product expiration date issue | FAERS: 1 | US FAERS | |
| 238 | Product packaging difficult to open | FAERS: 1 | US FAERS | |
| 239 | Product packaging quantity issue | FAERS: 1 | US FAERS | |
| 240 | Product prescribing error | FAERS: 1 | US FAERS | |
| 241 | Product use complaint | FAERS: 1 | US FAERS | |
| 242 | Pulmonary pain | FAERS: 1 | US FAERS | |
| 243 | Rash erythematous | FAERS: 1 | US FAERS | |
| 244 | Rectal tenesmus | FAERS: 1 | US FAERS | |
| 245 | Renal cyst | FAERS: 1 | US FAERS | |
| 246 | Renal pain | FAERS: 1 | US FAERS | |
| 247 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 248 | Respiratory tract congestion | FAERS: 1 | US FAERS | |
| 249 | Rotator cuff syndrome | FAERS: 1 | US FAERS | |
| 250 | Saliva altered | FAERS: 1 | US FAERS | |
| 251 | Screaming | FAERS: 1 | US FAERS | |
| 252 | Self-induced vomiting | FAERS: 1 | US FAERS | |
| 253 | Sinusitis | FAERS: 1 | US FAERS | |
| 254 | Skin laceration | FAERS: 1 | US FAERS | |
| 255 | Skin reaction | FAERS: 1 | US FAERS | |
| 256 | Stomatitis | FAERS: 1 | US FAERS | |
| 257 | Stress | FAERS: 1 | US FAERS | |
| 258 | Suicide attempt | FAERS: 1 | US FAERS | |
| 259 | Tension | FAERS: 1 | US FAERS | |
| 260 | Therapeutic product ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 261 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 262 | Therapy partial responder | FAERS: 1 | US FAERS | |
| 263 | Thirst | FAERS: 1 | US FAERS | |
| 264 | Tongue blistering | FAERS: 1 | US FAERS | |
| 265 | Tongue spasm | FAERS: 1 | US FAERS | |
| 266 | Toxicologic test abnormal | FAERS: 1 | US FAERS | |
| 267 | Transferrin abnormal | FAERS: 1 | US FAERS | |
| 268 | Urinary sediment present | FAERS: 1 | US FAERS | |
| 269 | Urine alcohol test positive | FAERS: 1 | US FAERS | |
| 270 | Vulvovaginal burning sensation | FAERS: 1 | US FAERS | |
| 271 | Vulvovaginal discomfort | FAERS: 1 | US FAERS | |
| 272 | Vulvovaginal dryness | FAERS: 1 | US FAERS | |
| 273 | Yawning | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.