BMS-790052
(FKRSSPOQAMALKA-CUPIEXAXSA-N)
Structure
- SMILES
- COC(=O)N[C@H](C(=O)N1CCC[C@H]1c1ncc([nH]1)c1ccc(cc1)c1ccc(cc1)c1cnc([nH]1)[C@@H]1CCCN1C(=O)[C@H](C(C)C)NC(=O)OC)C(C)C
- Type(s)
- Approved; Investigational
- ATC code(s)
- J05AP07
- Molecular Formula:
- C40H50N8O6
- Molecular Weight:
- 738.875
- Log P:
- 6.8796
- Hydrogen Bond Acceptor:
- 12
- Hydrogen Bond Donor:
- 4
- TPSA:
- 174.64
- CAS Number(s):
- 1009119-64-5; 1009119-65-6; 1214735-16-6
Synonym(s)
1.
BMS-790052
2.
Daklinza
3.
daclatasvir
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Fatigue | FAERS: 149 | US FAERS | |
| 2 | Headache | FAERS: 109 | US FAERS | |
| 3 | Nausea | FAERS: 57 | US FAERS | |
| 4 | Drug dose omission | FAERS: 25 | US FAERS | |
| 5 | Dizziness | FAERS: 16 | US FAERS | |
| 6 | Abdominal discomfort | FAERS: 11 | US FAERS | |
| 7 | Asthenia | FAERS: 10 | US FAERS | |
| 8 | Myalgia | FAERS: 10 | US FAERS | |
| 9 | Pain | FAERS: 10 | US FAERS | |
| 10 | Pruritus | FAERS: 10 | US FAERS | |
| 11 | Adverse event | FAERS: 9 | US FAERS | |
| 12 | Arthralgia | FAERS: 8 | US FAERS | |
| 13 | Back Pain | FAERS: 8 | US FAERS | |
| 14 | Somnolence | FAERS: 7 | US FAERS | |
| 15 | Vomiting | FAERS: 7 | US FAERS | |
| 16 | Alopecia | FAERS: 6 | US FAERS | |
| 17 | Anxiety | FAERS: 6 | US FAERS | |
| 18 | Drug ineffective | FAERS: 5 | US FAERS | |
| 19 | Dry skin | FAERS: 5 | US FAERS | |
| 20 | Malaise | FAERS: 5 | US FAERS | |
| 21 | Weight decreased | FAERS: 5 | US FAERS | |
| 22 | Constipation | FAERS: 4 | US FAERS | |
| 23 | Dyspepsia | FAERS: 4 | US FAERS | |
| 24 | Feeling abnormal | FAERS: 4 | US FAERS | |
| 25 | Incorrect product storage | FAERS: 4 | US FAERS | |
| 26 | Memory impairment | FAERS: 4 | US FAERS | |
| 27 | Nasopharyngitis | FAERS: 4 | US FAERS | |
| 28 | Amnesia | FAERS: 3 | US FAERS | |
| 29 | Dysphonia | FAERS: 3 | US FAERS | |
| 30 | Epistaxis | FAERS: 3 | US FAERS | |
| 31 | Flatulence | FAERS: 3 | US FAERS | |
| 32 | Lethargy | FAERS: 3 | US FAERS | |
| 33 | Peripheral swelling | FAERS: 3 | US FAERS | |
| 34 | Product use issue | FAERS: 3 | US FAERS | |
| 35 | Tremor | FAERS: 3 | US FAERS | |
| 36 | Wrong technique in product usage process | FAERS: 3 | US FAERS | |
| 37 | jaundice | FAERS: 3 | US FAERS | |
| 38 | Abdominal Pain | FAERS: 2 | US FAERS | |
| 39 | Ascites | FAERS: 2 | US FAERS | |
| 40 | Bone pain | FAERS: 2 | US FAERS | |
| 41 | Chest discomfort | FAERS: 2 | US FAERS | |
| 42 | Chills | FAERS: 2 | US FAERS | |
| 43 | Depressed mood | FAERS: 2 | US FAERS | |
| 44 | Eosinophilia | FAERS: 2 | US FAERS | |
| 45 | General physical health deterioration | FAERS: 2 | US FAERS | |
| 46 | Hypersensitivity | FAERS: 2 | US FAERS | |
| 47 | Influenza | FAERS: 2 | US FAERS | |
| 48 | Medication Error | FAERS: 2 | US FAERS | |
| 49 | Mood swings | FAERS: 2 | US FAERS | |
| 50 | Overdose | FAERS: 2 | US FAERS | |
| 51 | Sepsis | FAERS: 2 | US FAERS | |
| 52 | Therapeutic response unexpected | FAERS: 2 | US FAERS | |
| 53 | Visual Impairment | FAERS: 2 | US FAERS | |
| 54 | treatment failure | FAERS: 2 | US FAERS | |
| 55 | Accidental overdose | FAERS: 1 | US FAERS | |
| 56 | Acute kidney injury | FAERS: 1 | US FAERS | |
| 57 | Ammonia increased | FAERS: 1 | US FAERS | |
| 58 | Arthritis | FAERS: 1 | US FAERS | |
| 59 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 60 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 61 | Bronchitis | FAERS: 1 | US FAERS | |
| 62 | Cataract | FAERS: 1 | US FAERS | |
| 63 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 64 | Chest Pain | FAERS: 1 | US FAERS | |
| 65 | Cholestasis | FAERS: 1 | US FAERS | |
| 66 | Chromaturia | FAERS: 1 | US FAERS | |
| 67 | Colitis | FAERS: 1 | US FAERS | |
| 68 | Crying | FAERS: 1 | US FAERS | |
| 69 | Dehydration | FAERS: 1 | US FAERS | |
| 70 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 71 | Discomfort | FAERS: 1 | US FAERS | |
| 72 | Disease recurrence | FAERS: 1 | US FAERS | |
| 73 | Drug Dependence | FAERS: 1 | US FAERS | |
| 74 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 75 | Dysgraphia | FAERS: 1 | US FAERS | |
| 76 | Dysuria | FAERS: 1 | US FAERS | |
| 77 | Emotional disorder | FAERS: 1 | US FAERS | |
| 78 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 79 | Eructation | FAERS: 1 | US FAERS | |
| 80 | Erythema | FAERS: 1 | US FAERS | |
| 81 | Eye irritation | FAERS: 1 | US FAERS | |
| 82 | Febrile Neutropenia | FAERS: 1 | US FAERS | |
| 83 | Full blood count decreased | FAERS: 1 | US FAERS | |
| 84 | Hepatomegaly | FAERS: 1 | US FAERS | |
| 85 | Hernia | FAERS: 1 | US FAERS | |
| 86 | Hypersomnia | FAERS: 1 | US FAERS | |
| 87 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 88 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 89 | Initial insomnia | FAERS: 1 | US FAERS | |
| 90 | Intestinal Perforation | FAERS: 1 | US FAERS | |
| 91 | Lactose Intolerance | FAERS: 1 | US FAERS | |
| 92 | Leukoplakia | FAERS: 1 | US FAERS | |
| 93 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 94 | Mental impairment | FAERS: 1 | US FAERS | |
| 95 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 96 | Nerve injury | FAERS: 1 | US FAERS | |
| 97 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 98 | Pancytopenia | FAERS: 1 | US FAERS | |
| 99 | Paranasal sinus discomfort | FAERS: 1 | US FAERS | |
| 100 | Pneumonia | FAERS: 1 | US FAERS | |
| 101 | Product dispensing error | FAERS: 1 | US FAERS | |
| 102 | Product packaging quantity issue | FAERS: 1 | US FAERS | |
| 103 | Product quality issue | FAERS: 1 | US FAERS | |
| 104 | Renal pain | FAERS: 1 | US FAERS | |
| 105 | Respiratory tract congestion | FAERS: 1 | US FAERS | |
| 106 | Rhabdomyolysis | FAERS: 1 | US FAERS | |
| 107 | Rheumatoid Arthritis | FAERS: 1 | US FAERS | |
| 108 | Septic Shock | FAERS: 1 | US FAERS | |
| 109 | Sinusitis | FAERS: 1 | US FAERS | |
| 110 | Stress | FAERS: 1 | US FAERS | |
| 111 | Suicide attempt | FAERS: 1 | US FAERS | |
| 112 | Swelling | FAERS: 1 | US FAERS | |
| 113 | Tachycardia | FAERS: 1 | US FAERS | |
| 114 | Throat irritation | FAERS: 1 | US FAERS | |
| 115 | Tinnitus | FAERS: 1 | US FAERS | |
| 116 | Toothache | FAERS: 1 | US FAERS | |
| 117 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 118 | Urticaria | FAERS: 1 | US FAERS | |
| 119 | Vascular rupture | FAERS: 1 | US FAERS | |
| 120 | Vitamin D Deficiency | FAERS: 1 | US FAERS | |
| 121 | Wheezing | FAERS: 1 | US FAERS | |
| 122 | colonoscopy | FAERS: 1 | US FAERS | |
| 123 | Hepatitis C, Chronic | 25987834 | CTD | |
| 124 | Hepatitis C | 25937625 | CTD |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120240
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.